diff --git a/Dockerfile b/Dockerfile new file mode 100644 index 00000000..1228fcb3 --- /dev/null +++ b/Dockerfile @@ -0,0 +1,29 @@ +# The Dockerfile for build localhost source, not git repo +FROM debian:buster as builder + +MAINTAINER cppla https://cpp.la + +RUN apt-get update -y && apt-get -y install gcc g++ make libcurl4-openssl-dev + +COPY . . + +WORKDIR /server + +RUN make -j +RUN pwd && ls -a + +# glibc env run +FROM nginx:latest + +RUN mkdir -p /ServerStatus/server/ && ln -sf /dev/null /var/log/nginx/access.log && ln -sf /dev/null /var/log/nginx/error.log + +COPY --from=builder server /ServerStatus/server/ +COPY --from=builder web /usr/share/nginx/html/ + +# china time +ENV TZ=Asia/Shanghai +RUN ln -snf /usr/share/zoneinfo/$TZ /etc/localtime && echo $TZ > /etc/timezone + +EXPOSE 80 35601 +HEALTHCHECK --interval=5s --timeout=3s --retries=3 CMD curl --fail http://localhost:80 || bash -c 'kill -s 15 -1 && (sleep 10; kill -s 9 -1)' +CMD nohup sh -c '/etc/init.d/nginx start && /ServerStatus/server/sergate --config=/ServerStatus/server/config.json --web-dir=/usr/share/nginx/html' diff --git a/README.md b/README.md index 5c9f97a7..d697ac83 100644 --- a/README.md +++ b/README.md @@ -3,139 +3,205 @@ * ServerStatus中文版是一个酷炫高逼格的云探针、云监控、服务器云监控、多服务器探针~。 * 在线演示：https://tz.cloudcpp.com -[![Build Status](https://img.shields.io/travis/otale/tale.svg?style=flat-square)](https://github.com/cppla/ServerStatus) -[![Python Support](https://img.shields.io/badge/python-2.7%2B%20-blue.svg)](https://github.com/cppla/ServerStatus) +[![Python Support](https://img.shields.io/badge/python-3.6%2B%20-blue.svg)](https://github.com/cppla/ServerStatus) [![C++ Compiler](http://img.shields.io/badge/C++-GNU-blue.svg?style=flat&logo=cplusplus)](https://github.com/cppla/ServerStatus) [![License](https://img.shields.io/badge/license-MIT-4EB1BA.svg?style=flat-square)](https://github.com/cppla/ServerStatus) +[![Version](https://img.shields.io/badge/Version-Build%201.1.5-red)](https://github.com/cppla/ServerStatus) -![Latest Version](http://dl.cpp.la/Archive/serverstatus.png) +![Latest Host Version](https://dl.cpp.la/Archive/serverstatus_1.1.5.png) -# 目录介绍： +`Watchdog触发式告警，interval只是为了防止频繁收到报警信息造成的骚扰，并不是探测间隔。值得注意的是，Exprtk库默认使用窄字符类型，中文等Unicode字符无法解析计算，等待修复。 ` -* autodeploy 自动部署. -* clients 客户端文件 -* server 服务端文件 -* web 网站文件 +# 目录： -# 更新说明： +* clients 客户端文件 +* server 服务端文件 +* web 网站文件 -* 20200629, 优化IPv6,优化前端。注意docker默认是不支持IPv6的, 如使用docker需要手动开启ipv6 -* 20200407, 网速计算不严谨，fixed -* 20190129, 降低CPU占用 -* 20181221, 增加实时到三网的延迟 -* 20181126, add tupd(tcp, udp, process ,thread) count for view ddcc attack -* 20180829, 网络情况：主机到三网(CU,CT,CM)每小时丢包率的检测 -* 20180726, 一切皆容器额,查看自动部署或autodeploy/readme -* 20180312, 加入失联(被照顾)检测【正常：MH361, 屏蔽：MH370】，校准虚拟化流量统计异常　　　　　　 -* 20170807, 更新平均1，5，15负载, 增加服务器总流量监控         +* server/config.json 探针配置文件       +* web/json 探针月流量 -# 自动部署： +# 部署： 【服务端】： ```bash -wget https://raw.githubusercontent.com/cppla/ServerStatus/master/autodeploy/config.json -docker run -d --restart=always --name=serverstatus -v {$path}/config.json:/ServerStatus/server/config.json -p {$port}:80 -p {$port}:35601 cppla/serverstatus -eg: -docker run -d --restart=always --name=serverstatus -v ~/config.json:/ServerStatus/server/config.json -p 80:80 -p 35601:35601 cppla/serverstatus +`Docker`: + +wget --no-check-certificate -qO ~/serverstatus-config.json https://raw.githubusercontent.com/cppla/ServerStatus/master/server/config.json && mkdir ~/serverstatus-monthtraffic +docker run -d --restart=always --name=serverstatus -v ~/serverstatus-config.json:/ServerStatus/server/config.json -v ~/serverstatus-monthtraffic:/usr/share/nginx/html/json -p 80:80 -p 35601:35601 cppla/serverstatus:latest + +`Docker-compose(推荐)`: docker-compose up -d ``` 【客户端】： ```bash -wget --no-check-certificate -qO client-linux.py 'https://raw.githubusercontent.com/cppla/ServerStatus/master/clients/client-linux.py' && nohup python client-linux.py SERVER={$SERVER} USER={$USER} PASSWORD={$PASSWORD} >/dev/null 2>&1 & +wget --no-check-certificate -qO client-linux.py 'https://raw.githubusercontent.com/cppla/ServerStatus/master/clients/client-linux.py' && nohup python3 client-linux.py SERVER={$SERVER} USER={$USER} PASSWORD={$PASSWORD} >/dev/null 2>&1 & eg: -wget --no-check-certificate -qO client-linux.py 'https://raw.githubusercontent.com/cppla/ServerStatus/master/clients/client-linux.py' && nohup python client-linux.py SERVER=45.79.67.132 USER=s04 >/dev/null 2>&1 & +wget --no-check-certificate -qO client-linux.py 'https://raw.githubusercontent.com/cppla/ServerStatus/master/clients/client-linux.py' && nohup python3 client-linux.py SERVER=45.79.67.132 USER=s04 >/dev/null 2>&1 & ``` +# 主题： + +* layui：https://github.com/zeyudada/StatusServerLayui ，预览：https://sslt.8zyw.cn + + +* light：https://github.com/orilights/ServerStatus-Theme-Light ，预览：https://tz.cloudcpp.com/index3.html + + + # 手动安装教程： -【克隆代码】: -``` -git clone https://github.com/cppla/ServerStatus.git -``` - -【服务端配置】（服务端程序在ServerStatus/web下）: +**【服务端配置】** -一、生成服务端程序 +#### 一、生成服务端程序 ``` -cd ServerStatus/server -make +`Debian/Ubuntu`: apt-get -y install gcc g++ make libcurl4-openssl-dev +`Centos/Redhat`: yum -y install gcc gcc-c++ make libcurl-devel + +cd ServerStatus/server && make ./sergate ``` 如果没错误提示，OK，ctrl+c关闭；如果有错误提示，检查35601端口是否被占用 -二、修改配置文件 -修改config.json文件，注意username, password的值需要和客户端对应一致     +#### 二、修改配置文件 +```diff +! watchdog rule 可以为任何已知字段的表达式。注意Exprtk库默认使用窄字符类型，中文等Unicode字符无法解析计算，等待修复 +! watchdog interval 最小通知间隔 +! watchdog callback 可自定义为Post方法的URL，告警内容将拼接其后并发起回调 + +! Telegram: https://api.telegram.org/bot你自己的密钥/sendMessage?parse_mode=HTML&disable_web_page_preview=true&chat_id=你自己的标识&text= +! Server酱: https://sctapi.ftqq.com/你自己的密钥.send?title=ServerStatus&desp= +! PushDeer: https://api2.pushdeer.com/message/push?pushkey=你自己的密钥&text= +! HttpBasicAuth: https://用户名:密码@你自己的域名/api/push?message= ``` -{"servers": + +``` +{ + "servers": [ { "username": "s01", - "name": "Mainserver 1", - "type": "Dedicated Server", - "host": "GenericServerHost123", - "location": "Austria", - "password": "some-hard-to-guess-copy-paste-password" + "name": "vps-1", + "type": "kvm", + "host": "chengdu", + "location": "🇨🇳", + "password": "USER_DEFAULT_PASSWORD", + "monthstart": 1 + } + ], + "monitors": [ + { + "name": "监测网站，默认为一天在线率", + "host": "https://www.baidu.com", + "interval": 300, + "type": "https" + }, + { + "name": "监测tcp服务端口", + "host": "114.114.114.114:53", + "interval": 300, + "type": "tcp" + } + ], + "watchdog": + [ + { + "name": "服务器负载高监控，排除内存大于32G物理机，同时排除node1机器", + "rule": "cpu>90&load_1>4&memory_total<33554432&name!='node1'", + "interval": 600, + "callback": "https://yourSMSurl" + }, + { + "name": "服务器内存使用率过高监控，排除小于1G的机器", + "rule": "(memory_used/memory_total)*100>90&memory_total>1048576", + "interval": 600, + "callback": "https://yourSMSurl" + }, + { + "name": "服务器宕机告警", + "rule": "online4=0&online6=0", + "interval": 600, + "callback": "https://yourSMSurl" + }, + { + "name": "DDOS和CC攻击监控，限制甲骨文机器", + "rule": "tcp_count>600&type='Oracle'", + "interval": 300, + "callback": "https://yourSMSurl" + }, + { + "name": "服务器月出口流量999GB告警", + "rule": "(network_out-last_network_out)/1024/1024/1024>999", + "interval": 3600, + "callback": "https://yourSMSurl" + }, + { + "name": "阿里云服务器流量18GB告警,限制username为乌兰察布", + "rule": "(network_out-last_network_out)/1024/1024/1024>18&(username='wlcb1'|username='wlcb2'|username='wlcb3'|username='wlcb4')", + "interval": 3600, + "callback": "https://yourSMSurl" }, + { + "name": "重要线路丢包率过高检查", + "rule": "(ping_10010>10|ping_189>10|ping_10086>10)&(host='sgp'|host='qqhk'|host='hk-21-x'|host='hk-31-x')", + "interval": 600, + "callback": "https://yourSMSurl" + }, + { + "name": "你可以组合任何已知字段的表达式", + "rule": "(hdd_used/hdd_total)*100>95", + "interval": 1800, + "callback": "https://yourSMSurl" + } ] } ``` -三、拷贝ServerStatus/status到你的网站目录 +#### 三、拷贝ServerStatus/status到你的网站目录 例如： ``` sudo cp -r ServerStatus/web/* /home/wwwroot/default ``` -四、运行服务端： +#### 四、运行服务端： web-dir参数为上一步设置的网站根目录，务必修改成自己网站的路径 ``` ./sergate --config=config.json --web-dir=/home/wwwroot/default ``` -【客户端配置】（客户端程序在ServerStatus/clients下）： +**【客户端配置】** + 客户端有两个版本，client-linux为普通linux，client-psutil为跨平台版，普通版不成功，换成跨平台版即可。 -一、client-linux版配置： +#### 一、client-linux版配置： 1、vim client-linux.py, 修改SERVER地址，username帐号， password密码 -2、python client-linux.py 运行即可。 +2、python3 client-linux.py 运行即可。 -二、client-psutil版配置: -1、安装psutil跨平台依赖库 -2、vim client-psutil.py, 修改SERVER地址，username帐号， password密码 -3、python client-psutil.py 运行即可。 +#### 二、client-psutil版配置: +1、安装psutil跨平台依赖库 ``` -### for Centos： -sudo yum -y install epel-release -sudo yum -y install python-pip -sudo yum clean all -sudo yum -y install gcc -sudo yum -y install python-devel -sudo pip install psutil -### for Ubuntu/Debian: -sudo root -apt-get -y install python-setuptools python-dev build-essential -apt-get -y install python-pip -pip install psutil -### for Windows: -打开网址：https://pypi.python.org/pypi?:action=display&name=psutil#downloads -下载psutil for windows程序包 -安装即可 +`Debian/Ubuntu`: apt -y install python3-pip && pip3 install psutil +`Centos/Redhat`: yum -y install python3-pip gcc python3-devel && pip3 install psutil +`Windows`: https://pypi.org/project/psutil/ ``` +2、vim client-psutil.py, 修改SERVER地址，username帐号， password密码 +3、python3 client-psutil.py 运行即可。 -打开云探针页面，就可以正常的监控。接下来把服务器和客户端脚本自行加入开机启动，或者进程守护，或以后台方式运行即可！例如： nohup python client-linux.py & +服务器和客户端自行加入开机启动，或进程守护，或后台方式运行。 例如： nohup python3 client-linux.py & -# 为什么会有ServerStatus中文版： +`extra scene (run web/ssview.py)` +![Shell View](https://dl.cpp.la/Archive/serverstatus-shell.png?version=2023) -* 有些功能确实没用 -* 原版本部署，英文说明复杂 -* 不符合中文版的习惯 -* 没有一次又一次的轮子，哪来如此优秀的云探针 -# 相关开源项目，感谢： +# Make Better -* ServerStatus：https://github.com/BotoX/ServerStatus +* BotoX：https://github.com/BotoX/ServerStatus * mojeda: https://github.com/mojeda * mojeda's ServerStatus: https://github.com/mojeda/ServerStatus * BlueVM's project: http://www.lowendtalk.com/discussion/comment/169690#Comment_169690 + +# Jetbrains + + diff --git a/autodeploy/Dockerfile b/autodeploy/Dockerfile deleted file mode 100755 index edd9d80d..00000000 --- a/autodeploy/Dockerfile +++ /dev/null @@ -1,24 +0,0 @@ -FROM debian:latest as builder - -MAINTAINER cppla https://cpp.la - -RUN apt-get update -RUN apt-get -y install gcc g++ make git -RUN git clone https://github.com/cppla/ServerStatus - -WORKDIR /ServerStatus/server - -RUN make -RUN pwd && ls -a - -# glibc env run -FROM nginx:latest - -RUN mkdir -p /ServerStatus/server/ - -COPY --from=builder /ServerStatus/server /ServerStatus/server/ -COPY --from=builder /ServerStatus/web /usr/share/nginx/html/ - -EXPOSE 80 35601 - -CMD nohup sh -c '/etc/init.d/nginx start && /ServerStatus/server/sergate --config=/ServerStatus/server/config.json --web-dir=/usr/share/nginx/html' diff --git a/autodeploy/config.json b/autodeploy/config.json deleted file mode 100755 index 5e82392c..00000000 --- a/autodeploy/config.json +++ /dev/null @@ -1,37 +0,0 @@ -{"servers": - [ - { - "username": "s01", - "name": "node1", - "type": "xen", - "host": "host1", - "location": "cn", - "password": "USER_DEFAULT_PASSWORD" - }, - { - "username": "s02", - "name": "node2", - "type": "vmware", - "host": "host2", - "location": "jp", - "password": "USER_DEFAULT_PASSWORD" - }, - { - "disabled": true, - "username": "s03", - "name": "node3", - "type": "Nothing", - "host": "host3", - "location": "fr", - "password": "USER_DEFAULT_PASSWORD" - }, - { - "username": "s04", - "name": "ssss", - "type": "ssss", - "host": "ssss", - "location": "ssss", - "password": "USER_DEFAULT_PASSWORD" - } - ] -} diff --git a/autodeploy/readme b/autodeploy/readme deleted file mode 100755 index 3e773d06..00000000 --- a/autodeploy/readme +++ /dev/null @@ -1,15 +0,0 @@ -服务端: - -docker build -f Dockerfile -t sss . -docker run -d --restart=always --name=sss -v {$path}/config.json:/ServerStatus/server/config.json -p {$port}:80 -p {$port}:35601 sss - -客户端: - -wget --no-check-certificate -qO client-linux.py 'https://raw.githubusercontent.com/cppla/ServerStatus/master/clients/client-linux.py' && nohup python client-linux.py SERVER={$SERVER} USER={$USER} PASSWORD={$PASSWORD} >/dev/null 2>&1 & - - - - - -附: docker安装 -curl -sSL https://get.docker.com/ | sh diff --git a/clients/client-linux.py b/clients/client-linux.py index 8fa8bb20..a9d5dc2a 100755 --- a/clients/client-linux.py +++ b/clients/client-linux.py @@ -1,33 +1,41 @@ -#!/usr/bin/env python +#!/usr/bin/env python3 # coding: utf-8 -# Update by : https://github.com/cppla/ServerStatus -# 支持Python版本：2.7 to 3.7 +# Update by : https://github.com/cppla/ServerStatus, Update date: 20220530 +# 版本：1.0.3, 支持Python版本：2.7 to 3.10 # 支持操作系统： Linux, OSX, FreeBSD, OpenBSD and NetBSD, both 32-bit and 64-bit architectures -# 时间: 20200407 +# ONLINE_PACKET_HISTORY_LEN， 探测间隔120s，记录24小时在线率（720）；探测时间300s，记录24小时（288）；探测间隔60s，记录7天（10080） # 说明: 默认情况下修改server和user就可以了。丢包率监测方向可以自定义，例如：CU = "www.facebook.com"。 SERVER = "127.0.0.1" USER = "s01" - -PORT = 35601 PASSWORD = "USER_DEFAULT_PASSWORD" -INTERVAL = 1 -PORBEPORT = 80 +PORT = 35601 CU = "cu.tz.cloudcpp.com" CT = "ct.tz.cloudcpp.com" CM = "cm.tz.cloudcpp.com" +PROBEPORT = 80 +PROBE_PROTOCOL_PREFER = "ipv4" # ipv4, ipv6 +PING_PACKET_HISTORY_LEN = 100 +ONLINE_PACKET_HISTORY_LEN = 288 +INTERVAL = 1 import socket +import ssl import time import timeit import re import os import sys import json +import errno import subprocess import threading +if sys.version_info.major == 3: + from queue import Queue +elif sys.version_info.major == 2: + from Queue import Queue def get_uptime(): with open('/proc/uptime', 'r') as f: @@ -112,18 +120,6 @@ def tupd(): d = int(s[:-1])-2 return t,u,p,d -def ip_status(): - ip_check = 0 - for i in [CU, CT, CM]: - try: - socket.create_connection((i, PORBEPORT), timeout=1).close() - except: - ip_check += 1 - if ip_check >= 2: - return False - else: - return True - def get_network(ip_version): if(ip_version == 4): HOST = "ipv4.google.com" @@ -153,30 +149,47 @@ def get_network(ip_version): 'avgrx': 0, 'avgtx': 0 } +diskIO = { + 'read': 0, + 'write': 0 +} +monitorServer = {} def _ping_thread(host, mark, port): lostPacket = 0 - allPacket = 0 - startTime = time.time() + packet_queue = Queue(maxsize=PING_PACKET_HISTORY_LEN) while True: + # flush dns , every time. + IP = host + if host.count(':') < 1: # if not plain ipv6 address, means ipv4 address or hostname + try: + if PROBE_PROTOCOL_PREFER == 'ipv4': + IP = socket.getaddrinfo(host, None, socket.AF_INET)[0][4][0] + else: + IP = socket.getaddrinfo(host, None, socket.AF_INET6)[0][4][0] + except Exception: + pass + + if packet_queue.full(): + if packet_queue.get() == 0: + lostPacket -= 1 try: b = timeit.default_timer() - socket.create_connection((host, port), timeout=1).close() - pingTime[mark] = int((timeit.default_timer()-b)*1000) - except: - lostPacket += 1 - finally: - allPacket += 1 - - if allPacket > 100: - lostRate[mark] = float(lostPacket) / allPacket + socket.create_connection((IP, port), timeout=1).close() + pingTime[mark] = int((timeit.default_timer() - b) * 1000) + packet_queue.put(1) + except socket.error as error: + if error.errno == errno.ECONNREFUSED: + pingTime[mark] = int((timeit.default_timer() - b) * 1000) + packet_queue.put(1) + #elif error.errno == errno.ETIMEDOUT: + else: + lostPacket += 1 + packet_queue.put(0) - endTime = time.time() - if endTime - startTime > 3600: - lostPacket = 0 - allPacket = 0 - startTime = endTime + if packet_queue.qsize() > 30: + lostRate[mark] = float(lostPacket) / packet_queue.qsize() time.sleep(INTERVAL) @@ -205,13 +218,78 @@ def _net_speed(): netSpeed["avgtx"] = avgtx time.sleep(INTERVAL) -def get_realtime_date(): +def _disk_io(): + ''' + good luck for opensource! by: cpp.la + 磁盘IO：因为IOPS原因，SSD和HDD、包括RAID卡，ZFS等阵列技术。IO对性能的影响还需要结合自身服务器情况来判断。 + 比如我这里是机械硬盘，大量做随机小文件读写，那么很低的读写也就能造成硬盘长时间的等待。 + 如果这里做连续性IO，那么普通机械硬盘写入到100Mb/s，那么也能造成硬盘长时间的等待。 + 磁盘读写有误差：4k，8k ，https://stackoverflow.com/questions/34413926/psutil-vs-dd-monitoring-disk-i-o + :return: + ''' + while True: + # pre pid snapshot + snapshot_first = {} + # next pid snapshot + snapshot_second = {} + # read count snapshot + snapshot_read = 0 + # write count snapshot + snapshot_write = 0 + # process snapshot + pid_snapshot = [str(i) for i in os.listdir("/proc") if i.isdigit() is True] + for pid in pid_snapshot: + try: + with open("/proc/{}/io".format(pid)) as f: + pid_io = {} + for line in f.readlines(): + if "read_bytes" in line: + pid_io["read"] = int(line.split("read_bytes:")[-1].strip()) + elif "write_bytes" in line and "cancelled_write_bytes" not in line: + pid_io["write"] = int(line.split("write_bytes:")[-1].strip()) + pid_io["name"] = open("/proc/{}/comm".format(pid), "r").read().strip() + snapshot_first[pid] = pid_io + except: + if pid in snapshot_first: + snapshot_first.pop(pid) + + time.sleep(INTERVAL) + + for pid in pid_snapshot: + try: + with open("/proc/{}/io".format(pid)) as f: + pid_io = {} + for line in f.readlines(): + if "read_bytes" in line: + pid_io["read"] = int(line.split("read_bytes:")[-1].strip()) + elif "write_bytes" in line and "cancelled_write_bytes" not in line: + pid_io["write"] = int(line.split("write_bytes:")[-1].strip()) + pid_io["name"] = open("/proc/{}/comm".format(pid), "r").read().strip() + snapshot_second[pid] = pid_io + except: + if pid in snapshot_first: + snapshot_first.pop(pid) + if pid in snapshot_second: + snapshot_second.pop(pid) + + for k, v in snapshot_first.items(): + if snapshot_first[k]["name"] == snapshot_second[k]["name"] and snapshot_first[k]["name"] != "bash": + snapshot_read += (snapshot_second[k]["read"] - snapshot_first[k]["read"]) + snapshot_write += (snapshot_second[k]["write"] - snapshot_first[k]["write"]) + diskIO["read"] = snapshot_read + diskIO["write"] = snapshot_write + +def get_realtime_data(): + ''' + real time get system data + :return: + ''' t1 = threading.Thread( target=_ping_thread, kwargs={ 'host': CU, 'mark': '10010', - 'port': PORBEPORT + 'port': PROBEPORT } ) t2 = threading.Thread( @@ -219,7 +297,7 @@ def get_realtime_date(): kwargs={ 'host': CT, 'mark': '189', - 'port': PORBEPORT + 'port': PROBEPORT } ) t3 = threading.Thread( @@ -227,20 +305,103 @@ def get_realtime_date(): kwargs={ 'host': CM, 'mark': '10086', - 'port': PORBEPORT + 'port': PROBEPORT } ) t4 = threading.Thread( target=_net_speed, ) - t1.setDaemon(True) - t2.setDaemon(True) - t3.setDaemon(True) - t4.setDaemon(True) - t1.start() - t2.start() - t3.start() - t4.start() + t5 = threading.Thread( + target=_disk_io, + ) + for ti in [t1, t2, t3, t4, t5]: + ti.daemon = True + ti.start() + + +def _monitor_thread(name, host, interval, type): + lostPacket = 0 + packet_queue = Queue(maxsize=ONLINE_PACKET_HISTORY_LEN) + while True: + if name not in monitorServer.keys(): + break + if packet_queue.full(): + if packet_queue.get() == 0: + lostPacket -= 1 + try: + if type == "http": + address = host.replace("http://", "") + m = timeit.default_timer() + if PROBE_PROTOCOL_PREFER == 'ipv4': + IP = socket.getaddrinfo(address, None, socket.AF_INET)[0][4][0] + else: + IP = socket.getaddrinfo(address, None, socket.AF_INET6)[0][4][0] + monitorServer[name]["dns_time"] = int((timeit.default_timer() - m) * 1000) + m = timeit.default_timer() + k = socket.create_connection((IP, 80), timeout=6) + monitorServer[name]["connect_time"] = int((timeit.default_timer() - m) * 1000) + m = timeit.default_timer() + k.sendall("GET / HTTP/1.2\r\nHost:{}\r\nUser-Agent:ServerStatus/cppla\r\nConnection:close\r\n\r\n".format(address).encode('utf-8')) + response = b"" + while True: + data = k.recv(4096) + if not data: + break + response += data + http_code = response.decode('utf-8').split('\r\n')[0].split()[1] + monitorServer[name]["download_time"] = int((timeit.default_timer() - m) * 1000) + k.close() + if http_code not in ['200', '204', '301', '302', '401']: + raise Exception("http code not in 200, 204, 301, 302, 401") + elif type == "https": + context = ssl._create_unverified_context() + address = host.replace("https://", "") + m = timeit.default_timer() + if PROBE_PROTOCOL_PREFER == 'ipv4': + IP = socket.getaddrinfo(address, None, socket.AF_INET)[0][4][0] + else: + IP = socket.getaddrinfo(address, None, socket.AF_INET6)[0][4][0] + monitorServer[name]["dns_time"] = int((timeit.default_timer() - m) * 1000) + m = timeit.default_timer() + k = socket.create_connection((IP, 443), timeout=6) + monitorServer[name]["connect_time"] = int((timeit.default_timer() - m) * 1000) + m = timeit.default_timer() + kk = context.wrap_socket(k, server_hostname=address) + kk.sendall("GET / HTTP/1.2\r\nHost:{}\r\nUser-Agent:ServerStatus/cppla\r\nConnection:close\r\n\r\n".format(address).encode('utf-8')) + response = b"" + while True: + data = kk.recv(4096) + if not data: + break + response += data + http_code = response.decode('utf-8').split('\r\n')[0].split()[1] + monitorServer[name]["download_time"] = int((timeit.default_timer() - m) * 1000) + kk.close() + k.close() + if http_code not in ['200', '204', '301', '302', '401']: + raise Exception("http code not in 200, 204, 301, 302, 401") + elif type == "tcp": + m = timeit.default_timer() + if PROBE_PROTOCOL_PREFER == 'ipv4': + IP = socket.getaddrinfo(host.split(":")[0], None, socket.AF_INET)[0][4][0] + else: + IP = socket.getaddrinfo(host.split(":")[0], None, socket.AF_INET6)[0][4][0] + monitorServer[name]["dns_time"] = int((timeit.default_timer() - m) * 1000) + m = timeit.default_timer() + k = socket.create_connection((IP, int(host.split(":")[1])), timeout=6) + monitorServer[name]["connect_time"] = int((timeit.default_timer() - m) * 1000) + m = timeit.default_timer() + k.send(b"GET / HTTP/1.2\r\n\r\n") + k.recv(1024) + monitorServer[name]["download_time"] = int((timeit.default_timer() - m) * 1000) + k.close() + packet_queue.put(1) + except Exception as e: + lostPacket += 1 + packet_queue.put(0) + if packet_queue.qsize() > 5: + monitorServer[name]["online_rate"] = 1 - float(lostPacket) / packet_queue.qsize() + time.sleep(interval) def byte_str(object): ''' @@ -268,7 +429,7 @@ def byte_str(object): elif 'INTERVAL' in argc: INTERVAL = int(argc.split('INTERVAL=')[-1]) socket.setdefaulttimeout(30) - get_realtime_date() + get_realtime_data() while True: try: print("Connecting...") @@ -288,6 +449,28 @@ def byte_str(object): if data.find("You are connecting via") < 0: data = byte_str(s.recv(1024)) print(data) + monitorServer.clear() + for i in data.split('\n'): + if "monitor" in i and "type" in i and "{" in i and "}" in i: + jdata = json.loads(i[i.find("{"):i.find("}")+1]) + monitorServer[jdata.get("name")] = { + "type": jdata.get("type"), + "dns_time": 0, + "connect_time": 0, + "download_time": 0, + "online_rate": 1 + } + t = threading.Thread( + target=_monitor_thread, + kwargs={ + 'name': jdata.get("name"), + 'host': jdata.get("host"), + 'interval': jdata.get("interval"), + 'type': jdata.get("type") + } + ) + t.daemon = True + t.start() timer = 0 check_ip = 0 @@ -306,8 +489,6 @@ def byte_str(object): Load_1, Load_5, Load_15 = os.getloadavg() MemoryTotal, MemoryUsed, SwapTotal, SwapFree = get_memory() HDDTotal, HDDUsed = get_hdd() - IP_STATUS = ip_status() - array = {} if not timer: array['online' + str(check_ip)] = get_network(check_ip) @@ -330,7 +511,6 @@ def byte_str(object): array['network_tx'] = netSpeed.get("nettx") array['network_in'] = NET_IN array['network_out'] = NET_OUT - array['ip_status'] = IP_STATUS array['ping_10010'] = lostRate.get('10010') * 100 array['ping_189'] = lostRate.get('189') * 100 array['ping_10086'] = lostRate.get('10086') * 100 @@ -338,16 +518,20 @@ def byte_str(object): array['time_189'] = pingTime.get('189') array['time_10086'] = pingTime.get('10086') array['tcp'], array['udp'], array['process'], array['thread'] = tupd() - + array['io_read'] = diskIO.get("read") + array['io_write'] = diskIO.get("write") + array['custom'] = "
".join(f"{k}\\t解析: {v['dns_time']}\\t连接: {v['connect_time']}\\t下载: {v['download_time']}\\t在线率: {v['online_rate']*100:.1f}%" for k, v in monitorServer.items()) s.send(byte_str("update " + json.dumps(array) + "\n")) except KeyboardInterrupt: raise except socket.error: + monitorServer.clear() print("Disconnected...") if 's' in locals().keys(): del s time.sleep(3) except Exception as e: + monitorServer.clear() print("Caught Exception:", e) if 's' in locals().keys(): del s diff --git a/clients/client-psutil.py b/clients/client-psutil.py index 799ce56f..d3038095 100755 --- a/clients/client-psutil.py +++ b/clients/client-psutil.py @@ -1,33 +1,41 @@ -#!/usr/bin/env python +#!/usr/bin/env python3 # coding: utf-8 -# Update by : https://github.com/cppla/ServerStatus +# Update by : https://github.com/cppla/ServerStatus, Update date: 20220530 # 依赖于psutil跨平台库 -# 支持Python版本：2.7 to 3.7 +# 版本：1.0.3, 支持Python版本：2.7 to 3.10 # 支持操作系统： Linux, Windows, OSX, Sun Solaris, FreeBSD, OpenBSD and NetBSD, both 32-bit and 64-bit architectures -# 时间： 20200407 +# ONLINE_PACKET_HISTORY_LEN， 探测间隔120s，记录24小时在线率（720）；探测时间300s，记录24小时（288）；探测间隔60s，记录7天（10080） # 说明: 默认情况下修改server和user就可以了。丢包率监测方向可以自定义，例如：CU = "www.facebook.com"。 SERVER = "127.0.0.1" USER = "s01" - -PORT = 35601 PASSWORD = "USER_DEFAULT_PASSWORD" -INTERVAL = 1 -PORBEPORT = 80 +PORT = 35601 CU = "cu.tz.cloudcpp.com" CT = "ct.tz.cloudcpp.com" CM = "cm.tz.cloudcpp.com" +PROBEPORT = 80 +PROBE_PROTOCOL_PREFER = "ipv4" # ipv4, ipv6 +PING_PACKET_HISTORY_LEN = 100 +ONLINE_PACKET_HISTORY_LEN = 288 +INTERVAL = 1 import socket +import ssl import time import timeit import os +import sys import json +import errno import psutil -import sys import threading +if sys.version_info.major == 3: + from queue import Queue +elif sys.version_info.major == 2: + from Queue import Queue def get_uptime(): return int(time.time() - psutil.boot_time()) @@ -41,18 +49,22 @@ def get_swap(): return int(Mem.total/1024.0), int(Mem.used/1024.0) def get_hdd(): - valid_fs = [ "ext4", "ext3", "ext2", "reiserfs", "jfs", "btrfs", "fuseblk", "zfs", "simfs", "ntfs", "fat32", "exfat", "xfs" ] - disks = dict() - size = 0 - used = 0 - for disk in psutil.disk_partitions(): - if not disk.device in disks and disk.fstype.lower() in valid_fs: - disks[disk.device] = disk.mountpoint - for disk in disks.values(): - usage = psutil.disk_usage(disk) - size += usage.total - used += usage.used - return int(size/1024.0/1024.0), int(used/1024.0/1024.0) + if "darwin" in sys.platform: + return int(psutil.disk_usage("/").total/1024.0/1024.0), int((psutil.disk_usage("/").total-psutil.disk_usage("/").free)/1024.0/1024.0) + else: + valid_fs = ["ext4", "ext3", "ext2", "reiserfs", "jfs", "btrfs", "fuseblk", "zfs", "simfs", "ntfs", "fat32", + "exfat", "xfs"] + disks = dict() + size = 0 + used = 0 + for disk in psutil.disk_partitions(): + if not disk.device in disks and disk.fstype.lower() in valid_fs: + disks[disk.device] = disk.mountpoint + for disk in disks.values(): + usage = psutil.disk_usage(disk) + size += usage.total + used += usage.used + return int(size/1024.0/1024.0), int(used/1024.0/1024.0) def get_cpu(): return psutil.cpu_percent(interval=INTERVAL) @@ -83,31 +95,29 @@ def tupd(): u = int(os.popen('ss -u|wc -l').read()[:-1])-1 p = int(os.popen('ps -ef|wc -l').read()[:-1])-2 d = int(os.popen('ps -eLf|wc -l').read()[:-1])-2 + elif sys.platform.startswith("darwin") is True: + t = int(os.popen('lsof -nP -iTCP | wc -l').read()[:-1]) - 1 + u = int(os.popen('lsof -nP -iUDP | wc -l').read()[:-1]) - 1 + p = len(psutil.pids()) + d = 0 + for k in psutil.pids(): + try: + d += psutil.Process(k).num_threads() + except: + pass + elif sys.platform.startswith("win") is True: t = int(os.popen('netstat -an|find "TCP" /c').read()[:-1])-1 u = int(os.popen('netstat -an|find "UDP" /c').read()[:-1])-1 p = len(psutil.pids()) - d = 0 - # cpu is high, default: 0 - # d = sum([psutil.Process(k).num_threads() for k in [x for x in psutil.pids()]]) + # if you find cpu is high, please set d=0 + d = sum([psutil.Process(k).num_threads() for k in psutil.pids()]) else: t,u,p,d = 0,0,0,0 return t,u,p,d except: return 0,0,0,0 -def ip_status(): - ip_check = 0 - for i in [CU, CT, CM]: - try: - socket.create_connection((i, PORBEPORT), timeout=1).close() - except: - ip_check += 1 - if ip_check >= 2: - return False - else: - return True - def get_network(ip_version): if(ip_version == 4): HOST = "ipv4.google.com" @@ -137,30 +147,47 @@ def get_network(ip_version): 'avgrx': 0, 'avgtx': 0 } +diskIO = { + 'read': 0, + 'write': 0 +} +monitorServer = {} def _ping_thread(host, mark, port): lostPacket = 0 - allPacket = 0 - startTime = time.time() + packet_queue = Queue(maxsize=PING_PACKET_HISTORY_LEN) while True: + # flush dns, every time. + IP = host + if host.count(':') < 1: # if not plain ipv6 address, means ipv4 address or hostname + try: + if PROBE_PROTOCOL_PREFER == 'ipv4': + IP = socket.getaddrinfo(host, None, socket.AF_INET)[0][4][0] + else: + IP = socket.getaddrinfo(host, None, socket.AF_INET6)[0][4][0] + except Exception: + pass + + if packet_queue.full(): + if packet_queue.get() == 0: + lostPacket -= 1 try: b = timeit.default_timer() - socket.create_connection((host, port), timeout=1).close() + socket.create_connection((IP, port), timeout=1).close() pingTime[mark] = int((timeit.default_timer() - b) * 1000) - except: - lostPacket += 1 - finally: - allPacket += 1 - - if allPacket > 100: - lostRate[mark] = float(lostPacket) / allPacket + packet_queue.put(1) + except socket.error as error: + if error.errno == errno.ECONNREFUSED: + pingTime[mark] = int((timeit.default_timer() - b) * 1000) + packet_queue.put(1) + #elif error.errno == errno.ETIMEDOUT: + else: + lostPacket += 1 + packet_queue.put(0) - endTime = time.time() - if endTime - startTime > 3600: - lostPacket = 0 - allPacket = 0 - startTime = endTime + if packet_queue.qsize() > 30: + lostRate[mark] = float(lostPacket) / packet_queue.qsize() time.sleep(INTERVAL) @@ -185,13 +212,73 @@ def _net_speed(): netSpeed["avgtx"] = avgtx time.sleep(INTERVAL) -def get_realtime_date(): +def _disk_io(): + """ + the code is by: https://github.com/giampaolo/psutil/blob/master/scripts/iotop.py + good luck for opensource! modify: cpp.la + Calculate IO usage by comparing IO statics before and + after the interval. + Return a tuple including all currently running processes + sorted by IO activity and total disks I/O activity. + 磁盘IO：因为IOPS原因，SSD和HDD、包括RAID卡，ZFS等。IO对性能的影响还需要结合自身服务器情况来判断。 + 比如我这里是机械硬盘，大量做随机小文件读写，那么很低的读写也就能造成硬盘长时间的等待。 + 如果这里做连续性IO，那么普通机械硬盘写入到100Mb/s，那么也能造成硬盘长时间的等待。 + 磁盘读写有误差：4k，8k ，https://stackoverflow.com/questions/34413926/psutil-vs-dd-monitoring-disk-i-o + macos/win，暂不处理。 + """ + if "darwin" in sys.platform or "win" in sys.platform: + diskIO["read"] = 0 + diskIO["write"] = 0 + else: + while True: + # first get a list of all processes and disk io counters + procs = [p for p in psutil.process_iter()] + for p in procs[:]: + try: + p._before = p.io_counters() + except psutil.Error: + procs.remove(p) + continue + disks_before = psutil.disk_io_counters() + + # sleep some time, only when INTERVAL==1 , io read/write per_sec. + # when INTERVAL > 1, io read/write per_INTERVAL + time.sleep(INTERVAL) + + # then retrieve the same info again + for p in procs[:]: + with p.oneshot(): + try: + p._after = p.io_counters() + p._cmdline = ' '.join(p.cmdline()) + if not p._cmdline: + p._cmdline = p.name() + p._username = p.username() + except (psutil.NoSuchProcess, psutil.ZombieProcess): + procs.remove(p) + disks_after = psutil.disk_io_counters() + + # finally calculate results by comparing data before and + # after the interval + for p in procs: + p._read_per_sec = p._after.read_bytes - p._before.read_bytes + p._write_per_sec = p._after.write_bytes - p._before.write_bytes + p._total = p._read_per_sec + p._write_per_sec + + diskIO["read"] = disks_after.read_bytes - disks_before.read_bytes + diskIO["write"] = disks_after.write_bytes - disks_before.write_bytes + +def get_realtime_data(): + ''' + real time get system data + :return: + ''' t1 = threading.Thread( target=_ping_thread, kwargs={ 'host': CU, 'mark': '10010', - 'port': PORBEPORT + 'port': PROBEPORT } ) t2 = threading.Thread( @@ -199,7 +286,7 @@ def get_realtime_date(): kwargs={ 'host': CT, 'mark': '189', - 'port': PORBEPORT + 'port': PROBEPORT } ) t3 = threading.Thread( @@ -207,20 +294,103 @@ def get_realtime_date(): kwargs={ 'host': CM, 'mark': '10086', - 'port': PORBEPORT + 'port': PROBEPORT } ) t4 = threading.Thread( target=_net_speed, ) - t1.setDaemon(True) - t2.setDaemon(True) - t3.setDaemon(True) - t4.setDaemon(True) - t1.start() - t2.start() - t3.start() - t4.start() + t5 = threading.Thread( + target=_disk_io, + ) + for ti in [t1, t2, t3, t4, t5]: + ti.daemon = True + ti.start() + +def _monitor_thread(name, host, interval, type): + lostPacket = 0 + packet_queue = Queue(maxsize=ONLINE_PACKET_HISTORY_LEN) + while True: + if name not in monitorServer.keys(): + break + if packet_queue.full(): + if packet_queue.get() == 0: + lostPacket -= 1 + try: + if type == "http": + address = host.replace("http://", "") + m = timeit.default_timer() + if PROBE_PROTOCOL_PREFER == 'ipv4': + IP = socket.getaddrinfo(address, None, socket.AF_INET)[0][4][0] + else: + IP = socket.getaddrinfo(address, None, socket.AF_INET6)[0][4][0] + monitorServer[name]["dns_time"] = int((timeit.default_timer() - m) * 1000) + m = timeit.default_timer() + k = socket.create_connection((IP, 80), timeout=6) + monitorServer[name]["connect_time"] = int((timeit.default_timer() - m) * 1000) + m = timeit.default_timer() + k.sendall("GET / HTTP/1.2\r\nHost:{}\r\nUser-Agent:ServerStatus/cppla\r\nConnection:close\r\n\r\n".format(address).encode('utf-8')) + response = b"" + while True: + data = k.recv(4096) + if not data: + break + response += data + http_code = response.decode('utf-8').split('\r\n')[0].split()[1] + monitorServer[name]["download_time"] = int((timeit.default_timer() - m) * 1000) + k.close() + if http_code not in ['200', '204', '301', '302', '401']: + raise Exception("http code not in 200, 204, 301, 302, 401") + elif type == "https": + context = ssl._create_unverified_context() + address = host.replace("https://", "") + m = timeit.default_timer() + if PROBE_PROTOCOL_PREFER == 'ipv4': + IP = socket.getaddrinfo(address, None, socket.AF_INET)[0][4][0] + else: + IP = socket.getaddrinfo(address, None, socket.AF_INET6)[0][4][0] + monitorServer[name]["dns_time"] = int((timeit.default_timer() - m) * 1000) + m = timeit.default_timer() + k = socket.create_connection((IP, 443), timeout=6) + monitorServer[name]["connect_time"] = int((timeit.default_timer() - m) * 1000) + m = timeit.default_timer() + kk = context.wrap_socket(k, server_hostname=address) + kk.sendall("GET / HTTP/1.2\r\nHost:{}\r\nUser-Agent:ServerStatus/cppla\r\nConnection:close\r\n\r\n".format(address).encode('utf-8')) + response = b"" + while True: + data = kk.recv(4096) + if not data: + break + response += data + http_code = response.decode('utf-8').split('\r\n')[0].split()[1] + monitorServer[name]["download_time"] = int((timeit.default_timer() - m) * 1000) + kk.close() + k.close() + if http_code not in ['200', '204', '301', '302', '401']: + raise Exception("http code not in 200, 204, 301, 302, 401") + elif type == "tcp": + m = timeit.default_timer() + if PROBE_PROTOCOL_PREFER == 'ipv4': + IP = socket.getaddrinfo(host.split(":")[0], None, socket.AF_INET)[0][4][0] + else: + IP = socket.getaddrinfo(host.split(":")[0], None, socket.AF_INET6)[0][4][0] + monitorServer[name]["dns_time"] = int((timeit.default_timer() - m) * 1000) + m = timeit.default_timer() + k = socket.create_connection((IP, int(host.split(":")[1])), timeout=6) + monitorServer[name]["connect_time"] = int((timeit.default_timer() - m) * 1000) + m = timeit.default_timer() + k.send(b"GET / HTTP/1.2\r\n\r\n") + k.recv(1024) + monitorServer[name]["download_time"] = int((timeit.default_timer() - m) * 1000) + k.close() + packet_queue.put(1) + except Exception as e: + lostPacket += 1 + packet_queue.put(0) + if packet_queue.qsize() > 5: + monitorServer[name]["online_rate"] = 1 - float(lostPacket) / packet_queue.qsize() + time.sleep(interval) + def byte_str(object): ''' @@ -248,7 +418,7 @@ def byte_str(object): elif 'INTERVAL' in argc: INTERVAL = int(argc.split('INTERVAL=')[-1]) socket.setdefaulttimeout(30) - get_realtime_date() + get_realtime_data() while 1: try: print("Connecting...") @@ -268,6 +438,27 @@ def byte_str(object): if data.find("You are connecting via") < 0: data = byte_str(s.recv(1024)) print(data) + for i in data.split('\n'): + if "monitor" in i and "type" in i and "{" in i and "}" in i: + jdata = json.loads(i[i.find("{"):i.find("}")+1]) + monitorServer[jdata.get("name")] = { + "type": jdata.get("type"), + "dns_time": 0, + "connect_time": 0, + "download_time": 0, + "online_rate": 1 + } + t = threading.Thread( + target=_monitor_thread, + kwargs={ + 'name': jdata.get("name"), + 'host': jdata.get("host"), + 'interval': jdata.get("interval"), + 'type': jdata.get("type") + } + ) + t.daemon = True + t.start() timer = 0 check_ip = 0 @@ -283,12 +474,10 @@ def byte_str(object): CPU = get_cpu() NET_IN, NET_OUT = liuliang() Uptime = get_uptime() - Load_1, Load_5, Load_15 = os.getloadavg() if 'linux' in sys.platform else (0.0, 0.0, 0.0) + Load_1, Load_5, Load_15 = os.getloadavg() if 'linux' in sys.platform or 'darwin' in sys.platform else (0.0, 0.0, 0.0) MemoryTotal, MemoryUsed = get_memory() SwapTotal, SwapUsed = get_swap() HDDTotal, HDDUsed = get_hdd() - IP_STATUS = ip_status() - array = {} if not timer: array['online' + str(check_ip)] = get_network(check_ip) @@ -311,7 +500,6 @@ def byte_str(object): array['network_tx'] = netSpeed.get("nettx") array['network_in'] = NET_IN array['network_out'] = NET_OUT - array['ip_status'] = IP_STATUS array['ping_10010'] = lostRate.get('10010') * 100 array['ping_189'] = lostRate.get('189') * 100 array['ping_10086'] = lostRate.get('10086') * 100 @@ -319,16 +507,20 @@ def byte_str(object): array['time_189'] = pingTime.get('189') array['time_10086'] = pingTime.get('10086') array['tcp'], array['udp'], array['process'], array['thread'] = tupd() - + array['io_read'] = diskIO.get("read") + array['io_write'] = diskIO.get("write") + array['custom'] = "
".join(f"{k}\\t解析: {v['dns_time']}\\t连接: {v['connect_time']}\\t下载: {v['download_time']}\\t在线率: {v['online_rate']*100:.2f}%" for k, v in monitorServer.items()) s.send(byte_str("update " + json.dumps(array) + "\n")) except KeyboardInterrupt: raise except socket.error: + monitorServer.clear() print("Disconnected...") if 's' in locals().keys(): del s time.sleep(3) except Exception as e: + monitorServer.clear() print("Caught Exception:", e) if 's' in locals().keys(): del s diff --git a/docker-compose.yml b/docker-compose.yml new file mode 100644 index 00000000..42f8e12b --- /dev/null +++ b/docker-compose.yml @@ -0,0 +1,29 @@ +version: "3" +services: + serverstatus: + build: + context: . + dockerfile: Dockerfile + image: serverstatus_server + healthcheck: + test: curl --fail http://localhost:80 || bash -c 'kill -s 15 -1 && (sleep 10; kill -s 9 -1)' + interval: 30s + timeout: 10s + retries: 5 + container_name: serverstatus + restart: unless-stopped + networks: + serverstatus-network: + ipv4_address: 172.23.0.2 + volumes: + - ./server/config.json:/ServerStatus/server/config.json + - ./web/json:/usr/share/nginx/html/json + ports: + - 35601:35601 + - 8080:80 + +networks: + serverstatus-network: + ipam: + config: + - subnet: 172.23.0.0/24 diff --git a/plugin/Dockerfile-telegram b/plugin/Dockerfile-telegram new file mode 100644 index 00000000..f9084efa --- /dev/null +++ b/plugin/Dockerfile-telegram @@ -0,0 +1,10 @@ +FROM python:alpine + +LABEL maintainer="lidalao" +LABEL version="0.0.1" +LABEL description="Telegram Bot for ServerStatus" + +WORKDIR /app +RUN pip install requests +COPY ./bot-telegram.py . +CMD [ "python", "./bot-telegram.py" ] diff --git a/plugin/bot-telegram.py b/plugin/bot-telegram.py new file mode 100644 index 00000000..67ef36e4 --- /dev/null +++ b/plugin/bot-telegram.py @@ -0,0 +1,73 @@ +#!/usr/bin/env python3 +# coding: utf-8 +# Create by : https://github.com/lidalao/ServerStatus +# 版本：0.0.1, 支持Python版本：2.7 to 3.9 +# 支持操作系统： Linux, OSX, FreeBSD, OpenBSD and NetBSD, both 32-bit and 64-bit architectures + +import os +import sys +import requests +import time +import traceback + +NODE_STATUS_URL = 'http://serverstatus/json/stats.json' + +offs = [] +counterOff = {} +counterOn = {} + +def _send(text): + chat_id = os.getenv('TG_CHAT_ID') + bot_token = os.environ.get('TG_BOT_TOKEN') + url = f"https://api.telegram.org/bot{bot_token}/sendMessage?parse_mode=HTML&disable_web_page_preview=true&chat_id=" + chat_id + "&text=" + text + try: + requests.get(url) + except Exception as e: + print("catch exception: ", traceback.format_exc()) + +def send2tg(srv, flag): + if srv not in counterOff: + counterOff[srv] = 0 + if srv not in counterOn: + counterOn[srv] = 0 + + if flag == 1 : # online + if srv in offs: + if counterOn[srv] < 10: + counterOn[srv] += 1 + return + #1. Remove srv from offs; 2. Send to tg: I am online + offs.remove(srv) + counterOn[srv] = 0 + text = 'Server Status' + '\n主机上线: ' + srv + _send(text) + else: #offline + if srv not in offs: + if counterOff[srv] < 10: + counterOff[srv] += 1 + return + #1. Append srv to offs; 2. Send to tg: I am offline + offs.append(srv) + counterOff[srv] = 0 + text = 'Server Status' + '\n主机下线: ' + srv + _send(text) + +def sscmd(address): + while True: + r = requests.get(url=address, headers={"User-Agent": "ServerStatus/20211116"}) + try: + jsonR = r.json() + except Exception as e: + print('未发现任何节点') + continue + for i in jsonR["servers"]: + if i["online4"] is False and i["online6"] is False: + send2tg(i["name"], 0) + else: + send2tg(i["name"], 1) + + + time.sleep(3) + +if __name__ == '__main__': + sscmd(NODE_STATUS_URL) diff --git a/plugin/docker-compose-telegram.yml b/plugin/docker-compose-telegram.yml new file mode 100644 index 00000000..adbe5a72 --- /dev/null +++ b/plugin/docker-compose-telegram.yml @@ -0,0 +1,38 @@ +version: "3" +services: + serverstatus: + build: + context: .. + dockerfile: Dockerfile + image: serverstatus_server + container_name: serverstatus + restart: unless-stopped + networks: + serverstatus-network: + ipv4_address: 172.23.0.2 + volumes: + - ../server/config.json:/ServerStatus/server/config.json + - ../web/json:/usr/share/nginx/html/json + ports: + - 35601:35601 + - 8080:80 + bot: + build: + context: . + dockerfile: Dockerfile-telegram + image: serverstatus_bot + container_name: bot4sss + restart: unless-stopped + networks: + serverstatus-network: + ipv4_address: 172.23.0.3 + environment: + - TG_CHAT_ID=${TG_CHAT_ID} + - TG_BOT_TOKEN=${TG_BOT_TOKEN} + +networks: + serverstatus-network: + name: serverstatus-network + ipam: + config: + - subnet: 172.23.0.0/24 diff --git a/server/Makefile b/server/Makefile index 3ca07ff6..ccee6fbf 100644 --- a/server/Makefile +++ b/server/Makefile @@ -6,7 +6,7 @@ CFLAGS = -Wall -O2 #CXX = clang++ CXX = g++ -CXXFLAGS = -Wall -O2 +CXXFLAGS = -Wall -O2 -std=c++11 ODIR = obj SDIR = src @@ -26,7 +26,7 @@ $(ODIR)/%.o: $(SDIR)/%.cpp $(CXX) -c $(INC) $(CXXFLAGS) $< -o $@ $(OUT): $(OBJS) - $(CXX) $(LIBS) $^ -o $(OUT) + $(CXX) $(LIBS) $^ -o $(OUT) -lcurl .PHONY: clean diff --git a/server/config.json b/server/config.json index d5e823bf..aa37dd50 100644 --- a/server/config.json +++ b/server/config.json @@ -1,37 +1,105 @@ -{"servers": - [ +{ + "servers": [ { "username": "s01", "name": "node1", "type": "xen", "host": "host1", - "location": "cn", - "password": "USER_DEFAULT_PASSWORD" + "location": "🇨🇳", + "password": "USER_DEFAULT_PASSWORD", + "monthstart": 1 }, { "username": "s02", "name": "node2", "type": "vmware", "host": "host2", - "location": "jp", - "password": "USER_DEFAULT_PASSWORD" + "location": "🇯🇵", + "password": "USER_DEFAULT_PASSWORD", + "monthstart": 1 }, { "disabled": true, "username": "s03", "name": "node3", - "type": "Nothing", + "type": "hyper", "host": "host3", - "location": "fr", - "password": "USER_DEFAULT_PASSWORD" + "location": "🇫🇷", + "password": "USER_DEFAULT_PASSWORD", + "monthstart": 1 }, { "username": "s04", "name": "node4", "type": "kvm", "host": "host4", - "location": "kr", - "password": "USER_DEFAULT_PASSWORD" + "location": "🇰🇷", + "password": "USER_DEFAULT_PASSWORD", + "monthstart": 1 + } + ], + "monitors": [ + { + "name": "baidu", + "host": "https://www.baidu.com", + "interval": 300, + "type": "https" + }, + { + "name": "114", + "host": "114.114.114.114:53", + "interval": 300, + "type": "tcp" + } + ], + "watchdog": [ + { + "name": "cpu high warning,exclude username s01", + "rule": "cpu>90&load_1>5&username!='s01'", + "interval": 600, + "callback": "https://yourSMSurl" + }, + { + "name": "memory high warning, exclude less than 1GB vps", + "rule": "(memory_used/memory_total)*100>90&memory_total>1048576", + "interval": 300, + "callback": "https://yourSMSurl" + }, + { + "name": "offline warning", + "rule": "online4=0&online6=0", + "interval": 600, + "callback": "https://yourSMSurl" + }, + { + "name": "ddcc attack,limit type Oracle", + "rule": "tcp_count>600&type='Oracle'", + "interval": 300, + "callback": "https://yourSMSurl" + }, + { + "name": "month 999GB traffic warning", + "rule": "(network_out-last_network_out)/1024/1024/1024>999", + "interval": 3600, + "callback": "https://yourSMSurl" + }, + { + "name": "aliyun china free 18GB traffic warning", + "rule": "(network_out-last_network_out)/1024/1024/1024>18&(username='aliyun1'|username='aliyun2')", + "interval": 3600, + "callback": "https://yourSMSurl" + }, + { + "name": "packet loss rate warning", + "rule": "(ping_10010>10|ping_189>10|ping_10086>10)&(host='sgp'|host='qqhk'|host='hk-21-x'|host='hk-31-x')", + "interval": 3600, + "callback": "https://yourSMSurl" + }, + { + "name": "you can parse an expression combining any known field", + "rule": "load_5>3", + "interval": 900, + "callback": "https://yourSMSurl" } ] -} \ No newline at end of file +} diff --git a/server/src/exprtk.hpp b/server/src/exprtk.hpp new file mode 100644 index 00000000..b4530ba0 --- /dev/null +++ b/server/src/exprtk.hpp @@ -0,0 +1,40983 @@ +/* + ****************************************************************** + * C++ Mathematical Expression Toolkit Library * + * * + * Author: Arash Partow (1999-2023) * + * URL: https://www.partow.net/programming/exprtk/index.html * + * * + * Copyright notice: * + * Free use of the C++ Mathematical Expression Toolkit Library is * + * permitted under the guidelines and in accordance with the most * + * current version of the MIT License. * + * https://www.opensource.org/licenses/MIT * + * * + * Example expressions: * + * (00) (y + x / y) * (x - y / x) * + * (01) (x^2 / sin(2 * pi / y)) - x / 2 * + * (02) sqrt(1 - (x^2)) * + * (03) 1 - sin(2 * x) + cos(pi / y) * + * (04) a * exp(2 * t) + c * + * (05) if(((x + 2) == 3) and ((y + 5) <= 9),1 + w, 2 / z) * + * (06) (avg(x,y) <= x + y ? x - y : x * y) + 2 * pi / x * + * (07) z := x + sin(2 * pi / y) * + * (08) u := 2 * (pi * z) / (w := x + cos(y / pi)) * + * (09) clamp(-1,sin(2 * pi * x) + cos(y / 2 * pi),+1) * + * (10) inrange(-2,m,+2) == if(({-2 <= m} and [m <= +2]),1,0) * + * (11) (2sin(x)cos(2y)7 + 1) == (2 * sin(x) * cos(2*y) * 7 + 1) * + * (12) (x ilike 's*ri?g') and [y < (3 z^7 + w)] * + * * + ****************************************************************** +*/ + + +#ifndef INCLUDE_EXPRTK_HPP +#define INCLUDE_EXPRTK_HPP + + +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include +#include + + +namespace exprtk +{ + #ifdef exprtk_enable_debugging + #define exprtk_debug(params) printf params + #else + #define exprtk_debug(params) (void)0 + #endif + + #define exprtk_error_location \ + "exprtk.hpp:" + details::to_str(__LINE__) \ + + #if defined(__GNUC__) && (__GNUC__ >= 7) + + #define exprtk_disable_fallthrough_begin \ + _Pragma ("GCC diagnostic push") \ + _Pragma ("GCC diagnostic ignored \"-Wimplicit-fallthrough\"") \ + + #define exprtk_disable_fallthrough_end \ + _Pragma ("GCC diagnostic pop") \ + + #else + #define exprtk_disable_fallthrough_begin (void)0; + #define exprtk_disable_fallthrough_end (void)0; + #endif + + #if __cplusplus >= 201103L + #define exprtk_override override + #define exprtk_final final + #define exprtk_delete = delete + #else + #define exprtk_override + #define exprtk_final + #define exprtk_delete + #endif + + namespace details + { + typedef char char_t; + typedef char_t* char_ptr; + typedef char_t const* char_cptr; + typedef unsigned char uchar_t; + typedef uchar_t* uchar_ptr; + typedef uchar_t const* uchar_cptr; + typedef unsigned long long int _uint64_t; + typedef long long int _int64_t; + + inline bool is_whitespace(const char_t c) + { + return (' ' == c) || ('\n' == c) || + ('\r' == c) || ('\t' == c) || + ('\b' == c) || ('\v' == c) || + ('\f' == c) ; + } + + inline bool is_operator_char(const char_t c) + { + return ('+' == c) || ('-' == c) || + ('*' == c) || ('/' == c) || + ('^' == c) || ('<' == c) || + ('>' == c) || ('=' == c) || + (',' == c) || ('!' == c) || + ('(' == c) || (')' == c) || + ('[' == c) || (']' == c) || + ('{' == c) || ('}' == c) || + ('%' == c) || (':' == c) || + ('?' == c) || ('&' == c) || + ('|' == c) || (';' == c) ; + } + + inline bool is_letter(const char_t c) + { + return (('a' <= c) && (c <= 'z')) || + (('A' <= c) && (c <= 'Z')) ; + } + + inline bool is_digit(const char_t c) + { + return ('0' <= c) && (c <= '9'); + } + + inline bool is_letter_or_digit(const char_t c) + { + return is_letter(c) || is_digit(c); + } + + inline bool is_left_bracket(const char_t c) + { + return ('(' == c) || ('[' == c) || ('{' == c); + } + + inline bool is_right_bracket(const char_t c) + { + return (')' == c) || (']' == c) || ('}' == c); + } + + inline bool is_bracket(const char_t c) + { + return is_left_bracket(c) || is_right_bracket(c); + } + + inline bool is_sign(const char_t c) + { + return ('+' == c) || ('-' == c); + } + + inline bool is_invalid(const char_t c) + { + return !is_whitespace (c) && + !is_operator_char(c) && + !is_letter (c) && + !is_digit (c) && + ('.' != c) && + ('_' != c) && + ('$' != c) && + ('~' != c) && + ('\'' != c); + } + + inline bool is_valid_string_char(const char_t c) + { + return std::isprint(static_cast(c)) || + is_whitespace(c); + } + + #ifndef exprtk_disable_caseinsensitivity + inline void case_normalise(std::string& s) + { + for (std::size_t i = 0; i < s.size(); ++i) + { + s[i] = static_cast(std::tolower(s[i])); + } + } + + inline bool imatch(const char_t c1, const char_t c2) + { + return std::tolower(c1) == std::tolower(c2); + } + + inline bool imatch(const std::string& s1, const std::string& s2) + { + if (s1.size() == s2.size()) + { + for (std::size_t i = 0; i < s1.size(); ++i) + { + if (std::tolower(s1[i]) != std::tolower(s2[i])) + { + return false; + } + } + + return true; + } + + return false; + } + + struct ilesscompare + { + inline bool operator() (const std::string& s1, const std::string& s2) const + { + const std::size_t length = std::min(s1.size(),s2.size()); + + for (std::size_t i = 0; i < length; ++i) + { + const char_t c1 = static_cast(std::tolower(s1[i])); + const char_t c2 = static_cast(std::tolower(s2[i])); + + if (c1 > c2) + return false; + else if (c1 < c2) + return true; + } + + return s1.size() < s2.size(); + } + }; + + #else + inline void case_normalise(std::string&) + {} + + inline bool imatch(const char_t c1, const char_t c2) + { + return c1 == c2; + } + + inline bool imatch(const std::string& s1, const std::string& s2) + { + return s1 == s2; + } + + struct ilesscompare + { + inline bool operator() (const std::string& s1, const std::string& s2) const + { + return s1 < s2; + } + }; + #endif + + inline bool is_valid_sf_symbol(const std::string& symbol) + { + // Special function: $f12 or $F34 + return (4 == symbol.size()) && + ('$' == symbol[0]) && + imatch('f',symbol[1]) && + is_digit(symbol[2]) && + is_digit(symbol[3]); + } + + inline const char_t& front(const std::string& s) + { + return s[0]; + } + + inline const char_t& back(const std::string& s) + { + return s[s.size() - 1]; + } + + inline std::string to_str(int i) + { + if (0 == i) + return std::string("0"); + + std::string result; + + const int sign = (i < 0) ? -1 : 1; + + for ( ; i; i /= 10) + { + result += '0' + static_cast(sign * (i % 10)); + } + + if (sign < 0) + { + result += '-'; + } + + std::reverse(result.begin(), result.end()); + + return result; + } + + inline std::string to_str(std::size_t i) + { + return to_str(static_cast(i)); + } + + inline bool is_hex_digit(const uchar_t digit) + { + return (('0' <= digit) && (digit <= '9')) || + (('A' <= digit) && (digit <= 'F')) || + (('a' <= digit) && (digit <= 'f')) ; + } + + inline uchar_t hex_to_bin(uchar_t h) + { + if (('0' <= h) && (h <= '9')) + return (h - '0'); + else + return static_cast(std::toupper(h) - 'A'); + } + + template + inline bool parse_hex(Iterator& itr, Iterator end, + char_t& result) + { + if ( + (end == (itr )) || + (end == (itr + 1)) || + (end == (itr + 2)) || + (end == (itr + 3)) || + ('0' != *(itr )) || + ('X' != std::toupper(*(itr + 1))) || + (!is_hex_digit(*(itr + 2))) || + (!is_hex_digit(*(itr + 3))) + ) + { + return false; + } + + result = hex_to_bin(static_cast(*(itr + 2))) << 4 | + hex_to_bin(static_cast(*(itr + 3))) ; + + return true; + } + + inline bool cleanup_escapes(std::string& s) + { + typedef std::string::iterator str_itr_t; + + str_itr_t itr1 = s.begin(); + str_itr_t itr2 = s.begin(); + str_itr_t end = s.end (); + + std::size_t removal_count = 0; + + while (end != itr1) + { + if ('\\' == (*itr1)) + { + if (end == ++itr1) + { + return false; + } + else if (parse_hex(itr1, end, *itr2)) + { + itr1+= 4; + itr2+= 1; + removal_count +=4; + } + else if ('a' == (*itr1)) { (*itr2++) = '\a'; ++itr1; ++removal_count; } + else if ('b' == (*itr1)) { (*itr2++) = '\b'; ++itr1; ++removal_count; } + else if ('f' == (*itr1)) { (*itr2++) = '\f'; ++itr1; ++removal_count; } + else if ('n' == (*itr1)) { (*itr2++) = '\n'; ++itr1; ++removal_count; } + else if ('r' == (*itr1)) { (*itr2++) = '\r'; ++itr1; ++removal_count; } + else if ('t' == (*itr1)) { (*itr2++) = '\t'; ++itr1; ++removal_count; } + else if ('v' == (*itr1)) { (*itr2++) = '\v'; ++itr1; ++removal_count; } + else if ('0' == (*itr1)) { (*itr2++) = '\0'; ++itr1; ++removal_count; } + else + { + (*itr2++) = (*itr1++); + ++removal_count; + } + continue; + } + else + (*itr2++) = (*itr1++); + } + + if ((removal_count > s.size()) || (0 == removal_count)) + return false; + + s.resize(s.size() - removal_count); + + return true; + } + + class build_string + { + public: + + explicit build_string(const std::size_t& initial_size = 64) + { + data_.reserve(initial_size); + } + + inline build_string& operator << (const std::string& s) + { + data_ += s; + return (*this); + } + + inline build_string& operator << (char_cptr s) + { + data_ += std::string(s); + return (*this); + } + + inline operator std::string () const + { + return data_; + } + + inline std::string as_string() const + { + return data_; + } + + private: + + std::string data_; + }; + + static const std::string reserved_words[] = + { + "break", "case", "continue", "default", "false", "for", + "if", "else", "ilike", "in", "like", "and", "nand", "nor", + "not", "null", "or", "repeat", "return", "shl", "shr", + "swap", "switch", "true", "until", "var", "while", "xnor", + "xor", "&", "|" + }; + + static const std::size_t reserved_words_size = sizeof(reserved_words) / sizeof(std::string); + + static const std::string reserved_symbols[] = + { + "abs", "acos", "acosh", "and", "asin", "asinh", "atan", + "atanh", "atan2", "avg", "break", "case", "ceil", "clamp", + "continue", "cos", "cosh", "cot", "csc", "default", + "deg2grad", "deg2rad", "equal", "erf", "erfc", "exp", + "expm1", "false", "floor", "for", "frac", "grad2deg", + "hypot", "iclamp", "if", "else", "ilike", "in", "inrange", + "like", "log", "log10", "log2", "logn", "log1p", "mand", + "max", "min", "mod", "mor", "mul", "ncdf", "nand", "nor", + "not", "not_equal", "null", "or", "pow", "rad2deg", + "repeat", "return", "root", "round", "roundn", "sec", "sgn", + "shl", "shr", "sin", "sinc", "sinh", "sqrt", "sum", "swap", + "switch", "tan", "tanh", "true", "trunc", "until", "var", + "while", "xnor", "xor", "&", "|" + }; + + static const std::size_t reserved_symbols_size = sizeof(reserved_symbols) / sizeof(std::string); + + static const std::string base_function_list[] = + { + "abs", "acos", "acosh", "asin", "asinh", "atan", "atanh", + "atan2", "avg", "ceil", "clamp", "cos", "cosh", "cot", + "csc", "equal", "erf", "erfc", "exp", "expm1", "floor", + "frac", "hypot", "iclamp", "like", "log", "log10", "log2", + "logn", "log1p", "mand", "max", "min", "mod", "mor", "mul", + "ncdf", "pow", "root", "round", "roundn", "sec", "sgn", + "sin", "sinc", "sinh", "sqrt", "sum", "swap", "tan", "tanh", + "trunc", "not_equal", "inrange", "deg2grad", "deg2rad", + "rad2deg", "grad2deg" + }; + + static const std::size_t base_function_list_size = sizeof(base_function_list) / sizeof(std::string); + + static const std::string logic_ops_list[] = + { + "and", "nand", "nor", "not", "or", "xnor", "xor", "&", "|" + }; + + static const std::size_t logic_ops_list_size = sizeof(logic_ops_list) / sizeof(std::string); + + static const std::string cntrl_struct_list[] = + { + "if", "switch", "for", "while", "repeat", "return" + }; + + static const std::size_t cntrl_struct_list_size = sizeof(cntrl_struct_list) / sizeof(std::string); + + static const std::string arithmetic_ops_list[] = + { + "+", "-", "*", "/", "%", "^" + }; + + static const std::size_t arithmetic_ops_list_size = sizeof(arithmetic_ops_list) / sizeof(std::string); + + static const std::string assignment_ops_list[] = + { + ":=", "+=", "-=", + "*=", "/=", "%=" + }; + + static const std::size_t assignment_ops_list_size = sizeof(assignment_ops_list) / sizeof(std::string); + + static const std::string inequality_ops_list[] = + { + "<", "<=", "==", + "=", "!=", "<>", + ">=", ">" + }; + + static const std::size_t inequality_ops_list_size = sizeof(inequality_ops_list) / sizeof(std::string); + + inline bool is_reserved_word(const std::string& symbol) + { + for (std::size_t i = 0; i < reserved_words_size; ++i) + { + if (imatch(symbol, reserved_words[i])) + { + return true; + } + } + + return false; + } + + inline bool is_reserved_symbol(const std::string& symbol) + { + for (std::size_t i = 0; i < reserved_symbols_size; ++i) + { + if (imatch(symbol, reserved_symbols[i])) + { + return true; + } + } + + return false; + } + + inline bool is_base_function(const std::string& function_name) + { + for (std::size_t i = 0; i < base_function_list_size; ++i) + { + if (imatch(function_name, base_function_list[i])) + { + return true; + } + } + + return false; + } + + inline bool is_control_struct(const std::string& cntrl_strct) + { + for (std::size_t i = 0; i < cntrl_struct_list_size; ++i) + { + if (imatch(cntrl_strct, cntrl_struct_list[i])) + { + return true; + } + } + + return false; + } + + inline bool is_logic_opr(const std::string& lgc_opr) + { + for (std::size_t i = 0; i < logic_ops_list_size; ++i) + { + if (imatch(lgc_opr, logic_ops_list[i])) + { + return true; + } + } + + return false; + } + + struct cs_match + { + static inline bool cmp(const char_t c0, const char_t c1) + { + return (c0 == c1); + } + }; + + struct cis_match + { + static inline bool cmp(const char_t c0, const char_t c1) + { + return (std::tolower(c0) == std::tolower(c1)); + } + }; + + template + inline bool match_impl(const Iterator pattern_begin, + const Iterator pattern_end , + const Iterator data_begin , + const Iterator data_end , + const typename std::iterator_traits::value_type& zero_or_more, + const typename std::iterator_traits::value_type& exactly_one ) + { + typedef typename std::iterator_traits::value_type type; + + const Iterator null_itr(0); + + Iterator p_itr = pattern_begin; + Iterator d_itr = data_begin; + Iterator np_itr = null_itr; + Iterator nd_itr = null_itr; + + for ( ; ; ) + { + if (p_itr != pattern_end) + { + const type c = *(p_itr); + + if ((data_end != d_itr) && (Compare::cmp(c,*(d_itr)) || (exactly_one == c))) + { + ++d_itr; + ++p_itr; + continue; + } + else if (zero_or_more == c) + { + while ((pattern_end != p_itr) && (zero_or_more == *(p_itr))) + { + ++p_itr; + } + + const type d = *(p_itr); + + while ((data_end != d_itr) && !(Compare::cmp(d,*(d_itr)) || (exactly_one == d))) + { + ++d_itr; + } + + // set backtrack iterators + np_itr = p_itr - 1; + nd_itr = d_itr + 1; + + continue; + } + } + else if (data_end == d_itr) + return true; + + if ((data_end == d_itr) || (null_itr == nd_itr)) + return false; + + p_itr = np_itr; + d_itr = nd_itr; + } + + return true; + } + + inline bool wc_match(const std::string& wild_card, + const std::string& str) + { + return match_impl( + wild_card.data(), + wild_card.data() + wild_card.size(), + str.data(), + str.data() + str.size(), + '*', '?'); + } + + inline bool wc_imatch(const std::string& wild_card, + const std::string& str) + { + return match_impl( + wild_card.data(), + wild_card.data() + wild_card.size(), + str.data(), + str.data() + str.size(), + '*', '?'); + } + + inline bool sequence_match(const std::string& pattern, + const std::string& str, + std::size_t& diff_index, + char_t& diff_value) + { + if (str.empty()) + { + return ("Z" == pattern); + } + else if ('*' == pattern[0]) + return false; + + typedef std::string::const_iterator itr_t; + + itr_t p_itr = pattern.begin(); + itr_t s_itr = str .begin(); + + const itr_t p_end = pattern.end(); + const itr_t s_end = str .end(); + + while ((s_end != s_itr) && (p_end != p_itr)) + { + if ('*' == (*p_itr)) + { + const char_t target = static_cast(std::toupper(*(p_itr - 1))); + + if ('*' == target) + { + diff_index = static_cast(std::distance(str.begin(),s_itr)); + diff_value = static_cast(std::toupper(*p_itr)); + + return false; + } + else + ++p_itr; + + while (s_itr != s_end) + { + if (target != std::toupper(*s_itr)) + break; + else + ++s_itr; + } + + continue; + } + else if ( + ('?' != *p_itr) && + std::toupper(*p_itr) != std::toupper(*s_itr) + ) + { + diff_index = static_cast(std::distance(str.begin(),s_itr)); + diff_value = static_cast(std::toupper(*p_itr)); + + return false; + } + + ++p_itr; + ++s_itr; + } + + return ( + (s_end == s_itr) && + ( + (p_end == p_itr) || + ('*' == *p_itr) + ) + ); + } + + static const double pow10[] = { + 1.0, + 1.0E+001, 1.0E+002, 1.0E+003, 1.0E+004, + 1.0E+005, 1.0E+006, 1.0E+007, 1.0E+008, + 1.0E+009, 1.0E+010, 1.0E+011, 1.0E+012, + 1.0E+013, 1.0E+014, 1.0E+015, 1.0E+016 + }; + + static const std::size_t pow10_size = sizeof(pow10) / sizeof(double); + + namespace numeric + { + namespace constant + { + static const double e = 2.71828182845904523536028747135266249775724709369996; + static const double pi = 3.14159265358979323846264338327950288419716939937510; + static const double pi_2 = 1.57079632679489661923132169163975144209858469968755; + static const double pi_4 = 0.78539816339744830961566084581987572104929234984378; + static const double pi_180 = 0.01745329251994329576923690768488612713442871888542; + static const double _1_pi = 0.31830988618379067153776752674502872406891929148091; + static const double _2_pi = 0.63661977236758134307553505349005744813783858296183; + static const double _180_pi = 57.29577951308232087679815481410517033240547246656443; + static const double log2 = 0.69314718055994530941723212145817656807550013436026; + static const double sqrt2 = 1.41421356237309504880168872420969807856967187537695; + } + + namespace details + { + struct unknown_type_tag { unknown_type_tag() {} }; + struct real_type_tag { real_type_tag () {} }; + struct int_type_tag { int_type_tag () {} }; + + template + struct number_type + { + typedef unknown_type_tag type; + number_type() {} + }; + + #define exprtk_register_real_type_tag(T) \ + template <> struct number_type \ + { typedef real_type_tag type; number_type() {} }; \ + + #define exprtk_register_int_type_tag(T) \ + template <> struct number_type \ + { typedef int_type_tag type; number_type() {} }; \ + + exprtk_register_real_type_tag(double ) + exprtk_register_real_type_tag(long double) + exprtk_register_real_type_tag(float ) + + exprtk_register_int_type_tag(short ) + exprtk_register_int_type_tag(int ) + exprtk_register_int_type_tag(_int64_t ) + exprtk_register_int_type_tag(unsigned short) + exprtk_register_int_type_tag(unsigned int ) + exprtk_register_int_type_tag(_uint64_t ) + + #undef exprtk_register_real_type_tag + #undef exprtk_register_int_type_tag + + template + struct epsilon_type {}; + + #define exprtk_define_epsilon_type(Type, Epsilon) \ + template <> struct epsilon_type \ + { \ + static inline Type value() \ + { \ + const Type epsilon = static_cast(Epsilon); \ + return epsilon; \ + } \ + }; \ + + exprtk_define_epsilon_type(float , 0.00000100000f) + exprtk_define_epsilon_type(double , 0.000000000100) + exprtk_define_epsilon_type(long double, 0.000000000001) + + #undef exprtk_define_epsilon_type + + template + inline bool is_nan_impl(const T v, real_type_tag) + { + return std::not_equal_to()(v,v); + } + + template + inline int to_int32_impl(const T v, real_type_tag) + { + return static_cast(v); + } + + template + inline _int64_t to_int64_impl(const T v, real_type_tag) + { + return static_cast<_int64_t>(v); + } + + template + inline bool is_true_impl(const T v) + { + return std::not_equal_to()(T(0),v); + } + + template + inline bool is_false_impl(const T v) + { + return std::equal_to()(T(0),v); + } + + template + inline T abs_impl(const T v, real_type_tag) + { + return ((v < T(0)) ? -v : v); + } + + template + inline T min_impl(const T v0, const T v1, real_type_tag) + { + return std::min(v0,v1); + } + + template + inline T max_impl(const T v0, const T v1, real_type_tag) + { + return std::max(v0,v1); + } + + template + inline T equal_impl(const T v0, const T v1, real_type_tag) + { + const T epsilon = epsilon_type::value(); + return (abs_impl(v0 - v1,real_type_tag()) <= (std::max(T(1),std::max(abs_impl(v0,real_type_tag()),abs_impl(v1,real_type_tag()))) * epsilon)) ? T(1) : T(0); + } + + inline float equal_impl(const float v0, const float v1, real_type_tag) + { + const float epsilon = epsilon_type::value(); + return (abs_impl(v0 - v1,real_type_tag()) <= (std::max(1.0f,std::max(abs_impl(v0,real_type_tag()),abs_impl(v1,real_type_tag()))) * epsilon)) ? 1.0f : 0.0f; + } + + template + inline T equal_impl(const T v0, const T v1, int_type_tag) + { + return (v0 == v1) ? 1 : 0; + } + + template + inline T expm1_impl(const T v, real_type_tag) + { + // return std::expm1(v); + if (abs_impl(v,real_type_tag()) < T(0.00001)) + return v + (T(0.5) * v * v); + else + return std::exp(v) - T(1); + } + + template + inline T expm1_impl(const T v, int_type_tag) + { + return T(std::exp(v)) - T(1); + } + + template + inline T nequal_impl(const T v0, const T v1, real_type_tag) + { + typedef real_type_tag rtg; + const T epsilon = epsilon_type::value(); + return (abs_impl(v0 - v1,rtg()) > (std::max(T(1),std::max(abs_impl(v0,rtg()),abs_impl(v1,rtg()))) * epsilon)) ? T(1) : T(0); + } + + inline float nequal_impl(const float v0, const float v1, real_type_tag) + { + typedef real_type_tag rtg; + const float epsilon = epsilon_type::value(); + return (abs_impl(v0 - v1,rtg()) > (std::max(1.0f,std::max(abs_impl(v0,rtg()),abs_impl(v1,rtg()))) * epsilon)) ? 1.0f : 0.0f; + } + + template + inline T nequal_impl(const T v0, const T v1, int_type_tag) + { + return (v0 != v1) ? 1 : 0; + } + + template + inline T modulus_impl(const T v0, const T v1, real_type_tag) + { + return std::fmod(v0,v1); + } + + template + inline T modulus_impl(const T v0, const T v1, int_type_tag) + { + return v0 % v1; + } + + template + inline T pow_impl(const T v0, const T v1, real_type_tag) + { + return std::pow(v0,v1); + } + + template + inline T pow_impl(const T v0, const T v1, int_type_tag) + { + return std::pow(static_cast(v0),static_cast(v1)); + } + + template + inline T logn_impl(const T v0, const T v1, real_type_tag) + { + return std::log(v0) / std::log(v1); + } + + template + inline T logn_impl(const T v0, const T v1, int_type_tag) + { + return static_cast(logn_impl(static_cast(v0),static_cast(v1),real_type_tag())); + } + + template + inline T log1p_impl(const T v, real_type_tag) + { + if (v > T(-1)) + { + if (abs_impl(v,real_type_tag()) > T(0.0001)) + { + return std::log(T(1) + v); + } + else + return (T(-0.5) * v + T(1)) * v; + } + else + return std::numeric_limits::quiet_NaN(); + } + + template + inline T log1p_impl(const T v, int_type_tag) + { + if (v > T(-1)) + { + return std::log(T(1) + v); + } + else + return std::numeric_limits::quiet_NaN(); + } + + template + inline T root_impl(const T v0, const T v1, real_type_tag) + { + if (v1 < T(0)) + return std::numeric_limits::quiet_NaN(); + + const std::size_t n = static_cast(v1); + + if ((v0 < T(0)) && (0 == (n % 2))) + return std::numeric_limits::quiet_NaN(); + + return std::pow(v0, T(1) / n); + } + + template + inline T root_impl(const T v0, const T v1, int_type_tag) + { + return root_impl(static_cast(v0),static_cast(v1),real_type_tag()); + } + + template + inline T round_impl(const T v, real_type_tag) + { + return ((v < T(0)) ? std::ceil(v - T(0.5)) : std::floor(v + T(0.5))); + } + + template + inline T roundn_impl(const T v0, const T v1, real_type_tag) + { + const int index = std::max(0, std::min(pow10_size - 1, static_cast(std::floor(v1)))); + const T p10 = T(pow10[index]); + + if (v0 < T(0)) + return T(std::ceil ((v0 * p10) - T(0.5)) / p10); + else + return T(std::floor((v0 * p10) + T(0.5)) / p10); + } + + template + inline T roundn_impl(const T v0, const T, int_type_tag) + { + return v0; + } + + template + inline T hypot_impl(const T v0, const T v1, real_type_tag) + { + return std::sqrt((v0 * v0) + (v1 * v1)); + } + + template + inline T hypot_impl(const T v0, const T v1, int_type_tag) + { + return static_cast(std::sqrt(static_cast((v0 * v0) + (v1 * v1)))); + } + + template + inline T atan2_impl(const T v0, const T v1, real_type_tag) + { + return std::atan2(v0,v1); + } + + template + inline T atan2_impl(const T, const T, int_type_tag) + { + return 0; + } + + template + inline T shr_impl(const T v0, const T v1, real_type_tag) + { + return v0 * (T(1) / std::pow(T(2),static_cast(static_cast(v1)))); + } + + template + inline T shr_impl(const T v0, const T v1, int_type_tag) + { + return v0 >> v1; + } + + template + inline T shl_impl(const T v0, const T v1, real_type_tag) + { + return v0 * std::pow(T(2),static_cast(static_cast(v1))); + } + + template + inline T shl_impl(const T v0, const T v1, int_type_tag) + { + return v0 << v1; + } + + template + inline T sgn_impl(const T v, real_type_tag) + { + if (v > T(0)) return T(+1); + else if (v < T(0)) return T(-1); + else return T( 0); + } + + template + inline T sgn_impl(const T v, int_type_tag) + { + if (v > T(0)) return T(+1); + else if (v < T(0)) return T(-1); + else return T( 0); + } + + template + inline T and_impl(const T v0, const T v1, real_type_tag) + { + return (is_true_impl(v0) && is_true_impl(v1)) ? T(1) : T(0); + } + + template + inline T and_impl(const T v0, const T v1, int_type_tag) + { + return v0 && v1; + } + + template + inline T nand_impl(const T v0, const T v1, real_type_tag) + { + return (is_false_impl(v0) || is_false_impl(v1)) ? T(1) : T(0); + } + + template + inline T nand_impl(const T v0, const T v1, int_type_tag) + { + return !(v0 && v1); + } + + template + inline T or_impl(const T v0, const T v1, real_type_tag) + { + return (is_true_impl(v0) || is_true_impl(v1)) ? T(1) : T(0); + } + + template + inline T or_impl(const T v0, const T v1, int_type_tag) + { + return (v0 || v1); + } + + template + inline T nor_impl(const T v0, const T v1, real_type_tag) + { + return (is_false_impl(v0) && is_false_impl(v1)) ? T(1) : T(0); + } + + template + inline T nor_impl(const T v0, const T v1, int_type_tag) + { + return !(v0 || v1); + } + + template + inline T xor_impl(const T v0, const T v1, real_type_tag) + { + return (is_false_impl(v0) != is_false_impl(v1)) ? T(1) : T(0); + } + + template + inline T xor_impl(const T v0, const T v1, int_type_tag) + { + return v0 ^ v1; + } + + template + inline T xnor_impl(const T v0, const T v1, real_type_tag) + { + const bool v0_true = is_true_impl(v0); + const bool v1_true = is_true_impl(v1); + + if ((v0_true && v1_true) || (!v0_true && !v1_true)) + return T(1); + else + return T(0); + } + + template + inline T xnor_impl(const T v0, const T v1, int_type_tag) + { + const bool v0_true = is_true_impl(v0); + const bool v1_true = is_true_impl(v1); + + if ((v0_true && v1_true) || (!v0_true && !v1_true)) + return T(1); + else + return T(0); + } + + #if (defined(_MSC_VER) && (_MSC_VER >= 1900)) || !defined(_MSC_VER) + #define exprtk_define_erf(TT, impl) \ + inline TT erf_impl(const TT v) { return impl(v); } \ + + exprtk_define_erf( float,::erff) + exprtk_define_erf( double,::erf ) + exprtk_define_erf(long double,::erfl) + #undef exprtk_define_erf + #endif + + template + inline T erf_impl(const T v, real_type_tag) + { + #if defined(_MSC_VER) && (_MSC_VER < 1900) + // Credits: Abramowitz & Stegun Equations 7.1.25-28 + static const T c[] = { + T( 1.26551223), T(1.00002368), + T( 0.37409196), T(0.09678418), + T(-0.18628806), T(0.27886807), + T(-1.13520398), T(1.48851587), + T(-0.82215223), T(0.17087277) + }; + + const T t = T(1) / (T(1) + T(0.5) * abs_impl(v,real_type_tag())); + + const T result = T(1) - t * std::exp((-v * v) - + c[0] + t * (c[1] + t * + (c[2] + t * (c[3] + t * + (c[4] + t * (c[5] + t * + (c[6] + t * (c[7] + t * + (c[8] + t * (c[9])))))))))); + + return (v >= T(0)) ? result : -result; + #else + return erf_impl(v); + #endif + } + + template + inline T erf_impl(const T v, int_type_tag) + { + return erf_impl(static_cast(v),real_type_tag()); + } + + #if (defined(_MSC_VER) && (_MSC_VER >= 1900)) || !defined(_MSC_VER) + #define exprtk_define_erfc(TT, impl) \ + inline TT erfc_impl(const TT v) { return impl(v); } \ + + exprtk_define_erfc(float ,::erfcf) + exprtk_define_erfc(double ,::erfc ) + exprtk_define_erfc(long double,::erfcl) + #undef exprtk_define_erfc + #endif + + template + inline T erfc_impl(const T v, real_type_tag) + { + #if defined(_MSC_VER) && (_MSC_VER < 1900) + return T(1) - erf_impl(v,real_type_tag()); + #else + return erfc_impl(v); + #endif + } + + template + inline T erfc_impl(const T v, int_type_tag) + { + return erfc_impl(static_cast(v),real_type_tag()); + } + + template + inline T ncdf_impl(const T v, real_type_tag) + { + const T cnd = T(0.5) * (T(1) + + erf_impl(abs_impl(v,real_type_tag()) / + T(numeric::constant::sqrt2),real_type_tag())); + return (v < T(0)) ? (T(1) - cnd) : cnd; + } + + template + inline T ncdf_impl(const T v, int_type_tag) + { + return ncdf_impl(static_cast(v),real_type_tag()); + } + + template + inline T sinc_impl(const T v, real_type_tag) + { + if (std::abs(v) >= std::numeric_limits::epsilon()) + return(std::sin(v) / v); + else + return T(1); + } + + template + inline T sinc_impl(const T v, int_type_tag) + { + return sinc_impl(static_cast(v),real_type_tag()); + } + + template inline T acos_impl(const T v, real_type_tag) { return std::acos (v); } + template inline T acosh_impl(const T v, real_type_tag) { return std::log(v + std::sqrt((v * v) - T(1))); } + template inline T asin_impl(const T v, real_type_tag) { return std::asin (v); } + template inline T asinh_impl(const T v, real_type_tag) { return std::log(v + std::sqrt((v * v) + T(1))); } + template inline T atan_impl(const T v, real_type_tag) { return std::atan (v); } + template inline T atanh_impl(const T v, real_type_tag) { return (std::log(T(1) + v) - std::log(T(1) - v)) / T(2); } + template inline T ceil_impl(const T v, real_type_tag) { return std::ceil (v); } + template inline T cos_impl(const T v, real_type_tag) { return std::cos (v); } + template inline T cosh_impl(const T v, real_type_tag) { return std::cosh (v); } + template inline T exp_impl(const T v, real_type_tag) { return std::exp (v); } + template inline T floor_impl(const T v, real_type_tag) { return std::floor(v); } + template inline T log_impl(const T v, real_type_tag) { return std::log (v); } + template inline T log10_impl(const T v, real_type_tag) { return std::log10(v); } + template inline T log2_impl(const T v, real_type_tag) { return std::log(v)/T(numeric::constant::log2); } + template inline T neg_impl(const T v, real_type_tag) { return -v; } + template inline T pos_impl(const T v, real_type_tag) { return +v; } + template inline T sin_impl(const T v, real_type_tag) { return std::sin (v); } + template inline T sinh_impl(const T v, real_type_tag) { return std::sinh (v); } + template inline T sqrt_impl(const T v, real_type_tag) { return std::sqrt (v); } + template inline T tan_impl(const T v, real_type_tag) { return std::tan (v); } + template inline T tanh_impl(const T v, real_type_tag) { return std::tanh (v); } + template inline T cot_impl(const T v, real_type_tag) { return T(1) / std::tan(v); } + template inline T sec_impl(const T v, real_type_tag) { return T(1) / std::cos(v); } + template inline T csc_impl(const T v, real_type_tag) { return T(1) / std::sin(v); } + template inline T r2d_impl(const T v, real_type_tag) { return (v * T(numeric::constant::_180_pi)); } + template inline T d2r_impl(const T v, real_type_tag) { return (v * T(numeric::constant::pi_180)); } + template inline T d2g_impl(const T v, real_type_tag) { return (v * T(10.0/9.0)); } + template inline T g2d_impl(const T v, real_type_tag) { return (v * T(9.0/10.0)); } + template inline T notl_impl(const T v, real_type_tag) { return (std::not_equal_to()(T(0),v) ? T(0) : T(1)); } + template inline T frac_impl(const T v, real_type_tag) { return (v - static_cast(v)); } + template inline T trunc_impl(const T v, real_type_tag) { return T(static_cast(v)); } + + template inline T const_pi_impl(real_type_tag) { return T(numeric::constant::pi); } + template inline T const_e_impl(real_type_tag) { return T(numeric::constant::e); } + template inline T const_qnan_impl(real_type_tag) { return std::numeric_limits::quiet_NaN(); } + + template inline T abs_impl(const T v, int_type_tag) { return ((v >= T(0)) ? v : -v); } + template inline T exp_impl(const T v, int_type_tag) { return std::exp (v); } + template inline T log_impl(const T v, int_type_tag) { return std::log (v); } + template inline T log10_impl(const T v, int_type_tag) { return std::log10(v); } + template inline T log2_impl(const T v, int_type_tag) { return std::log(v)/T(numeric::constant::log2); } + template inline T neg_impl(const T v, int_type_tag) { return -v; } + template inline T pos_impl(const T v, int_type_tag) { return +v; } + template inline T ceil_impl(const T v, int_type_tag) { return v; } + template inline T floor_impl(const T v, int_type_tag) { return v; } + template inline T round_impl(const T v, int_type_tag) { return v; } + template inline T notl_impl(const T v, int_type_tag) { return !v; } + template inline T sqrt_impl(const T v, int_type_tag) { return std::sqrt (v); } + template inline T frac_impl(const T , int_type_tag) { return T(0); } + template inline T trunc_impl(const T v, int_type_tag) { return v; } + template inline T acos_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T acosh_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T asin_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T asinh_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T atan_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T atanh_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T cos_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T cosh_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T sin_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T sinh_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T tan_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T tanh_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T cot_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T sec_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + template inline T csc_impl(const T , int_type_tag) { return std::numeric_limits::quiet_NaN(); } + + template + inline bool is_integer_impl(const T& v, real_type_tag) + { + return std::equal_to()(T(0),std::fmod(v,T(1))); + } + + template + inline bool is_integer_impl(const T&, int_type_tag) + { + return true; + } + } + + template + struct numeric_info { enum { length = 0, size = 32, bound_length = 0, min_exp = 0, max_exp = 0 }; }; + + template <> struct numeric_info { enum { length = 10, size = 16, bound_length = 9 }; }; + template <> struct numeric_info { enum { min_exp = -38, max_exp = +38 }; }; + template <> struct numeric_info { enum { min_exp = -308, max_exp = +308 }; }; + template <> struct numeric_info { enum { min_exp = -308, max_exp = +308 }; }; + + template + inline int to_int32(const T v) + { + const typename details::number_type::type num_type; + return to_int32_impl(v, num_type); + } + + template + inline _int64_t to_int64(const T v) + { + const typename details::number_type::type num_type; + return to_int64_impl(v, num_type); + } + + template + inline bool is_nan(const T v) + { + const typename details::number_type::type num_type; + return is_nan_impl(v, num_type); + } + + template + inline T min(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return min_impl(v0, v1, num_type); + } + + template + inline T max(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return max_impl(v0, v1, num_type); + } + + template + inline T equal(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return equal_impl(v0, v1, num_type); + } + + template + inline T nequal(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return nequal_impl(v0, v1, num_type); + } + + template + inline T modulus(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return modulus_impl(v0, v1, num_type); + } + + template + inline T pow(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return pow_impl(v0, v1, num_type); + } + + template + inline T logn(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return logn_impl(v0, v1, num_type); + } + + template + inline T root(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return root_impl(v0, v1, num_type); + } + + template + inline T roundn(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return roundn_impl(v0, v1, num_type); + } + + template + inline T hypot(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return hypot_impl(v0, v1, num_type); + } + + template + inline T atan2(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return atan2_impl(v0, v1, num_type); + } + + template + inline T shr(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return shr_impl(v0, v1, num_type); + } + + template + inline T shl(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return shl_impl(v0, v1, num_type); + } + + template + inline T and_opr(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return and_impl(v0, v1, num_type); + } + + template + inline T nand_opr(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return nand_impl(v0, v1, num_type); + } + + template + inline T or_opr(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return or_impl(v0, v1, num_type); + } + + template + inline T nor_opr(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return nor_impl(v0, v1, num_type); + } + + template + inline T xor_opr(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return xor_impl(v0, v1, num_type); + } + + template + inline T xnor_opr(const T v0, const T v1) + { + const typename details::number_type::type num_type; + return xnor_impl(v0, v1, num_type); + } + + template + inline bool is_integer(const T v) + { + const typename details::number_type::type num_type; + return is_integer_impl(v, num_type); + } + + template + struct fast_exp + { + static inline T result(T v) + { + unsigned int k = N; + T l = T(1); + + while (k) + { + if (1 == (k % 2)) + { + l *= v; + --k; + } + + v *= v; + k /= 2; + } + + return l; + } + }; + + template struct fast_exp { static inline T result(const T v) { T v_5 = fast_exp::result(v); return v_5 * v_5; } }; + template struct fast_exp { static inline T result(const T v) { return fast_exp::result(v) * v; } }; + template struct fast_exp { static inline T result(const T v) { T v_4 = fast_exp::result(v); return v_4 * v_4; } }; + template struct fast_exp { static inline T result(const T v) { return fast_exp::result(v) * v; } }; + template struct fast_exp { static inline T result(const T v) { T v_3 = fast_exp::result(v); return v_3 * v_3; } }; + template struct fast_exp { static inline T result(const T v) { return fast_exp::result(v) * v; } }; + template struct fast_exp { static inline T result(const T v) { T v_2 = v * v; return v_2 * v_2; } }; + template struct fast_exp { static inline T result(const T v) { return v * v * v; } }; + template struct fast_exp { static inline T result(const T v) { return v * v; } }; + template struct fast_exp { static inline T result(const T v) { return v; } }; + template struct fast_exp { static inline T result(const T ) { return T(1); } }; + + #define exprtk_define_unary_function(FunctionName) \ + template \ + inline T FunctionName (const T v) \ + { \ + const typename details::number_type::type num_type; \ + return FunctionName##_impl(v,num_type); \ + } \ + + exprtk_define_unary_function(abs ) + exprtk_define_unary_function(acos ) + exprtk_define_unary_function(acosh) + exprtk_define_unary_function(asin ) + exprtk_define_unary_function(asinh) + exprtk_define_unary_function(atan ) + exprtk_define_unary_function(atanh) + exprtk_define_unary_function(ceil ) + exprtk_define_unary_function(cos ) + exprtk_define_unary_function(cosh ) + exprtk_define_unary_function(exp ) + exprtk_define_unary_function(expm1) + exprtk_define_unary_function(floor) + exprtk_define_unary_function(log ) + exprtk_define_unary_function(log10) + exprtk_define_unary_function(log2 ) + exprtk_define_unary_function(log1p) + exprtk_define_unary_function(neg ) + exprtk_define_unary_function(pos ) + exprtk_define_unary_function(round) + exprtk_define_unary_function(sin ) + exprtk_define_unary_function(sinc ) + exprtk_define_unary_function(sinh ) + exprtk_define_unary_function(sqrt ) + exprtk_define_unary_function(tan ) + exprtk_define_unary_function(tanh ) + exprtk_define_unary_function(cot ) + exprtk_define_unary_function(sec ) + exprtk_define_unary_function(csc ) + exprtk_define_unary_function(r2d ) + exprtk_define_unary_function(d2r ) + exprtk_define_unary_function(d2g ) + exprtk_define_unary_function(g2d ) + exprtk_define_unary_function(notl ) + exprtk_define_unary_function(sgn ) + exprtk_define_unary_function(erf ) + exprtk_define_unary_function(erfc ) + exprtk_define_unary_function(ncdf ) + exprtk_define_unary_function(frac ) + exprtk_define_unary_function(trunc) + #undef exprtk_define_unary_function + } + + template + inline T compute_pow10(T d, const int exponent) + { + static const double fract10[] = + { + 0.0, + 1.0E+001, 1.0E+002, 1.0E+003, 1.0E+004, 1.0E+005, 1.0E+006, 1.0E+007, 1.0E+008, 1.0E+009, 1.0E+010, + 1.0E+011, 1.0E+012, 1.0E+013, 1.0E+014, 1.0E+015, 1.0E+016, 1.0E+017, 1.0E+018, 1.0E+019, 1.0E+020, + 1.0E+021, 1.0E+022, 1.0E+023, 1.0E+024, 1.0E+025, 1.0E+026, 1.0E+027, 1.0E+028, 1.0E+029, 1.0E+030, + 1.0E+031, 1.0E+032, 1.0E+033, 1.0E+034, 1.0E+035, 1.0E+036, 1.0E+037, 1.0E+038, 1.0E+039, 1.0E+040, + 1.0E+041, 1.0E+042, 1.0E+043, 1.0E+044, 1.0E+045, 1.0E+046, 1.0E+047, 1.0E+048, 1.0E+049, 1.0E+050, + 1.0E+051, 1.0E+052, 1.0E+053, 1.0E+054, 1.0E+055, 1.0E+056, 1.0E+057, 1.0E+058, 1.0E+059, 1.0E+060, + 1.0E+061, 1.0E+062, 1.0E+063, 1.0E+064, 1.0E+065, 1.0E+066, 1.0E+067, 1.0E+068, 1.0E+069, 1.0E+070, + 1.0E+071, 1.0E+072, 1.0E+073, 1.0E+074, 1.0E+075, 1.0E+076, 1.0E+077, 1.0E+078, 1.0E+079, 1.0E+080, + 1.0E+081, 1.0E+082, 1.0E+083, 1.0E+084, 1.0E+085, 1.0E+086, 1.0E+087, 1.0E+088, 1.0E+089, 1.0E+090, + 1.0E+091, 1.0E+092, 1.0E+093, 1.0E+094, 1.0E+095, 1.0E+096, 1.0E+097, 1.0E+098, 1.0E+099, 1.0E+100, + 1.0E+101, 1.0E+102, 1.0E+103, 1.0E+104, 1.0E+105, 1.0E+106, 1.0E+107, 1.0E+108, 1.0E+109, 1.0E+110, + 1.0E+111, 1.0E+112, 1.0E+113, 1.0E+114, 1.0E+115, 1.0E+116, 1.0E+117, 1.0E+118, 1.0E+119, 1.0E+120, + 1.0E+121, 1.0E+122, 1.0E+123, 1.0E+124, 1.0E+125, 1.0E+126, 1.0E+127, 1.0E+128, 1.0E+129, 1.0E+130, + 1.0E+131, 1.0E+132, 1.0E+133, 1.0E+134, 1.0E+135, 1.0E+136, 1.0E+137, 1.0E+138, 1.0E+139, 1.0E+140, + 1.0E+141, 1.0E+142, 1.0E+143, 1.0E+144, 1.0E+145, 1.0E+146, 1.0E+147, 1.0E+148, 1.0E+149, 1.0E+150, + 1.0E+151, 1.0E+152, 1.0E+153, 1.0E+154, 1.0E+155, 1.0E+156, 1.0E+157, 1.0E+158, 1.0E+159, 1.0E+160, + 1.0E+161, 1.0E+162, 1.0E+163, 1.0E+164, 1.0E+165, 1.0E+166, 1.0E+167, 1.0E+168, 1.0E+169, 1.0E+170, + 1.0E+171, 1.0E+172, 1.0E+173, 1.0E+174, 1.0E+175, 1.0E+176, 1.0E+177, 1.0E+178, 1.0E+179, 1.0E+180, + 1.0E+181, 1.0E+182, 1.0E+183, 1.0E+184, 1.0E+185, 1.0E+186, 1.0E+187, 1.0E+188, 1.0E+189, 1.0E+190, + 1.0E+191, 1.0E+192, 1.0E+193, 1.0E+194, 1.0E+195, 1.0E+196, 1.0E+197, 1.0E+198, 1.0E+199, 1.0E+200, + 1.0E+201, 1.0E+202, 1.0E+203, 1.0E+204, 1.0E+205, 1.0E+206, 1.0E+207, 1.0E+208, 1.0E+209, 1.0E+210, + 1.0E+211, 1.0E+212, 1.0E+213, 1.0E+214, 1.0E+215, 1.0E+216, 1.0E+217, 1.0E+218, 1.0E+219, 1.0E+220, + 1.0E+221, 1.0E+222, 1.0E+223, 1.0E+224, 1.0E+225, 1.0E+226, 1.0E+227, 1.0E+228, 1.0E+229, 1.0E+230, + 1.0E+231, 1.0E+232, 1.0E+233, 1.0E+234, 1.0E+235, 1.0E+236, 1.0E+237, 1.0E+238, 1.0E+239, 1.0E+240, + 1.0E+241, 1.0E+242, 1.0E+243, 1.0E+244, 1.0E+245, 1.0E+246, 1.0E+247, 1.0E+248, 1.0E+249, 1.0E+250, + 1.0E+251, 1.0E+252, 1.0E+253, 1.0E+254, 1.0E+255, 1.0E+256, 1.0E+257, 1.0E+258, 1.0E+259, 1.0E+260, + 1.0E+261, 1.0E+262, 1.0E+263, 1.0E+264, 1.0E+265, 1.0E+266, 1.0E+267, 1.0E+268, 1.0E+269, 1.0E+270, + 1.0E+271, 1.0E+272, 1.0E+273, 1.0E+274, 1.0E+275, 1.0E+276, 1.0E+277, 1.0E+278, 1.0E+279, 1.0E+280, + 1.0E+281, 1.0E+282, 1.0E+283, 1.0E+284, 1.0E+285, 1.0E+286, 1.0E+287, 1.0E+288, 1.0E+289, 1.0E+290, + 1.0E+291, 1.0E+292, 1.0E+293, 1.0E+294, 1.0E+295, 1.0E+296, 1.0E+297, 1.0E+298, 1.0E+299, 1.0E+300, + 1.0E+301, 1.0E+302, 1.0E+303, 1.0E+304, 1.0E+305, 1.0E+306, 1.0E+307, 1.0E+308 + }; + + static const int fract10_size = static_cast(sizeof(fract10) / sizeof(double)); + + const int e = std::abs(exponent); + + if (exponent >= std::numeric_limits::min_exponent10) + { + if (e < fract10_size) + { + if (exponent > 0) + return T(d * fract10[e]); + else + return T(d / fract10[e]); + } + else + return T(d * std::pow(10.0, 10.0 * exponent)); + } + else + { + d /= T(fract10[ -std::numeric_limits::min_exponent10]); + return T(d / fract10[-exponent + std::numeric_limits::min_exponent10]); + } + } + + template + inline bool string_to_type_converter_impl_ref(Iterator& itr, const Iterator end, T& result) + { + if (itr == end) + return false; + + const bool negative = ('-' == (*itr)); + + if (negative || ('+' == (*itr))) + { + if (end == ++itr) + return false; + } + + static const uchar_t zero = static_cast('0'); + + while ((end != itr) && (zero == (*itr))) ++itr; + + bool return_result = true; + unsigned int digit = 0; + const std::size_t length = static_cast(std::distance(itr,end)); + + if (length <= 4) + { + exprtk_disable_fallthrough_begin + switch (length) + { + #ifdef exprtk_use_lut + + #define exprtk_process_digit \ + if ((digit = details::digit_table[(int)*itr++]) < 10) \ + result = result * 10 + (digit); \ + else \ + { \ + return_result = false; \ + break; \ + } \ + + #else + + #define exprtk_process_digit \ + if ((digit = (*itr++ - zero)) < 10) \ + result = result * T(10) + digit; \ + else \ + { \ + return_result = false; \ + break; \ + } \ + + #endif + + case 4 : exprtk_process_digit + case 3 : exprtk_process_digit + case 2 : exprtk_process_digit + case 1 : if ((digit = (*itr - zero))>= 10) + { + digit = 0; + return_result = false; + } + + #undef exprtk_process_digit + } + exprtk_disable_fallthrough_end + } + else + return_result = false; + + if (length && return_result) + { + result = result * 10 + static_cast(digit); + ++itr; + } + + result = negative ? -result : result; + return return_result; + } + + template + static inline bool parse_nan(Iterator& itr, const Iterator end, T& t) + { + typedef typename std::iterator_traits::value_type type; + + static const std::size_t nan_length = 3; + + if (std::distance(itr,end) != static_cast(nan_length)) + return false; + + if (static_cast('n') == (*itr)) + { + if ( + (static_cast('a') != *(itr + 1)) || + (static_cast('n') != *(itr + 2)) + ) + { + return false; + } + } + else if ( + (static_cast('A') != *(itr + 1)) || + (static_cast('N') != *(itr + 2)) + ) + { + return false; + } + + t = std::numeric_limits::quiet_NaN(); + + return true; + } + + template + static inline bool parse_inf(Iterator& itr, const Iterator end, T& t, const bool negative) + { + static const char_t inf_uc[] = "INFINITY"; + static const char_t inf_lc[] = "infinity"; + static const std::size_t inf_length = 8; + + const std::size_t length = static_cast(std::distance(itr,end)); + + if ((3 != length) && (inf_length != length)) + return false; + + char_cptr inf_itr = ('i' == (*itr)) ? inf_lc : inf_uc; + + while (end != itr) + { + if (*inf_itr == static_cast(*itr)) + { + ++itr; + ++inf_itr; + continue; + } + else + return false; + } + + if (negative) + t = -std::numeric_limits::infinity(); + else + t = std::numeric_limits::infinity(); + + return true; + } + + template + inline bool valid_exponent(const int exponent, numeric::details::real_type_tag) + { + using namespace details::numeric; + return (numeric_info::min_exp <= exponent) && (exponent <= numeric_info::max_exp); + } + + template + inline bool string_to_real(Iterator& itr_external, const Iterator end, T& t, numeric::details::real_type_tag) + { + if (end == itr_external) return false; + + Iterator itr = itr_external; + + T d = T(0); + + const bool negative = ('-' == (*itr)); + + if (negative || '+' == (*itr)) + { + if (end == ++itr) + return false; + } + + bool instate = false; + + static const char_t zero = static_cast('0'); + + #define parse_digit_1(d) \ + if ((digit = (*itr - zero)) < 10) \ + { d = d * T(10) + digit; } \ + else \ + { break; } \ + if (end == ++itr) break; \ + + #define parse_digit_2(d) \ + if ((digit = (*itr - zero)) < 10) \ + { d = d * T(10) + digit; } \ + else \ + { break; } \ + ++itr; \ + + if ('.' != (*itr)) + { + const Iterator curr = itr; + + while ((end != itr) && (zero == (*itr))) ++itr; + + while (end != itr) + { + unsigned int digit; + parse_digit_1(d) + parse_digit_1(d) + parse_digit_2(d) + } + + if (curr != itr) instate = true; + } + + int exponent = 0; + + if (end != itr) + { + if ('.' == (*itr)) + { + const Iterator curr = ++itr; + T tmp_d = T(0); + + while (end != itr) + { + unsigned int digit; + parse_digit_1(tmp_d) + parse_digit_1(tmp_d) + parse_digit_2(tmp_d) + } + + if (curr != itr) + { + instate = true; + + const int frac_exponent = static_cast(-std::distance(curr, itr)); + + if (!valid_exponent(frac_exponent, numeric::details::real_type_tag())) + return false; + + d += compute_pow10(tmp_d, frac_exponent); + } + + #undef parse_digit_1 + #undef parse_digit_2 + } + + if (end != itr) + { + typename std::iterator_traits::value_type c = (*itr); + + if (('e' == c) || ('E' == c)) + { + int exp = 0; + + if (!details::string_to_type_converter_impl_ref(++itr, end, exp)) + { + if (end == itr) + return false; + else + c = (*itr); + } + + exponent += exp; + } + + if (end != itr) + { + if (('f' == c) || ('F' == c) || ('l' == c) || ('L' == c)) + ++itr; + else if ('#' == c) + { + if (end == ++itr) + return false; + else if (('I' <= (*itr)) && ((*itr) <= 'n')) + { + if (('i' == (*itr)) || ('I' == (*itr))) + { + return parse_inf(itr, end, t, negative); + } + else if (('n' == (*itr)) || ('N' == (*itr))) + { + return parse_nan(itr, end, t); + } + else + return false; + } + else + return false; + } + else if (('I' <= (*itr)) && ((*itr) <= 'n')) + { + if (('i' == (*itr)) || ('I' == (*itr))) + { + return parse_inf(itr, end, t, negative); + } + else if (('n' == (*itr)) || ('N' == (*itr))) + { + return parse_nan(itr, end, t); + } + else + return false; + } + else + return false; + } + } + } + + if ((end != itr) || (!instate)) + return false; + else if (!valid_exponent(exponent, numeric::details::real_type_tag())) + return false; + else if (exponent) + d = compute_pow10(d,exponent); + + t = static_cast((negative) ? -d : d); + return true; + } + + template + inline bool string_to_real(const std::string& s, T& t) + { + const typename numeric::details::number_type::type num_type; + + char_cptr begin = s.data(); + char_cptr end = s.data() + s.size(); + + return string_to_real(begin, end, t, num_type); + } + + template + struct functor_t + { + /* + Note: The following definitions for Type, may require tweaking + based on the compiler and target architecture. The benchmark + should provide enough information to make the right choice. + */ + //typedef T Type; + //typedef const T Type; + typedef const T& Type; + typedef T& RefType; + typedef T (*qfunc_t)(Type t0, Type t1, Type t2, Type t3); + typedef T (*tfunc_t)(Type t0, Type t1, Type t2); + typedef T (*bfunc_t)(Type t0, Type t1); + typedef T (*ufunc_t)(Type t0); + }; + + } // namespace details + + struct loop_runtime_check + { + enum loop_types + { + e_invalid = 0, + e_for_loop = 1, + e_while_loop = 2, + e_repeat_until_loop = 4, + e_all_loops = 7 + }; + + enum violation_type + { + e_unknown = 0, + e_iteration_count = 1, + e_timeout = 2 + }; + + loop_types loop_set; + + loop_runtime_check() + : loop_set(e_invalid) + , max_loop_iterations(0) + {} + + details::_uint64_t max_loop_iterations; + + struct violation_context + { + loop_types loop; + violation_type violation; + details::_uint64_t iteration_count; + }; + + virtual bool check() + { + return true; + } + + virtual void handle_runtime_violation(const violation_context&) + { + throw std::runtime_error("ExprTk Loop run-time violation."); + } + + virtual ~loop_runtime_check() {} + }; + + typedef loop_runtime_check* loop_runtime_check_ptr; + + namespace lexer + { + struct token + { + enum token_type + { + e_none = 0, e_error = 1, e_err_symbol = 2, + e_err_number = 3, e_err_string = 4, e_err_sfunc = 5, + e_eof = 6, e_number = 7, e_symbol = 8, + e_string = 9, e_assign = 10, e_addass = 11, + e_subass = 12, e_mulass = 13, e_divass = 14, + e_modass = 15, e_shr = 16, e_shl = 17, + e_lte = 18, e_ne = 19, e_gte = 20, + e_swap = 21, e_lt = '<', e_gt = '>', + e_eq = '=', e_rbracket = ')', e_lbracket = '(', + e_rsqrbracket = ']', e_lsqrbracket = '[', e_rcrlbracket = '}', + e_lcrlbracket = '{', e_comma = ',', e_add = '+', + e_sub = '-', e_div = '/', e_mul = '*', + e_mod = '%', e_pow = '^', e_colon = ':', + e_ternary = '?' + }; + + token() + : type(e_none) + , value("") + , position(std::numeric_limits::max()) + {} + + void clear() + { + type = e_none; + value = ""; + position = std::numeric_limits::max(); + } + + template + inline token& set_operator(const token_type tt, + const Iterator begin, const Iterator end, + const Iterator base_begin = Iterator(0)) + { + type = tt; + value.assign(begin,end); + if (base_begin) + position = static_cast(std::distance(base_begin,begin)); + return (*this); + } + + template + inline token& set_symbol(const Iterator begin, const Iterator end, const Iterator base_begin = Iterator(0)) + { + type = e_symbol; + value.assign(begin,end); + if (base_begin) + position = static_cast(std::distance(base_begin,begin)); + return (*this); + } + + template + inline token& set_numeric(const Iterator begin, const Iterator end, const Iterator base_begin = Iterator(0)) + { + type = e_number; + value.assign(begin,end); + if (base_begin) + position = static_cast(std::distance(base_begin,begin)); + return (*this); + } + + template + inline token& set_string(const Iterator begin, const Iterator end, const Iterator base_begin = Iterator(0)) + { + type = e_string; + value.assign(begin,end); + if (base_begin) + position = static_cast(std::distance(base_begin,begin)); + return (*this); + } + + inline token& set_string(const std::string& s, const std::size_t p) + { + type = e_string; + value = s; + position = p; + return (*this); + } + + template + inline token& set_error(const token_type et, + const Iterator begin, const Iterator end, + const Iterator base_begin = Iterator(0)) + { + if ( + (e_error == et) || + (e_err_symbol == et) || + (e_err_number == et) || + (e_err_string == et) || + (e_err_sfunc == et) + ) + { + type = et; + } + else + type = e_error; + + value.assign(begin,end); + + if (base_begin) + position = static_cast(std::distance(base_begin,begin)); + + return (*this); + } + + static inline std::string to_str(token_type t) + { + switch (t) + { + case e_none : return "NONE"; + case e_error : return "ERROR"; + case e_err_symbol : return "ERROR_SYMBOL"; + case e_err_number : return "ERROR_NUMBER"; + case e_err_string : return "ERROR_STRING"; + case e_eof : return "EOF"; + case e_number : return "NUMBER"; + case e_symbol : return "SYMBOL"; + case e_string : return "STRING"; + case e_assign : return ":="; + case e_addass : return "+="; + case e_subass : return "-="; + case e_mulass : return "*="; + case e_divass : return "/="; + case e_modass : return "%="; + case e_shr : return ">>"; + case e_shl : return "<<"; + case e_lte : return "<="; + case e_ne : return "!="; + case e_gte : return ">="; + case e_lt : return "<"; + case e_gt : return ">"; + case e_eq : return "="; + case e_rbracket : return ")"; + case e_lbracket : return "("; + case e_rsqrbracket : return "]"; + case e_lsqrbracket : return "["; + case e_rcrlbracket : return "}"; + case e_lcrlbracket : return "{"; + case e_comma : return ","; + case e_add : return "+"; + case e_sub : return "-"; + case e_div : return "/"; + case e_mul : return "*"; + case e_mod : return "%"; + case e_pow : return "^"; + case e_colon : return ":"; + case e_ternary : return "?"; + case e_swap : return "<=>"; + default : return "UNKNOWN"; + } + } + + inline bool is_error() const + { + return ( + (e_error == type) || + (e_err_symbol == type) || + (e_err_number == type) || + (e_err_string == type) || + (e_err_sfunc == type) + ); + } + + token_type type; + std::string value; + std::size_t position; + }; + + class generator + { + public: + + typedef token token_t; + typedef std::vector token_list_t; + typedef token_list_t::iterator token_list_itr_t; + typedef details::char_t char_t; + + generator() + : base_itr_(0) + , s_itr_ (0) + , s_end_ (0) + { + clear(); + } + + inline void clear() + { + base_itr_ = 0; + s_itr_ = 0; + s_end_ = 0; + token_list_.clear(); + token_itr_ = token_list_.end(); + store_token_itr_ = token_list_.end(); + } + + inline bool process(const std::string& str) + { + base_itr_ = str.data(); + s_itr_ = str.data(); + s_end_ = str.data() + str.size(); + + eof_token_.set_operator(token_t::e_eof,s_end_,s_end_,base_itr_); + token_list_.clear(); + + while (!is_end(s_itr_)) + { + scan_token(); + + if (!token_list_.empty() && token_list_.back().is_error()) + return false; + } + + return true; + } + + inline bool empty() const + { + return token_list_.empty(); + } + + inline std::size_t size() const + { + return token_list_.size(); + } + + inline void begin() + { + token_itr_ = token_list_.begin(); + store_token_itr_ = token_list_.begin(); + } + + inline void store() + { + store_token_itr_ = token_itr_; + } + + inline void restore() + { + token_itr_ = store_token_itr_; + } + + inline token_t& next_token() + { + if (token_list_.end() != token_itr_) + { + return *token_itr_++; + } + else + return eof_token_; + } + + inline token_t& peek_next_token() + { + if (token_list_.end() != token_itr_) + { + return *token_itr_; + } + else + return eof_token_; + } + + inline token_t& operator[](const std::size_t& index) + { + if (index < token_list_.size()) + return token_list_[index]; + else + return eof_token_; + } + + inline token_t operator[](const std::size_t& index) const + { + if (index < token_list_.size()) + return token_list_[index]; + else + return eof_token_; + } + + inline bool finished() const + { + return (token_list_.end() == token_itr_); + } + + inline void insert_front(token_t::token_type tk_type) + { + if ( + !token_list_.empty() && + (token_list_.end() != token_itr_) + ) + { + token_t t = *token_itr_; + + t.type = tk_type; + token_itr_ = token_list_.insert(token_itr_,t); + } + } + + inline std::string substr(const std::size_t& begin, const std::size_t& end) const + { + const details::char_cptr begin_itr = ((base_itr_ + begin) < s_end_) ? (base_itr_ + begin) : s_end_; + const details::char_cptr end_itr = ((base_itr_ + end ) < s_end_) ? (base_itr_ + end ) : s_end_; + + return std::string(begin_itr,end_itr); + } + + inline std::string remaining() const + { + if (finished()) + return ""; + else if (token_list_.begin() != token_itr_) + return std::string(base_itr_ + (token_itr_ - 1)->position, s_end_); + else + return std::string(base_itr_ + token_itr_->position, s_end_); + } + + private: + + inline bool is_end(details::char_cptr itr) const + { + return (s_end_ == itr); + } + + #ifndef exprtk_disable_comments + inline bool is_comment_start(details::char_cptr itr) const + { + const char_t c0 = *(itr + 0); + const char_t c1 = *(itr + 1); + + if ('#' == c0) + return true; + else if (!is_end(itr + 1)) + { + if (('/' == c0) && ('/' == c1)) return true; + if (('/' == c0) && ('*' == c1)) return true; + } + return false; + } + #else + inline bool is_comment_start(details::char_cptr) const + { + return false; + } + #endif + + inline void skip_whitespace() + { + while (!is_end(s_itr_) && details::is_whitespace(*s_itr_)) + { + ++s_itr_; + } + } + + inline void skip_comments() + { + #ifndef exprtk_disable_comments + // The following comment styles are supported: + // 1. // .... \n + // 2. # .... \n + // 3. /* .... */ + struct test + { + static inline bool comment_start(const char_t c0, const char_t c1, int& mode, int& incr) + { + mode = 0; + if ('#' == c0) { mode = 1; incr = 1; } + else if ('/' == c0) + { + if ('/' == c1) { mode = 1; incr = 2; } + else if ('*' == c1) { mode = 2; incr = 2; } + } + return (0 != mode); + } + + static inline bool comment_end(const char_t c0, const char_t c1, int& mode) + { + if ( + ((1 == mode) && ('\n' == c0)) || + ((2 == mode) && ( '*' == c0) && ('/' == c1)) + ) + { + mode = 0; + return true; + } + else + return false; + } + }; + + int mode = 0; + int increment = 0; + + if (is_end(s_itr_)) + return; + else if (!test::comment_start(*s_itr_, *(s_itr_ + 1), mode, increment)) + return; + + details::char_cptr cmt_start = s_itr_; + + s_itr_ += increment; + + while (!is_end(s_itr_)) + { + if ((1 == mode) && test::comment_end(*s_itr_, 0, mode)) + { + ++s_itr_; + return; + } + + if ((2 == mode)) + { + if (!is_end((s_itr_ + 1)) && test::comment_end(*s_itr_, *(s_itr_ + 1), mode)) + { + s_itr_ += 2; + return; + } + } + + ++s_itr_; + } + + if (2 == mode) + { + token_t t; + t.set_error(token::e_error, cmt_start, cmt_start + mode, base_itr_); + token_list_.push_back(t); + } + #endif + } + + inline void scan_token() + { + if (details::is_whitespace(*s_itr_)) + { + skip_whitespace(); + return; + } + else if (is_comment_start(s_itr_)) + { + skip_comments(); + return; + } + else if (details::is_operator_char(*s_itr_)) + { + scan_operator(); + return; + } + else if (details::is_letter(*s_itr_)) + { + scan_symbol(); + return; + } + else if (details::is_digit((*s_itr_)) || ('.' == (*s_itr_))) + { + scan_number(); + return; + } + else if ('$' == (*s_itr_)) + { + scan_special_function(); + return; + } + #ifndef exprtk_disable_string_capabilities + else if ('\'' == (*s_itr_)) + { + scan_string(); + return; + } + #endif + else if ('~' == (*s_itr_)) + { + token_t t; + t.set_symbol(s_itr_, s_itr_ + 1, base_itr_); + token_list_.push_back(t); + ++s_itr_; + return; + } + else + { + token_t t; + t.set_error(token::e_error, s_itr_, s_itr_ + 2, base_itr_); + token_list_.push_back(t); + ++s_itr_; + } + } + + inline void scan_operator() + { + token_t t; + + const char_t c0 = s_itr_[0]; + + if (!is_end(s_itr_ + 1)) + { + const char_t c1 = s_itr_[1]; + + if (!is_end(s_itr_ + 2)) + { + const char_t c2 = s_itr_[2]; + + if ((c0 == '<') && (c1 == '=') && (c2 == '>')) + { + t.set_operator(token_t::e_swap, s_itr_, s_itr_ + 3, base_itr_); + token_list_.push_back(t); + s_itr_ += 3; + return; + } + } + + token_t::token_type ttype = token_t::e_none; + + if ((c0 == '<') && (c1 == '=')) ttype = token_t::e_lte; + else if ((c0 == '>') && (c1 == '=')) ttype = token_t::e_gte; + else if ((c0 == '<') && (c1 == '>')) ttype = token_t::e_ne; + else if ((c0 == '!') && (c1 == '=')) ttype = token_t::e_ne; + else if ((c0 == '=') && (c1 == '=')) ttype = token_t::e_eq; + else if ((c0 == ':') && (c1 == '=')) ttype = token_t::e_assign; + else if ((c0 == '<') && (c1 == '<')) ttype = token_t::e_shl; + else if ((c0 == '>') && (c1 == '>')) ttype = token_t::e_shr; + else if ((c0 == '+') && (c1 == '=')) ttype = token_t::e_addass; + else if ((c0 == '-') && (c1 == '=')) ttype = token_t::e_subass; + else if ((c0 == '*') && (c1 == '=')) ttype = token_t::e_mulass; + else if ((c0 == '/') && (c1 == '=')) ttype = token_t::e_divass; + else if ((c0 == '%') && (c1 == '=')) ttype = token_t::e_modass; + + if (token_t::e_none != ttype) + { + t.set_operator(ttype, s_itr_, s_itr_ + 2, base_itr_); + token_list_.push_back(t); + s_itr_ += 2; + return; + } + } + + if ('<' == c0) + t.set_operator(token_t::e_lt , s_itr_, s_itr_ + 1, base_itr_); + else if ('>' == c0) + t.set_operator(token_t::e_gt , s_itr_, s_itr_ + 1, base_itr_); + else if (';' == c0) + t.set_operator(token_t::e_eof, s_itr_, s_itr_ + 1, base_itr_); + else if ('&' == c0) + t.set_symbol(s_itr_, s_itr_ + 1, base_itr_); + else if ('|' == c0) + t.set_symbol(s_itr_, s_itr_ + 1, base_itr_); + else + t.set_operator(token_t::token_type(c0), s_itr_, s_itr_ + 1, base_itr_); + + token_list_.push_back(t); + ++s_itr_; + } + + inline void scan_symbol() + { + details::char_cptr initial_itr = s_itr_; + + while (!is_end(s_itr_)) + { + if (!details::is_letter_or_digit(*s_itr_) && ('_' != (*s_itr_))) + { + if ('.' != (*s_itr_)) + break; + /* + Permit symbols that contain a 'dot' + Allowed : abc.xyz, a123.xyz, abc.123, abc_.xyz a123_.xyz abc._123 + Disallowed: .abc, abc., abc., abc. + */ + if ( + (s_itr_ != initial_itr) && + !is_end(s_itr_ + 1) && + !details::is_letter_or_digit(*(s_itr_ + 1)) && + ('_' != (*(s_itr_ + 1))) + ) + break; + } + + ++s_itr_; + } + + token_t t; + t.set_symbol(initial_itr,s_itr_,base_itr_); + token_list_.push_back(t); + } + + inline void scan_number() + { + /* + Attempt to match a valid numeric value in one of the following formats: + (01) 123456 + (02) 123456. + (03) 123.456 + (04) 123.456e3 + (05) 123.456E3 + (06) 123.456e+3 + (07) 123.456E+3 + (08) 123.456e-3 + (09) 123.456E-3 + (00) .1234 + (11) .1234e3 + (12) .1234E+3 + (13) .1234e+3 + (14) .1234E-3 + (15) .1234e-3 + */ + + details::char_cptr initial_itr = s_itr_; + bool dot_found = false; + bool e_found = false; + bool post_e_sign_found = false; + bool post_e_digit_found = false; + token_t t; + + while (!is_end(s_itr_)) + { + if ('.' == (*s_itr_)) + { + if (dot_found) + { + t.set_error(token::e_err_number, initial_itr, s_itr_, base_itr_); + token_list_.push_back(t); + + return; + } + + dot_found = true; + ++s_itr_; + + continue; + } + else if ('e' == std::tolower(*s_itr_)) + { + const char_t& c = *(s_itr_ + 1); + + if (is_end(s_itr_ + 1)) + { + t.set_error(token::e_err_number, initial_itr, s_itr_, base_itr_); + token_list_.push_back(t); + + return; + } + else if ( + ('+' != c) && + ('-' != c) && + !details::is_digit(c) + ) + { + t.set_error(token::e_err_number, initial_itr, s_itr_, base_itr_); + token_list_.push_back(t); + + return; + } + + e_found = true; + ++s_itr_; + + continue; + } + else if (e_found && details::is_sign(*s_itr_) && !post_e_digit_found) + { + if (post_e_sign_found) + { + t.set_error(token::e_err_number, initial_itr, s_itr_, base_itr_); + token_list_.push_back(t); + + return; + } + + post_e_sign_found = true; + ++s_itr_; + + continue; + } + else if (e_found && details::is_digit(*s_itr_)) + { + post_e_digit_found = true; + ++s_itr_; + + continue; + } + else if (('.' != (*s_itr_)) && !details::is_digit(*s_itr_)) + break; + else + ++s_itr_; + } + + t.set_numeric(initial_itr, s_itr_, base_itr_); + token_list_.push_back(t); + + return; + } + + inline void scan_special_function() + { + details::char_cptr initial_itr = s_itr_; + token_t t; + + // $fdd(x,x,x) = at least 11 chars + if (std::distance(s_itr_,s_end_) < 11) + { + t.set_error( + token::e_err_sfunc, + initial_itr, std::min(initial_itr + 11, s_end_), + base_itr_); + token_list_.push_back(t); + + return; + } + + if ( + !(('$' == *s_itr_) && + (details::imatch ('f',*(s_itr_ + 1))) && + (details::is_digit(*(s_itr_ + 2))) && + (details::is_digit(*(s_itr_ + 3)))) + ) + { + t.set_error( + token::e_err_sfunc, + initial_itr, std::min(initial_itr + 4, s_end_), + base_itr_); + token_list_.push_back(t); + + return; + } + + s_itr_ += 4; // $fdd = 4chars + + t.set_symbol(initial_itr, s_itr_, base_itr_); + token_list_.push_back(t); + + return; + } + + #ifndef exprtk_disable_string_capabilities + inline void scan_string() + { + details::char_cptr initial_itr = s_itr_ + 1; + token_t t; + + if (std::distance(s_itr_,s_end_) < 2) + { + t.set_error(token::e_err_string, s_itr_, s_end_, base_itr_); + token_list_.push_back(t); + + return; + } + + ++s_itr_; + + bool escaped_found = false; + bool escaped = false; + + while (!is_end(s_itr_)) + { + if (!details::is_valid_string_char(*s_itr_)) + { + t.set_error(token::e_err_string, initial_itr, s_itr_, base_itr_); + token_list_.push_back(t); + + return; + } + else if (!escaped && ('\\' == *s_itr_)) + { + escaped_found = true; + escaped = true; + ++s_itr_; + + continue; + } + else if (!escaped) + { + if ('\'' == *s_itr_) + break; + } + else if (escaped) + { + if ( + !is_end(s_itr_) && ('0' == *(s_itr_)) && + ((s_itr_ + 4) <= s_end_) + ) + { + const bool x_seperator = ('X' == std::toupper(*(s_itr_ + 1))); + + const bool both_digits = details::is_hex_digit(*(s_itr_ + 2)) && + details::is_hex_digit(*(s_itr_ + 3)) ; + + if (!(x_seperator && both_digits)) + { + t.set_error(token::e_err_string, initial_itr, s_itr_, base_itr_); + token_list_.push_back(t); + + return; + } + else + s_itr_ += 3; + } + + escaped = false; + } + + ++s_itr_; + } + + if (is_end(s_itr_)) + { + t.set_error(token::e_err_string, initial_itr, s_itr_, base_itr_); + token_list_.push_back(t); + + return; + } + + if (!escaped_found) + t.set_string(initial_itr, s_itr_, base_itr_); + else + { + std::string parsed_string(initial_itr,s_itr_); + + if (!details::cleanup_escapes(parsed_string)) + { + t.set_error(token::e_err_string, initial_itr, s_itr_, base_itr_); + token_list_.push_back(t); + + return; + } + + t.set_string( + parsed_string, + static_cast(std::distance(base_itr_,initial_itr))); + } + + token_list_.push_back(t); + ++s_itr_; + + return; + } + #endif + + private: + + token_list_t token_list_; + token_list_itr_t token_itr_; + token_list_itr_t store_token_itr_; + token_t eof_token_; + details::char_cptr base_itr_; + details::char_cptr s_itr_; + details::char_cptr s_end_; + + friend class token_scanner; + friend class token_modifier; + friend class token_inserter; + friend class token_joiner; + }; // class generator + + class helper_interface + { + public: + + virtual void init() { } + virtual void reset() { } + virtual bool result() { return true; } + virtual std::size_t process(generator&) { return 0; } + virtual ~helper_interface() { } + }; + + class token_scanner : public helper_interface + { + public: + + virtual ~token_scanner() {} + + explicit token_scanner(const std::size_t& stride) + : stride_(stride) + { + if (stride > 4) + { + throw std::invalid_argument("token_scanner() - Invalid stride value"); + } + } + + inline std::size_t process(generator& g) exprtk_override + { + if (g.token_list_.size() >= stride_) + { + for (std::size_t i = 0; i < (g.token_list_.size() - stride_ + 1); ++i) + { + token t; + + switch (stride_) + { + case 1 : + { + const token& t0 = g.token_list_[i]; + + if (!operator()(t0)) + { + return i; + } + } + break; + + case 2 : + { + const token& t0 = g.token_list_[i ]; + const token& t1 = g.token_list_[i + 1]; + + if (!operator()(t0, t1)) + { + return i; + } + } + break; + + case 3 : + { + const token& t0 = g.token_list_[i ]; + const token& t1 = g.token_list_[i + 1]; + const token& t2 = g.token_list_[i + 2]; + + if (!operator()(t0, t1, t2)) + { + return i; + } + } + break; + + case 4 : + { + const token& t0 = g.token_list_[i ]; + const token& t1 = g.token_list_[i + 1]; + const token& t2 = g.token_list_[i + 2]; + const token& t3 = g.token_list_[i + 3]; + + if (!operator()(t0, t1, t2, t3)) + { + return i; + } + } + break; + } + } + } + + return (g.token_list_.size() - stride_ + 1); + } + + virtual bool operator() (const token&) + { + return false; + } + + virtual bool operator() (const token&, const token&) + { + return false; + } + + virtual bool operator() (const token&, const token&, const token&) + { + return false; + } + + virtual bool operator() (const token&, const token&, const token&, const token&) + { + return false; + } + + private: + + const std::size_t stride_; + }; // class token_scanner + + class token_modifier : public helper_interface + { + public: + + inline std::size_t process(generator& g) exprtk_override + { + std::size_t changes = 0; + + for (std::size_t i = 0; i < g.token_list_.size(); ++i) + { + if (modify(g.token_list_[i])) changes++; + } + + return changes; + } + + virtual bool modify(token& t) = 0; + }; + + class token_inserter : public helper_interface + { + public: + + explicit token_inserter(const std::size_t& stride) + : stride_(stride) + { + if (stride > 5) + { + throw std::invalid_argument("token_inserter() - Invalid stride value"); + } + } + + inline std::size_t process(generator& g) exprtk_override + { + if (g.token_list_.empty()) + return 0; + else if (g.token_list_.size() < stride_) + return 0; + + std::size_t changes = 0; + + typedef std::pair insert_t; + std::vector insert_list; + insert_list.reserve(10000); + + for (std::size_t i = 0; i < (g.token_list_.size() - stride_ + 1); ++i) + { + int insert_index = -1; + token t; + + switch (stride_) + { + case 1 : insert_index = insert(g.token_list_[i],t); + break; + + case 2 : insert_index = insert(g.token_list_[i], g.token_list_[i + 1], t); + break; + + case 3 : insert_index = insert(g.token_list_[i], g.token_list_[i + 1], g.token_list_[i + 2], t); + break; + + case 4 : insert_index = insert(g.token_list_[i], g.token_list_[i + 1], g.token_list_[i + 2], g.token_list_[i + 3], t); + break; + + case 5 : insert_index = insert(g.token_list_[i], g.token_list_[i + 1], g.token_list_[i + 2], g.token_list_[i + 3], g.token_list_[i + 4], t); + break; + } + + if ((insert_index >= 0) && (insert_index <= (static_cast(stride_) + 1))) + { + insert_list.push_back(insert_t(i, t)); + changes++; + } + } + + if (!insert_list.empty()) + { + generator::token_list_t token_list; + + std::size_t insert_index = 0; + + for (std::size_t i = 0; i < g.token_list_.size(); ++i) + { + token_list.push_back(g.token_list_[i]); + + if ( + (insert_index < insert_list.size()) && + (insert_list[insert_index].first == i) + ) + { + token_list.push_back(insert_list[insert_index].second); + insert_index++; + } + } + + std::swap(g.token_list_,token_list); + } + + return changes; + } + + #define token_inserter_empty_body \ + { \ + return -1; \ + } \ + + inline virtual int insert(const token&, token&) + token_inserter_empty_body + + inline virtual int insert(const token&, const token&, token&) + token_inserter_empty_body + + inline virtual int insert(const token&, const token&, const token&, token&) + token_inserter_empty_body + + inline virtual int insert(const token&, const token&, const token&, const token&, token&) + token_inserter_empty_body + + inline virtual int insert(const token&, const token&, const token&, const token&, const token&, token&) + token_inserter_empty_body + + #undef token_inserter_empty_body + + private: + + const std::size_t stride_; + }; + + class token_joiner : public helper_interface + { + public: + + explicit token_joiner(const std::size_t& stride) + : stride_(stride) + {} + + inline std::size_t process(generator& g) exprtk_override + { + if (g.token_list_.empty()) + return 0; + + switch (stride_) + { + case 2 : return process_stride_2(g); + case 3 : return process_stride_3(g); + default : return 0; + } + } + + virtual bool join(const token&, const token&, token&) { return false; } + virtual bool join(const token&, const token&, const token&, token&) { return false; } + + private: + + inline std::size_t process_stride_2(generator& g) + { + if (g.token_list_.size() < 2) + return 0; + + std::size_t changes = 0; + + generator::token_list_t token_list; + token_list.reserve(10000); + + for (int i = 0; i < static_cast(g.token_list_.size() - 1); ++i) + { + token t; + + for ( ; ; ) + { + if (!join(g[i], g[i + 1], t)) + { + token_list.push_back(g[i]); + break; + } + + token_list.push_back(t); + + ++changes; + + i+=2; + + if (static_cast(i) >= (g.token_list_.size() - 1)) + break; + } + } + + token_list.push_back(g.token_list_.back()); + + assert(token_list.size() <= g.token_list_.size()); + + std::swap(token_list, g.token_list_); + + return changes; + } + + inline std::size_t process_stride_3(generator& g) + { + if (g.token_list_.size() < 3) + return 0; + + std::size_t changes = 0; + + generator::token_list_t token_list; + token_list.reserve(10000); + + for (int i = 0; i < static_cast(g.token_list_.size() - 2); ++i) + { + token t; + + for ( ; ; ) + { + if (!join(g[i], g[i + 1], g[i + 2], t)) + { + token_list.push_back(g[i]); + break; + } + + token_list.push_back(t); + + ++changes; + + i+=3; + + if (static_cast(i) >= (g.token_list_.size() - 2)) + break; + } + } + + token_list.push_back(*(g.token_list_.begin() + g.token_list_.size() - 2)); + token_list.push_back(*(g.token_list_.begin() + g.token_list_.size() - 1)); + + assert(token_list.size() <= g.token_list_.size()); + + std::swap(token_list, g.token_list_); + + return changes; + } + + const std::size_t stride_; + }; + + namespace helper + { + + inline void dump(const lexer::generator& generator) + { + for (std::size_t i = 0; i < generator.size(); ++i) + { + const lexer::token& t = generator[i]; + printf("Token[%02d] @ %03d %6s --> '%s'\n", + static_cast(i), + static_cast(t.position), + t.to_str(t.type).c_str(), + t.value.c_str()); + } + } + + class commutative_inserter : public lexer::token_inserter + { + public: + + using lexer::token_inserter::insert; + + commutative_inserter() + : lexer::token_inserter(2) + {} + + inline void ignore_symbol(const std::string& symbol) + { + ignore_set_.insert(symbol); + } + + inline int insert(const lexer::token& t0, const lexer::token& t1, lexer::token& new_token) exprtk_override + { + bool match = false; + new_token.type = lexer::token::e_mul; + new_token.value = "*"; + new_token.position = t1.position; + + if (t0.type == lexer::token::e_symbol) + { + if (ignore_set_.end() != ignore_set_.find(t0.value)) + { + return -1; + } + else if (!t0.value.empty() && ('$' == t0.value[0])) + { + return -1; + } + } + + if (t1.type == lexer::token::e_symbol) + { + if (ignore_set_.end() != ignore_set_.find(t1.value)) + { + return -1; + } + } + if ((t0.type == lexer::token::e_number ) && (t1.type == lexer::token::e_symbol )) match = true; + else if ((t0.type == lexer::token::e_number ) && (t1.type == lexer::token::e_lbracket )) match = true; + else if ((t0.type == lexer::token::e_number ) && (t1.type == lexer::token::e_lcrlbracket)) match = true; + else if ((t0.type == lexer::token::e_number ) && (t1.type == lexer::token::e_lsqrbracket)) match = true; + else if ((t0.type == lexer::token::e_symbol ) && (t1.type == lexer::token::e_number )) match = true; + else if ((t0.type == lexer::token::e_rbracket ) && (t1.type == lexer::token::e_number )) match = true; + else if ((t0.type == lexer::token::e_rcrlbracket) && (t1.type == lexer::token::e_number )) match = true; + else if ((t0.type == lexer::token::e_rsqrbracket) && (t1.type == lexer::token::e_number )) match = true; + else if ((t0.type == lexer::token::e_rbracket ) && (t1.type == lexer::token::e_symbol )) match = true; + else if ((t0.type == lexer::token::e_rcrlbracket) && (t1.type == lexer::token::e_symbol )) match = true; + else if ((t0.type == lexer::token::e_rsqrbracket) && (t1.type == lexer::token::e_symbol )) match = true; + else if ((t0.type == lexer::token::e_symbol ) && (t1.type == lexer::token::e_symbol )) match = true; + + return (match) ? 1 : -1; + } + + private: + + std::set ignore_set_; + }; + + class operator_joiner : public token_joiner + { + public: + + explicit operator_joiner(const std::size_t& stride) + : token_joiner(stride) + {} + + inline bool join(const lexer::token& t0, const lexer::token& t1, lexer::token& t) exprtk_override + { + // ': =' --> ':=' + if ((t0.type == lexer::token::e_colon) && (t1.type == lexer::token::e_eq)) + { + t.type = lexer::token::e_assign; + t.value = ":="; + t.position = t0.position; + + return true; + } + // '+ =' --> '+=' + else if ((t0.type == lexer::token::e_add) && (t1.type == lexer::token::e_eq)) + { + t.type = lexer::token::e_addass; + t.value = "+="; + t.position = t0.position; + + return true; + } + // '- =' --> '-=' + else if ((t0.type == lexer::token::e_sub) && (t1.type == lexer::token::e_eq)) + { + t.type = lexer::token::e_subass; + t.value = "-="; + t.position = t0.position; + + return true; + } + // '* =' --> '*=' + else if ((t0.type == lexer::token::e_mul) && (t1.type == lexer::token::e_eq)) + { + t.type = lexer::token::e_mulass; + t.value = "*="; + t.position = t0.position; + + return true; + } + // '/ =' --> '/=' + else if ((t0.type == lexer::token::e_div) && (t1.type == lexer::token::e_eq)) + { + t.type = lexer::token::e_divass; + t.value = "/="; + t.position = t0.position; + + return true; + } + // '% =' --> '%=' + else if ((t0.type == lexer::token::e_mod) && (t1.type == lexer::token::e_eq)) + { + t.type = lexer::token::e_modass; + t.value = "%="; + t.position = t0.position; + + return true; + } + // '> =' --> '>=' + else if ((t0.type == lexer::token::e_gt) && (t1.type == lexer::token::e_eq)) + { + t.type = lexer::token::e_gte; + t.value = ">="; + t.position = t0.position; + + return true; + } + // '< =' --> '<=' + else if ((t0.type == lexer::token::e_lt) && (t1.type == lexer::token::e_eq)) + { + t.type = lexer::token::e_lte; + t.value = "<="; + t.position = t0.position; + + return true; + } + // '= =' --> '==' + else if ((t0.type == lexer::token::e_eq) && (t1.type == lexer::token::e_eq)) + { + t.type = lexer::token::e_eq; + t.value = "=="; + t.position = t0.position; + + return true; + } + // '! =' --> '!=' + else if ((static_cast(t0.type) == '!') && (t1.type == lexer::token::e_eq)) + { + t.type = lexer::token::e_ne; + t.value = "!="; + t.position = t0.position; + + return true; + } + // '< >' --> '<>' + else if ((t0.type == lexer::token::e_lt) && (t1.type == lexer::token::e_gt)) + { + t.type = lexer::token::e_ne; + t.value = "<>"; + t.position = t0.position; + + return true; + } + // '<= >' --> '<=>' + else if ((t0.type == lexer::token::e_lte) && (t1.type == lexer::token::e_gt)) + { + t.type = lexer::token::e_swap; + t.value = "<=>"; + t.position = t0.position; + + return true; + } + // '+ -' --> '-' + else if ((t0.type == lexer::token::e_add) && (t1.type == lexer::token::e_sub)) + { + t.type = lexer::token::e_sub; + t.value = "-"; + t.position = t0.position; + + return true; + } + // '- +' --> '-' + else if ((t0.type == lexer::token::e_sub) && (t1.type == lexer::token::e_add)) + { + t.type = lexer::token::e_sub; + t.value = "-"; + t.position = t0.position; + + return true; + } + // '- -' --> '+' + else if ((t0.type == lexer::token::e_sub) && (t1.type == lexer::token::e_sub)) + { + /* + Note: May need to reconsider this when wanting to implement + pre/postfix decrement operator + */ + t.type = lexer::token::e_add; + t.value = "+"; + t.position = t0.position; + + return true; + } + else + return false; + } + + inline bool join(const lexer::token& t0, + const lexer::token& t1, + const lexer::token& t2, + lexer::token& t) exprtk_override + { + // '[ * ]' --> '[*]' + if ( + (t0.type == lexer::token::e_lsqrbracket) && + (t1.type == lexer::token::e_mul ) && + (t2.type == lexer::token::e_rsqrbracket) + ) + { + t.type = lexer::token::e_symbol; + t.value = "[*]"; + t.position = t0.position; + + return true; + } + else + return false; + } + }; + + class bracket_checker : public lexer::token_scanner + { + public: + + using lexer::token_scanner::operator(); + + bracket_checker() + : token_scanner(1) + , state_(true) + {} + + bool result() + { + if (!stack_.empty()) + { + lexer::token t; + t.value = stack_.top().first; + t.position = stack_.top().second; + error_token_ = t; + state_ = false; + + return false; + } + else + return state_; + } + + lexer::token error_token() + { + return error_token_; + } + + void reset() + { + // Why? because msvc doesn't support swap properly. + stack_ = std::stack >(); + state_ = true; + error_token_.clear(); + } + + bool operator() (const lexer::token& t) + { + if ( + !t.value.empty() && + (lexer::token::e_string != t.type) && + (lexer::token::e_symbol != t.type) && + exprtk::details::is_bracket(t.value[0]) + ) + { + details::char_t c = t.value[0]; + + if (t.type == lexer::token::e_lbracket ) stack_.push(std::make_pair(')',t.position)); + else if (t.type == lexer::token::e_lcrlbracket) stack_.push(std::make_pair('}',t.position)); + else if (t.type == lexer::token::e_lsqrbracket) stack_.push(std::make_pair(']',t.position)); + else if (exprtk::details::is_right_bracket(c)) + { + if (stack_.empty()) + { + state_ = false; + error_token_ = t; + + return false; + } + else if (c != stack_.top().first) + { + state_ = false; + error_token_ = t; + + return false; + } + else + stack_.pop(); + } + } + + return true; + } + + private: + + bool state_; + std::stack > stack_; + lexer::token error_token_; + }; + + template + class numeric_checker exprtk_final : public lexer::token_scanner + { + public: + + using lexer::token_scanner::operator(); + + numeric_checker() + : token_scanner (1) + , current_index_(0) + {} + + bool result() + { + return error_list_.empty(); + } + + void reset() + { + error_list_.clear(); + current_index_ = 0; + } + + bool operator() (const lexer::token& t) + { + if (token::e_number == t.type) + { + T v; + + if (!exprtk::details::string_to_real(t.value,v)) + { + error_list_.push_back(current_index_); + } + } + + ++current_index_; + + return true; + } + + std::size_t error_count() const + { + return error_list_.size(); + } + + std::size_t error_index(const std::size_t& i) + { + if (i < error_list_.size()) + return error_list_[i]; + else + return std::numeric_limits::max(); + } + + void clear_errors() + { + error_list_.clear(); + } + + private: + + std::size_t current_index_; + std::vector error_list_; + }; + + class symbol_replacer : public lexer::token_modifier + { + private: + + typedef std::map,details::ilesscompare> replace_map_t; + + public: + + bool remove(const std::string& target_symbol) + { + const replace_map_t::iterator itr = replace_map_.find(target_symbol); + + if (replace_map_.end() == itr) + return false; + + replace_map_.erase(itr); + + return true; + } + + bool add_replace(const std::string& target_symbol, + const std::string& replace_symbol, + const lexer::token::token_type token_type = lexer::token::e_symbol) + { + const replace_map_t::iterator itr = replace_map_.find(target_symbol); + + if (replace_map_.end() != itr) + { + return false; + } + + replace_map_[target_symbol] = std::make_pair(replace_symbol,token_type); + + return true; + } + + void clear() + { + replace_map_.clear(); + } + + private: + + bool modify(lexer::token& t) + { + if (lexer::token::e_symbol == t.type) + { + if (replace_map_.empty()) + return false; + + const replace_map_t::iterator itr = replace_map_.find(t.value); + + if (replace_map_.end() != itr) + { + t.value = itr->second.first; + t.type = itr->second.second; + + return true; + } + } + + return false; + } + + replace_map_t replace_map_; + }; + + class sequence_validator exprtk_final : public lexer::token_scanner + { + private: + + typedef std::pair token_pair_t; + typedef std::set set_t; + + public: + + using lexer::token_scanner::operator(); + + sequence_validator() + : lexer::token_scanner(2) + { + add_invalid(lexer::token::e_number, lexer::token::e_number); + add_invalid(lexer::token::e_string, lexer::token::e_string); + add_invalid(lexer::token::e_number, lexer::token::e_string); + add_invalid(lexer::token::e_string, lexer::token::e_number); + + add_invalid_set1(lexer::token::e_assign ); + add_invalid_set1(lexer::token::e_shr ); + add_invalid_set1(lexer::token::e_shl ); + add_invalid_set1(lexer::token::e_lte ); + add_invalid_set1(lexer::token::e_ne ); + add_invalid_set1(lexer::token::e_gte ); + add_invalid_set1(lexer::token::e_lt ); + add_invalid_set1(lexer::token::e_gt ); + add_invalid_set1(lexer::token::e_eq ); + add_invalid_set1(lexer::token::e_comma ); + add_invalid_set1(lexer::token::e_add ); + add_invalid_set1(lexer::token::e_sub ); + add_invalid_set1(lexer::token::e_div ); + add_invalid_set1(lexer::token::e_mul ); + add_invalid_set1(lexer::token::e_mod ); + add_invalid_set1(lexer::token::e_pow ); + add_invalid_set1(lexer::token::e_colon ); + add_invalid_set1(lexer::token::e_ternary); + } + + bool result() + { + return error_list_.empty(); + } + + bool operator() (const lexer::token& t0, const lexer::token& t1) + { + const set_t::value_type p = std::make_pair(t0.type,t1.type); + + if (invalid_bracket_check(t0.type,t1.type)) + { + error_list_.push_back(std::make_pair(t0,t1)); + } + else if (invalid_comb_.find(p) != invalid_comb_.end()) + { + error_list_.push_back(std::make_pair(t0,t1)); + } + + return true; + } + + std::size_t error_count() const + { + return error_list_.size(); + } + + std::pair error(const std::size_t index) + { + if (index < error_list_.size()) + { + return error_list_[index]; + } + else + { + static const lexer::token error_token; + return std::make_pair(error_token,error_token); + } + } + + void clear_errors() + { + error_list_.clear(); + } + + private: + + void add_invalid(const lexer::token::token_type base, const lexer::token::token_type t) + { + invalid_comb_.insert(std::make_pair(base,t)); + } + + void add_invalid_set1(const lexer::token::token_type t) + { + add_invalid(t, lexer::token::e_assign); + add_invalid(t, lexer::token::e_shr ); + add_invalid(t, lexer::token::e_shl ); + add_invalid(t, lexer::token::e_lte ); + add_invalid(t, lexer::token::e_ne ); + add_invalid(t, lexer::token::e_gte ); + add_invalid(t, lexer::token::e_lt ); + add_invalid(t, lexer::token::e_gt ); + add_invalid(t, lexer::token::e_eq ); + add_invalid(t, lexer::token::e_comma ); + add_invalid(t, lexer::token::e_div ); + add_invalid(t, lexer::token::e_mul ); + add_invalid(t, lexer::token::e_mod ); + add_invalid(t, lexer::token::e_pow ); + add_invalid(t, lexer::token::e_colon ); + } + + bool invalid_bracket_check(const lexer::token::token_type base, const lexer::token::token_type t) + { + if (details::is_right_bracket(static_cast(base))) + { + switch (t) + { + case lexer::token::e_assign : return (']' != base); + case lexer::token::e_string : return (')' != base); + default : return false; + } + } + else if (details::is_left_bracket(static_cast(base))) + { + if (details::is_right_bracket(static_cast(t))) + return false; + else if (details::is_left_bracket(static_cast(t))) + return false; + else + { + switch (t) + { + case lexer::token::e_number : return false; + case lexer::token::e_symbol : return false; + case lexer::token::e_string : return false; + case lexer::token::e_add : return false; + case lexer::token::e_sub : return false; + case lexer::token::e_colon : return false; + case lexer::token::e_ternary : return false; + default : return true ; + } + } + } + else if (details::is_right_bracket(static_cast(t))) + { + switch (base) + { + case lexer::token::e_number : return false; + case lexer::token::e_symbol : return false; + case lexer::token::e_string : return false; + case lexer::token::e_eof : return false; + case lexer::token::e_colon : return false; + case lexer::token::e_ternary : return false; + default : return true ; + } + } + else if (details::is_left_bracket(static_cast(t))) + { + switch (base) + { + case lexer::token::e_rbracket : return true; + case lexer::token::e_rsqrbracket : return true; + case lexer::token::e_rcrlbracket : return true; + default : return false; + } + } + + return false; + } + + set_t invalid_comb_; + std::vector > error_list_; + }; + + class sequence_validator_3tokens exprtk_final : public lexer::token_scanner + { + private: + + typedef lexer::token::token_type token_t; + typedef std::pair > token_triplet_t; + typedef std::set set_t; + + public: + + using lexer::token_scanner::operator(); + + sequence_validator_3tokens() + : lexer::token_scanner(3) + { + add_invalid(lexer::token::e_number , lexer::token::e_number , lexer::token::e_number); + add_invalid(lexer::token::e_string , lexer::token::e_string , lexer::token::e_string); + add_invalid(lexer::token::e_comma , lexer::token::e_comma , lexer::token::e_comma ); + + add_invalid(lexer::token::e_add , lexer::token::e_add , lexer::token::e_add ); + add_invalid(lexer::token::e_sub , lexer::token::e_sub , lexer::token::e_sub ); + add_invalid(lexer::token::e_div , lexer::token::e_div , lexer::token::e_div ); + add_invalid(lexer::token::e_mul , lexer::token::e_mul , lexer::token::e_mul ); + add_invalid(lexer::token::e_mod , lexer::token::e_mod , lexer::token::e_mod ); + add_invalid(lexer::token::e_pow , lexer::token::e_pow , lexer::token::e_pow ); + + add_invalid(lexer::token::e_add , lexer::token::e_sub , lexer::token::e_add ); + add_invalid(lexer::token::e_sub , lexer::token::e_add , lexer::token::e_sub ); + add_invalid(lexer::token::e_div , lexer::token::e_mul , lexer::token::e_div ); + add_invalid(lexer::token::e_mul , lexer::token::e_div , lexer::token::e_mul ); + add_invalid(lexer::token::e_mod , lexer::token::e_pow , lexer::token::e_mod ); + add_invalid(lexer::token::e_pow , lexer::token::e_mod , lexer::token::e_pow ); + } + + bool result() + { + return error_list_.empty(); + } + + bool operator() (const lexer::token& t0, const lexer::token& t1, const lexer::token& t2) + { + const set_t::value_type p = std::make_pair(t0.type,std::make_pair(t1.type,t2.type)); + + if (invalid_comb_.find(p) != invalid_comb_.end()) + { + error_list_.push_back(std::make_pair(t0,t1)); + } + + return true; + } + + std::size_t error_count() const + { + return error_list_.size(); + } + + std::pair error(const std::size_t index) + { + if (index < error_list_.size()) + { + return error_list_[index]; + } + else + { + static const lexer::token error_token; + return std::make_pair(error_token,error_token); + } + } + + void clear_errors() + { + error_list_.clear(); + } + + private: + + void add_invalid(const token_t t0, const token_t t1, const token_t t2) + { + invalid_comb_.insert(std::make_pair(t0,std::make_pair(t1,t2))); + } + + set_t invalid_comb_; + std::vector > error_list_; + }; + + struct helper_assembly + { + inline bool register_scanner(lexer::token_scanner* scanner) + { + if (token_scanner_list.end() != std::find(token_scanner_list.begin(), + token_scanner_list.end (), + scanner)) + { + return false; + } + + token_scanner_list.push_back(scanner); + + return true; + } + + inline bool register_modifier(lexer::token_modifier* modifier) + { + if (token_modifier_list.end() != std::find(token_modifier_list.begin(), + token_modifier_list.end (), + modifier)) + { + return false; + } + + token_modifier_list.push_back(modifier); + + return true; + } + + inline bool register_joiner(lexer::token_joiner* joiner) + { + if (token_joiner_list.end() != std::find(token_joiner_list.begin(), + token_joiner_list.end (), + joiner)) + { + return false; + } + + token_joiner_list.push_back(joiner); + + return true; + } + + inline bool register_inserter(lexer::token_inserter* inserter) + { + if (token_inserter_list.end() != std::find(token_inserter_list.begin(), + token_inserter_list.end (), + inserter)) + { + return false; + } + + token_inserter_list.push_back(inserter); + + return true; + } + + inline bool run_modifiers(lexer::generator& g) + { + error_token_modifier = reinterpret_cast(0); + + for (std::size_t i = 0; i < token_modifier_list.size(); ++i) + { + lexer::token_modifier& modifier = (*token_modifier_list[i]); + + modifier.reset(); + modifier.process(g); + + if (!modifier.result()) + { + error_token_modifier = token_modifier_list[i]; + + return false; + } + } + + return true; + } + + inline bool run_joiners(lexer::generator& g) + { + error_token_joiner = reinterpret_cast(0); + + for (std::size_t i = 0; i < token_joiner_list.size(); ++i) + { + lexer::token_joiner& joiner = (*token_joiner_list[i]); + + joiner.reset(); + joiner.process(g); + + if (!joiner.result()) + { + error_token_joiner = token_joiner_list[i]; + + return false; + } + } + + return true; + } + + inline bool run_inserters(lexer::generator& g) + { + error_token_inserter = reinterpret_cast(0); + + for (std::size_t i = 0; i < token_inserter_list.size(); ++i) + { + lexer::token_inserter& inserter = (*token_inserter_list[i]); + + inserter.reset(); + inserter.process(g); + + if (!inserter.result()) + { + error_token_inserter = token_inserter_list[i]; + + return false; + } + } + + return true; + } + + inline bool run_scanners(lexer::generator& g) + { + error_token_scanner = reinterpret_cast(0); + + for (std::size_t i = 0; i < token_scanner_list.size(); ++i) + { + lexer::token_scanner& scanner = (*token_scanner_list[i]); + + scanner.reset(); + scanner.process(g); + + if (!scanner.result()) + { + error_token_scanner = token_scanner_list[i]; + + return false; + } + } + + return true; + } + + std::vector token_scanner_list; + std::vector token_modifier_list; + std::vector token_joiner_list; + std::vector token_inserter_list; + + lexer::token_scanner* error_token_scanner; + lexer::token_modifier* error_token_modifier; + lexer::token_joiner* error_token_joiner; + lexer::token_inserter* error_token_inserter; + }; + } + + class parser_helper + { + public: + + typedef token token_t; + typedef generator generator_t; + + inline bool init(const std::string& str) + { + if (!lexer_.process(str)) + { + return false; + } + + lexer_.begin(); + + next_token(); + + return true; + } + + inline generator_t& lexer() + { + return lexer_; + } + + inline const generator_t& lexer() const + { + return lexer_; + } + + inline void store_token() + { + lexer_.store(); + store_current_token_ = current_token_; + } + + inline void restore_token() + { + lexer_.restore(); + current_token_ = store_current_token_; + } + + inline void next_token() + { + current_token_ = lexer_.next_token(); + } + + inline const token_t& current_token() const + { + return current_token_; + } + + enum token_advance_mode + { + e_hold = 0, + e_advance = 1 + }; + + inline void advance_token(const token_advance_mode mode) + { + if (e_advance == mode) + { + next_token(); + } + } + + inline bool token_is(const token_t::token_type& ttype, const token_advance_mode mode = e_advance) + { + if (current_token().type != ttype) + { + return false; + } + + advance_token(mode); + + return true; + } + + inline bool token_is(const token_t::token_type& ttype, + const std::string& value, + const token_advance_mode mode = e_advance) + { + if ( + (current_token().type != ttype) || + !exprtk::details::imatch(value,current_token().value) + ) + { + return false; + } + + advance_token(mode); + + return true; + } + + inline bool peek_token_is(const token_t::token_type& ttype) + { + return (lexer_.peek_next_token().type == ttype); + } + + inline bool peek_token_is(const std::string& s) + { + return (exprtk::details::imatch(lexer_.peek_next_token().value,s)); + } + + private: + + generator_t lexer_; + token_t current_token_; + token_t store_current_token_; + }; + } + + template + class vector_view + { + public: + + typedef T* data_ptr_t; + + vector_view(data_ptr_t data, const std::size_t& size) + : size_(size) + , data_(data) + , data_ref_(0) + {} + + vector_view(const vector_view& vv) + : size_(vv.size_) + , data_(vv.data_) + , data_ref_(0) + {} + + inline void rebase(data_ptr_t data) + { + data_ = data; + + if (!data_ref_.empty()) + { + for (std::size_t i = 0; i < data_ref_.size(); ++i) + { + (*data_ref_[i]) = data; + } + } + } + + inline data_ptr_t data() const + { + return data_; + } + + inline std::size_t size() const + { + return size_; + } + + inline const T& operator[](const std::size_t index) const + { + return data_[index]; + } + + inline T& operator[](const std::size_t index) + { + return data_[index]; + } + + void set_ref(data_ptr_t* data_ref) + { + data_ref_.push_back(data_ref); + } + + private: + + const std::size_t size_; + data_ptr_t data_; + std::vector data_ref_; + }; + + template + inline vector_view make_vector_view(T* data, + const std::size_t size, const std::size_t offset = 0) + { + return vector_view(data + offset, size); + } + + template + inline vector_view make_vector_view(std::vector& v, + const std::size_t size, const std::size_t offset = 0) + { + return vector_view(v.data() + offset, size); + } + + template class results_context; + + template + struct type_store + { + enum store_type + { + e_unknown, + e_scalar , + e_vector , + e_string + }; + + type_store() + : data(0) + , size(0) + , type(e_unknown) + {} + + union + { + void* data; + T* vec_data; + }; + + std::size_t size; + store_type type; + + class parameter_list + { + public: + + explicit parameter_list(std::vector& pl) + : parameter_list_(pl) + {} + + inline bool empty() const + { + return parameter_list_.empty(); + } + + inline std::size_t size() const + { + return parameter_list_.size(); + } + + inline type_store& operator[](const std::size_t& index) + { + return parameter_list_[index]; + } + + inline const type_store& operator[](const std::size_t& index) const + { + return parameter_list_[index]; + } + + inline type_store& front() + { + return parameter_list_[0]; + } + + inline const type_store& front() const + { + return parameter_list_[0]; + } + + inline type_store& back() + { + return parameter_list_.back(); + } + + inline const type_store& back() const + { + return parameter_list_.back(); + } + + private: + + std::vector& parameter_list_; + + friend class results_context; + }; + + template + struct type_view + { + typedef type_store type_store_t; + typedef ViewType value_t; + + explicit type_view(type_store_t& ts) + : ts_(ts) + , data_(reinterpret_cast(ts_.data)) + {} + + explicit type_view(const type_store_t& ts) + : ts_(const_cast(ts)) + , data_(reinterpret_cast(ts_.data)) + {} + + inline std::size_t size() const + { + return ts_.size; + } + + inline value_t& operator[](const std::size_t& i) + { + return data_[i]; + } + + inline const value_t& operator[](const std::size_t& i) const + { + return data_[i]; + } + + inline const value_t* begin() const { return data_; } + inline value_t* begin() { return data_; } + + inline const value_t* end() const + { + return static_cast(data_ + ts_.size); + } + + inline value_t* end() + { + return static_cast(data_ + ts_.size); + } + + type_store_t& ts_; + value_t* data_; + }; + + typedef type_view vector_view; + typedef type_view string_view; + + struct scalar_view + { + typedef type_store type_store_t; + typedef T value_t; + + explicit scalar_view(type_store_t& ts) + : v_(*reinterpret_cast(ts.data)) + {} + + explicit scalar_view(const type_store_t& ts) + : v_(*reinterpret_cast(const_cast(ts).data)) + {} + + inline value_t& operator() () + { + return v_; + } + + inline const value_t& operator() () const + { + return v_; + } + + template + inline bool to_int(IntType& i) const + { + if (!exprtk::details::numeric::is_integer(v_)) + return false; + + i = static_cast(v_); + + return true; + } + + template + inline bool to_uint(UIntType& u) const + { + if (v_ < T(0)) + return false; + else if (!exprtk::details::numeric::is_integer(v_)) + return false; + + u = static_cast(v_); + + return true; + } + + T& v_; + }; + }; + + template + inline std::string to_str(const StringView& view) + { + return std::string(view.begin(),view.size()); + } + + #ifndef exprtk_disable_return_statement + namespace details + { + template class return_node; + template class return_envelope_node; + } + #endif + + template + class results_context + { + public: + + typedef type_store type_store_t; + + results_context() + : results_available_(false) + {} + + inline std::size_t count() const + { + if (results_available_) + return parameter_list_.size(); + else + return 0; + } + + inline type_store_t& operator[](const std::size_t& index) + { + return parameter_list_[index]; + } + + inline const type_store_t& operator[](const std::size_t& index) const + { + return parameter_list_[index]; + } + + private: + + inline void clear() + { + results_available_ = false; + } + + typedef std::vector ts_list_t; + typedef typename type_store_t::parameter_list parameter_list_t; + + inline void assign(const parameter_list_t& pl) + { + parameter_list_ = pl.parameter_list_; + results_available_ = true; + } + + bool results_available_; + ts_list_t parameter_list_; + + #ifndef exprtk_disable_return_statement + friend class details::return_node; + friend class details::return_envelope_node; + #endif + }; + + namespace details + { + enum operator_type + { + e_default , e_null , e_add , e_sub , + e_mul , e_div , e_mod , e_pow , + e_atan2 , e_min , e_max , e_avg , + e_sum , e_prod , e_lt , e_lte , + e_eq , e_equal , e_ne , e_nequal , + e_gte , e_gt , e_and , e_nand , + e_or , e_nor , e_xor , e_xnor , + e_mand , e_mor , e_scand , e_scor , + e_shr , e_shl , e_abs , e_acos , + e_acosh , e_asin , e_asinh , e_atan , + e_atanh , e_ceil , e_cos , e_cosh , + e_exp , e_expm1 , e_floor , e_log , + e_log10 , e_log2 , e_log1p , e_logn , + e_neg , e_pos , e_round , e_roundn , + e_root , e_sqrt , e_sin , e_sinc , + e_sinh , e_sec , e_csc , e_tan , + e_tanh , e_cot , e_clamp , e_iclamp , + e_inrange , e_sgn , e_r2d , e_d2r , + e_d2g , e_g2d , e_hypot , e_notl , + e_erf , e_erfc , e_ncdf , e_frac , + e_trunc , e_assign , e_addass , e_subass , + e_mulass , e_divass , e_modass , e_in , + e_like , e_ilike , e_multi , e_smulti , + e_swap , + + // Do not add new functions/operators after this point. + e_sf00 = 1000, e_sf01 = 1001, e_sf02 = 1002, e_sf03 = 1003, + e_sf04 = 1004, e_sf05 = 1005, e_sf06 = 1006, e_sf07 = 1007, + e_sf08 = 1008, e_sf09 = 1009, e_sf10 = 1010, e_sf11 = 1011, + e_sf12 = 1012, e_sf13 = 1013, e_sf14 = 1014, e_sf15 = 1015, + e_sf16 = 1016, e_sf17 = 1017, e_sf18 = 1018, e_sf19 = 1019, + e_sf20 = 1020, e_sf21 = 1021, e_sf22 = 1022, e_sf23 = 1023, + e_sf24 = 1024, e_sf25 = 1025, e_sf26 = 1026, e_sf27 = 1027, + e_sf28 = 1028, e_sf29 = 1029, e_sf30 = 1030, e_sf31 = 1031, + e_sf32 = 1032, e_sf33 = 1033, e_sf34 = 1034, e_sf35 = 1035, + e_sf36 = 1036, e_sf37 = 1037, e_sf38 = 1038, e_sf39 = 1039, + e_sf40 = 1040, e_sf41 = 1041, e_sf42 = 1042, e_sf43 = 1043, + e_sf44 = 1044, e_sf45 = 1045, e_sf46 = 1046, e_sf47 = 1047, + e_sf48 = 1048, e_sf49 = 1049, e_sf50 = 1050, e_sf51 = 1051, + e_sf52 = 1052, e_sf53 = 1053, e_sf54 = 1054, e_sf55 = 1055, + e_sf56 = 1056, e_sf57 = 1057, e_sf58 = 1058, e_sf59 = 1059, + e_sf60 = 1060, e_sf61 = 1061, e_sf62 = 1062, e_sf63 = 1063, + e_sf64 = 1064, e_sf65 = 1065, e_sf66 = 1066, e_sf67 = 1067, + e_sf68 = 1068, e_sf69 = 1069, e_sf70 = 1070, e_sf71 = 1071, + e_sf72 = 1072, e_sf73 = 1073, e_sf74 = 1074, e_sf75 = 1075, + e_sf76 = 1076, e_sf77 = 1077, e_sf78 = 1078, e_sf79 = 1079, + e_sf80 = 1080, e_sf81 = 1081, e_sf82 = 1082, e_sf83 = 1083, + e_sf84 = 1084, e_sf85 = 1085, e_sf86 = 1086, e_sf87 = 1087, + e_sf88 = 1088, e_sf89 = 1089, e_sf90 = 1090, e_sf91 = 1091, + e_sf92 = 1092, e_sf93 = 1093, e_sf94 = 1094, e_sf95 = 1095, + e_sf96 = 1096, e_sf97 = 1097, e_sf98 = 1098, e_sf99 = 1099, + e_sffinal = 1100, + e_sf4ext00 = 2000, e_sf4ext01 = 2001, e_sf4ext02 = 2002, e_sf4ext03 = 2003, + e_sf4ext04 = 2004, e_sf4ext05 = 2005, e_sf4ext06 = 2006, e_sf4ext07 = 2007, + e_sf4ext08 = 2008, e_sf4ext09 = 2009, e_sf4ext10 = 2010, e_sf4ext11 = 2011, + e_sf4ext12 = 2012, e_sf4ext13 = 2013, e_sf4ext14 = 2014, e_sf4ext15 = 2015, + e_sf4ext16 = 2016, e_sf4ext17 = 2017, e_sf4ext18 = 2018, e_sf4ext19 = 2019, + e_sf4ext20 = 2020, e_sf4ext21 = 2021, e_sf4ext22 = 2022, e_sf4ext23 = 2023, + e_sf4ext24 = 2024, e_sf4ext25 = 2025, e_sf4ext26 = 2026, e_sf4ext27 = 2027, + e_sf4ext28 = 2028, e_sf4ext29 = 2029, e_sf4ext30 = 2030, e_sf4ext31 = 2031, + e_sf4ext32 = 2032, e_sf4ext33 = 2033, e_sf4ext34 = 2034, e_sf4ext35 = 2035, + e_sf4ext36 = 2036, e_sf4ext37 = 2037, e_sf4ext38 = 2038, e_sf4ext39 = 2039, + e_sf4ext40 = 2040, e_sf4ext41 = 2041, e_sf4ext42 = 2042, e_sf4ext43 = 2043, + e_sf4ext44 = 2044, e_sf4ext45 = 2045, e_sf4ext46 = 2046, e_sf4ext47 = 2047, + e_sf4ext48 = 2048, e_sf4ext49 = 2049, e_sf4ext50 = 2050, e_sf4ext51 = 2051, + e_sf4ext52 = 2052, e_sf4ext53 = 2053, e_sf4ext54 = 2054, e_sf4ext55 = 2055, + e_sf4ext56 = 2056, e_sf4ext57 = 2057, e_sf4ext58 = 2058, e_sf4ext59 = 2059, + e_sf4ext60 = 2060, e_sf4ext61 = 2061 + }; + + inline std::string to_str(const operator_type opr) + { + switch (opr) + { + case e_add : return "+" ; + case e_sub : return "-" ; + case e_mul : return "*" ; + case e_div : return "/" ; + case e_mod : return "%" ; + case e_pow : return "^" ; + case e_assign : return ":=" ; + case e_addass : return "+=" ; + case e_subass : return "-=" ; + case e_mulass : return "*=" ; + case e_divass : return "/=" ; + case e_modass : return "%=" ; + case e_lt : return "<" ; + case e_lte : return "<=" ; + case e_eq : return "==" ; + case e_equal : return "=" ; + case e_ne : return "!=" ; + case e_nequal : return "<>" ; + case e_gte : return ">=" ; + case e_gt : return ">" ; + case e_and : return "and" ; + case e_or : return "or" ; + case e_xor : return "xor" ; + case e_nand : return "nand"; + case e_nor : return "nor" ; + case e_xnor : return "xnor"; + default : return "N/A" ; + } + } + + struct base_operation_t + { + base_operation_t(const operator_type t, const unsigned int& np) + : type(t) + , num_params(np) + {} + + operator_type type; + unsigned int num_params; + }; + + namespace loop_unroll + { + #ifndef exprtk_disable_superscalar_unroll + const unsigned int global_loop_batch_size = 16; + #else + const unsigned int global_loop_batch_size = 4; + #endif + + struct details + { + explicit details(const std::size_t& vsize, + const unsigned int loop_batch_size = global_loop_batch_size) + : batch_size(loop_batch_size ) + , remainder (vsize % batch_size) + , upper_bound(static_cast(vsize - (remainder ? loop_batch_size : 0))) + {} + + unsigned int batch_size; + int remainder; + int upper_bound; + }; + } + + #ifdef exprtk_enable_debugging + inline void dump_ptr(const std::string& s, const void* ptr, const std::size_t size = 0) + { + if (size) + exprtk_debug(("%s - addr: %p size: %d\n", + s.c_str(), + ptr, + static_cast(size))); + else + exprtk_debug(("%s - addr: %p\n",s.c_str(),ptr)); + } + #else + inline void dump_ptr(const std::string&, const void*) {} + inline void dump_ptr(const std::string&, const void*, const std::size_t) {} + #endif + + template + class vec_data_store + { + public: + + typedef vec_data_store type; + typedef T* data_t; + + private: + + struct control_block + { + control_block() + : ref_count(1) + , size (0) + , data (0) + , destruct (true) + {} + + explicit control_block(const std::size_t& dsize) + : ref_count(1 ) + , size (dsize) + , data (0 ) + , destruct (true ) + { create_data(); } + + control_block(const std::size_t& dsize, data_t dptr, bool dstrct = false) + : ref_count(1 ) + , size (dsize ) + , data (dptr ) + , destruct (dstrct) + {} + + ~control_block() + { + if (data && destruct && (0 == ref_count)) + { + dump_ptr("~vec_data_store::control_block() data",data); + delete[] data; + data = reinterpret_cast(0); + } + } + + static inline control_block* create(const std::size_t& dsize, data_t data_ptr = data_t(0), bool dstrct = false) + { + if (dsize) + { + if (0 == data_ptr) + return (new control_block(dsize)); + else + return (new control_block(dsize, data_ptr, dstrct)); + } + else + return (new control_block); + } + + static inline void destroy(control_block*& cntrl_blck) + { + if (cntrl_blck) + { + if ( + (0 != cntrl_blck->ref_count) && + (0 == --cntrl_blck->ref_count) + ) + { + delete cntrl_blck; + } + + cntrl_blck = 0; + } + } + + std::size_t ref_count; + std::size_t size; + data_t data; + bool destruct; + + private: + + control_block(const control_block&) exprtk_delete; + control_block& operator=(const control_block&) exprtk_delete; + + inline void create_data() + { + destruct = true; + data = new T[size]; + std::fill_n(data, size, T(0)); + dump_ptr("control_block::create_data() - data", data, size); + } + }; + + public: + + vec_data_store() + : control_block_(control_block::create(0)) + {} + + explicit vec_data_store(const std::size_t& size) + : control_block_(control_block::create(size,reinterpret_cast(0),true)) + {} + + vec_data_store(const std::size_t& size, data_t data, bool dstrct = false) + : control_block_(control_block::create(size, data, dstrct)) + {} + + vec_data_store(const type& vds) + { + control_block_ = vds.control_block_; + control_block_->ref_count++; + } + + ~vec_data_store() + { + control_block::destroy(control_block_); + } + + type& operator=(const type& vds) + { + if (this != &vds) + { + std::size_t final_size = min_size(control_block_, vds.control_block_); + + vds.control_block_->size = final_size; + control_block_->size = final_size; + + if (control_block_->destruct || (0 == control_block_->data)) + { + control_block::destroy(control_block_); + + control_block_ = vds.control_block_; + control_block_->ref_count++; + } + } + + return (*this); + } + + inline data_t data() + { + return control_block_->data; + } + + inline data_t data() const + { + return control_block_->data; + } + + inline std::size_t size() const + { + return control_block_->size; + } + + inline data_t& ref() + { + return control_block_->data; + } + + inline void dump() const + { + #ifdef exprtk_enable_debugging + exprtk_debug(("size: %d\taddress:%p\tdestruct:%c\n", + size(), + data(), + (control_block_->destruct ? 'T' : 'F'))); + + for (std::size_t i = 0; i < size(); ++i) + { + if (5 == i) + exprtk_debug(("\n")); + + exprtk_debug(("%15.10f ",data()[i])); + } + exprtk_debug(("\n")); + #endif + } + + static inline void match_sizes(type& vds0, type& vds1) + { + const std::size_t size = min_size(vds0.control_block_,vds1.control_block_); + vds0.control_block_->size = size; + vds1.control_block_->size = size; + } + + private: + + static inline std::size_t min_size(const control_block* cb0, const control_block* cb1) + { + const std::size_t size0 = cb0->size; + const std::size_t size1 = cb1->size; + + if (size0 && size1) + return std::min(size0,size1); + else + return (size0) ? size0 : size1; + } + + control_block* control_block_; + }; + + namespace numeric + { + namespace details + { + template + inline T process_impl(const operator_type operation, const T arg) + { + switch (operation) + { + case e_abs : return numeric::abs (arg); + case e_acos : return numeric::acos (arg); + case e_acosh : return numeric::acosh(arg); + case e_asin : return numeric::asin (arg); + case e_asinh : return numeric::asinh(arg); + case e_atan : return numeric::atan (arg); + case e_atanh : return numeric::atanh(arg); + case e_ceil : return numeric::ceil (arg); + case e_cos : return numeric::cos (arg); + case e_cosh : return numeric::cosh (arg); + case e_exp : return numeric::exp (arg); + case e_expm1 : return numeric::expm1(arg); + case e_floor : return numeric::floor(arg); + case e_log : return numeric::log (arg); + case e_log10 : return numeric::log10(arg); + case e_log2 : return numeric::log2 (arg); + case e_log1p : return numeric::log1p(arg); + case e_neg : return numeric::neg (arg); + case e_pos : return numeric::pos (arg); + case e_round : return numeric::round(arg); + case e_sin : return numeric::sin (arg); + case e_sinc : return numeric::sinc (arg); + case e_sinh : return numeric::sinh (arg); + case e_sqrt : return numeric::sqrt (arg); + case e_tan : return numeric::tan (arg); + case e_tanh : return numeric::tanh (arg); + case e_cot : return numeric::cot (arg); + case e_sec : return numeric::sec (arg); + case e_csc : return numeric::csc (arg); + case e_r2d : return numeric::r2d (arg); + case e_d2r : return numeric::d2r (arg); + case e_d2g : return numeric::d2g (arg); + case e_g2d : return numeric::g2d (arg); + case e_notl : return numeric::notl (arg); + case e_sgn : return numeric::sgn (arg); + case e_erf : return numeric::erf (arg); + case e_erfc : return numeric::erfc (arg); + case e_ncdf : return numeric::ncdf (arg); + case e_frac : return numeric::frac (arg); + case e_trunc : return numeric::trunc(arg); + + default : exprtk_debug(("numeric::details::process_impl - Invalid unary operation.\n")); + return std::numeric_limits::quiet_NaN(); + } + } + + template + inline T process_impl(const operator_type operation, const T arg0, const T arg1) + { + switch (operation) + { + case e_add : return (arg0 + arg1); + case e_sub : return (arg0 - arg1); + case e_mul : return (arg0 * arg1); + case e_div : return (arg0 / arg1); + case e_mod : return modulus(arg0,arg1); + case e_pow : return pow(arg0,arg1); + case e_atan2 : return atan2(arg0,arg1); + case e_min : return std::min(arg0,arg1); + case e_max : return std::max(arg0,arg1); + case e_logn : return logn(arg0,arg1); + case e_lt : return (arg0 < arg1) ? T(1) : T(0); + case e_lte : return (arg0 <= arg1) ? T(1) : T(0); + case e_eq : return std::equal_to()(arg0,arg1) ? T(1) : T(0); + case e_ne : return std::not_equal_to()(arg0,arg1) ? T(1) : T(0); + case e_gte : return (arg0 >= arg1) ? T(1) : T(0); + case e_gt : return (arg0 > arg1) ? T(1) : T(0); + case e_and : return and_opr (arg0,arg1); + case e_nand : return nand_opr(arg0,arg1); + case e_or : return or_opr (arg0,arg1); + case e_nor : return nor_opr (arg0,arg1); + case e_xor : return xor_opr (arg0,arg1); + case e_xnor : return xnor_opr(arg0,arg1); + case e_root : return root (arg0,arg1); + case e_roundn : return roundn (arg0,arg1); + case e_equal : return equal (arg0,arg1); + case e_nequal : return nequal (arg0,arg1); + case e_hypot : return hypot (arg0,arg1); + case e_shr : return shr (arg0,arg1); + case e_shl : return shl (arg0,arg1); + + default : exprtk_debug(("numeric::details::process_impl - Invalid binary operation.\n")); + return std::numeric_limits::quiet_NaN(); + } + } + + template + inline T process_impl(const operator_type operation, const T arg0, const T arg1, int_type_tag) + { + switch (operation) + { + case e_add : return (arg0 + arg1); + case e_sub : return (arg0 - arg1); + case e_mul : return (arg0 * arg1); + case e_div : return (arg0 / arg1); + case e_mod : return arg0 % arg1; + case e_pow : return pow(arg0,arg1); + case e_min : return std::min(arg0,arg1); + case e_max : return std::max(arg0,arg1); + case e_logn : return logn(arg0,arg1); + case e_lt : return (arg0 < arg1) ? T(1) : T(0); + case e_lte : return (arg0 <= arg1) ? T(1) : T(0); + case e_eq : return (arg0 == arg1) ? T(1) : T(0); + case e_ne : return (arg0 != arg1) ? T(1) : T(0); + case e_gte : return (arg0 >= arg1) ? T(1) : T(0); + case e_gt : return (arg0 > arg1) ? T(1) : T(0); + case e_and : return ((arg0 != T(0)) && (arg1 != T(0))) ? T(1) : T(0); + case e_nand : return ((arg0 != T(0)) && (arg1 != T(0))) ? T(0) : T(1); + case e_or : return ((arg0 != T(0)) || (arg1 != T(0))) ? T(1) : T(0); + case e_nor : return ((arg0 != T(0)) || (arg1 != T(0))) ? T(0) : T(1); + case e_xor : return arg0 ^ arg1; + case e_xnor : return !(arg0 ^ arg1); + case e_root : return root(arg0,arg1); + case e_equal : return arg0 == arg1; + case e_nequal : return arg0 != arg1; + case e_hypot : return hypot(arg0,arg1); + case e_shr : return arg0 >> arg1; + case e_shl : return arg0 << arg1; + + default : exprtk_debug(("numeric::details::process_impl - Invalid binary operation.\n")); + return std::numeric_limits::quiet_NaN(); + } + } + } + + template + inline T process(const operator_type operation, const T arg) + { + return exprtk::details::numeric::details::process_impl(operation,arg); + } + + template + inline T process(const operator_type operation, const T arg0, const T arg1) + { + return exprtk::details::numeric::details::process_impl(operation, arg0, arg1); + } + } + + template + struct node_collector_interface + { + typedef Node* node_ptr_t; + typedef Node** node_pp_t; + typedef std::vector noderef_list_t; + + virtual ~node_collector_interface() {} + + virtual void collect_nodes(noderef_list_t&) {} + }; + + template + struct node_depth_base; + + template + class expression_node : public node_collector_interface >, + public node_depth_base > + { + public: + + enum node_type + { + e_none , e_null , e_constant , e_unary , + e_binary , e_binary_ext , e_trinary , e_quaternary , + e_vararg , e_conditional , e_while , e_repeat , + e_for , e_switch , e_mswitch , e_return , + e_retenv , e_variable , e_stringvar , e_stringconst , + e_stringvarrng , e_cstringvarrng , e_strgenrange , e_strconcat , + e_stringvarsize , e_strswap , e_stringsize , e_stringvararg , + e_function , e_vafunction , e_genfunction , e_strfunction , + e_strcondition , e_strccondition , e_add , e_sub , + e_mul , e_div , e_mod , e_pow , + e_lt , e_lte , e_gt , e_gte , + e_eq , e_ne , e_and , e_nand , + e_or , e_nor , e_xor , e_xnor , + e_in , e_like , e_ilike , e_inranges , + e_ipow , e_ipowinv , e_abs , e_acos , + e_acosh , e_asin , e_asinh , e_atan , + e_atanh , e_ceil , e_cos , e_cosh , + e_exp , e_expm1 , e_floor , e_log , + e_log10 , e_log2 , e_log1p , e_neg , + e_pos , e_round , e_sin , e_sinc , + e_sinh , e_sqrt , e_tan , e_tanh , + e_cot , e_sec , e_csc , e_r2d , + e_d2r , e_d2g , e_g2d , e_notl , + e_sgn , e_erf , e_erfc , e_ncdf , + e_frac , e_trunc , e_uvouv , e_vov , + e_cov , e_voc , e_vob , e_bov , + e_cob , e_boc , e_vovov , e_vovoc , + e_vocov , e_covov , e_covoc , e_vovovov , + e_vovovoc , e_vovocov , e_vocovov , e_covovov , + e_covocov , e_vocovoc , e_covovoc , e_vococov , + e_sf3ext , e_sf4ext , e_nulleq , e_strass , + e_vector , e_vecelem , e_rbvecelem , e_rbveccelem , + e_vecdefass , e_vecvalass , e_vecvecass , e_vecopvalass , + e_vecopvecass , e_vecfunc , e_vecvecswap , e_vecvecineq , + e_vecvalineq , e_valvecineq , e_vecvecarith , e_vecvalarith , + e_valvecarith , e_vecunaryop , e_vecondition , e_break , + e_continue , e_swap + }; + + typedef T value_type; + typedef expression_node* expression_ptr; + typedef node_collector_interface > nci_t; + typedef typename nci_t::noderef_list_t noderef_list_t; + typedef node_depth_base > ndb_t; + + virtual ~expression_node() {} + + inline virtual T value() const + { + return std::numeric_limits::quiet_NaN(); + } + + inline virtual expression_node* branch(const std::size_t& index = 0) const + { + return reinterpret_cast(index * 0); + } + + inline virtual node_type type() const + { + return e_none; + } + }; // class expression_node + + template + inline bool is_generally_string_node(const expression_node* node); + + inline bool is_true(const double v) + { + return std::not_equal_to()(0.0,v); + } + + inline bool is_true(const long double v) + { + return std::not_equal_to()(0.0L,v); + } + + inline bool is_true(const float v) + { + return std::not_equal_to()(0.0f,v); + } + + template + inline bool is_true(const expression_node* node) + { + return std::not_equal_to()(T(0),node->value()); + } + + template + inline bool is_true(const std::pair*,bool>& node) + { + return std::not_equal_to()(T(0),node.first->value()); + } + + template + inline bool is_false(const expression_node* node) + { + return std::equal_to()(T(0),node->value()); + } + + template + inline bool is_false(const std::pair*,bool>& node) + { + return std::equal_to()(T(0),node.first->value()); + } + + template + inline bool is_unary_node(const expression_node* node) + { + return node && (details::expression_node::e_unary == node->type()); + } + + template + inline bool is_neg_unary_node(const expression_node* node) + { + return node && (details::expression_node::e_neg == node->type()); + } + + template + inline bool is_binary_node(const expression_node* node) + { + return node && (details::expression_node::e_binary == node->type()); + } + + template + inline bool is_variable_node(const expression_node* node) + { + return node && (details::expression_node::e_variable == node->type()); + } + + template + inline bool is_ivariable_node(const expression_node* node) + { + return node && + ( + details::expression_node::e_variable == node->type() || + details::expression_node::e_vecelem == node->type() || + details::expression_node::e_rbvecelem == node->type() || + details::expression_node::e_rbveccelem == node->type() + ); + } + + template + inline bool is_vector_elem_node(const expression_node* node) + { + return node && (details::expression_node::e_vecelem == node->type()); + } + + template + inline bool is_rebasevector_elem_node(const expression_node* node) + { + return node && (details::expression_node::e_rbvecelem == node->type()); + } + + template + inline bool is_rebasevector_celem_node(const expression_node* node) + { + return node && (details::expression_node::e_rbveccelem == node->type()); + } + + template + inline bool is_vector_node(const expression_node* node) + { + return node && (details::expression_node::e_vector == node->type()); + } + + template + inline bool is_ivector_node(const expression_node* node) + { + if (node) + { + switch (node->type()) + { + case details::expression_node::e_vector : + case details::expression_node::e_vecvalass : + case details::expression_node::e_vecvecass : + case details::expression_node::e_vecopvalass : + case details::expression_node::e_vecopvecass : + case details::expression_node::e_vecvecswap : + case details::expression_node::e_vecvecarith : + case details::expression_node::e_vecvalarith : + case details::expression_node::e_valvecarith : + case details::expression_node::e_vecunaryop : + case details::expression_node::e_vecondition : return true; + default : return false; + } + } + else + return false; + } + + template + inline bool is_constant_node(const expression_node* node) + { + return node && + ( + details::expression_node::e_constant == node->type() || + details::expression_node::e_stringconst == node->type() + ); + } + + template + inline bool is_null_node(const expression_node* node) + { + return node && (details::expression_node::e_null == node->type()); + } + + template + inline bool is_break_node(const expression_node* node) + { + return node && (details::expression_node::e_break == node->type()); + } + + template + inline bool is_continue_node(const expression_node* node) + { + return node && (details::expression_node::e_continue == node->type()); + } + + template + inline bool is_swap_node(const expression_node* node) + { + return node && (details::expression_node::e_swap == node->type()); + } + + template + inline bool is_function(const expression_node* node) + { + return node && (details::expression_node::e_function == node->type()); + } + + template + inline bool is_return_node(const expression_node* node) + { + return node && (details::expression_node::e_return == node->type()); + } + + template class unary_node; + + template + inline bool is_negate_node(const expression_node* node) + { + if (node && is_unary_node(node)) + { + return (details::e_neg == static_cast*>(node)->operation()); + } + else + return false; + } + + template + inline bool branch_deletable(expression_node* node) + { + return (0 != node) && + !is_variable_node(node) && + !is_string_node (node) ; + } + + template + inline bool all_nodes_valid(expression_node* (&b)[N]) + { + for (std::size_t i = 0; i < N; ++i) + { + if (0 == b[i]) return false; + } + + return true; + } + + template class Sequence> + inline bool all_nodes_valid(const Sequence*,Allocator>& b) + { + for (std::size_t i = 0; i < b.size(); ++i) + { + if (0 == b[i]) return false; + } + + return true; + } + + template + inline bool all_nodes_variables(expression_node* (&b)[N]) + { + for (std::size_t i = 0; i < N; ++i) + { + if (0 == b[i]) + return false; + else if (!is_variable_node(b[i])) + return false; + } + + return true; + } + + template class Sequence> + inline bool all_nodes_variables(Sequence*,Allocator>& b) + { + for (std::size_t i = 0; i < b.size(); ++i) + { + if (0 == b[i]) + return false; + else if (!is_variable_node(b[i])) + return false; + } + + return true; + } + + template + class node_collection_destructor + { + public: + + typedef node_collector_interface nci_t; + + typedef typename nci_t::node_ptr_t node_ptr_t; + typedef typename nci_t::node_pp_t node_pp_t; + typedef typename nci_t::noderef_list_t noderef_list_t; + + static void delete_nodes(node_ptr_t& root) + { + std::vector node_delete_list; + node_delete_list.reserve(1000); + + collect_nodes(root, node_delete_list); + + for (std::size_t i = 0; i < node_delete_list.size(); ++i) + { + node_ptr_t& node = *node_delete_list[i]; + exprtk_debug(("ncd::delete_nodes() - deleting: %p\n", static_cast(node))); + delete node; + node = reinterpret_cast(0); + } + } + + private: + + static void collect_nodes(node_ptr_t& root, noderef_list_t& node_delete_list) + { + std::deque node_list; + node_list.push_back(root); + node_delete_list.push_back(&root); + + noderef_list_t child_node_delete_list; + child_node_delete_list.reserve(1000); + + while (!node_list.empty()) + { + node_list.front()->collect_nodes(child_node_delete_list); + + if (!child_node_delete_list.empty()) + { + for (std::size_t i = 0; i < child_node_delete_list.size(); ++i) + { + node_pp_t& node = child_node_delete_list[i]; + + if (0 == (*node)) + { + exprtk_debug(("ncd::collect_nodes() - null node encountered.\n")); + } + + node_list.push_back(*node); + } + + node_delete_list.insert( + node_delete_list.end(), + child_node_delete_list.begin(), child_node_delete_list.end()); + + child_node_delete_list.clear(); + } + + node_list.pop_front(); + } + + std::reverse(node_delete_list.begin(), node_delete_list.end()); + } + }; + + template + inline void free_all_nodes(NodeAllocator& node_allocator, expression_node* (&b)[N]) + { + for (std::size_t i = 0; i < N; ++i) + { + free_node(node_allocator,b[i]); + } + } + + template class Sequence> + inline void free_all_nodes(NodeAllocator& node_allocator, Sequence*,Allocator>& b) + { + for (std::size_t i = 0; i < b.size(); ++i) + { + free_node(node_allocator,b[i]); + } + + b.clear(); + } + + template + inline void free_node(NodeAllocator&, expression_node*& node) + { + if ((0 == node) || is_variable_node(node) || is_string_node(node)) + { + return; + } + + node_collection_destructor > + ::delete_nodes(node); + } + + template + inline void destroy_node(expression_node*& node) + { + if (0 != node) + { + node_collection_destructor > + ::delete_nodes(node); + } + } + + template + struct node_depth_base + { + typedef Node* node_ptr_t; + typedef std::pair nb_pair_t; + + node_depth_base() + : depth_set(false) + , depth(0) + {} + + virtual ~node_depth_base() {} + + virtual std::size_t node_depth() const { return 1; } + + std::size_t compute_node_depth(const Node* const& node) const + { + if (!depth_set) + { + depth = 1 + (node ? node->node_depth() : 0); + depth_set = true; + } + + return depth; + } + + std::size_t compute_node_depth(const nb_pair_t& branch) const + { + if (!depth_set) + { + depth = 1 + (branch.first ? branch.first->node_depth() : 0); + depth_set = true; + } + + return depth; + } + + template + std::size_t compute_node_depth(const nb_pair_t (&branch)[N]) const + { + if (!depth_set) + { + depth = 0; + for (std::size_t i = 0; i < N; ++i) + { + if (branch[i].first) + { + depth = std::max(depth,branch[i].first->node_depth()); + } + } + depth += 1; + depth_set = true; + } + + return depth; + } + + template + std::size_t compute_node_depth(const BranchType& n0, const BranchType& n1) const + { + if (!depth_set) + { + depth = 1 + std::max(compute_node_depth(n0), compute_node_depth(n1)); + depth_set = true; + } + + return depth; + } + + template + std::size_t compute_node_depth(const BranchType& n0, const BranchType& n1, + const BranchType& n2) const + { + if (!depth_set) + { + depth = 1 + std::max( + std::max(compute_node_depth(n0), compute_node_depth(n1)), + compute_node_depth(n2)); + depth_set = true; + } + + return depth; + } + + template + std::size_t compute_node_depth(const BranchType& n0, const BranchType& n1, + const BranchType& n2, const BranchType& n3) const + { + if (!depth_set) + { + depth = 1 + std::max( + std::max(compute_node_depth(n0), compute_node_depth(n1)), + std::max(compute_node_depth(n2), compute_node_depth(n3))); + depth_set = true; + } + + return depth; + } + + template class Sequence> + std::size_t compute_node_depth(const Sequence& branch_list) const + { + if (!depth_set) + { + for (std::size_t i = 0; i < branch_list.size(); ++i) + { + if (branch_list[i]) + { + depth = std::max(depth, compute_node_depth(branch_list[i])); + } + } + depth_set = true; + } + + return depth; + } + + template class Sequence> + std::size_t compute_node_depth(const Sequence& branch_list) const + { + if (!depth_set) + { + for (std::size_t i = 0; i < branch_list.size(); ++i) + { + if (branch_list[i].first) + { + depth = std::max(depth, compute_node_depth(branch_list[i].first)); + } + } + depth_set = true; + } + + return depth; + } + + mutable bool depth_set; + mutable std::size_t depth; + + template + void collect(node_ptr_t const& node, + const bool deletable, + NodeSequence& delete_node_list) const + { + if ((0 != node) && deletable) + { + delete_node_list.push_back(const_cast(&node)); + } + } + + template + void collect(const nb_pair_t& branch, + NodeSequence& delete_node_list) const + { + collect(branch.first, branch.second, delete_node_list); + } + + template + void collect(Node*& node, + NodeSequence& delete_node_list) const + { + collect(node, branch_deletable(node), delete_node_list); + } + + template + void collect(const nb_pair_t(&branch)[N], + NodeSequence& delete_node_list) const + { + for (std::size_t i = 0; i < N; ++i) + { + collect(branch[i].first, branch[i].second, delete_node_list); + } + } + + template class Sequence, + typename NodeSequence> + void collect(const Sequence& branch, + NodeSequence& delete_node_list) const + { + for (std::size_t i = 0; i < branch.size(); ++i) + { + collect(branch[i].first, branch[i].second, delete_node_list); + } + } + + template class Sequence, + typename NodeSequence> + void collect(const Sequence& branch_list, + NodeSequence& delete_node_list) const + { + for (std::size_t i = 0; i < branch_list.size(); ++i) + { + collect(branch_list[i], branch_deletable(branch_list[i]), delete_node_list); + } + } + + template class Sequence, + typename NodeSequence> + void collect(const Sequence& branch_list, + const Sequence& branch_deletable_list, + NodeSequence& delete_node_list) const + { + for (std::size_t i = 0; i < branch_list.size(); ++i) + { + collect(branch_list[i], branch_deletable_list[i], delete_node_list); + } + } + }; + + template + class vector_holder + { + private: + + typedef Type value_type; + typedef value_type* value_ptr; + typedef const value_ptr const_value_ptr; + + class vector_holder_base + { + public: + + virtual ~vector_holder_base() {} + + inline value_ptr operator[](const std::size_t& index) const + { + return value_at(index); + } + + inline std::size_t size() const + { + return vector_size(); + } + + inline value_ptr data() const + { + return value_at(0); + } + + virtual inline bool rebaseable() const + { + return false; + } + + virtual void set_ref(value_ptr*) {} + + protected: + + virtual value_ptr value_at(const std::size_t&) const = 0; + virtual std::size_t vector_size() const = 0; + }; + + class array_vector_impl : public vector_holder_base + { + public: + + array_vector_impl(const Type* vec, const std::size_t& vec_size) + : vec_(vec) + , size_(vec_size) + {} + + protected: + + value_ptr value_at(const std::size_t& index) const + { + if (index < size_) + return const_cast(vec_ + index); + else + return const_value_ptr(0); + } + + std::size_t vector_size() const + { + return size_; + } + + private: + + array_vector_impl(const array_vector_impl&) exprtk_delete; + array_vector_impl& operator=(const array_vector_impl&) exprtk_delete; + + const Type* vec_; + const std::size_t size_; + }; + + template class Sequence> + class sequence_vector_impl : public vector_holder_base + { + public: + + typedef Sequence sequence_t; + + sequence_vector_impl(sequence_t& seq) + : sequence_(seq) + {} + + protected: + + value_ptr value_at(const std::size_t& index) const + { + return (index < sequence_.size()) ? (&sequence_[index]) : const_value_ptr(0); + } + + std::size_t vector_size() const + { + return sequence_.size(); + } + + private: + + sequence_vector_impl(const sequence_vector_impl&) exprtk_delete; + sequence_vector_impl& operator=(const sequence_vector_impl&) exprtk_delete; + + sequence_t& sequence_; + }; + + class vector_view_impl : public vector_holder_base + { + public: + + typedef exprtk::vector_view vector_view_t; + + vector_view_impl(vector_view_t& vec_view) + : vec_view_(vec_view) + {} + + void set_ref(value_ptr* ref) + { + vec_view_.set_ref(ref); + } + + virtual inline bool rebaseable() const + { + return true; + } + + protected: + + value_ptr value_at(const std::size_t& index) const + { + return (index < vec_view_.size()) ? (&vec_view_[index]) : const_value_ptr(0); + } + + std::size_t vector_size() const + { + return vec_view_.size(); + } + + private: + + vector_view_impl(const vector_view_impl&) exprtk_delete; + vector_view_impl& operator=(const vector_view_impl&) exprtk_delete; + + vector_view_t& vec_view_; + }; + + public: + + typedef typename details::vec_data_store vds_t; + + vector_holder(Type* vec, const std::size_t& vec_size) + : vector_holder_base_(new(buffer)array_vector_impl(vec,vec_size)) + {} + + explicit vector_holder(const vds_t& vds) + : vector_holder_base_(new(buffer)array_vector_impl(vds.data(),vds.size())) + {} + + template + explicit vector_holder(std::vector& vec) + : vector_holder_base_(new(buffer)sequence_vector_impl(vec)) + {} + + explicit vector_holder(exprtk::vector_view& vec) + : vector_holder_base_(new(buffer)vector_view_impl(vec)) + {} + + inline value_ptr operator[](const std::size_t& index) const + { + return (*vector_holder_base_)[index]; + } + + inline std::size_t size() const + { + return vector_holder_base_->size(); + } + + inline value_ptr data() const + { + return vector_holder_base_->data(); + } + + void set_ref(value_ptr* ref) + { + vector_holder_base_->set_ref(ref); + } + + bool rebaseable() const + { + return vector_holder_base_->rebaseable(); + } + + private: + + mutable vector_holder_base* vector_holder_base_; + uchar_t buffer[64]; + }; + + template + class null_node exprtk_final : public expression_node + { + public: + + inline T value() const exprtk_override + { + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_null; + } + }; + + template + inline void construct_branch_pair(std::pair*,bool> (&branch)[N], + expression_node* b, + const std::size_t& index) + { + if (b && (index < N)) + { + branch[index] = std::make_pair(b,branch_deletable(b)); + } + } + + template + inline void construct_branch_pair(std::pair*,bool>& branch, expression_node* b) + { + if (b) + { + branch = std::make_pair(b,branch_deletable(b)); + } + } + + template + inline void init_branches(std::pair*,bool> (&branch)[N], + expression_node* b0, + expression_node* b1 = reinterpret_cast*>(0), + expression_node* b2 = reinterpret_cast*>(0), + expression_node* b3 = reinterpret_cast*>(0), + expression_node* b4 = reinterpret_cast*>(0), + expression_node* b5 = reinterpret_cast*>(0), + expression_node* b6 = reinterpret_cast*>(0), + expression_node* b7 = reinterpret_cast*>(0), + expression_node* b8 = reinterpret_cast*>(0), + expression_node* b9 = reinterpret_cast*>(0)) + { + construct_branch_pair(branch, b0, 0); + construct_branch_pair(branch, b1, 1); + construct_branch_pair(branch, b2, 2); + construct_branch_pair(branch, b3, 3); + construct_branch_pair(branch, b4, 4); + construct_branch_pair(branch, b5, 5); + construct_branch_pair(branch, b6, 6); + construct_branch_pair(branch, b7, 7); + construct_branch_pair(branch, b8, 8); + construct_branch_pair(branch, b9, 9); + } + + template + class null_eq_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + explicit null_eq_node(expression_ptr branch, const bool equality = true) + : equality_(equality) + { + construct_branch_pair(branch_, branch); + } + + inline T value() const exprtk_override + { + assert(branch_.first); + + const T v = branch_.first->value(); + const bool result = details::numeric::is_nan(v); + + if (result) + return equality_ ? T(1) : T(0); + else + return equality_ ? T(0) : T(1); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_nulleq; + } + + inline expression_node* branch(const std::size_t&) const exprtk_override + { + return branch_.first; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(branch_); + } + + private: + + bool equality_; + branch_t branch_; + }; + + template + class literal_node exprtk_final : public expression_node + { + public: + + explicit literal_node(const T& v) + : value_(v) + {} + + inline T value() const exprtk_override + { + return value_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_constant; + } + + inline expression_node* branch(const std::size_t&) const exprtk_override + { + return reinterpret_cast*>(0); + } + + private: + + literal_node(const literal_node&) exprtk_delete; + literal_node& operator=(const literal_node&) exprtk_delete; + + const T value_; + }; + + template + struct range_pack; + + template + struct range_data_type; + + template + class range_interface + { + public: + + typedef range_pack range_t; + + virtual ~range_interface() {} + + virtual range_t& range_ref() = 0; + + virtual const range_t& range_ref() const = 0; + }; + + #ifndef exprtk_disable_string_capabilities + template + class string_base_node + { + public: + + typedef range_data_type range_data_type_t; + + virtual ~string_base_node() {} + + virtual std::string str () const = 0; + + virtual char_cptr base() const = 0; + + virtual std::size_t size() const = 0; + }; + + template + class string_literal_node exprtk_final + : public expression_node , + public string_base_node, + public range_interface + { + public: + + typedef range_pack range_t; + + explicit string_literal_node(const std::string& v) + : value_(v) + { + rp_.n0_c = std::make_pair(true,0); + rp_.n1_c = std::make_pair(true,v.size() - 1); + rp_.cache.first = rp_.n0_c.second; + rp_.cache.second = rp_.n1_c.second; + } + + inline T value() const exprtk_override + { + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_stringconst; + } + + inline expression_node* branch(const std::size_t&) const exprtk_override + { + return reinterpret_cast*>(0); + } + + std::string str() const exprtk_override + { + return value_; + } + + char_cptr base() const exprtk_override + { + return value_.data(); + } + + std::size_t size() const exprtk_override + { + return value_.size(); + } + + range_t& range_ref() exprtk_override + { + return rp_; + } + + const range_t& range_ref() const exprtk_override + { + return rp_; + } + + private: + + string_literal_node(const string_literal_node&) exprtk_delete; + string_literal_node& operator=(const string_literal_node&) exprtk_delete; + + const std::string value_; + range_t rp_; + }; + #endif + + template + class unary_node : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + unary_node(const operator_type& opr, expression_ptr branch) + : operation_(opr) + { + construct_branch_pair(branch_,branch); + } + + inline T value() const exprtk_override + { + assert(branch_.first); + const T arg = branch_.first->value(); + return numeric::process(operation_,arg); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_unary; + } + + inline operator_type operation() + { + return operation_; + } + + inline expression_node* branch(const std::size_t&) const exprtk_override + { + return branch_.first; + } + + inline void release() + { + branch_.second = false; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_final + { + return expression_node::ndb_t::compute_node_depth(branch_); + } + + private: + + operator_type operation_; + branch_t branch_; + }; + + template + class binary_node : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + binary_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : operation_(opr) + { + init_branches<2>(branch_, branch0, branch1); + } + + inline T value() const exprtk_override + { + assert(branch_[0].first); + assert(branch_[1].first); + + const T arg0 = branch_[0].first->value(); + const T arg1 = branch_[1].first->value(); + + return numeric::process(operation_, arg0, arg1); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_binary; + } + + inline operator_type operation() + { + return operation_; + } + + inline expression_node* branch(const std::size_t& index = 0) const exprtk_override + { + if (0 == index) + return branch_[0].first; + else if (1 == index) + return branch_[1].first; + else + return reinterpret_cast(0); + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::template collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_final + { + return expression_node::ndb_t::template compute_node_depth<2>(branch_); + } + + private: + + operator_type operation_; + branch_t branch_[2]; + }; + + template + class binary_ext_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + binary_ext_node(expression_ptr branch0, expression_ptr branch1) + { + init_branches<2>(branch_, branch0, branch1); + } + + inline T value() const exprtk_override + { + assert(branch_[0].first); + assert(branch_[1].first); + + const T arg0 = branch_[0].first->value(); + const T arg1 = branch_[1].first->value(); + + return Operation::process(arg0,arg1); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_binary_ext; + } + + inline operator_type operation() + { + return Operation::operation(); + } + + inline expression_node* branch(const std::size_t& index = 0) const exprtk_override + { + if (0 == index) + return branch_[0].first; + else if (1 == index) + return branch_[1].first; + else + return reinterpret_cast(0); + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::template collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::template compute_node_depth<2>(branch_); + } + + protected: + + branch_t branch_[2]; + }; + + template + class trinary_node : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + trinary_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1, + expression_ptr branch2) + : operation_(opr) + { + init_branches<3>(branch_, branch0, branch1, branch2); + } + + inline T value() const exprtk_override + { + assert(branch_[0].first); + assert(branch_[1].first); + assert(branch_[2].first); + + const T arg0 = branch_[0].first->value(); + const T arg1 = branch_[1].first->value(); + const T arg2 = branch_[2].first->value(); + + switch (operation_) + { + case e_inrange : return (arg1 < arg0) ? T(0) : ((arg1 > arg2) ? T(0) : T(1)); + + case e_clamp : return (arg1 < arg0) ? arg0 : (arg1 > arg2 ? arg2 : arg1); + + case e_iclamp : if ((arg1 <= arg0) || (arg1 >= arg2)) + return arg1; + else + return ((T(2) * arg1 <= (arg2 + arg0)) ? arg0 : arg2); + + default : exprtk_debug(("trinary_node::value() - Error: Invalid operation\n")); + return std::numeric_limits::quiet_NaN(); + } + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_trinary; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::template collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override exprtk_final + { + return expression_node::ndb_t::template compute_node_depth<3>(branch_); + } + + protected: + + operator_type operation_; + branch_t branch_[3]; + }; + + template + class quaternary_node : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + quaternary_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1, + expression_ptr branch2, + expression_ptr branch3) + : operation_(opr) + { + init_branches<4>(branch_, branch0, branch1, branch2, branch3); + } + + inline T value() const exprtk_override + { + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_quaternary; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::template collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override exprtk_final + { + return expression_node::ndb_t::template compute_node_depth<4>(branch_); + } + + protected: + + operator_type operation_; + branch_t branch_[4]; + }; + + template + class conditional_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + conditional_node(expression_ptr condition, + expression_ptr consequent, + expression_ptr alternative) + { + construct_branch_pair(condition_ , condition ); + construct_branch_pair(consequent_ , consequent ); + construct_branch_pair(alternative_, alternative); + } + + inline T value() const exprtk_override + { + assert(condition_ .first); + assert(consequent_ .first); + assert(alternative_.first); + + if (is_true(condition_)) + return consequent_.first->value(); + else + return alternative_.first->value(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_conditional; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(condition_ , node_delete_list); + expression_node::ndb_t::collect(consequent_ , node_delete_list); + expression_node::ndb_t::collect(alternative_ , node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth + (condition_, consequent_, alternative_); + } + + private: + + branch_t condition_; + branch_t consequent_; + branch_t alternative_; + }; + + template + class cons_conditional_node exprtk_final : public expression_node + { + public: + + // Consequent only conditional statement node + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + cons_conditional_node(expression_ptr condition, + expression_ptr consequent) + { + construct_branch_pair(condition_ , condition ); + construct_branch_pair(consequent_, consequent); + } + + inline T value() const exprtk_override + { + assert(condition_ .first); + assert(consequent_.first); + + if (is_true(condition_)) + return consequent_.first->value(); + else + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_conditional; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(condition_ , node_delete_list); + expression_node::ndb_t::collect(consequent_ , node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t:: + compute_node_depth(condition_, consequent_); + } + + private: + + branch_t condition_; + branch_t consequent_; + }; + + #ifndef exprtk_disable_break_continue + template + class break_exception + { + public: + + explicit break_exception(const T& v) + : value(v) + {} + + T value; + }; + + class continue_exception {}; + + template + class break_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + break_node(expression_ptr ret = expression_ptr(0)) + { + construct_branch_pair(return_, ret); + } + + inline T value() const exprtk_override + { + const T result = return_.first ? + return_.first->value() : + std::numeric_limits::quiet_NaN(); + + throw break_exception(result); + + #ifndef _MSC_VER + return std::numeric_limits::quiet_NaN(); + #endif + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_break; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(return_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(return_); + } + + private: + + branch_t return_; + }; + + template + class continue_node exprtk_final : public expression_node + { + public: + + inline T value() const exprtk_override + { + throw continue_exception(); + #ifndef _MSC_VER + return std::numeric_limits::quiet_NaN(); + #endif + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_break; + } + }; + #endif + + struct loop_runtime_checker + { + loop_runtime_checker(loop_runtime_check_ptr loop_runtime_check, + loop_runtime_check::loop_types lp_typ = loop_runtime_check::e_invalid) + : iteration_count_(0) + , loop_runtime_check_(loop_runtime_check) + , max_loop_iterations_(loop_runtime_check_->max_loop_iterations) + , loop_type_(lp_typ) + { + assert(loop_runtime_check_); + } + + inline void reset(const _uint64_t initial_value = 0) const + { + iteration_count_ = initial_value; + } + + inline bool check() const + { + if ( + (0 == loop_runtime_check_) || + ((++iteration_count_ <= max_loop_iterations_) && loop_runtime_check_->check()) + ) + { + return true; + } + + loop_runtime_check::violation_context ctxt; + ctxt.loop = loop_type_; + ctxt.violation = loop_runtime_check::e_iteration_count; + + loop_runtime_check_->handle_runtime_violation(ctxt); + + return false; + } + + mutable _uint64_t iteration_count_; + mutable loop_runtime_check_ptr loop_runtime_check_; + const details::_uint64_t& max_loop_iterations_; + loop_runtime_check::loop_types loop_type_; + }; + + template + class while_loop_node : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + while_loop_node(expression_ptr condition, + expression_ptr loop_body) + { + construct_branch_pair(condition_, condition); + construct_branch_pair(loop_body_, loop_body); + } + + inline T value() const exprtk_override + { + assert(condition_.first); + assert(loop_body_.first); + + T result = T(0); + + while (is_true(condition_)) + { + result = loop_body_.first->value(); + } + + return result; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_while; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(condition_ , node_delete_list); + expression_node::ndb_t::collect(loop_body_ , node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(condition_, loop_body_); + } + + protected: + + branch_t condition_; + branch_t loop_body_; + }; + + template + class while_loop_rtc_node exprtk_final + : public while_loop_node + , public loop_runtime_checker + { + public: + + typedef while_loop_node parent_t; + typedef expression_node* expression_ptr; + + while_loop_rtc_node(expression_ptr condition, + expression_ptr loop_body, + loop_runtime_check_ptr loop_rt_chk) + : parent_t(condition, loop_body) + , loop_runtime_checker(loop_rt_chk, loop_runtime_check::e_while_loop) + {} + + inline T value() const exprtk_override + { + assert(parent_t::condition_.first); + assert(parent_t::loop_body_.first); + + T result = T(0); + + loop_runtime_checker::reset(); + + while (is_true(parent_t::condition_) && loop_runtime_checker::check()) + { + result = parent_t::loop_body_.first->value(); + } + + return result; + } + }; + + template + class repeat_until_loop_node : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + repeat_until_loop_node(expression_ptr condition, + expression_ptr loop_body) + { + construct_branch_pair(condition_, condition); + construct_branch_pair(loop_body_, loop_body); + } + + inline T value() const exprtk_override + { + assert(condition_.first); + assert(loop_body_.first); + + T result = T(0); + + do + { + result = loop_body_.first->value(); + } + while (is_false(condition_.first)); + + return result; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_repeat; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(condition_ , node_delete_list); + expression_node::ndb_t::collect(loop_body_ , node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(condition_, loop_body_); + } + + protected: + + branch_t condition_; + branch_t loop_body_; + }; + + template + class repeat_until_loop_rtc_node exprtk_final + : public repeat_until_loop_node + , public loop_runtime_checker + { + public: + + typedef repeat_until_loop_node parent_t; + typedef expression_node* expression_ptr; + + repeat_until_loop_rtc_node(expression_ptr condition, + expression_ptr loop_body, + loop_runtime_check_ptr loop_rt_chk) + : parent_t(condition, loop_body) + , loop_runtime_checker(loop_rt_chk, loop_runtime_check::e_repeat_until_loop) + {} + + inline T value() const exprtk_override + { + assert(parent_t::condition_.first); + assert(parent_t::loop_body_.first); + + T result = T(0); + + loop_runtime_checker::reset(1); + + do + { + result = parent_t::loop_body_.first->value(); + } + while (is_false(parent_t::condition_.first) && loop_runtime_checker::check()); + + return result; + } + }; + + template + class for_loop_node : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + for_loop_node(expression_ptr initialiser, + expression_ptr condition, + expression_ptr incrementor, + expression_ptr loop_body) + { + construct_branch_pair(initialiser_, initialiser); + construct_branch_pair(condition_ , condition ); + construct_branch_pair(incrementor_, incrementor); + construct_branch_pair(loop_body_ , loop_body ); + } + + inline T value() const exprtk_override + { + assert(condition_.first); + assert(loop_body_.first); + + T result = T(0); + + if (initialiser_.first) + initialiser_.first->value(); + + if (incrementor_.first) + { + while (is_true(condition_)) + { + result = loop_body_.first->value(); + incrementor_.first->value(); + } + } + else + { + while (is_true(condition_)) + { + result = loop_body_.first->value(); + } + } + + return result; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_for; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(initialiser_ , node_delete_list); + expression_node::ndb_t::collect(condition_ , node_delete_list); + expression_node::ndb_t::collect(incrementor_ , node_delete_list); + expression_node::ndb_t::collect(loop_body_ , node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth + (initialiser_, condition_, incrementor_, loop_body_); + } + + protected: + + branch_t initialiser_; + branch_t condition_ ; + branch_t incrementor_; + branch_t loop_body_ ; + }; + + template + class for_loop_rtc_node exprtk_final + : public for_loop_node + , public loop_runtime_checker + { + public: + + typedef for_loop_node parent_t; + typedef expression_node* expression_ptr; + + for_loop_rtc_node(expression_ptr initialiser, + expression_ptr condition, + expression_ptr incrementor, + expression_ptr loop_body, + loop_runtime_check_ptr loop_rt_chk) + : parent_t(initialiser, condition, incrementor, loop_body) + , loop_runtime_checker(loop_rt_chk, loop_runtime_check::e_for_loop) + {} + + inline T value() const exprtk_override + { + assert(parent_t::condition_.first); + assert(parent_t::loop_body_.first); + + T result = T(0); + + loop_runtime_checker::reset(); + + if (parent_t::initialiser_.first) + parent_t::initialiser_.first->value(); + + if (parent_t::incrementor_.first) + { + while (is_true(parent_t::condition_) && loop_runtime_checker::check()) + { + result = parent_t::loop_body_.first->value(); + parent_t::incrementor_.first->value(); + } + } + else + { + while (is_true(parent_t::condition_) && loop_runtime_checker::check()) + { + result = parent_t::loop_body_.first->value(); + } + } + + return result; + } + }; + + #ifndef exprtk_disable_break_continue + template + class while_loop_bc_node : public while_loop_node + { + public: + + typedef while_loop_node parent_t; + typedef expression_node* expression_ptr; + + while_loop_bc_node(expression_ptr condition, + expression_ptr loop_body) + : parent_t(condition, loop_body) + {} + + inline T value() const exprtk_override + { + assert(parent_t::condition_.first); + assert(parent_t::loop_body_.first); + + T result = T(0); + + while (is_true(parent_t::condition_)) + { + try + { + result = parent_t::loop_body_.first->value(); + } + catch(const break_exception& e) + { + return e.value; + } + catch(const continue_exception&) + {} + } + + return result; + } + }; + + template + class while_loop_bc_rtc_node exprtk_final + : public while_loop_bc_node + , public loop_runtime_checker + { + public: + + typedef while_loop_bc_node parent_t; + typedef expression_node* expression_ptr; + + while_loop_bc_rtc_node(expression_ptr condition, + expression_ptr loop_body, + loop_runtime_check_ptr loop_rt_chk) + : parent_t(condition, loop_body) + , loop_runtime_checker(loop_rt_chk, loop_runtime_check::e_while_loop) + {} + + inline T value() const exprtk_override + { + assert(parent_t::condition_.first); + assert(parent_t::loop_body_.first); + + T result = T(0); + + loop_runtime_checker::reset(); + + while (is_true(parent_t::condition_) && loop_runtime_checker::check()) + { + try + { + result = parent_t::loop_body_.first->value(); + } + catch(const break_exception& e) + { + return e.value; + } + catch(const continue_exception&) + {} + } + + return result; + } + }; + + template + class repeat_until_loop_bc_node : public repeat_until_loop_node + { + public: + + typedef repeat_until_loop_node parent_t; + typedef expression_node* expression_ptr; + + repeat_until_loop_bc_node(expression_ptr condition, + expression_ptr loop_body) + : parent_t(condition, loop_body) + {} + + inline T value() const exprtk_override + { + assert(parent_t::condition_.first); + assert(parent_t::loop_body_.first); + + T result = T(0); + + do + { + try + { + result = parent_t::loop_body_.first->value(); + } + catch(const break_exception& e) + { + return e.value; + } + catch(const continue_exception&) + {} + } + while (is_false(parent_t::condition_.first)); + + return result; + } + }; + + template + class repeat_until_loop_bc_rtc_node exprtk_final + : public repeat_until_loop_bc_node, + public loop_runtime_checker + { + public: + + typedef repeat_until_loop_bc_node parent_t; + typedef expression_node* expression_ptr; + + repeat_until_loop_bc_rtc_node(expression_ptr condition, + expression_ptr loop_body, + loop_runtime_check_ptr loop_rt_chk) + : parent_t(condition, loop_body) + , loop_runtime_checker(loop_rt_chk, loop_runtime_check::e_repeat_until_loop) + {} + + inline T value() const exprtk_override + { + assert(parent_t::condition_.first); + assert(parent_t::loop_body_.first); + + T result = T(0); + + loop_runtime_checker::reset(); + + do + { + try + { + result = parent_t::loop_body_.first->value(); + } + catch(const break_exception& e) + { + return e.value; + } + catch(const continue_exception&) + {} + } + while (is_false(parent_t::condition_.first) && loop_runtime_checker::check()); + + return result; + } + }; + + template + class for_loop_bc_node : public for_loop_node + { + public: + + typedef for_loop_node parent_t; + typedef expression_node* expression_ptr; + + for_loop_bc_node(expression_ptr initialiser, + expression_ptr condition, + expression_ptr incrementor, + expression_ptr loop_body) + : parent_t(initialiser, condition, incrementor, loop_body) + {} + + inline T value() const exprtk_override + { + assert(parent_t::condition_.first); + assert(parent_t::loop_body_.first); + + T result = T(0); + + if (parent_t::initialiser_.first) + parent_t::initialiser_.first->value(); + + if (parent_t::incrementor_.first) + { + while (is_true(parent_t::condition_)) + { + try + { + result = parent_t::loop_body_.first->value(); + } + catch(const break_exception& e) + { + return e.value; + } + catch(const continue_exception&) + {} + + parent_t::incrementor_.first->value(); + } + } + else + { + while (is_true(parent_t::condition_)) + { + try + { + result = parent_t::loop_body_.first->value(); + } + catch(const break_exception& e) + { + return e.value; + } + catch(const continue_exception&) + {} + } + } + + return result; + } + }; + + template + class for_loop_bc_rtc_node exprtk_final + : public for_loop_bc_node + , public loop_runtime_checker + { + public: + + typedef for_loop_bc_node parent_t; + typedef expression_node* expression_ptr; + + for_loop_bc_rtc_node(expression_ptr initialiser, + expression_ptr condition, + expression_ptr incrementor, + expression_ptr loop_body, + loop_runtime_check_ptr loop_rt_chk) + : parent_t(initialiser, condition, incrementor, loop_body) + , loop_runtime_checker(loop_rt_chk, loop_runtime_check::e_for_loop) + {} + + inline T value() const exprtk_override + { + assert(parent_t::condition_.first); + assert(parent_t::loop_body_.first); + + T result = T(0); + + loop_runtime_checker::reset(); + + if (parent_t::initialiser_.first) + parent_t::initialiser_.first->value(); + + if (parent_t::incrementor_.first) + { + while (is_true(parent_t::condition_) && loop_runtime_checker::check()) + { + try + { + result = parent_t::loop_body_.first->value(); + } + catch(const break_exception& e) + { + return e.value; + } + catch(const continue_exception&) + {} + + parent_t::incrementor_.first->value(); + } + } + else + { + while (is_true(parent_t::condition_) && loop_runtime_checker::check()) + { + try + { + result = parent_t::loop_body_.first->value(); + } + catch(const break_exception& e) + { + return e.value; + } + catch(const continue_exception&) + {} + } + } + + return result; + } + }; + #endif + + template + class switch_node : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + template class Sequence> + explicit switch_node(const Sequence& arg_list) + { + if (1 != (arg_list.size() & 1)) + return; + + arg_list_.resize(arg_list.size()); + + for (std::size_t i = 0; i < arg_list.size(); ++i) + { + if (arg_list[i]) + { + construct_branch_pair(arg_list_[i], arg_list[i]); + } + else + { + arg_list_.clear(); + return; + } + } + } + + inline T value() const exprtk_override + { + if (!arg_list_.empty()) + { + const std::size_t upper_bound = (arg_list_.size() - 1); + + for (std::size_t i = 0; i < upper_bound; i += 2) + { + expression_ptr condition = arg_list_[i ].first; + expression_ptr consequent = arg_list_[i + 1].first; + + if (is_true(condition)) + { + return consequent->value(); + } + } + + return arg_list_[upper_bound].first->value(); + } + else + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override exprtk_final + { + return expression_node::e_switch; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(arg_list_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override exprtk_final + { + return expression_node::ndb_t::compute_node_depth(arg_list_); + } + + protected: + + std::vector arg_list_; + }; + + template + class switch_n_node exprtk_final : public switch_node + { + public: + + typedef expression_node* expression_ptr; + + template class Sequence> + explicit switch_n_node(const Sequence& arg_list) + : switch_node(arg_list) + {} + + inline T value() const exprtk_override + { + return Switch_N::process(switch_node::arg_list_); + } + }; + + template + class multi_switch_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + template class Sequence> + explicit multi_switch_node(const Sequence& arg_list) + { + if (0 != (arg_list.size() & 1)) + return; + + arg_list_.resize(arg_list.size()); + + for (std::size_t i = 0; i < arg_list.size(); ++i) + { + if (arg_list[i]) + { + construct_branch_pair(arg_list_[i], arg_list[i]); + } + else + { + arg_list_.clear(); + return; + } + } + } + + inline T value() const exprtk_override + { + T result = T(0); + + if (arg_list_.empty()) + { + return std::numeric_limits::quiet_NaN(); + } + + const std::size_t upper_bound = (arg_list_.size() - 1); + + for (std::size_t i = 0; i < upper_bound; i += 2) + { + expression_ptr condition = arg_list_[i ].first; + expression_ptr consequent = arg_list_[i + 1].first; + + if (is_true(condition)) + { + result = consequent->value(); + } + } + + return result; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_mswitch; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(arg_list_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override exprtk_final + { + return expression_node::ndb_t::compute_node_depth(arg_list_); + } + + private: + + std::vector arg_list_; + }; + + template + class ivariable + { + public: + + virtual ~ivariable() {} + + virtual T& ref() = 0; + virtual const T& ref() const = 0; + }; + + template + class variable_node exprtk_final + : public expression_node, + public ivariable + { + public: + + static T null_value; + + explicit variable_node() + : value_(&null_value) + {} + + explicit variable_node(T& v) + : value_(&v) + {} + + inline bool operator <(const variable_node& v) const + { + return this < (&v); + } + + inline T value() const exprtk_override + { + return (*value_); + } + + inline T& ref() exprtk_override + { + return (*value_); + } + + inline const T& ref() const exprtk_override + { + return (*value_); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_variable; + } + + private: + + T* value_; + }; + + template + T variable_node::null_value = T(std::numeric_limits::quiet_NaN()); + + template + struct range_pack + { + typedef expression_node* expression_node_ptr; + typedef std::pair cached_range_t; + + range_pack() + : n0_e (std::make_pair(false,expression_node_ptr(0))) + , n1_e (std::make_pair(false,expression_node_ptr(0))) + , n0_c (std::make_pair(false,0)) + , n1_c (std::make_pair(false,0)) + , cache(std::make_pair(0,0)) + {} + + void clear() + { + n0_e = std::make_pair(false,expression_node_ptr(0)); + n1_e = std::make_pair(false,expression_node_ptr(0)); + n0_c = std::make_pair(false,0); + n1_c = std::make_pair(false,0); + cache = std::make_pair(0,0); + } + + void free() + { + if (n0_e.first && n0_e.second) + { + n0_e.first = false; + + if ( + !is_variable_node(n0_e.second) && + !is_string_node (n0_e.second) + ) + { + destroy_node(n0_e.second); + } + } + + if (n1_e.first && n1_e.second) + { + n1_e.first = false; + + if ( + !is_variable_node(n1_e.second) && + !is_string_node (n1_e.second) + ) + { + destroy_node(n1_e.second); + } + } + } + + bool const_range() const + { + return ( n0_c.first && n1_c.first) && + (!n0_e.first && !n1_e.first); + } + + bool var_range() const + { + return ( n0_e.first && n1_e.first) && + (!n0_c.first && !n1_c.first); + } + + bool operator() (std::size_t& r0, std::size_t& r1, + const std::size_t& size = std::numeric_limits::max()) const + { + if (n0_c.first) + r0 = n0_c.second; + else if (n0_e.first) + { + r0 = static_cast(details::numeric::to_int64(n0_e.second->value())); + } + else + return false; + + if (n1_c.first) + r1 = n1_c.second; + else if (n1_e.first) + { + r1 = static_cast(details::numeric::to_int64(n1_e.second->value())); + } + else + return false; + + if ( + (std::numeric_limits::max() != size) && + (std::numeric_limits::max() == r1 ) + ) + { + r1 = size - 1; + } + + cache.first = r0; + cache.second = r1; + + #ifndef exprtk_enable_range_runtime_checks + return (r0 <= r1); + #else + return range_runtime_check(r0, r1, size); + #endif + } + + inline std::size_t const_size() const + { + return (n1_c.second - n0_c.second + 1); + } + + inline std::size_t cache_size() const + { + return (cache.second - cache.first + 1); + } + + std::pair n0_e; + std::pair n1_e; + std::pair n0_c; + std::pair n1_c; + mutable cached_range_t cache; + + #ifdef exprtk_enable_range_runtime_checks + bool range_runtime_check(const std::size_t r0, + const std::size_t r1, + const std::size_t size) const + { + if (r0 >= size) + { + throw std::runtime_error("range error: (r0 < 0) || (r0 >= size)"); + return false; + } + + if (r1 >= size) + { + throw std::runtime_error("range error: (r1 < 0) || (r1 >= size)"); + return false; + } + + return (r0 <= r1); + } + #endif + }; + + template + class string_base_node; + + template + struct range_data_type + { + typedef range_pack range_t; + typedef string_base_node* strbase_ptr_t; + + range_data_type() + : range(0) + , data (0) + , size (0) + , type_size(0) + , str_node (0) + {} + + range_t* range; + void* data; + std::size_t size; + std::size_t type_size; + strbase_ptr_t str_node; + }; + + template class vector_node; + + template + class vector_interface + { + public: + + typedef vector_node* vector_node_ptr; + typedef vec_data_store vds_t; + + virtual ~vector_interface() {} + + virtual std::size_t size () const = 0; + + virtual vector_node_ptr vec() const = 0; + + virtual vector_node_ptr vec() = 0; + + virtual vds_t& vds () = 0; + + virtual const vds_t& vds () const = 0; + + virtual bool side_effect () const { return false; } + }; + + template + class vector_node exprtk_final + : public expression_node + , public vector_interface + { + public: + + typedef expression_node* expression_ptr; + typedef vector_holder vector_holder_t; + typedef vector_node* vector_node_ptr; + typedef vec_data_store vds_t; + + explicit vector_node(vector_holder_t* vh) + : vector_holder_(vh) + , vds_((*vector_holder_).size(),(*vector_holder_)[0]) + { + vector_holder_->set_ref(&vds_.ref()); + } + + vector_node(const vds_t& vds, vector_holder_t* vh) + : vector_holder_(vh) + , vds_(vds) + {} + + inline T value() const exprtk_override + { + return vds().data()[0]; + } + + vector_node_ptr vec() const exprtk_override + { + return const_cast(this); + } + + vector_node_ptr vec() exprtk_override + { + return this; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vector; + } + + std::size_t size() const exprtk_override + { + return vds().size(); + } + + vds_t& vds() exprtk_override + { + return vds_; + } + + const vds_t& vds() const exprtk_override + { + return vds_; + } + + inline vector_holder_t& vec_holder() + { + return (*vector_holder_); + } + + private: + + vector_holder_t* vector_holder_; + vds_t vds_; + }; + + template + class vector_elem_node exprtk_final + : public expression_node, + public ivariable + { + public: + + typedef expression_node* expression_ptr; + typedef vector_holder vector_holder_t; + typedef vector_holder_t* vector_holder_ptr; + typedef std::pair branch_t; + + vector_elem_node(expression_ptr index, vector_holder_ptr vec_holder) + : vec_holder_(vec_holder) + , vector_base_((*vec_holder)[0]) + { + construct_branch_pair(index_, index); + } + + inline T value() const exprtk_override + { + return *(vector_base_ + static_cast(details::numeric::to_int64(index_.first->value()))); + } + + inline T& ref() exprtk_override + { + return *(vector_base_ + static_cast(details::numeric::to_int64(index_.first->value()))); + } + + inline const T& ref() const exprtk_override + { + return *(vector_base_ + static_cast(details::numeric::to_int64(index_.first->value()))); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecelem; + } + + inline vector_holder_t& vec_holder() + { + return (*vec_holder_); + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(index_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(index_); + } + + private: + + vector_holder_ptr vec_holder_; + T* vector_base_; + branch_t index_; + }; + + template + class rebasevector_elem_node exprtk_final + : public expression_node, + public ivariable + { + public: + + typedef expression_node* expression_ptr; + typedef vector_holder vector_holder_t; + typedef vector_holder_t* vector_holder_ptr; + typedef vec_data_store vds_t; + typedef std::pair branch_t; + + rebasevector_elem_node(expression_ptr index, vector_holder_ptr vec_holder) + : vector_holder_(vec_holder) + , vds_((*vector_holder_).size(),(*vector_holder_)[0]) + { + vector_holder_->set_ref(&vds_.ref()); + construct_branch_pair(index_, index); + } + + inline T value() const exprtk_override + { + return *(vds_.data() + static_cast(details::numeric::to_int64(index_.first->value()))); + } + + inline T& ref() exprtk_override + { + return *(vds_.data() + static_cast(details::numeric::to_int64(index_.first->value()))); + } + + inline const T& ref() const exprtk_override + { + return *(vds_.data() + static_cast(details::numeric::to_int64(index_.first->value()))); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_rbvecelem; + } + + inline vector_holder_t& vec_holder() + { + return (*vector_holder_); + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::template collect(index_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(index_); + } + + private: + + vector_holder_ptr vector_holder_; + vds_t vds_; + branch_t index_; + }; + + template + class rebasevector_celem_node exprtk_final + : public expression_node, + public ivariable + { + public: + + typedef expression_node* expression_ptr; + typedef vector_holder vector_holder_t; + typedef vector_holder_t* vector_holder_ptr; + typedef vec_data_store vds_t; + + rebasevector_celem_node(const std::size_t index, vector_holder_ptr vec_holder) + : index_(index) + , vector_holder_(vec_holder) + , vds_((*vector_holder_).size(),(*vector_holder_)[0]) + { + vector_holder_->set_ref(&vds_.ref()); + } + + inline T value() const exprtk_override + { + return *(vds_.data() + index_); + } + + inline T& ref() exprtk_override + { + return *(vds_.data() + index_); + } + + inline const T& ref() const exprtk_override + { + return *(vds_.data() + index_); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_rbveccelem; + } + + inline vector_holder_t& vec_holder() + { + return (*vector_holder_); + } + + private: + + const std::size_t index_; + vector_holder_ptr vector_holder_; + vds_t vds_; + }; + + template + class vector_assignment_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + + vector_assignment_node(T* vector_base, + const std::size_t& size, + const std::vector& initialiser_list, + const bool single_value_initialse) + : vector_base_(vector_base) + , initialiser_list_(initialiser_list) + , size_(size) + , single_value_initialse_(single_value_initialse) + {} + + inline T value() const exprtk_override + { + if (single_value_initialse_) + { + for (std::size_t i = 0; i < size_; ++i) + { + *(vector_base_ + i) = initialiser_list_[0]->value(); + } + } + else + { + const std::size_t initialiser_list_size = initialiser_list_.size(); + + for (std::size_t i = 0; i < initialiser_list_size; ++i) + { + *(vector_base_ + i) = initialiser_list_[i]->value(); + } + + if (initialiser_list_size < size_) + { + for (std::size_t i = initialiser_list_size; i < size_; ++i) + { + *(vector_base_ + i) = T(0); + } + } + } + + return *(vector_base_); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecdefass; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(initialiser_list_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(initialiser_list_); + } + + private: + + vector_assignment_node(const vector_assignment_node&) exprtk_delete; + vector_assignment_node& operator=(const vector_assignment_node&) exprtk_delete; + + mutable T* vector_base_; + std::vector initialiser_list_; + const std::size_t size_; + const bool single_value_initialse_; + }; + + template + class swap_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef variable_node* variable_node_ptr; + + swap_node(variable_node_ptr var0, variable_node_ptr var1) + : var0_(var0) + , var1_(var1) + {} + + inline T value() const exprtk_override + { + std::swap(var0_->ref(),var1_->ref()); + return var1_->ref(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_swap; + } + + private: + + variable_node_ptr var0_; + variable_node_ptr var1_; + }; + + template + class swap_generic_node exprtk_final : public binary_node + { + public: + + typedef expression_node* expression_ptr; + typedef ivariable* ivariable_ptr; + + swap_generic_node(expression_ptr var0, expression_ptr var1) + : binary_node(details::e_swap, var0, var1) + , var0_(dynamic_cast(var0)) + , var1_(dynamic_cast(var1)) + {} + + inline T value() const exprtk_override + { + std::swap(var0_->ref(),var1_->ref()); + return var1_->ref(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_swap; + } + + private: + + ivariable_ptr var0_; + ivariable_ptr var1_; + }; + + template + class swap_vecvec_node exprtk_final + : public binary_node + , public vector_interface + { + public: + + typedef expression_node* expression_ptr; + typedef vector_node * vector_node_ptr; + typedef vec_data_store vds_t; + + using binary_node::branch; + + swap_vecvec_node(expression_ptr branch0, + expression_ptr branch1) + : binary_node(details::e_swap, branch0, branch1) + , vec0_node_ptr_(0) + , vec1_node_ptr_(0) + , vec_size_ (0) + , initialised_ (false) + { + if (is_ivector_node(branch(0))) + { + vector_interface* vi = reinterpret_cast*>(0); + + if (0 != (vi = dynamic_cast*>(branch(0)))) + { + vec0_node_ptr_ = vi->vec(); + vds() = vi->vds(); + } + } + + if (is_ivector_node(branch(1))) + { + vector_interface* vi = reinterpret_cast*>(0); + + if (0 != (vi = dynamic_cast*>(branch(1)))) + { + vec1_node_ptr_ = vi->vec(); + } + } + + if (vec0_node_ptr_ && vec1_node_ptr_) + { + vec_size_ = std::min(vec0_node_ptr_->vds().size(), + vec1_node_ptr_->vds().size()); + + initialised_ = true; + } + + assert(initialised_); + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(branch(0)); + assert(branch(1)); + + binary_node::branch(0)->value(); + binary_node::branch(1)->value(); + + T* vec0 = vec0_node_ptr_->vds().data(); + T* vec1 = vec1_node_ptr_->vds().data(); + + for (std::size_t i = 0; i < vec_size_; ++i) + { + std::swap(vec0[i],vec1[i]); + } + + return vec1_node_ptr_->value(); + } + else + return std::numeric_limits::quiet_NaN(); + } + + vector_node_ptr vec() const exprtk_override + { + return vec0_node_ptr_; + } + + vector_node_ptr vec() exprtk_override + { + return vec0_node_ptr_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecvecswap; + } + + std::size_t size() const exprtk_override + { + return vec_size_; + } + + vds_t& vds() exprtk_override + { + return vds_; + } + + const vds_t& vds() const exprtk_override + { + return vds_; + } + + private: + + vector_node* vec0_node_ptr_; + vector_node* vec1_node_ptr_; + std::size_t vec_size_; + bool initialised_; + vds_t vds_; + }; + + #ifndef exprtk_disable_string_capabilities + template + class stringvar_node exprtk_final + : public expression_node , + public string_base_node, + public range_interface + { + public: + + typedef typename range_interface::range_t range_t; + + static std::string null_value; + + explicit stringvar_node() + : value_(&null_value) + {} + + explicit stringvar_node(std::string& v) + : value_(&v) + { + rp_.n0_c = std::make_pair(true,0); + rp_.n1_c = std::make_pair(true,v.size() - 1); + rp_.cache.first = rp_.n0_c.second; + rp_.cache.second = rp_.n1_c.second; + } + + inline bool operator <(const stringvar_node& v) const + { + return this < (&v); + } + + inline T value() const exprtk_override + { + rp_.n1_c.second = (*value_).size() - 1; + rp_.cache.second = rp_.n1_c.second; + + return std::numeric_limits::quiet_NaN(); + } + + std::string str() const exprtk_override + { + return ref(); + } + + char_cptr base() const exprtk_override + { + return &(*value_)[0]; + } + + std::size_t size() const exprtk_override + { + return ref().size(); + } + + std::string& ref() + { + return (*value_); + } + + const std::string& ref() const + { + return (*value_); + } + + range_t& range_ref() exprtk_override + { + return rp_; + } + + const range_t& range_ref() const exprtk_override + { + return rp_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_stringvar; + } + + void rebase(std::string& s) + { + value_ = &s; + rp_.n0_c = std::make_pair(true,0); + rp_.n1_c = std::make_pair(true,value_->size() - 1); + rp_.cache.first = rp_.n0_c.second; + rp_.cache.second = rp_.n1_c.second; + } + + private: + + std::string* value_; + mutable range_t rp_; + }; + + template + std::string stringvar_node::null_value = std::string(""); + + template + class string_range_node exprtk_final + : public expression_node , + public string_base_node, + public range_interface + { + public: + + typedef typename range_interface::range_t range_t; + + static std::string null_value; + + explicit string_range_node(std::string& v, const range_t& rp) + : value_(&v) + , rp_(rp) + {} + + virtual ~string_range_node() + { + rp_.free(); + } + + inline bool operator <(const string_range_node& v) const + { + return this < (&v); + } + + inline T value() const exprtk_override + { + return std::numeric_limits::quiet_NaN(); + } + + inline std::string str() const exprtk_override + { + return (*value_); + } + + char_cptr base() const exprtk_override + { + return &(*value_)[0]; + } + + std::size_t size() const exprtk_override + { + return ref().size(); + } + + inline range_t range() const + { + return rp_; + } + + inline virtual std::string& ref() + { + return (*value_); + } + + inline virtual const std::string& ref() const + { + return (*value_); + } + + inline range_t& range_ref() exprtk_override + { + return rp_; + } + + inline const range_t& range_ref() const exprtk_override + { + return rp_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_stringvarrng; + } + + private: + + std::string* value_; + range_t rp_; + }; + + template + std::string string_range_node::null_value = std::string(""); + + template + class const_string_range_node exprtk_final + : public expression_node , + public string_base_node, + public range_interface + { + public: + + typedef typename range_interface::range_t range_t; + + explicit const_string_range_node(const std::string& v, const range_t& rp) + : value_(v) + , rp_(rp) + {} + + ~const_string_range_node() + { + rp_.free(); + } + + inline T value() const exprtk_override + { + return std::numeric_limits::quiet_NaN(); + } + + std::string str() const exprtk_override + { + return value_; + } + + char_cptr base() const exprtk_override + { + return value_.data(); + } + + std::size_t size() const exprtk_override + { + return value_.size(); + } + + range_t range() const + { + return rp_; + } + + range_t& range_ref() exprtk_override + { + return rp_; + } + + const range_t& range_ref() const exprtk_override + { + return rp_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_cstringvarrng; + } + + private: + + const_string_range_node(const const_string_range_node&) exprtk_delete; + const_string_range_node& operator=(const const_string_range_node&) exprtk_delete; + + const std::string value_; + range_t rp_; + }; + + template + class generic_string_range_node exprtk_final + : public expression_node , + public string_base_node, + public range_interface + { + public: + + typedef expression_node * expression_ptr; + typedef stringvar_node * strvar_node_ptr; + typedef string_base_node* str_base_ptr; + typedef typename range_interface::range_t range_t; + typedef range_t* range_ptr; + typedef range_interface irange_t; + typedef irange_t* irange_ptr; + typedef std::pair branch_t; + + generic_string_range_node(expression_ptr str_branch, const range_t& brange) + : initialised_(false) + , str_base_ptr_ (0) + , str_range_ptr_(0) + , base_range_(brange) + { + range_.n0_c = std::make_pair(true,0); + range_.n1_c = std::make_pair(true,0); + range_.cache.first = range_.n0_c.second; + range_.cache.second = range_.n1_c.second; + + construct_branch_pair(branch_, str_branch); + + if (is_generally_string_node(branch_.first)) + { + str_base_ptr_ = dynamic_cast(branch_.first); + + if (0 == str_base_ptr_) + return; + + str_range_ptr_ = dynamic_cast(branch_.first); + + if (0 == str_range_ptr_) + return; + } + + initialised_ = (str_base_ptr_ && str_range_ptr_); + + assert(initialised_); + } + + ~generic_string_range_node() + { + base_range_.free(); + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(branch_.first); + + branch_.first->value(); + + std::size_t str_r0 = 0; + std::size_t str_r1 = 0; + + std::size_t r0 = 0; + std::size_t r1 = 0; + + const range_t& range = str_range_ptr_->range_ref(); + + const std::size_t base_str_size = str_base_ptr_->size(); + + if ( + range (str_r0, str_r1, base_str_size) && + base_range_( r0, r1, base_str_size - str_r0) + ) + { + const std::size_t size = (r1 - r0) + 1; + + range_.n1_c.second = size - 1; + range_.cache.second = range_.n1_c.second; + + value_.assign(str_base_ptr_->base() + str_r0 + r0, size); + } + } + + return std::numeric_limits::quiet_NaN(); + } + + std::string str() const exprtk_override + { + return value_; + } + + char_cptr base() const exprtk_override + { + return &value_[0]; + } + + std::size_t size() const exprtk_override + { + return value_.size(); + } + + range_t& range_ref() exprtk_override + { + return range_; + } + + const range_t& range_ref() const exprtk_override + { + return range_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_strgenrange; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(branch_); + } + + private: + + bool initialised_; + branch_t branch_; + str_base_ptr str_base_ptr_; + irange_ptr str_range_ptr_; + mutable range_t base_range_; + mutable range_t range_; + mutable std::string value_; + }; + + template + class string_concat_node exprtk_final + : public binary_node , + public string_base_node, + public range_interface + { + public: + + typedef typename range_interface::range_t range_t; + typedef range_interface irange_t; + typedef irange_t* irange_ptr; + typedef range_t* range_ptr; + typedef expression_node * expression_ptr; + typedef string_base_node* str_base_ptr; + + using binary_node::branch; + + string_concat_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , initialised_(false) + , str0_base_ptr_ (0) + , str1_base_ptr_ (0) + , str0_range_ptr_(0) + , str1_range_ptr_(0) + { + range_.n0_c = std::make_pair(true,0); + range_.n1_c = std::make_pair(true,0); + + range_.cache.first = range_.n0_c.second; + range_.cache.second = range_.n1_c.second; + + if (is_generally_string_node(branch(0))) + { + str0_base_ptr_ = dynamic_cast(branch(0)); + + if (0 == str0_base_ptr_) + return; + + str0_range_ptr_ = dynamic_cast(branch(0)); + + if (0 == str0_range_ptr_) + return; + } + + if (is_generally_string_node(branch(1))) + { + str1_base_ptr_ = dynamic_cast(branch(1)); + + if (0 == str1_base_ptr_) + return; + + str1_range_ptr_ = dynamic_cast(branch(1)); + + if (0 == str1_range_ptr_) + return; + } + + initialised_ = str0_base_ptr_ && + str1_base_ptr_ && + str0_range_ptr_ && + str1_range_ptr_ ; + + assert(initialised_); + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(branch(0)); + assert(branch(1)); + + branch(0)->value(); + branch(1)->value(); + + std::size_t str0_r0 = 0; + std::size_t str0_r1 = 0; + + std::size_t str1_r0 = 0; + std::size_t str1_r1 = 0; + + const range_t& range0 = str0_range_ptr_->range_ref(); + const range_t& range1 = str1_range_ptr_->range_ref(); + + if ( + range0(str0_r0, str0_r1, str0_base_ptr_->size()) && + range1(str1_r0, str1_r1, str1_base_ptr_->size()) + ) + { + const std::size_t size0 = (str0_r1 - str0_r0) + 1; + const std::size_t size1 = (str1_r1 - str1_r0) + 1; + + value_.assign(str0_base_ptr_->base() + str0_r0, size0); + value_.append(str1_base_ptr_->base() + str1_r0, size1); + + range_.n1_c.second = value_.size() - 1; + range_.cache.second = range_.n1_c.second; + } + } + + return std::numeric_limits::quiet_NaN(); + } + + std::string str() const exprtk_override + { + return value_; + } + + char_cptr base() const exprtk_override + { + return &value_[0]; + } + + std::size_t size() const exprtk_override + { + return value_.size(); + } + + range_t& range_ref() exprtk_override + { + return range_; + } + + const range_t& range_ref() const exprtk_override + { + return range_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_strconcat; + } + + private: + + bool initialised_; + str_base_ptr str0_base_ptr_; + str_base_ptr str1_base_ptr_; + irange_ptr str0_range_ptr_; + irange_ptr str1_range_ptr_; + mutable range_t range_; + mutable std::string value_; + }; + + template + class swap_string_node exprtk_final + : public binary_node , + public string_base_node, + public range_interface + { + public: + + typedef typename range_interface::range_t range_t; + typedef range_t* range_ptr; + typedef range_interface irange_t; + typedef irange_t* irange_ptr; + typedef expression_node * expression_ptr; + typedef stringvar_node * strvar_node_ptr; + typedef string_base_node* str_base_ptr; + + using binary_node::branch; + + swap_string_node(expression_ptr branch0, expression_ptr branch1) + : binary_node(details::e_swap, branch0, branch1), + initialised_(false), + str0_node_ptr_(0), + str1_node_ptr_(0) + { + if (is_string_node(branch(0))) + { + str0_node_ptr_ = static_cast(branch(0)); + } + + if (is_string_node(branch(1))) + { + str1_node_ptr_ = static_cast(branch(1)); + } + + initialised_ = (str0_node_ptr_ && str1_node_ptr_); + + assert(initialised_); + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(branch(0)); + assert(branch(1)); + + branch(0)->value(); + branch(1)->value(); + + std::swap(str0_node_ptr_->ref(), str1_node_ptr_->ref()); + } + + return std::numeric_limits::quiet_NaN(); + } + + std::string str() const exprtk_override + { + return str0_node_ptr_->str(); + } + + char_cptr base() const exprtk_override + { + return str0_node_ptr_->base(); + } + + std::size_t size() const exprtk_override + { + return str0_node_ptr_->size(); + } + + range_t& range_ref() exprtk_override + { + return str0_node_ptr_->range_ref(); + } + + const range_t& range_ref() const exprtk_override + { + return str0_node_ptr_->range_ref(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_strswap; + } + + private: + + bool initialised_; + strvar_node_ptr str0_node_ptr_; + strvar_node_ptr str1_node_ptr_; + }; + + template + class swap_genstrings_node exprtk_final : public binary_node + { + public: + + typedef typename range_interface::range_t range_t; + typedef range_t* range_ptr; + typedef range_interface irange_t; + typedef irange_t* irange_ptr; + typedef expression_node * expression_ptr; + typedef string_base_node* str_base_ptr; + + using binary_node::branch; + + swap_genstrings_node(expression_ptr branch0, + expression_ptr branch1) + : binary_node(details::e_default, branch0, branch1) + , str0_base_ptr_ (0) + , str1_base_ptr_ (0) + , str0_range_ptr_(0) + , str1_range_ptr_(0) + , initialised_(false) + { + if (is_generally_string_node(branch(0))) + { + str0_base_ptr_ = dynamic_cast(branch(0)); + + if (0 == str0_base_ptr_) + return; + + irange_ptr range = dynamic_cast(branch(0)); + + if (0 == range) + return; + + str0_range_ptr_ = &(range->range_ref()); + } + + if (is_generally_string_node(branch(1))) + { + str1_base_ptr_ = dynamic_cast(branch(1)); + + if (0 == str1_base_ptr_) + return; + + irange_ptr range = dynamic_cast(branch(1)); + + if (0 == range) + return; + + str1_range_ptr_ = &(range->range_ref()); + } + + initialised_ = str0_base_ptr_ && + str1_base_ptr_ && + str0_range_ptr_ && + str1_range_ptr_ ; + + assert(initialised_); + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(branch(0)); + assert(branch(1)); + + branch(0)->value(); + branch(1)->value(); + + std::size_t str0_r0 = 0; + std::size_t str0_r1 = 0; + + std::size_t str1_r0 = 0; + std::size_t str1_r1 = 0; + + const range_t& range0 = (*str0_range_ptr_); + const range_t& range1 = (*str1_range_ptr_); + + if ( + range0(str0_r0, str0_r1, str0_base_ptr_->size()) && + range1(str1_r0, str1_r1, str1_base_ptr_->size()) + ) + { + const std::size_t size0 = range0.cache_size(); + const std::size_t size1 = range1.cache_size(); + const std::size_t max_size = std::min(size0,size1); + + char_ptr s0 = const_cast(str0_base_ptr_->base() + str0_r0); + char_ptr s1 = const_cast(str1_base_ptr_->base() + str1_r0); + + loop_unroll::details lud(max_size); + char_cptr upper_bound = s0 + lud.upper_bound; + + while (s0 < upper_bound) + { + #define exprtk_loop(N) \ + std::swap(s0[N], s1[N]); \ + + exprtk_loop( 0) exprtk_loop( 1) + exprtk_loop( 2) exprtk_loop( 3) + #ifndef exprtk_disable_superscalar_unroll + exprtk_loop( 4) exprtk_loop( 5) + exprtk_loop( 6) exprtk_loop( 7) + exprtk_loop( 8) exprtk_loop( 9) + exprtk_loop(10) exprtk_loop(11) + exprtk_loop(12) exprtk_loop(13) + exprtk_loop(14) exprtk_loop(15) + #endif + + s0 += lud.batch_size; + s1 += lud.batch_size; + } + + int i = 0; + + exprtk_disable_fallthrough_begin + switch (lud.remainder) + { + #define case_stmt(N) \ + case N : { std::swap(s0[i], s1[i]); ++i; } \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(15) case_stmt(14) + case_stmt(13) case_stmt(12) + case_stmt(11) case_stmt(10) + case_stmt( 9) case_stmt( 8) + case_stmt( 7) case_stmt( 6) + case_stmt( 5) case_stmt( 4) + #endif + case_stmt( 3) case_stmt( 2) + case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef exprtk_loop + #undef case_stmt + } + } + + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_strswap; + } + + private: + + swap_genstrings_node(const swap_genstrings_node&) exprtk_delete; + swap_genstrings_node& operator=(const swap_genstrings_node&) exprtk_delete; + + str_base_ptr str0_base_ptr_; + str_base_ptr str1_base_ptr_; + range_ptr str0_range_ptr_; + range_ptr str1_range_ptr_; + bool initialised_; + }; + + template + class stringvar_size_node exprtk_final : public expression_node + { + public: + + static std::string null_value; + + explicit stringvar_size_node() + : value_(&null_value) + {} + + explicit stringvar_size_node(std::string& v) + : value_(&v) + {} + + inline T value() const exprtk_override + { + return T((*value_).size()); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_stringvarsize; + } + + private: + + std::string* value_; + }; + + template + std::string stringvar_size_node::null_value = std::string(""); + + template + class string_size_node exprtk_final : public expression_node + { + public: + + typedef expression_node * expression_ptr; + typedef string_base_node* str_base_ptr; + typedef std::pair branch_t; + + explicit string_size_node(expression_ptr branch) + : str_base_ptr_(0) + { + construct_branch_pair(branch_, branch); + + if (is_generally_string_node(branch_.first)) + { + str_base_ptr_ = dynamic_cast(branch_.first); + + if (0 == str_base_ptr_) + return; + } + } + + inline T value() const exprtk_override + { + T result = std::numeric_limits::quiet_NaN(); + + if (str_base_ptr_) + { + branch_.first->value(); + result = T(str_base_ptr_->size()); + } + + return result; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_stringsize; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(branch_); + } + + private: + + branch_t branch_; + str_base_ptr str_base_ptr_; + }; + + struct asn_assignment + { + static inline void execute(std::string& s, char_cptr data, const std::size_t size) + { s.assign(data,size); } + }; + + struct asn_addassignment + { + static inline void execute(std::string& s, char_cptr data, const std::size_t size) + { s.append(data,size); } + }; + + template + class assignment_string_node exprtk_final + : public binary_node , + public string_base_node, + public range_interface + { + public: + + typedef typename range_interface::range_t range_t; + typedef range_t* range_ptr; + typedef range_interface irange_t; + typedef irange_t* irange_ptr; + typedef expression_node * expression_ptr; + typedef stringvar_node * strvar_node_ptr; + typedef string_base_node* str_base_ptr; + + using binary_node::branch; + + assignment_string_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , initialised_(false) + , str0_base_ptr_ (0) + , str1_base_ptr_ (0) + , str0_node_ptr_ (0) + , str1_range_ptr_(0) + { + if (is_string_node(branch(0))) + { + str0_node_ptr_ = static_cast(branch(0)); + str0_base_ptr_ = dynamic_cast(branch(0)); + } + + if (is_generally_string_node(branch(1))) + { + str1_base_ptr_ = dynamic_cast(branch(1)); + + if (0 == str1_base_ptr_) + return; + + irange_ptr range = dynamic_cast(branch(1)); + + if (0 == range) + return; + + str1_range_ptr_ = &(range->range_ref()); + } + + initialised_ = str0_base_ptr_ && + str1_base_ptr_ && + str0_node_ptr_ && + str1_range_ptr_ ; + + assert(initialised_); + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(branch(0)); + assert(branch(1)); + + branch(1)->value(); + + std::size_t r0 = 0; + std::size_t r1 = 0; + + const range_t& range = (*str1_range_ptr_); + + if (range(r0, r1, str1_base_ptr_->size())) + { + AssignmentProcess::execute(str0_node_ptr_->ref(), + str1_base_ptr_->base() + r0, + (r1 - r0) + 1); + + branch(0)->value(); + } + } + + return std::numeric_limits::quiet_NaN(); + } + + std::string str() const exprtk_override + { + return str0_node_ptr_->str(); + } + + char_cptr base() const exprtk_override + { + return str0_node_ptr_->base(); + } + + std::size_t size() const exprtk_override + { + return str0_node_ptr_->size(); + } + + range_t& range_ref() exprtk_override + { + return str0_node_ptr_->range_ref(); + } + + const range_t& range_ref() const exprtk_override + { + return str0_node_ptr_->range_ref(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_strass; + } + + private: + + bool initialised_; + str_base_ptr str0_base_ptr_; + str_base_ptr str1_base_ptr_; + strvar_node_ptr str0_node_ptr_; + range_ptr str1_range_ptr_; + }; + + template + class assignment_string_range_node exprtk_final + : public binary_node , + public string_base_node, + public range_interface + { + public: + + typedef typename range_interface::range_t range_t; + typedef range_t* range_ptr; + typedef range_interface irange_t; + typedef irange_t* irange_ptr; + typedef expression_node * expression_ptr; + typedef stringvar_node * strvar_node_ptr; + typedef string_range_node* str_rng_node_ptr; + typedef string_base_node * str_base_ptr; + + using binary_node::branch; + + assignment_string_range_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , initialised_(false) + , str0_base_ptr_ (0) + , str1_base_ptr_ (0) + , str0_rng_node_ptr_(0) + , str0_range_ptr_ (0) + , str1_range_ptr_ (0) + { + if (is_string_range_node(branch(0))) + { + str0_rng_node_ptr_ = static_cast(branch(0)); + str0_base_ptr_ = dynamic_cast(branch(0)); + irange_ptr range = dynamic_cast(branch(0)); + + if (0 == range) + return; + + str0_range_ptr_ = &(range->range_ref()); + } + + if (is_generally_string_node(branch(1))) + { + str1_base_ptr_ = dynamic_cast(branch(1)); + + if (0 == str1_base_ptr_) + return; + + irange_ptr range = dynamic_cast(branch(1)); + + if (0 == range) + return; + + str1_range_ptr_ = &(range->range_ref()); + } + + initialised_ = str0_base_ptr_ && + str1_base_ptr_ && + str0_rng_node_ptr_ && + str0_range_ptr_ && + str1_range_ptr_ ; + + assert(initialised_); + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(branch(0)); + assert(branch(1)); + + branch(0)->value(); + branch(1)->value(); + + std::size_t s0_r0 = 0; + std::size_t s0_r1 = 0; + + std::size_t s1_r0 = 0; + std::size_t s1_r1 = 0; + + const range_t& range0 = (*str0_range_ptr_); + const range_t& range1 = (*str1_range_ptr_); + + if ( + range0(s0_r0, s0_r1, str0_base_ptr_->size()) && + range1(s1_r0, s1_r1, str1_base_ptr_->size()) + ) + { + const std::size_t size = std::min((s0_r1 - s0_r0), (s1_r1 - s1_r0)) + 1; + + std::copy(str1_base_ptr_->base() + s1_r0, + str1_base_ptr_->base() + s1_r0 + size, + const_cast(base() + s0_r0)); + } + } + + return std::numeric_limits::quiet_NaN(); + } + + std::string str() const exprtk_override + { + return str0_base_ptr_->str(); + } + + char_cptr base() const exprtk_override + { + return str0_base_ptr_->base(); + } + + std::size_t size() const exprtk_override + { + return str0_base_ptr_->size(); + } + + range_t& range_ref() exprtk_override + { + return str0_rng_node_ptr_->range_ref(); + } + + const range_t& range_ref() const exprtk_override + { + return str0_rng_node_ptr_->range_ref(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_strass; + } + + private: + + bool initialised_; + str_base_ptr str0_base_ptr_; + str_base_ptr str1_base_ptr_; + str_rng_node_ptr str0_rng_node_ptr_; + range_ptr str0_range_ptr_; + range_ptr str1_range_ptr_; + }; + + template + class conditional_string_node exprtk_final + : public trinary_node , + public string_base_node, + public range_interface + { + public: + + typedef typename range_interface::range_t range_t; + typedef range_t* range_ptr; + typedef range_interface irange_t; + typedef irange_t* irange_ptr; + typedef expression_node * expression_ptr; + typedef string_base_node* str_base_ptr; + + conditional_string_node(expression_ptr condition, + expression_ptr consequent, + expression_ptr alternative) + : trinary_node(details::e_default, consequent, alternative, condition) + , initialised_(false) + , str0_base_ptr_ (0) + , str1_base_ptr_ (0) + , str0_range_ptr_(0) + , str1_range_ptr_(0) + , condition_ (condition ) + , consequent_ (consequent ) + , alternative_(alternative) + { + range_.n0_c = std::make_pair(true,0); + range_.n1_c = std::make_pair(true,0); + + range_.cache.first = range_.n0_c.second; + range_.cache.second = range_.n1_c.second; + + if (is_generally_string_node(trinary_node::branch_[0].first)) + { + str0_base_ptr_ = dynamic_cast(trinary_node::branch_[0].first); + + if (0 == str0_base_ptr_) + return; + + str0_range_ptr_ = dynamic_cast(trinary_node::branch_[0].first); + + if (0 == str0_range_ptr_) + return; + } + + if (is_generally_string_node(trinary_node::branch_[1].first)) + { + str1_base_ptr_ = dynamic_cast(trinary_node::branch_[1].first); + + if (0 == str1_base_ptr_) + return; + + str1_range_ptr_ = dynamic_cast(trinary_node::branch_[1].first); + + if (0 == str1_range_ptr_) + return; + } + + initialised_ = str0_base_ptr_ && + str1_base_ptr_ && + str0_range_ptr_ && + str1_range_ptr_ ; + + assert(initialised_); + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(condition_ ); + assert(consequent_ ); + assert(alternative_); + + std::size_t r0 = 0; + std::size_t r1 = 0; + + if (is_true(condition_)) + { + consequent_->value(); + + const range_t& range = str0_range_ptr_->range_ref(); + + if (range(r0, r1, str0_base_ptr_->size())) + { + const std::size_t size = (r1 - r0) + 1; + + value_.assign(str0_base_ptr_->base() + r0, size); + + range_.n1_c.second = value_.size() - 1; + range_.cache.second = range_.n1_c.second; + + return T(1); + } + } + else + { + alternative_->value(); + + const range_t& range = str1_range_ptr_->range_ref(); + + if (range(r0, r1, str1_base_ptr_->size())) + { + const std::size_t size = (r1 - r0) + 1; + + value_.assign(str1_base_ptr_->base() + r0, size); + + range_.n1_c.second = value_.size() - 1; + range_.cache.second = range_.n1_c.second; + + return T(0); + } + } + } + + return std::numeric_limits::quiet_NaN(); + } + + std::string str() const exprtk_override + { + return value_; + } + + char_cptr base() const exprtk_override + { + return &value_[0]; + } + + std::size_t size() const exprtk_override + { + return value_.size(); + } + + range_t& range_ref() exprtk_override + { + return range_; + } + + const range_t& range_ref() const exprtk_override + { + return range_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_strcondition; + } + + private: + + bool initialised_; + str_base_ptr str0_base_ptr_; + str_base_ptr str1_base_ptr_; + irange_ptr str0_range_ptr_; + irange_ptr str1_range_ptr_; + mutable range_t range_; + mutable std::string value_; + + expression_ptr condition_; + expression_ptr consequent_; + expression_ptr alternative_; + }; + + template + class cons_conditional_str_node exprtk_final + : public binary_node , + public string_base_node, + public range_interface + { + public: + + typedef typename range_interface::range_t range_t; + typedef range_t* range_ptr; + typedef range_interface irange_t; + typedef irange_t* irange_ptr; + typedef expression_node * expression_ptr; + typedef string_base_node* str_base_ptr; + + using binary_node::branch; + + cons_conditional_str_node(expression_ptr condition, + expression_ptr consequent) + : binary_node(details::e_default, consequent, condition) + , initialised_(false) + , str0_base_ptr_ (0) + , str0_range_ptr_(0) + , condition_ (condition ) + , consequent_(consequent) + { + range_.n0_c = std::make_pair(true,0); + range_.n1_c = std::make_pair(true,0); + + range_.cache.first = range_.n0_c.second; + range_.cache.second = range_.n1_c.second; + + if (is_generally_string_node(branch(0))) + { + str0_base_ptr_ = dynamic_cast(branch(0)); + + if (0 == str0_base_ptr_) + return; + + str0_range_ptr_ = dynamic_cast(branch(0)); + + if (0 == str0_range_ptr_) + return; + } + + initialised_ = str0_base_ptr_ && str0_range_ptr_ ; + + assert(initialised_); + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(condition_ ); + assert(consequent_); + + if (is_true(condition_)) + { + consequent_->value(); + + const range_t& range = str0_range_ptr_->range_ref(); + + std::size_t r0 = 0; + std::size_t r1 = 0; + + if (range(r0, r1, str0_base_ptr_->size())) + { + const std::size_t size = (r1 - r0) + 1; + + value_.assign(str0_base_ptr_->base() + r0, size); + + range_.n1_c.second = value_.size() - 1; + range_.cache.second = range_.n1_c.second; + + return T(1); + } + } + } + + return std::numeric_limits::quiet_NaN(); + } + + std::string str() const + { + return value_; + } + + char_cptr base() const + { + return &value_[0]; + } + + std::size_t size() const + { + return value_.size(); + } + + range_t& range_ref() + { + return range_; + } + + const range_t& range_ref() const + { + return range_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_strccondition; + } + + private: + + bool initialised_; + str_base_ptr str0_base_ptr_; + irange_ptr str0_range_ptr_; + mutable range_t range_; + mutable std::string value_; + + expression_ptr condition_; + expression_ptr consequent_; + }; + + template + class str_vararg_node exprtk_final + : public expression_node , + public string_base_node, + public range_interface + { + public: + + typedef typename range_interface::range_t range_t; + typedef range_t* range_ptr; + typedef range_interface irange_t; + typedef irange_t* irange_ptr; + typedef expression_node * expression_ptr; + typedef string_base_node* str_base_ptr; + typedef std::pair branch_t; + + template class Sequence> + explicit str_vararg_node(const Sequence& arg_list) + : initialised_(false) + , str_base_ptr_ (0) + , str_range_ptr_(0) + { + construct_branch_pair(final_node_, const_cast(arg_list.back())); + + if (0 == final_node_.first) + return; + else if (!is_generally_string_node(final_node_.first)) + return; + + str_base_ptr_ = dynamic_cast(final_node_.first); + + if (0 == str_base_ptr_) + return; + + str_range_ptr_ = dynamic_cast(final_node_.first); + + if (0 == str_range_ptr_) + return; + + initialised_ = str_base_ptr_ && str_range_ptr_; + + if (arg_list.size() > 1) + { + const std::size_t arg_list_size = arg_list.size() - 1; + + arg_list_.resize(arg_list_size); + + for (std::size_t i = 0; i < arg_list_size; ++i) + { + if (arg_list[i]) + { + construct_branch_pair(arg_list_[i], arg_list[i]); + } + else + { + arg_list_.clear(); + return; + } + } + } + } + + inline T value() const exprtk_override + { + if (!arg_list_.empty()) + { + VarArgFunction::process(arg_list_); + } + + final_node_.first->value(); + + return std::numeric_limits::quiet_NaN(); + } + + std::string str() const exprtk_override + { + return str_base_ptr_->str(); + } + + char_cptr base() const exprtk_override + { + return str_base_ptr_->base(); + } + + std::size_t size() const exprtk_override + { + return str_base_ptr_->size(); + } + + range_t& range_ref() exprtk_override + { + return str_range_ptr_->range_ref(); + } + + const range_t& range_ref() const exprtk_override + { + return str_range_ptr_->range_ref(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_stringvararg; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(final_node_ , node_delete_list); + expression_node::ndb_t::collect(arg_list_ , node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return std::max( + expression_node::ndb_t::compute_node_depth(final_node_), + expression_node::ndb_t::compute_node_depth(arg_list_ )); + } + + private: + + bool initialised_; + branch_t final_node_; + str_base_ptr str_base_ptr_; + irange_ptr str_range_ptr_; + std::vector arg_list_; + }; + #endif + + template + inline T axn(const T a, const T x) + { + // a*x^n + return a * exprtk::details::numeric::fast_exp::result(x); + } + + template + inline T axnb(const T a, const T x, const T b) + { + // a*x^n+b + return a * exprtk::details::numeric::fast_exp::result(x) + b; + } + + template + struct sf_base + { + typedef typename details::functor_t::Type Type; + typedef typename details::functor_t functor_t; + typedef typename functor_t::qfunc_t quaternary_functor_t; + typedef typename functor_t::tfunc_t trinary_functor_t; + typedef typename functor_t::bfunc_t binary_functor_t; + typedef typename functor_t::ufunc_t unary_functor_t; + }; + + #define define_sfop3(NN, OP0, OP1) \ + template \ + struct sf##NN##_op : public sf_base \ + { \ + typedef typename sf_base::Type const Type; \ + static inline T process(Type x, Type y, Type z) \ + { \ + return (OP0); \ + } \ + static inline std::string id() \ + { \ + return (OP1); \ + } \ + }; \ + + define_sfop3(00,(x + y) / z ,"(t+t)/t") + define_sfop3(01,(x + y) * z ,"(t+t)*t") + define_sfop3(02,(x + y) - z ,"(t+t)-t") + define_sfop3(03,(x + y) + z ,"(t+t)+t") + define_sfop3(04,(x - y) + z ,"(t-t)+t") + define_sfop3(05,(x - y) / z ,"(t-t)/t") + define_sfop3(06,(x - y) * z ,"(t-t)*t") + define_sfop3(07,(x * y) + z ,"(t*t)+t") + define_sfop3(08,(x * y) - z ,"(t*t)-t") + define_sfop3(09,(x * y) / z ,"(t*t)/t") + define_sfop3(10,(x * y) * z ,"(t*t)*t") + define_sfop3(11,(x / y) + z ,"(t/t)+t") + define_sfop3(12,(x / y) - z ,"(t/t)-t") + define_sfop3(13,(x / y) / z ,"(t/t)/t") + define_sfop3(14,(x / y) * z ,"(t/t)*t") + define_sfop3(15,x / (y + z) ,"t/(t+t)") + define_sfop3(16,x / (y - z) ,"t/(t-t)") + define_sfop3(17,x / (y * z) ,"t/(t*t)") + define_sfop3(18,x / (y / z) ,"t/(t/t)") + define_sfop3(19,x * (y + z) ,"t*(t+t)") + define_sfop3(20,x * (y - z) ,"t*(t-t)") + define_sfop3(21,x * (y * z) ,"t*(t*t)") + define_sfop3(22,x * (y / z) ,"t*(t/t)") + define_sfop3(23,x - (y + z) ,"t-(t+t)") + define_sfop3(24,x - (y - z) ,"t-(t-t)") + define_sfop3(25,x - (y / z) ,"t-(t/t)") + define_sfop3(26,x - (y * z) ,"t-(t*t)") + define_sfop3(27,x + (y * z) ,"t+(t*t)") + define_sfop3(28,x + (y / z) ,"t+(t/t)") + define_sfop3(29,x + (y + z) ,"t+(t+t)") + define_sfop3(30,x + (y - z) ,"t+(t-t)") + define_sfop3(31,(axnb(x,y,z))," ") + define_sfop3(32,(axnb(x,y,z))," ") + define_sfop3(33,(axnb(x,y,z))," ") + define_sfop3(34,(axnb(x,y,z))," ") + define_sfop3(35,(axnb(x,y,z))," ") + define_sfop3(36,(axnb(x,y,z))," ") + define_sfop3(37,(axnb(x,y,z))," ") + define_sfop3(38,(axnb(x,y,z))," ") + define_sfop3(39,x * numeric::log(y) + z,"") + define_sfop3(40,x * numeric::log(y) - z,"") + define_sfop3(41,x * numeric::log10(y) + z,"") + define_sfop3(42,x * numeric::log10(y) - z,"") + define_sfop3(43,x * numeric::sin(y) + z ,"") + define_sfop3(44,x * numeric::sin(y) - z ,"") + define_sfop3(45,x * numeric::cos(y) + z ,"") + define_sfop3(46,x * numeric::cos(y) - z ,"") + define_sfop3(47,details::is_true(x) ? y : z,"") + + #define define_sfop4(NN, OP0, OP1) \ + template \ + struct sf##NN##_op : public sf_base \ + { \ + typedef typename sf_base::Type const Type; \ + static inline T process(Type x, Type y, Type z, Type w) \ + { \ + return (OP0); \ + } \ + static inline std::string id() \ + { \ + return (OP1); \ + } \ + }; \ + + define_sfop4(48,(x + ((y + z) / w)),"t+((t+t)/t)") + define_sfop4(49,(x + ((y + z) * w)),"t+((t+t)*t)") + define_sfop4(50,(x + ((y - z) / w)),"t+((t-t)/t)") + define_sfop4(51,(x + ((y - z) * w)),"t+((t-t)*t)") + define_sfop4(52,(x + ((y * z) / w)),"t+((t*t)/t)") + define_sfop4(53,(x + ((y * z) * w)),"t+((t*t)*t)") + define_sfop4(54,(x + ((y / z) + w)),"t+((t/t)+t)") + define_sfop4(55,(x + ((y / z) / w)),"t+((t/t)/t)") + define_sfop4(56,(x + ((y / z) * w)),"t+((t/t)*t)") + define_sfop4(57,(x - ((y + z) / w)),"t-((t+t)/t)") + define_sfop4(58,(x - ((y + z) * w)),"t-((t+t)*t)") + define_sfop4(59,(x - ((y - z) / w)),"t-((t-t)/t)") + define_sfop4(60,(x - ((y - z) * w)),"t-((t-t)*t)") + define_sfop4(61,(x - ((y * z) / w)),"t-((t*t)/t)") + define_sfop4(62,(x - ((y * z) * w)),"t-((t*t)*t)") + define_sfop4(63,(x - ((y / z) / w)),"t-((t/t)/t)") + define_sfop4(64,(x - ((y / z) * w)),"t-((t/t)*t)") + define_sfop4(65,(((x + y) * z) - w),"((t+t)*t)-t") + define_sfop4(66,(((x - y) * z) - w),"((t-t)*t)-t") + define_sfop4(67,(((x * y) * z) - w),"((t*t)*t)-t") + define_sfop4(68,(((x / y) * z) - w),"((t/t)*t)-t") + define_sfop4(69,(((x + y) / z) - w),"((t+t)/t)-t") + define_sfop4(70,(((x - y) / z) - w),"((t-t)/t)-t") + define_sfop4(71,(((x * y) / z) - w),"((t*t)/t)-t") + define_sfop4(72,(((x / y) / z) - w),"((t/t)/t)-t") + define_sfop4(73,((x * y) + (z * w)),"(t*t)+(t*t)") + define_sfop4(74,((x * y) - (z * w)),"(t*t)-(t*t)") + define_sfop4(75,((x * y) + (z / w)),"(t*t)+(t/t)") + define_sfop4(76,((x * y) - (z / w)),"(t*t)-(t/t)") + define_sfop4(77,((x / y) + (z / w)),"(t/t)+(t/t)") + define_sfop4(78,((x / y) - (z / w)),"(t/t)-(t/t)") + define_sfop4(79,((x / y) - (z * w)),"(t/t)-(t*t)") + define_sfop4(80,(x / (y + (z * w))),"t/(t+(t*t))") + define_sfop4(81,(x / (y - (z * w))),"t/(t-(t*t))") + define_sfop4(82,(x * (y + (z * w))),"t*(t+(t*t))") + define_sfop4(83,(x * (y - (z * w))),"t*(t-(t*t))") + + define_sfop4(84,(axn(x,y) + axn(z,w)),"") + define_sfop4(85,(axn(x,y) + axn(z,w)),"") + define_sfop4(86,(axn(x,y) + axn(z,w)),"") + define_sfop4(87,(axn(x,y) + axn(z,w)),"") + define_sfop4(88,(axn(x,y) + axn(z,w)),"") + define_sfop4(89,(axn(x,y) + axn(z,w)),"") + define_sfop4(90,(axn(x,y) + axn(z,w)),"") + define_sfop4(91,(axn(x,y) + axn(z,w)),"") + define_sfop4(92,((details::is_true(x) && details::is_true(y)) ? z : w),"") + define_sfop4(93,((details::is_true(x) || details::is_true(y)) ? z : w),"") + define_sfop4(94,((x < y) ? z : w),"") + define_sfop4(95,((x <= y) ? z : w),"") + define_sfop4(96,((x > y) ? z : w),"") + define_sfop4(97,((x >= y) ? z : w),"") + define_sfop4(98,(details::is_true(numeric::equal(x,y)) ? z : w),"") + define_sfop4(99,(x * numeric::sin(y) + z * numeric::cos(w)),"") + + define_sfop4(ext00,((x + y) - (z * w)),"(t+t)-(t*t)") + define_sfop4(ext01,((x + y) - (z / w)),"(t+t)-(t/t)") + define_sfop4(ext02,((x + y) + (z * w)),"(t+t)+(t*t)") + define_sfop4(ext03,((x + y) + (z / w)),"(t+t)+(t/t)") + define_sfop4(ext04,((x - y) + (z * w)),"(t-t)+(t*t)") + define_sfop4(ext05,((x - y) + (z / w)),"(t-t)+(t/t)") + define_sfop4(ext06,((x - y) - (z * w)),"(t-t)-(t*t)") + define_sfop4(ext07,((x - y) - (z / w)),"(t-t)-(t/t)") + define_sfop4(ext08,((x + y) - (z - w)),"(t+t)-(t-t)") + define_sfop4(ext09,((x + y) + (z - w)),"(t+t)+(t-t)") + define_sfop4(ext10,((x + y) + (z + w)),"(t+t)+(t+t)") + define_sfop4(ext11,((x + y) * (z - w)),"(t+t)*(t-t)") + define_sfop4(ext12,((x + y) / (z - w)),"(t+t)/(t-t)") + define_sfop4(ext13,((x - y) - (z + w)),"(t-t)-(t+t)") + define_sfop4(ext14,((x - y) + (z + w)),"(t-t)+(t+t)") + define_sfop4(ext15,((x - y) * (z + w)),"(t-t)*(t+t)") + define_sfop4(ext16,((x - y) / (z + w)),"(t-t)/(t+t)") + define_sfop4(ext17,((x * y) - (z + w)),"(t*t)-(t+t)") + define_sfop4(ext18,((x / y) - (z + w)),"(t/t)-(t+t)") + define_sfop4(ext19,((x * y) + (z + w)),"(t*t)+(t+t)") + define_sfop4(ext20,((x / y) + (z + w)),"(t/t)+(t+t)") + define_sfop4(ext21,((x * y) + (z - w)),"(t*t)+(t-t)") + define_sfop4(ext22,((x / y) + (z - w)),"(t/t)+(t-t)") + define_sfop4(ext23,((x * y) - (z - w)),"(t*t)-(t-t)") + define_sfop4(ext24,((x / y) - (z - w)),"(t/t)-(t-t)") + define_sfop4(ext25,((x + y) * (z * w)),"(t+t)*(t*t)") + define_sfop4(ext26,((x + y) * (z / w)),"(t+t)*(t/t)") + define_sfop4(ext27,((x + y) / (z * w)),"(t+t)/(t*t)") + define_sfop4(ext28,((x + y) / (z / w)),"(t+t)/(t/t)") + define_sfop4(ext29,((x - y) / (z * w)),"(t-t)/(t*t)") + define_sfop4(ext30,((x - y) / (z / w)),"(t-t)/(t/t)") + define_sfop4(ext31,((x - y) * (z * w)),"(t-t)*(t*t)") + define_sfop4(ext32,((x - y) * (z / w)),"(t-t)*(t/t)") + define_sfop4(ext33,((x * y) * (z + w)),"(t*t)*(t+t)") + define_sfop4(ext34,((x / y) * (z + w)),"(t/t)*(t+t)") + define_sfop4(ext35,((x * y) / (z + w)),"(t*t)/(t+t)") + define_sfop4(ext36,((x / y) / (z + w)),"(t/t)/(t+t)") + define_sfop4(ext37,((x * y) / (z - w)),"(t*t)/(t-t)") + define_sfop4(ext38,((x / y) / (z - w)),"(t/t)/(t-t)") + define_sfop4(ext39,((x * y) * (z - w)),"(t*t)*(t-t)") + define_sfop4(ext40,((x * y) / (z * w)),"(t*t)/(t*t)") + define_sfop4(ext41,((x / y) * (z / w)),"(t/t)*(t/t)") + define_sfop4(ext42,((x / y) * (z - w)),"(t/t)*(t-t)") + define_sfop4(ext43,((x * y) * (z * w)),"(t*t)*(t*t)") + define_sfop4(ext44,(x + (y * (z / w))),"t+(t*(t/t))") + define_sfop4(ext45,(x - (y * (z / w))),"t-(t*(t/t))") + define_sfop4(ext46,(x + (y / (z * w))),"t+(t/(t*t))") + define_sfop4(ext47,(x - (y / (z * w))),"t-(t/(t*t))") + define_sfop4(ext48,(((x - y) - z) * w),"((t-t)-t)*t") + define_sfop4(ext49,(((x - y) - z) / w),"((t-t)-t)/t") + define_sfop4(ext50,(((x - y) + z) * w),"((t-t)+t)*t") + define_sfop4(ext51,(((x - y) + z) / w),"((t-t)+t)/t") + define_sfop4(ext52,((x + (y - z)) * w),"(t+(t-t))*t") + define_sfop4(ext53,((x + (y - z)) / w),"(t+(t-t))/t") + define_sfop4(ext54,((x + y) / (z + w)),"(t+t)/(t+t)") + define_sfop4(ext55,((x - y) / (z - w)),"(t-t)/(t-t)") + define_sfop4(ext56,((x + y) * (z + w)),"(t+t)*(t+t)") + define_sfop4(ext57,((x - y) * (z - w)),"(t-t)*(t-t)") + define_sfop4(ext58,((x - y) + (z - w)),"(t-t)+(t-t)") + define_sfop4(ext59,((x - y) - (z - w)),"(t-t)-(t-t)") + define_sfop4(ext60,((x / y) + (z * w)),"(t/t)+(t*t)") + define_sfop4(ext61,(((x * y) * z) / w),"((t*t)*t)/t") + + #undef define_sfop3 + #undef define_sfop4 + + template + class sf3_node exprtk_final : public trinary_node + { + public: + + typedef expression_node* expression_ptr; + + sf3_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1, + expression_ptr branch2) + : trinary_node(opr, branch0, branch1, branch2) + {} + + inline T value() const exprtk_override + { + assert(trinary_node::branch_[0].first); + assert(trinary_node::branch_[1].first); + assert(trinary_node::branch_[2].first); + + const T x = trinary_node::branch_[0].first->value(); + const T y = trinary_node::branch_[1].first->value(); + const T z = trinary_node::branch_[2].first->value(); + + return SpecialFunction::process(x, y, z); + } + }; + + template + class sf4_node exprtk_final : public quaternary_node + { + public: + + typedef expression_node* expression_ptr; + + sf4_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1, + expression_ptr branch2, + expression_ptr branch3) + : quaternary_node(opr, branch0, branch1, branch2, branch3) + {} + + inline T value() const exprtk_override + { + assert(quaternary_node::branch_[0].first); + assert(quaternary_node::branch_[1].first); + assert(quaternary_node::branch_[2].first); + assert(quaternary_node::branch_[3].first); + + const T x = quaternary_node::branch_[0].first->value(); + const T y = quaternary_node::branch_[1].first->value(); + const T z = quaternary_node::branch_[2].first->value(); + const T w = quaternary_node::branch_[3].first->value(); + + return SpecialFunction::process(x, y, z, w); + } + }; + + template + class sf3_var_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + + sf3_var_node(const T& v0, const T& v1, const T& v2) + : v0_(v0) + , v1_(v1) + , v2_(v2) + {} + + inline T value() const exprtk_override + { + return SpecialFunction::process(v0_, v1_, v2_); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_trinary; + } + + private: + + sf3_var_node(const sf3_var_node&) exprtk_delete; + sf3_var_node& operator=(const sf3_var_node&) exprtk_delete; + + const T& v0_; + const T& v1_; + const T& v2_; + }; + + template + class sf4_var_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + + sf4_var_node(const T& v0, const T& v1, const T& v2, const T& v3) + : v0_(v0) + , v1_(v1) + , v2_(v2) + , v3_(v3) + {} + + inline T value() const exprtk_override + { + return SpecialFunction::process(v0_, v1_, v2_, v3_); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_trinary; + } + + private: + + sf4_var_node(const sf4_var_node&) exprtk_delete; + sf4_var_node& operator=(const sf4_var_node&) exprtk_delete; + + const T& v0_; + const T& v1_; + const T& v2_; + const T& v3_; + }; + + template + class vararg_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + template class Sequence> + explicit vararg_node(const Sequence& arg_list) + { + arg_list_.resize(arg_list.size()); + + for (std::size_t i = 0; i < arg_list.size(); ++i) + { + if (arg_list[i]) + { + construct_branch_pair(arg_list_[i],arg_list[i]); + } + else + { + arg_list_.clear(); + return; + } + } + } + + inline T value() const exprtk_override + { + return VarArgFunction::process(arg_list_); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vararg; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(arg_list_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(arg_list_); + } + + private: + + std::vector arg_list_; + }; + + template + class vararg_varnode exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + + template class Sequence> + explicit vararg_varnode(const Sequence& arg_list) + { + arg_list_.resize(arg_list.size()); + + for (std::size_t i = 0; i < arg_list.size(); ++i) + { + if (arg_list[i] && is_variable_node(arg_list[i])) + { + variable_node* var_node_ptr = static_cast*>(arg_list[i]); + arg_list_[i] = (&var_node_ptr->ref()); + } + else + { + arg_list_.clear(); + return; + } + } + } + + inline T value() const exprtk_override + { + if (!arg_list_.empty()) + return VarArgFunction::process(arg_list_); + else + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vararg; + } + + private: + + std::vector arg_list_; + }; + + template + class vectorize_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + explicit vectorize_node(const expression_ptr v) + : ivec_ptr_(0) + { + construct_branch_pair(v_, v); + + if (is_ivector_node(v_.first)) + { + ivec_ptr_ = dynamic_cast*>(v_.first); + } + else + ivec_ptr_ = 0; + } + + inline T value() const exprtk_override + { + if (ivec_ptr_) + { + assert(v_.first); + + v_.first->value(); + + return VecFunction::process(ivec_ptr_); + } + else + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecfunc; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(v_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(v_); + } + + private: + + vector_interface* ivec_ptr_; + branch_t v_; + }; + + template + class assignment_node exprtk_final : public binary_node + { + public: + + typedef expression_node* expression_ptr; + using binary_node::branch; + + assignment_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , var_node_ptr_(0) + { + if (is_variable_node(branch(0))) + { + var_node_ptr_ = static_cast*>(branch(0)); + } + } + + inline T value() const exprtk_override + { + if (var_node_ptr_) + { + assert(branch(1)); + + T& result = var_node_ptr_->ref(); + result = branch(1)->value(); + + return result; + } + else + return std::numeric_limits::quiet_NaN(); + } + + private: + + variable_node* var_node_ptr_; + }; + + template + class assignment_vec_elem_node exprtk_final : public binary_node + { + public: + + typedef expression_node* expression_ptr; + using binary_node::branch; + + assignment_vec_elem_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , vec_node_ptr_(0) + { + if (is_vector_elem_node(branch(0))) + { + vec_node_ptr_ = static_cast*>(branch(0)); + } + } + + inline T value() const exprtk_override + { + if (vec_node_ptr_) + { + assert(branch(1)); + + T& result = vec_node_ptr_->ref(); + result = branch(1)->value(); + + return result; + } + else + return std::numeric_limits::quiet_NaN(); + } + + private: + + vector_elem_node* vec_node_ptr_; + }; + + template + class assignment_rebasevec_elem_node exprtk_final : public binary_node + { + public: + + typedef expression_node* expression_ptr; + using expression_node::branch; + + assignment_rebasevec_elem_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , rbvec_node_ptr_(0) + { + if (is_rebasevector_elem_node(branch(0))) + { + rbvec_node_ptr_ = static_cast*>(branch(0)); + } + } + + inline T value() const exprtk_override + { + if (rbvec_node_ptr_) + { + assert(branch(1)); + + T& result = rbvec_node_ptr_->ref(); + + result = branch(1)->value(); + + return result; + } + else + return std::numeric_limits::quiet_NaN(); + } + + private: + + rebasevector_elem_node* rbvec_node_ptr_; + }; + + template + class assignment_rebasevec_celem_node exprtk_final : public binary_node + { + public: + + typedef expression_node* expression_ptr; + using binary_node::branch; + + assignment_rebasevec_celem_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , rbvec_node_ptr_(0) + { + if (is_rebasevector_celem_node(branch(0))) + { + rbvec_node_ptr_ = static_cast*>(branch(0)); + } + } + + inline T value() const exprtk_override + { + if (rbvec_node_ptr_) + { + assert(branch(1)); + + T& result = rbvec_node_ptr_->ref(); + result = branch(1)->value(); + + return result; + } + else + return std::numeric_limits::quiet_NaN(); + } + + private: + + rebasevector_celem_node* rbvec_node_ptr_; + }; + + template + class assignment_vec_node exprtk_final + : public binary_node + , public vector_interface + { + public: + + typedef expression_node* expression_ptr; + typedef vector_node* vector_node_ptr; + typedef vec_data_store vds_t; + + using binary_node::branch; + + assignment_vec_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , vec_node_ptr_(0) + { + if (is_vector_node(branch(0))) + { + vec_node_ptr_ = static_cast*>(branch(0)); + vds() = vec_node_ptr_->vds(); + } + } + + inline T value() const exprtk_override + { + if (vec_node_ptr_) + { + assert(branch(1)); + + const T v = branch(1)->value(); + + T* vec = vds().data(); + + loop_unroll::details lud(size()); + const T* upper_bound = vec + lud.upper_bound; + + while (vec < upper_bound) + { + #define exprtk_loop(N) \ + vec[N] = v; \ + + exprtk_loop( 0) exprtk_loop( 1) + exprtk_loop( 2) exprtk_loop( 3) + #ifndef exprtk_disable_superscalar_unroll + exprtk_loop( 4) exprtk_loop( 5) + exprtk_loop( 6) exprtk_loop( 7) + exprtk_loop( 8) exprtk_loop( 9) + exprtk_loop(10) exprtk_loop(11) + exprtk_loop(12) exprtk_loop(13) + exprtk_loop(14) exprtk_loop(15) + #endif + + vec += lud.batch_size; + } + + exprtk_disable_fallthrough_begin + switch (lud.remainder) + { + #define case_stmt(N) \ + case N : *vec++ = v; \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(15) case_stmt(14) + case_stmt(13) case_stmt(12) + case_stmt(11) case_stmt(10) + case_stmt( 9) case_stmt( 8) + case_stmt( 7) case_stmt( 6) + case_stmt( 5) case_stmt( 4) + #endif + case_stmt( 3) case_stmt( 2) + case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef exprtk_loop + #undef case_stmt + + return vec_node_ptr_->value(); + } + else + return std::numeric_limits::quiet_NaN(); + } + + vector_node_ptr vec() const exprtk_override + { + return vec_node_ptr_; + } + + vector_node_ptr vec() exprtk_override + { + return vec_node_ptr_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecvalass; + } + + std::size_t size() const exprtk_override + { + return vds().size(); + } + + vds_t& vds() exprtk_override + { + return vds_; + } + + const vds_t& vds() const exprtk_override + { + return vds_; + } + + private: + + vector_node* vec_node_ptr_; + vds_t vds_; + }; + + template + class assignment_vecvec_node exprtk_final + : public binary_node + , public vector_interface + { + public: + + typedef expression_node* expression_ptr; + typedef vector_node* vector_node_ptr; + typedef vec_data_store vds_t; + + using binary_node::branch; + + assignment_vecvec_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , vec0_node_ptr_(0) + , vec1_node_ptr_(0) + , initialised_(false) + , src_is_ivec_(false) + { + if (is_vector_node(branch(0))) + { + vec0_node_ptr_ = static_cast*>(branch(0)); + vds() = vec0_node_ptr_->vds(); + } + + if (is_vector_node(branch(1))) + { + vec1_node_ptr_ = static_cast*>(branch(1)); + vds_t::match_sizes(vds(),vec1_node_ptr_->vds()); + } + else if (is_ivector_node(branch(1))) + { + vector_interface* vi = reinterpret_cast*>(0); + + if (0 != (vi = dynamic_cast*>(branch(1)))) + { + vec1_node_ptr_ = vi->vec(); + + if (!vi->side_effect()) + { + vi->vds() = vds(); + src_is_ivec_ = true; + } + else + vds_t::match_sizes(vds(),vi->vds()); + } + } + + initialised_ = (vec0_node_ptr_ && vec1_node_ptr_); + + assert(initialised_); + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(branch(1)); + + branch(1)->value(); + + if (src_is_ivec_) + return vec0_node_ptr_->value(); + + T* vec0 = vec0_node_ptr_->vds().data(); + T* vec1 = vec1_node_ptr_->vds().data(); + + loop_unroll::details lud(size()); + const T* upper_bound = vec0 + lud.upper_bound; + + while (vec0 < upper_bound) + { + #define exprtk_loop(N) \ + vec0[N] = vec1[N]; \ + + exprtk_loop( 0) exprtk_loop( 1) + exprtk_loop( 2) exprtk_loop( 3) + #ifndef exprtk_disable_superscalar_unroll + exprtk_loop( 4) exprtk_loop( 5) + exprtk_loop( 6) exprtk_loop( 7) + exprtk_loop( 8) exprtk_loop( 9) + exprtk_loop(10) exprtk_loop(11) + exprtk_loop(12) exprtk_loop(13) + exprtk_loop(14) exprtk_loop(15) + #endif + + vec0 += lud.batch_size; + vec1 += lud.batch_size; + } + + exprtk_disable_fallthrough_begin + switch (lud.remainder) + { + #define case_stmt(N) \ + case N : *vec0++ = *vec1++; \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(15) case_stmt(14) + case_stmt(13) case_stmt(12) + case_stmt(11) case_stmt(10) + case_stmt( 9) case_stmt( 8) + case_stmt( 7) case_stmt( 6) + case_stmt( 5) case_stmt( 4) + #endif + case_stmt( 3) case_stmt( 2) + case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef exprtk_loop + #undef case_stmt + + return vec0_node_ptr_->value(); + } + else + return std::numeric_limits::quiet_NaN(); + } + + vector_node_ptr vec() exprtk_override + { + return vec0_node_ptr_; + } + + vector_node_ptr vec() const exprtk_override + { + return vec0_node_ptr_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecvecass; + } + + std::size_t size() const exprtk_override + { + return vds().size(); + } + + vds_t& vds() exprtk_override + { + return vds_; + } + + const vds_t& vds() const exprtk_override + { + return vds_; + } + + private: + + vector_node* vec0_node_ptr_; + vector_node* vec1_node_ptr_; + bool initialised_; + bool src_is_ivec_; + vds_t vds_; + }; + + template + class assignment_op_node exprtk_final : public binary_node + { + public: + + typedef expression_node* expression_ptr; + using binary_node::branch; + + assignment_op_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , var_node_ptr_(0) + { + if (is_variable_node(branch(0))) + { + var_node_ptr_ = static_cast*>(branch(0)); + } + } + + inline T value() const exprtk_override + { + if (var_node_ptr_) + { + assert(branch(1)); + + T& v = var_node_ptr_->ref(); + v = Operation::process(v,branch(1)->value()); + + return v; + } + else + return std::numeric_limits::quiet_NaN(); + } + + private: + + variable_node* var_node_ptr_; + }; + + template + class assignment_vec_elem_op_node exprtk_final : public binary_node + { + public: + + typedef expression_node* expression_ptr; + using binary_node::branch; + + assignment_vec_elem_op_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , vec_node_ptr_(0) + { + if (is_vector_elem_node(branch(0))) + { + vec_node_ptr_ = static_cast*>(branch(0)); + } + } + + inline T value() const exprtk_override + { + if (vec_node_ptr_) + { + assert(branch(1)); + + T& v = vec_node_ptr_->ref(); + v = Operation::process(v,branch(1)->value()); + + return v; + } + else + return std::numeric_limits::quiet_NaN(); + } + + private: + + vector_elem_node* vec_node_ptr_; + }; + + template + class assignment_rebasevec_elem_op_node exprtk_final : public binary_node + { + public: + + typedef expression_node* expression_ptr; + using binary_node::branch; + + assignment_rebasevec_elem_op_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , rbvec_node_ptr_(0) + { + if (is_rebasevector_elem_node(branch(0))) + { + rbvec_node_ptr_ = static_cast*>(branch(0)); + } + } + + inline T value() const exprtk_override + { + if (rbvec_node_ptr_) + { + assert(branch(1)); + + T& v = rbvec_node_ptr_->ref(); + v = Operation::process(v,branch(1)->value()); + + return v; + } + else + return std::numeric_limits::quiet_NaN(); + } + + private: + + rebasevector_elem_node* rbvec_node_ptr_; + }; + + template + class assignment_rebasevec_celem_op_node exprtk_final : public binary_node + { + public: + + typedef expression_node* expression_ptr; + using binary_node::branch; + + assignment_rebasevec_celem_op_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , rbvec_node_ptr_(0) + { + if (is_rebasevector_celem_node(branch(0))) + { + rbvec_node_ptr_ = static_cast*>(branch(0)); + } + } + + inline T value() const exprtk_override + { + if (rbvec_node_ptr_) + { + assert(branch(1)); + + T& v = rbvec_node_ptr_->ref(); + v = Operation::process(v,branch(1)->value()); + + return v; + } + else + return std::numeric_limits::quiet_NaN(); + } + + private: + + rebasevector_celem_node* rbvec_node_ptr_; + }; + + template + class assignment_vec_op_node exprtk_final + : public binary_node + , public vector_interface + { + public: + + typedef expression_node* expression_ptr; + typedef vector_node* vector_node_ptr; + typedef vec_data_store vds_t; + + using binary_node::branch; + + assignment_vec_op_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , vec_node_ptr_(0) + { + if (is_vector_node(branch(0))) + { + vec_node_ptr_ = static_cast*>(branch(0)); + vds() = vec_node_ptr_->vds(); + } + } + + inline T value() const exprtk_override + { + if (vec_node_ptr_) + { + assert(branch(1)); + + const T v = branch(1)->value(); + + T* vec = vds().data(); + + loop_unroll::details lud(size()); + const T* upper_bound = vec + lud.upper_bound; + + while (vec < upper_bound) + { + #define exprtk_loop(N) \ + Operation::assign(vec[N],v); \ + + exprtk_loop( 0) exprtk_loop( 1) + exprtk_loop( 2) exprtk_loop( 3) + #ifndef exprtk_disable_superscalar_unroll + exprtk_loop( 4) exprtk_loop( 5) + exprtk_loop( 6) exprtk_loop( 7) + exprtk_loop( 8) exprtk_loop( 9) + exprtk_loop(10) exprtk_loop(11) + exprtk_loop(12) exprtk_loop(13) + exprtk_loop(14) exprtk_loop(15) + #endif + + vec += lud.batch_size; + } + + exprtk_disable_fallthrough_begin + switch (lud.remainder) + { + #define case_stmt(N) \ + case N : Operation::assign(*vec++,v); \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(15) case_stmt(14) + case_stmt(13) case_stmt(12) + case_stmt(11) case_stmt(10) + case_stmt( 9) case_stmt( 8) + case_stmt( 7) case_stmt( 6) + case_stmt( 5) case_stmt( 4) + #endif + case_stmt( 3) case_stmt( 2) + case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef exprtk_loop + #undef case_stmt + + return vec_node_ptr_->value(); + } + else + return std::numeric_limits::quiet_NaN(); + } + + vector_node_ptr vec() const exprtk_override + { + return vec_node_ptr_; + } + + vector_node_ptr vec() exprtk_override + { + return vec_node_ptr_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecopvalass; + } + + std::size_t size() const exprtk_override + { + return vds().size(); + } + + vds_t& vds() exprtk_override + { + return vds_; + } + + const vds_t& vds() const exprtk_override + { + return vds_; + } + + bool side_effect() const exprtk_override + { + return true; + } + + private: + + vector_node* vec_node_ptr_; + vds_t vds_; + }; + + template + class assignment_vecvec_op_node exprtk_final + : public binary_node + , public vector_interface + { + public: + + typedef expression_node* expression_ptr; + typedef vector_node* vector_node_ptr; + typedef vec_data_store vds_t; + + using binary_node::branch; + + assignment_vecvec_op_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , vec0_node_ptr_(0) + , vec1_node_ptr_(0) + , initialised_(false) + { + if (is_vector_node(branch(0))) + { + vec0_node_ptr_ = static_cast*>(branch(0)); + vds() = vec0_node_ptr_->vds(); + } + + if (is_vector_node(branch(1))) + { + vec1_node_ptr_ = static_cast*>(branch(1)); + vec1_node_ptr_->vds() = vds(); + } + else if (is_ivector_node(branch(1))) + { + vector_interface* vi = reinterpret_cast*>(0); + + if (0 != (vi = dynamic_cast*>(branch(1)))) + { + vec1_node_ptr_ = vi->vec(); + vec1_node_ptr_->vds() = vds(); + } + else + vds_t::match_sizes(vds(),vec1_node_ptr_->vds()); + } + + initialised_ = (vec0_node_ptr_ && vec1_node_ptr_); + + assert(initialised_); + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(branch(0)); + assert(branch(1)); + + branch(0)->value(); + branch(1)->value(); + + T* vec0 = vec0_node_ptr_->vds().data(); + const T* vec1 = vec1_node_ptr_->vds().data(); + + loop_unroll::details lud(size()); + const T* upper_bound = vec0 + lud.upper_bound; + + while (vec0 < upper_bound) + { + #define exprtk_loop(N) \ + vec0[N] = Operation::process(vec0[N], vec1[N]); \ + + exprtk_loop( 0) exprtk_loop( 1) + exprtk_loop( 2) exprtk_loop( 3) + #ifndef exprtk_disable_superscalar_unroll + exprtk_loop( 4) exprtk_loop( 5) + exprtk_loop( 6) exprtk_loop( 7) + exprtk_loop( 8) exprtk_loop( 9) + exprtk_loop(10) exprtk_loop(11) + exprtk_loop(12) exprtk_loop(13) + exprtk_loop(14) exprtk_loop(15) + #endif + + vec0 += lud.batch_size; + vec1 += lud.batch_size; + } + + int i = 0; + + exprtk_disable_fallthrough_begin + switch (lud.remainder) + { + #define case_stmt(N) \ + case N : { vec0[i] = Operation::process(vec0[i], vec1[i]); ++i; } \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(15) case_stmt(14) + case_stmt(13) case_stmt(12) + case_stmt(11) case_stmt(10) + case_stmt( 9) case_stmt( 8) + case_stmt( 7) case_stmt( 6) + case_stmt( 5) case_stmt( 4) + #endif + case_stmt( 3) case_stmt( 2) + case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef exprtk_loop + #undef case_stmt + + return vec0_node_ptr_->value(); + } + else + return std::numeric_limits::quiet_NaN(); + } + + vector_node_ptr vec() const exprtk_override + { + return vec0_node_ptr_; + } + + vector_node_ptr vec() exprtk_override + { + return vec0_node_ptr_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecopvecass; + } + + std::size_t size() const exprtk_override + { + return vds().size(); + } + + vds_t& vds() exprtk_override + { + return vds_; + } + + const vds_t& vds() const exprtk_override + { + return vds_; + } + + bool side_effect() const exprtk_override + { + return true; + } + + private: + + vector_node* vec0_node_ptr_; + vector_node* vec1_node_ptr_; + bool initialised_; + vds_t vds_; + }; + + template + class vec_binop_vecvec_node exprtk_final + : public binary_node + , public vector_interface + { + public: + + typedef expression_node* expression_ptr; + typedef vector_node* vector_node_ptr; + typedef vector_holder* vector_holder_ptr; + typedef vec_data_store vds_t; + + using binary_node::branch; + + vec_binop_vecvec_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , vec0_node_ptr_(0) + , vec1_node_ptr_(0) + , temp_ (0) + , temp_vec_node_(0) + , initialised_(false) + { + bool v0_is_ivec = false; + bool v1_is_ivec = false; + + if (is_vector_node(branch(0))) + { + vec0_node_ptr_ = static_cast(branch(0)); + } + else if (is_ivector_node(branch(0))) + { + vector_interface* vi = reinterpret_cast*>(0); + + if (0 != (vi = dynamic_cast*>(branch(0)))) + { + vec0_node_ptr_ = vi->vec(); + v0_is_ivec = true; + } + } + + if (is_vector_node(branch(1))) + { + vec1_node_ptr_ = static_cast(branch(1)); + } + else if (is_ivector_node(branch(1))) + { + vector_interface* vi = reinterpret_cast*>(0); + + if (0 != (vi = dynamic_cast*>(branch(1)))) + { + vec1_node_ptr_ = vi->vec(); + v1_is_ivec = true; + } + } + + if (vec0_node_ptr_ && vec1_node_ptr_) + { + vector_holder& vec0 = vec0_node_ptr_->vec_holder(); + vector_holder& vec1 = vec1_node_ptr_->vec_holder(); + + if (v0_is_ivec && (vec0.size() <= vec1.size())) + vds_ = vds_t(vec0_node_ptr_->vds()); + else if (v1_is_ivec && (vec1.size() <= vec0.size())) + vds_ = vds_t(vec1_node_ptr_->vds()); + else + vds_ = vds_t(std::min(vec0.size(),vec1.size())); + + temp_ = new vector_holder(vds().data(),vds().size()); + temp_vec_node_ = new vector_node (vds(),temp_); + + initialised_ = true; + } + + assert(initialised_); + } + + ~vec_binop_vecvec_node() + { + delete temp_; + delete temp_vec_node_; + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(branch(0)); + assert(branch(1)); + + branch(0)->value(); + branch(1)->value(); + + const T* vec0 = vec0_node_ptr_->vds().data(); + const T* vec1 = vec1_node_ptr_->vds().data(); + T* vec2 = vds().data(); + + loop_unroll::details lud(size()); + const T* upper_bound = vec2 + lud.upper_bound; + + while (vec2 < upper_bound) + { + #define exprtk_loop(N) \ + vec2[N] = Operation::process(vec0[N], vec1[N]); \ + + exprtk_loop( 0) exprtk_loop( 1) + exprtk_loop( 2) exprtk_loop( 3) + #ifndef exprtk_disable_superscalar_unroll + exprtk_loop( 4) exprtk_loop( 5) + exprtk_loop( 6) exprtk_loop( 7) + exprtk_loop( 8) exprtk_loop( 9) + exprtk_loop(10) exprtk_loop(11) + exprtk_loop(12) exprtk_loop(13) + exprtk_loop(14) exprtk_loop(15) + #endif + + vec0 += lud.batch_size; + vec1 += lud.batch_size; + vec2 += lud.batch_size; + } + + int i = 0; + + exprtk_disable_fallthrough_begin + switch (lud.remainder) + { + #define case_stmt(N) \ + case N : { vec2[i] = Operation::process(vec0[i], vec1[i]); ++i; } \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(15) case_stmt(14) + case_stmt(13) case_stmt(12) + case_stmt(11) case_stmt(10) + case_stmt( 9) case_stmt( 8) + case_stmt( 7) case_stmt( 6) + case_stmt( 5) case_stmt( 4) + #endif + case_stmt( 3) case_stmt( 2) + case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef exprtk_loop + #undef case_stmt + + return (vds().data())[0]; + } + else + return std::numeric_limits::quiet_NaN(); + } + + vector_node_ptr vec() const exprtk_override + { + return temp_vec_node_; + } + + vector_node_ptr vec() exprtk_override + { + return temp_vec_node_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecvecarith; + } + + std::size_t size() const exprtk_override + { + return vds_.size(); + } + + vds_t& vds() exprtk_override + { + return vds_; + } + + const vds_t& vds() const exprtk_override + { + return vds_; + } + + private: + + vector_node_ptr vec0_node_ptr_; + vector_node_ptr vec1_node_ptr_; + vector_holder_ptr temp_; + vector_node_ptr temp_vec_node_; + bool initialised_; + vds_t vds_; + }; + + template + class vec_binop_vecval_node exprtk_final + : public binary_node + , public vector_interface + { + public: + + typedef expression_node* expression_ptr; + typedef vector_node* vector_node_ptr; + typedef vector_holder* vector_holder_ptr; + typedef vec_data_store vds_t; + + using binary_node::branch; + + vec_binop_vecval_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , vec0_node_ptr_(0) + , temp_ (0) + , temp_vec_node_(0) + { + bool v0_is_ivec = false; + + if (is_vector_node(branch(0))) + { + vec0_node_ptr_ = static_cast(branch(0)); + } + else if (is_ivector_node(branch(0))) + { + vector_interface* vi = reinterpret_cast*>(0); + + if (0 != (vi = dynamic_cast*>(branch(0)))) + { + vec0_node_ptr_ = vi->vec(); + v0_is_ivec = true; + } + } + + if (vec0_node_ptr_) + { + if (v0_is_ivec) + vds() = vec0_node_ptr_->vds(); + else + vds() = vds_t(vec0_node_ptr_->size()); + + temp_ = new vector_holder(vds()); + temp_vec_node_ = new vector_node (vds(),temp_); + } + } + + ~vec_binop_vecval_node() + { + delete temp_; + delete temp_vec_node_; + } + + inline T value() const exprtk_override + { + if (vec0_node_ptr_) + { + assert(branch(0)); + assert(branch(1)); + + branch(0)->value(); + const T v = branch(1)->value(); + + const T* vec0 = vec0_node_ptr_->vds().data(); + T* vec1 = vds().data(); + + loop_unroll::details lud(size()); + const T* upper_bound = vec0 + lud.upper_bound; + + while (vec0 < upper_bound) + { + #define exprtk_loop(N) \ + vec1[N] = Operation::process(vec0[N], v); \ + + exprtk_loop( 0) exprtk_loop( 1) + exprtk_loop( 2) exprtk_loop( 3) + #ifndef exprtk_disable_superscalar_unroll + exprtk_loop( 4) exprtk_loop( 5) + exprtk_loop( 6) exprtk_loop( 7) + exprtk_loop( 8) exprtk_loop( 9) + exprtk_loop(10) exprtk_loop(11) + exprtk_loop(12) exprtk_loop(13) + exprtk_loop(14) exprtk_loop(15) + #endif + + vec0 += lud.batch_size; + vec1 += lud.batch_size; + } + + int i = 0; + + exprtk_disable_fallthrough_begin + switch (lud.remainder) + { + #define case_stmt(N) \ + case N : { vec1[i] = Operation::process(vec0[i], v); ++i; } \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(15) case_stmt(14) + case_stmt(13) case_stmt(12) + case_stmt(11) case_stmt(10) + case_stmt( 9) case_stmt( 8) + case_stmt( 7) case_stmt( 6) + case_stmt( 5) case_stmt( 4) + #endif + case_stmt( 3) case_stmt( 2) + case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef exprtk_loop + #undef case_stmt + + return (vds().data())[0]; + } + else + return std::numeric_limits::quiet_NaN(); + } + + vector_node_ptr vec() const exprtk_override + { + return temp_vec_node_; + } + + vector_node_ptr vec() exprtk_override + { + return temp_vec_node_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecvalarith; + } + + std::size_t size() const exprtk_override + { + return vds().size(); + } + + vds_t& vds() exprtk_override + { + return vds_; + } + + const vds_t& vds() const exprtk_override + { + return vds_; + } + + private: + + vector_node_ptr vec0_node_ptr_; + vector_holder_ptr temp_; + vector_node_ptr temp_vec_node_; + vds_t vds_; + }; + + template + class vec_binop_valvec_node exprtk_final + : public binary_node + , public vector_interface + { + public: + + typedef expression_node* expression_ptr; + typedef vector_node* vector_node_ptr; + typedef vector_holder* vector_holder_ptr; + typedef vec_data_store vds_t; + + using binary_node::branch; + + vec_binop_valvec_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , vec1_node_ptr_(0) + , temp_ (0) + , temp_vec_node_(0) + { + bool v1_is_ivec = false; + + if (is_vector_node(branch(1))) + { + vec1_node_ptr_ = static_cast(branch(1)); + } + else if (is_ivector_node(branch(1))) + { + vector_interface* vi = reinterpret_cast*>(0); + + if (0 != (vi = dynamic_cast*>(branch(1)))) + { + vec1_node_ptr_ = vi->vec(); + v1_is_ivec = true; + } + } + + if (vec1_node_ptr_) + { + if (v1_is_ivec) + vds() = vec1_node_ptr_->vds(); + else + vds() = vds_t(vec1_node_ptr_->size()); + + temp_ = new vector_holder(vds()); + temp_vec_node_ = new vector_node (vds(),temp_); + } + } + + ~vec_binop_valvec_node() + { + delete temp_; + delete temp_vec_node_; + } + + inline T value() const exprtk_override + { + if (vec1_node_ptr_) + { + assert(branch(0)); + assert(branch(1)); + + const T v = branch(0)->value(); + branch(1)->value(); + + T* vec0 = vds().data(); + const T* vec1 = vec1_node_ptr_->vds().data(); + + loop_unroll::details lud(size()); + const T* upper_bound = vec0 + lud.upper_bound; + + while (vec0 < upper_bound) + { + #define exprtk_loop(N) \ + vec0[N] = Operation::process(v, vec1[N]); \ + + exprtk_loop( 0) exprtk_loop( 1) + exprtk_loop( 2) exprtk_loop( 3) + #ifndef exprtk_disable_superscalar_unroll + exprtk_loop( 4) exprtk_loop( 5) + exprtk_loop( 6) exprtk_loop( 7) + exprtk_loop( 8) exprtk_loop( 9) + exprtk_loop(10) exprtk_loop(11) + exprtk_loop(12) exprtk_loop(13) + exprtk_loop(14) exprtk_loop(15) + #endif + + vec0 += lud.batch_size; + vec1 += lud.batch_size; + } + + int i = 0; + + exprtk_disable_fallthrough_begin + switch (lud.remainder) + { + #define case_stmt(N) \ + case N : { vec0[i] = Operation::process(v, vec1[i]); ++i; } \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(15) case_stmt(14) + case_stmt(13) case_stmt(12) + case_stmt(11) case_stmt(10) + case_stmt( 9) case_stmt( 8) + case_stmt( 7) case_stmt( 6) + case_stmt( 5) case_stmt( 4) + #endif + case_stmt( 3) case_stmt( 2) + case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef exprtk_loop + #undef case_stmt + + return (vds().data())[0]; + } + else + return std::numeric_limits::quiet_NaN(); + } + + vector_node_ptr vec() const exprtk_override + { + return temp_vec_node_; + } + + vector_node_ptr vec() exprtk_override + { + return temp_vec_node_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecvalarith; + } + + std::size_t size() const exprtk_override + { + return vds().size(); + } + + vds_t& vds() exprtk_override + { + return vds_; + } + + const vds_t& vds() const exprtk_override + { + return vds_; + } + + private: + + vector_node_ptr vec1_node_ptr_; + vector_holder_ptr temp_; + vector_node_ptr temp_vec_node_; + vds_t vds_; + }; + + template + class unary_vector_node exprtk_final + : public unary_node + , public vector_interface + { + public: + + typedef expression_node* expression_ptr; + typedef vector_node* vector_node_ptr; + typedef vector_holder* vector_holder_ptr; + typedef vec_data_store vds_t; + + using expression_node::branch; + + unary_vector_node(const operator_type& opr, expression_ptr branch0) + : unary_node(opr, branch0) + , vec0_node_ptr_(0) + , temp_ (0) + , temp_vec_node_(0) + { + bool vec0_is_ivec = false; + + if (is_vector_node(branch())) + { + vec0_node_ptr_ = static_cast(branch()); + } + else if (is_ivector_node(branch())) + { + vector_interface* vi = reinterpret_cast*>(0); + + if (0 != (vi = dynamic_cast*>(branch()))) + { + vec0_node_ptr_ = vi->vec(); + vec0_is_ivec = true; + } + } + + if (vec0_node_ptr_) + { + if (vec0_is_ivec) + vds_ = vec0_node_ptr_->vds(); + else + vds_ = vds_t(vec0_node_ptr_->size()); + + temp_ = new vector_holder(vds()); + temp_vec_node_ = new vector_node (vds(),temp_); + } + } + + ~unary_vector_node() + { + delete temp_; + delete temp_vec_node_; + } + + inline T value() const exprtk_override + { + assert(branch()); + + branch()->value(); + + if (vec0_node_ptr_) + { + const T* vec0 = vec0_node_ptr_->vds().data(); + T* vec1 = vds().data(); + + loop_unroll::details lud(size()); + const T* upper_bound = vec0 + lud.upper_bound; + + while (vec0 < upper_bound) + { + #define exprtk_loop(N) \ + vec1[N] = Operation::process(vec0[N]); \ + + exprtk_loop( 0) exprtk_loop( 1) + exprtk_loop( 2) exprtk_loop( 3) + #ifndef exprtk_disable_superscalar_unroll + exprtk_loop( 4) exprtk_loop( 5) + exprtk_loop( 6) exprtk_loop( 7) + exprtk_loop( 8) exprtk_loop( 9) + exprtk_loop(10) exprtk_loop(11) + exprtk_loop(12) exprtk_loop(13) + exprtk_loop(14) exprtk_loop(15) + #endif + + vec0 += lud.batch_size; + vec1 += lud.batch_size; + } + + int i = 0; + + exprtk_disable_fallthrough_begin + switch (lud.remainder) + { + #define case_stmt(N) \ + case N : { vec1[i] = Operation::process(vec0[i]); ++i; } \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(15) case_stmt(14) + case_stmt(13) case_stmt(12) + case_stmt(11) case_stmt(10) + case_stmt( 9) case_stmt( 8) + case_stmt( 7) case_stmt( 6) + case_stmt( 5) case_stmt( 4) + #endif + case_stmt( 3) case_stmt( 2) + case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef exprtk_loop + #undef case_stmt + + return (vds().data())[0]; + } + else + return std::numeric_limits::quiet_NaN(); + } + + vector_node_ptr vec() const exprtk_override + { + return temp_vec_node_; + } + + vector_node_ptr vec() exprtk_override + { + return temp_vec_node_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecunaryop; + } + + std::size_t size() const exprtk_override + { + return vds().size(); + } + + vds_t& vds() exprtk_override + { + return vds_; + } + + const vds_t& vds() const exprtk_override + { + return vds_; + } + + private: + + vector_node_ptr vec0_node_ptr_; + vector_holder_ptr temp_; + vector_node_ptr temp_vec_node_; + vds_t vds_; + }; + + template + class conditional_vector_node exprtk_final + : public expression_node + , public vector_interface + { + public: + + typedef expression_node * expression_ptr; + typedef vector_interface* vec_interface_ptr; + typedef vector_node * vector_node_ptr; + typedef vector_holder * vector_holder_ptr; + typedef vec_data_store vds_t; + typedef std::pair branch_t; + + conditional_vector_node(expression_ptr condition, + expression_ptr consequent, + expression_ptr alternative) + : consequent_node_ptr_ (0) + , alternative_node_ptr_(0) + , temp_vec_node_ (0) + , temp_ (0) + , vec_size_ (0) + , initialised_ (false) + { + construct_branch_pair(condition_ , condition ); + construct_branch_pair(consequent_ , consequent ); + construct_branch_pair(alternative_, alternative); + + if (details::is_ivector_node(consequent_.first)) + { + vec_interface_ptr ivec_ptr = dynamic_cast(consequent_.first); + + if (0 != ivec_ptr) + { + consequent_node_ptr_ = ivec_ptr->vec(); + } + } + + if (details::is_ivector_node(alternative_.first)) + { + vec_interface_ptr ivec_ptr = dynamic_cast(alternative_.first); + + if (0 != ivec_ptr) + { + alternative_node_ptr_ = ivec_ptr->vec(); + } + } + + if (consequent_node_ptr_ && alternative_node_ptr_) + { + vec_size_ = std::min(consequent_node_ptr_ ->vds().size(), + alternative_node_ptr_->vds().size()); + + vds_ = vds_t(vec_size_); + temp_ = new vector_holder(vds_); + temp_vec_node_ = new vector_node (vds(),temp_); + + initialised_ = true; + } + + assert(initialised_ && (vec_size_ > 0)); + } + + ~conditional_vector_node() + { + delete temp_; + delete temp_vec_node_; + } + + inline T value() const exprtk_override + { + if (initialised_) + { + assert(condition_ .first); + assert(consequent_ .first); + assert(alternative_.first); + + T result = T(0); + T* source_vector = 0; + T* result_vector = vds().data(); + + if (is_true(condition_)) + { + result = consequent_.first->value(); + source_vector = consequent_node_ptr_->vds().data(); + } + else + { + result = alternative_.first->value(); + source_vector = alternative_node_ptr_->vds().data(); + } + + for (std::size_t i = 0; i < vec_size_; ++i) + { + result_vector[i] = source_vector[i]; + } + + return result; + } + + return std::numeric_limits::quiet_NaN(); + } + + vector_node_ptr vec() const exprtk_override + { + return temp_vec_node_; + } + + vector_node_ptr vec() exprtk_override + { + return temp_vec_node_; + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vecondition; + } + + std::size_t size() const exprtk_override + { + return vec_size_; + } + + vds_t& vds() exprtk_override + { + return vds_; + } + + const vds_t& vds() const exprtk_override + { + return vds_; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(condition_ , node_delete_list); + expression_node::ndb_t::collect(consequent_ , node_delete_list); + expression_node::ndb_t::collect(alternative_ , node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth + (condition_, consequent_, alternative_); + } + + private: + + branch_t condition_; + branch_t consequent_; + branch_t alternative_; + vector_node_ptr consequent_node_ptr_; + vector_node_ptr alternative_node_ptr_; + vector_node_ptr temp_vec_node_; + vector_holder_ptr temp_; + vds_t vds_; + std::size_t vec_size_; + bool initialised_; + }; + + template + class scand_node exprtk_final : public binary_node + { + public: + + typedef expression_node* expression_ptr; + using binary_node::branch; + + scand_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + {} + + inline T value() const exprtk_override + { + assert(branch(0)); + assert(branch(1)); + + return ( + std::not_equal_to() + (T(0),branch(0)->value()) && + std::not_equal_to() + (T(0),branch(1)->value()) + ) ? T(1) : T(0); + } + }; + + template + class scor_node exprtk_final : public binary_node + { + public: + + typedef expression_node* expression_ptr; + using binary_node::branch; + + scor_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + {} + + inline T value() const exprtk_override + { + assert(branch(0)); + assert(branch(1)); + + return ( + std::not_equal_to() + (T(0),branch(0)->value()) || + std::not_equal_to() + (T(0),branch(1)->value()) + ) ? T(1) : T(0); + } + }; + + template + class function_N_node exprtk_final : public expression_node + { + public: + + // Function of N paramters. + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + typedef IFunction ifunction; + + explicit function_N_node(ifunction* func) + : function_((N == func->param_count) ? func : reinterpret_cast(0)) + , parameter_count_(func->param_count) + {} + + template + bool init_branches(expression_ptr (&b)[NumBranches]) + { + // Needed for incompetent and broken msvc compiler versions + #ifdef _MSC_VER + #pragma warning(push) + #pragma warning(disable: 4127) + #endif + if (N != NumBranches) + return false; + else + { + for (std::size_t i = 0; i < NumBranches; ++i) + { + if (b[i]) + branch_[i] = std::make_pair(b[i],branch_deletable(b[i])); + else + return false; + } + return true; + } + #ifdef _MSC_VER + #pragma warning(pop) + #endif + } + + inline bool operator <(const function_N_node& fn) const + { + return this < (&fn); + } + + inline T value() const exprtk_override + { + // Needed for incompetent and broken msvc compiler versions + #ifdef _MSC_VER + #pragma warning(push) + #pragma warning(disable: 4127) + #endif + if ((0 == function_) || (0 == N)) + return std::numeric_limits::quiet_NaN(); + else + { + T v[N]; + evaluate_branches::execute(v,branch_); + return invoke::execute(*function_,v); + } + #ifdef _MSC_VER + #pragma warning(pop) + #endif + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_function; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::template collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::template compute_node_depth(branch_); + } + + template + struct evaluate_branches + { + static inline void execute(T_ (&v)[BranchCount], const branch_t (&b)[BranchCount]) + { + for (std::size_t i = 0; i < BranchCount; ++i) + { + v[i] = b[i].first->value(); + } + } + }; + + template + struct evaluate_branches + { + static inline void execute(T_ (&v)[5], const branch_t (&b)[5]) + { + v[0] = b[0].first->value(); + v[1] = b[1].first->value(); + v[2] = b[2].first->value(); + v[3] = b[3].first->value(); + v[4] = b[4].first->value(); + } + }; + + template + struct evaluate_branches + { + static inline void execute(T_ (&v)[4], const branch_t (&b)[4]) + { + v[0] = b[0].first->value(); + v[1] = b[1].first->value(); + v[2] = b[2].first->value(); + v[3] = b[3].first->value(); + } + }; + + template + struct evaluate_branches + { + static inline void execute(T_ (&v)[3], const branch_t (&b)[3]) + { + v[0] = b[0].first->value(); + v[1] = b[1].first->value(); + v[2] = b[2].first->value(); + } + }; + + template + struct evaluate_branches + { + static inline void execute(T_ (&v)[2], const branch_t (&b)[2]) + { + v[0] = b[0].first->value(); + v[1] = b[1].first->value(); + } + }; + + template + struct evaluate_branches + { + static inline void execute(T_ (&v)[1], const branch_t (&b)[1]) + { + v[0] = b[0].first->value(); + } + }; + + template + struct invoke { static inline T execute(ifunction&, branch_t (&)[ParamCount]) { return std::numeric_limits::quiet_NaN(); } }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[20]) + { return f(v[0],v[1],v[2],v[3],v[4],v[5],v[6],v[7],v[8],v[9],v[10],v[11],v[12],v[13],v[14],v[15],v[16],v[17],v[18],v[19]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[19]) + { return f(v[0],v[1],v[2],v[3],v[4],v[5],v[6],v[7],v[8],v[9],v[10],v[11],v[12],v[13],v[14],v[15],v[16],v[17],v[18]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[18]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5], v[6], v[7], v[8], v[9], v[10], v[11], v[12], v[13], v[14], v[15], v[16], v[17]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[17]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5], v[6], v[7], v[8], v[9], v[10], v[11], v[12], v[13], v[14], v[15], v[16]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[16]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5], v[6], v[7], v[8], v[9], v[10], v[11], v[12], v[13], v[14], v[15]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[15]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5], v[6], v[7], v[8], v[9], v[10], v[11], v[12], v[13], v[14]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[14]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5], v[6], v[7], v[8], v[9], v[10], v[11], v[12], v[13]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[13]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5], v[6], v[7], v[8], v[9], v[10], v[11], v[12]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[12]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5], v[6], v[7], v[8], v[9], v[10], v[11]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[11]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5], v[6], v[7], v[8], v[9], v[10]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[10]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5], v[6], v[7], v[8], v[9]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[9]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5], v[6], v[7], v[8]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[8]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5], v[6], v[7]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[7]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5], v[6]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[6]) + { return f(v[0], v[1], v[2], v[3], v[4], v[5]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[5]) + { return f(v[0], v[1], v[2], v[3], v[4]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[4]) + { return f(v[0], v[1], v[2], v[3]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[3]) + { return f(v[0], v[1], v[2]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[2]) + { return f(v[0], v[1]); } + }; + + template + struct invoke + { + static inline T_ execute(ifunction& f, T_ (&v)[1]) + { return f(v[0]); } + }; + + private: + + ifunction* function_; + std::size_t parameter_count_; + branch_t branch_[N]; + }; + + template + class function_N_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef IFunction ifunction; + + explicit function_N_node(ifunction* func) + : function_((0 == func->param_count) ? func : reinterpret_cast(0)) + {} + + inline bool operator <(const function_N_node& fn) const + { + return this < (&fn); + } + + inline T value() const exprtk_override + { + if (function_) + return (*function_)(); + else + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_function; + } + + private: + + ifunction* function_; + }; + + template + class vararg_function_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + + vararg_function_node(VarArgFunction* func, + const std::vector& arg_list) + : function_(func) + , arg_list_(arg_list) + { + value_list_.resize(arg_list.size(),std::numeric_limits::quiet_NaN()); + } + + inline bool operator <(const vararg_function_node& fn) const + { + return this < (&fn); + } + + inline T value() const exprtk_override + { + if (function_) + { + populate_value_list(); + return (*function_)(value_list_); + } + else + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_vafunction; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + for (std::size_t i = 0; i < arg_list_.size(); ++i) + { + if (arg_list_[i] && !details::is_variable_node(arg_list_[i])) + { + node_delete_list.push_back(&arg_list_[i]); + } + } + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(arg_list_); + } + + private: + + inline void populate_value_list() const + { + for (std::size_t i = 0; i < arg_list_.size(); ++i) + { + value_list_[i] = arg_list_[i]->value(); + } + } + + VarArgFunction* function_; + std::vector arg_list_; + mutable std::vector value_list_; + }; + + template + class generic_function_node : public expression_node + { + public: + + typedef type_store type_store_t; + typedef expression_node* expression_ptr; + typedef variable_node variable_node_t; + typedef vector_node vector_node_t; + typedef variable_node_t* variable_node_ptr_t; + typedef vector_node_t* vector_node_ptr_t; + typedef range_interface range_interface_t; + typedef range_data_type range_data_type_t; + typedef typename range_interface::range_t range_t; + + typedef std::pair branch_t; + typedef std::pair void_t; + + typedef std::vector tmp_vs_t; + typedef std::vector typestore_list_t; + typedef std::vector range_list_t; + + explicit generic_function_node(const std::vector& arg_list, + GenericFunction* func = reinterpret_cast(0)) + : function_(func) + , arg_list_(arg_list) + {} + + virtual ~generic_function_node() {} + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override exprtk_final + { + return expression_node::ndb_t::compute_node_depth(branch_); + } + + virtual bool init_branches() + { + expr_as_vec1_store_.resize(arg_list_.size(),T(0) ); + typestore_list_ .resize(arg_list_.size(),type_store_t() ); + range_list_ .resize(arg_list_.size(),range_data_type_t()); + branch_ .resize(arg_list_.size(),branch_t(reinterpret_cast(0),false)); + + for (std::size_t i = 0; i < arg_list_.size(); ++i) + { + type_store_t& ts = typestore_list_[i]; + + if (0 == arg_list_[i]) + return false; + else if (is_ivector_node(arg_list_[i])) + { + vector_interface* vi = reinterpret_cast*>(0); + + if (0 == (vi = dynamic_cast*>(arg_list_[i]))) + return false; + + ts.size = vi->size(); + ts.data = vi->vds().data(); + ts.type = type_store_t::e_vector; + vi->vec()->vec_holder().set_ref(&ts.vec_data); + } + #ifndef exprtk_disable_string_capabilities + else if (is_generally_string_node(arg_list_[i])) + { + string_base_node* sbn = reinterpret_cast*>(0); + + if (0 == (sbn = dynamic_cast*>(arg_list_[i]))) + return false; + + ts.size = sbn->size(); + ts.data = reinterpret_cast(const_cast(sbn->base())); + ts.type = type_store_t::e_string; + + range_list_[i].data = ts.data; + range_list_[i].size = ts.size; + range_list_[i].type_size = sizeof(char); + range_list_[i].str_node = sbn; + + range_interface_t* ri = reinterpret_cast(0); + + if (0 == (ri = dynamic_cast(arg_list_[i]))) + return false; + + const range_t& rp = ri->range_ref(); + + if ( + rp.const_range() && + is_const_string_range_node(arg_list_[i]) + ) + { + ts.size = rp.const_size(); + ts.data = static_cast(ts.data) + rp.n0_c.second; + range_list_[i].range = reinterpret_cast(0); + } + else + range_list_[i].range = &(ri->range_ref()); + } + #endif + else if (is_variable_node(arg_list_[i])) + { + variable_node_ptr_t var = variable_node_ptr_t(0); + + if (0 == (var = dynamic_cast(arg_list_[i]))) + return false; + + ts.size = 1; + ts.data = &var->ref(); + ts.type = type_store_t::e_scalar; + } + else + { + ts.size = 1; + ts.data = reinterpret_cast(&expr_as_vec1_store_[i]); + ts.type = type_store_t::e_scalar; + } + + branch_[i] = std::make_pair(arg_list_[i],branch_deletable(arg_list_[i])); + } + + return true; + } + + inline bool operator <(const generic_function_node& fn) const + { + return this < (&fn); + } + + inline T value() const exprtk_override + { + if (function_) + { + if (populate_value_list()) + { + typedef typename GenericFunction::parameter_list_t parameter_list_t; + + return (*function_)(parameter_list_t(typestore_list_)); + } + } + + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_genfunction; + } + + protected: + + inline virtual bool populate_value_list() const + { + for (std::size_t i = 0; i < branch_.size(); ++i) + { + expr_as_vec1_store_[i] = branch_[i].first->value(); + } + + for (std::size_t i = 0; i < branch_.size(); ++i) + { + range_data_type_t& rdt = range_list_[i]; + + if (rdt.range) + { + const range_t& rp = (*rdt.range); + std::size_t r0 = 0; + std::size_t r1 = 0; + + if (rp(r0, r1, rdt.size)) + { + type_store_t& ts = typestore_list_[i]; + + ts.size = rp.cache_size(); + #ifndef exprtk_disable_string_capabilities + if (ts.type == type_store_t::e_string) + ts.data = const_cast(rdt.str_node->base()) + rp.cache.first; + else + #endif + ts.data = static_cast(rdt.data) + (rp.cache.first * rdt.type_size); + } + else + return false; + } + } + + return true; + } + + GenericFunction* function_; + mutable typestore_list_t typestore_list_; + + private: + + std::vector arg_list_; + std::vector branch_; + mutable tmp_vs_t expr_as_vec1_store_; + mutable range_list_t range_list_; + }; + + #ifndef exprtk_disable_string_capabilities + template + class string_function_node : public generic_function_node, + public string_base_node, + public range_interface + { + public: + + typedef generic_function_node gen_function_t; + typedef typename range_interface::range_t range_t; + + string_function_node(StringFunction* func, + const std::vector& arg_list) + : gen_function_t(arg_list,func) + { + range_.n0_c = std::make_pair(true,0); + range_.n1_c = std::make_pair(true,0); + range_.cache.first = range_.n0_c.second; + range_.cache.second = range_.n1_c.second; + } + + inline bool operator <(const string_function_node& fn) const + { + return this < (&fn); + } + + inline T value() const exprtk_override + { + if (gen_function_t::function_) + { + if (gen_function_t::populate_value_list()) + { + typedef typename StringFunction::parameter_list_t parameter_list_t; + + const T result = (*gen_function_t::function_) + ( + ret_string_, + parameter_list_t(gen_function_t::typestore_list_) + ); + + range_.n1_c.second = ret_string_.size() - 1; + range_.cache.second = range_.n1_c.second; + + return result; + } + } + + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_strfunction; + } + + std::string str() const exprtk_override + { + return ret_string_; + } + + char_cptr base() const exprtk_override + { + return &ret_string_[0]; + } + + std::size_t size() const exprtk_override + { + return ret_string_.size(); + } + + range_t& range_ref() exprtk_override + { + return range_; + } + + const range_t& range_ref() const exprtk_override + { + return range_; + } + + protected: + + mutable range_t range_; + mutable std::string ret_string_; + }; + #endif + + template + class multimode_genfunction_node : public generic_function_node + { + public: + + typedef generic_function_node gen_function_t; + typedef typename gen_function_t::range_t range_t; + + multimode_genfunction_node(GenericFunction* func, + const std::size_t& param_seq_index, + const std::vector& arg_list) + : gen_function_t(arg_list,func) + , param_seq_index_(param_seq_index) + {} + + inline T value() const exprtk_override + { + if (gen_function_t::function_) + { + if (gen_function_t::populate_value_list()) + { + typedef typename GenericFunction::parameter_list_t parameter_list_t; + + return (*gen_function_t::function_) + ( + param_seq_index_, + parameter_list_t(gen_function_t::typestore_list_) + ); + } + } + + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override exprtk_final + { + return expression_node::e_genfunction; + } + + private: + + std::size_t param_seq_index_; + }; + + #ifndef exprtk_disable_string_capabilities + template + class multimode_strfunction_node exprtk_final : public string_function_node + { + public: + + typedef string_function_node str_function_t; + typedef typename str_function_t::range_t range_t; + + multimode_strfunction_node(StringFunction* func, + const std::size_t& param_seq_index, + const std::vector& arg_list) + : str_function_t(func,arg_list) + , param_seq_index_(param_seq_index) + {} + + inline T value() const exprtk_override + { + if (str_function_t::function_) + { + if (str_function_t::populate_value_list()) + { + typedef typename StringFunction::parameter_list_t parameter_list_t; + + const T result = (*str_function_t::function_) + ( + param_seq_index_, + str_function_t::ret_string_, + parameter_list_t(str_function_t::typestore_list_) + ); + + str_function_t::range_.n1_c.second = str_function_t::ret_string_.size() - 1; + str_function_t::range_.cache.second = str_function_t::range_.n1_c.second; + + return result; + } + } + + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_strfunction; + } + + private: + + const std::size_t param_seq_index_; + }; + #endif + + class return_exception + {}; + + template + class null_igenfunc + { + public: + + virtual ~null_igenfunc() {} + + typedef type_store generic_type; + typedef typename generic_type::parameter_list parameter_list_t; + + inline virtual T operator() (parameter_list_t) + { + return std::numeric_limits::quiet_NaN(); + } + }; + + #ifndef exprtk_disable_return_statement + template + class return_node exprtk_final : public generic_function_node > + { + public: + + typedef results_context results_context_t; + typedef null_igenfunc igeneric_function_t; + typedef igeneric_function_t* igeneric_function_ptr; + typedef generic_function_node gen_function_t; + + return_node(const std::vector& arg_list, + results_context_t& rc) + : gen_function_t (arg_list) + , results_context_(&rc) + {} + + inline T value() const exprtk_override + { + if ( + (0 != results_context_) && + gen_function_t::populate_value_list() + ) + { + typedef typename type_store::parameter_list parameter_list_t; + + results_context_-> + assign(parameter_list_t(gen_function_t::typestore_list_)); + + throw return_exception(); + } + + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_return; + } + + private: + + results_context_t* results_context_; + }; + + template + class return_envelope_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef results_context results_context_t; + typedef std::pair branch_t; + + return_envelope_node(expression_ptr body, results_context_t& rc) + : results_context_(&rc ) + , return_invoked_ (false) + { + construct_branch_pair(body_, body); + } + + inline T value() const exprtk_override + { + assert(body_.first); + + try + { + return_invoked_ = false; + results_context_->clear(); + + return body_.first->value(); + } + catch(const return_exception&) + { + return_invoked_ = true; + return std::numeric_limits::quiet_NaN(); + } + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_retenv; + } + + inline bool* retinvk_ptr() + { + return &return_invoked_; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(body_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(body_); + } + + private: + + results_context_t* results_context_; + mutable bool return_invoked_; + branch_t body_; + }; + #endif + + #define exprtk_define_unary_op(OpName) \ + template \ + struct OpName##_op \ + { \ + typedef typename functor_t::Type Type; \ + typedef typename expression_node::node_type node_t; \ + \ + static inline T process(Type v) \ + { \ + return numeric:: OpName (v); \ + } \ + \ + static inline node_t type() \ + { \ + return expression_node::e_##OpName; \ + } \ + \ + static inline details::operator_type operation() \ + { \ + return details::e_##OpName; \ + } \ + }; \ + + exprtk_define_unary_op(abs ) + exprtk_define_unary_op(acos ) + exprtk_define_unary_op(acosh) + exprtk_define_unary_op(asin ) + exprtk_define_unary_op(asinh) + exprtk_define_unary_op(atan ) + exprtk_define_unary_op(atanh) + exprtk_define_unary_op(ceil ) + exprtk_define_unary_op(cos ) + exprtk_define_unary_op(cosh ) + exprtk_define_unary_op(cot ) + exprtk_define_unary_op(csc ) + exprtk_define_unary_op(d2g ) + exprtk_define_unary_op(d2r ) + exprtk_define_unary_op(erf ) + exprtk_define_unary_op(erfc ) + exprtk_define_unary_op(exp ) + exprtk_define_unary_op(expm1) + exprtk_define_unary_op(floor) + exprtk_define_unary_op(frac ) + exprtk_define_unary_op(g2d ) + exprtk_define_unary_op(log ) + exprtk_define_unary_op(log10) + exprtk_define_unary_op(log2 ) + exprtk_define_unary_op(log1p) + exprtk_define_unary_op(ncdf ) + exprtk_define_unary_op(neg ) + exprtk_define_unary_op(notl ) + exprtk_define_unary_op(pos ) + exprtk_define_unary_op(r2d ) + exprtk_define_unary_op(round) + exprtk_define_unary_op(sec ) + exprtk_define_unary_op(sgn ) + exprtk_define_unary_op(sin ) + exprtk_define_unary_op(sinc ) + exprtk_define_unary_op(sinh ) + exprtk_define_unary_op(sqrt ) + exprtk_define_unary_op(tan ) + exprtk_define_unary_op(tanh ) + exprtk_define_unary_op(trunc) + #undef exprtk_define_unary_op + + template + struct opr_base + { + typedef typename details::functor_t::Type Type; + typedef typename details::functor_t::RefType RefType; + typedef typename details::functor_t functor_t; + typedef typename functor_t::qfunc_t quaternary_functor_t; + typedef typename functor_t::tfunc_t trinary_functor_t; + typedef typename functor_t::bfunc_t binary_functor_t; + typedef typename functor_t::ufunc_t unary_functor_t; + }; + + template + struct add_op : public opr_base + { + typedef typename opr_base::Type Type; + typedef typename opr_base::RefType RefType; + + static inline T process(Type t1, Type t2) { return t1 + t2; } + static inline T process(Type t1, Type t2, Type t3) { return t1 + t2 + t3; } + static inline void assign(RefType t1, Type t2) { t1 += t2; } + static inline typename expression_node::node_type type() { return expression_node::e_add; } + static inline details::operator_type operation() { return details::e_add; } + }; + + template + struct mul_op : public opr_base + { + typedef typename opr_base::Type Type; + typedef typename opr_base::RefType RefType; + + static inline T process(Type t1, Type t2) { return t1 * t2; } + static inline T process(Type t1, Type t2, Type t3) { return t1 * t2 * t3; } + static inline void assign(RefType t1, Type t2) { t1 *= t2; } + static inline typename expression_node::node_type type() { return expression_node::e_mul; } + static inline details::operator_type operation() { return details::e_mul; } + }; + + template + struct sub_op : public opr_base + { + typedef typename opr_base::Type Type; + typedef typename opr_base::RefType RefType; + + static inline T process(Type t1, Type t2) { return t1 - t2; } + static inline T process(Type t1, Type t2, Type t3) { return t1 - t2 - t3; } + static inline void assign(RefType t1, Type t2) { t1 -= t2; } + static inline typename expression_node::node_type type() { return expression_node::e_sub; } + static inline details::operator_type operation() { return details::e_sub; } + }; + + template + struct div_op : public opr_base + { + typedef typename opr_base::Type Type; + typedef typename opr_base::RefType RefType; + + static inline T process(Type t1, Type t2) { return t1 / t2; } + static inline T process(Type t1, Type t2, Type t3) { return t1 / t2 / t3; } + static inline void assign(RefType t1, Type t2) { t1 /= t2; } + static inline typename expression_node::node_type type() { return expression_node::e_div; } + static inline details::operator_type operation() { return details::e_div; } + }; + + template + struct mod_op : public opr_base + { + typedef typename opr_base::Type Type; + typedef typename opr_base::RefType RefType; + + static inline T process(Type t1, Type t2) { return numeric::modulus(t1,t2); } + static inline void assign(RefType t1, Type t2) { t1 = numeric::modulus(t1,t2); } + static inline typename expression_node::node_type type() { return expression_node::e_mod; } + static inline details::operator_type operation() { return details::e_mod; } + }; + + template + struct pow_op : public opr_base + { + typedef typename opr_base::Type Type; + typedef typename opr_base::RefType RefType; + + static inline T process(Type t1, Type t2) { return numeric::pow(t1,t2); } + static inline void assign(RefType t1, Type t2) { t1 = numeric::pow(t1,t2); } + static inline typename expression_node::node_type type() { return expression_node::e_pow; } + static inline details::operator_type operation() { return details::e_pow; } + }; + + template + struct lt_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(Type t1, Type t2) { return ((t1 < t2) ? T(1) : T(0)); } + static inline T process(const std::string& t1, const std::string& t2) { return ((t1 < t2) ? T(1) : T(0)); } + static inline typename expression_node::node_type type() { return expression_node::e_lt; } + static inline details::operator_type operation() { return details::e_lt; } + }; + + template + struct lte_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(Type t1, Type t2) { return ((t1 <= t2) ? T(1) : T(0)); } + static inline T process(const std::string& t1, const std::string& t2) { return ((t1 <= t2) ? T(1) : T(0)); } + static inline typename expression_node::node_type type() { return expression_node::e_lte; } + static inline details::operator_type operation() { return details::e_lte; } + }; + + template + struct gt_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(Type t1, Type t2) { return ((t1 > t2) ? T(1) : T(0)); } + static inline T process(const std::string& t1, const std::string& t2) { return ((t1 > t2) ? T(1) : T(0)); } + static inline typename expression_node::node_type type() { return expression_node::e_gt; } + static inline details::operator_type operation() { return details::e_gt; } + }; + + template + struct gte_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(Type t1, Type t2) { return ((t1 >= t2) ? T(1) : T(0)); } + static inline T process(const std::string& t1, const std::string& t2) { return ((t1 >= t2) ? T(1) : T(0)); } + static inline typename expression_node::node_type type() { return expression_node::e_gte; } + static inline details::operator_type operation() { return details::e_gte; } + }; + + template + struct eq_op : public opr_base + { + typedef typename opr_base::Type Type; + static inline T process(Type t1, Type t2) { return (std::equal_to()(t1,t2) ? T(1) : T(0)); } + static inline T process(const std::string& t1, const std::string& t2) { return ((t1 == t2) ? T(1) : T(0)); } + static inline typename expression_node::node_type type() { return expression_node::e_eq; } + static inline details::operator_type operation() { return details::e_eq; } + }; + + template + struct equal_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(Type t1, Type t2) { return numeric::equal(t1,t2); } + static inline T process(const std::string& t1, const std::string& t2) { return ((t1 == t2) ? T(1) : T(0)); } + static inline typename expression_node::node_type type() { return expression_node::e_eq; } + static inline details::operator_type operation() { return details::e_equal; } + }; + + template + struct ne_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(Type t1, Type t2) { return (std::not_equal_to()(t1,t2) ? T(1) : T(0)); } + static inline T process(const std::string& t1, const std::string& t2) { return ((t1 != t2) ? T(1) : T(0)); } + static inline typename expression_node::node_type type() { return expression_node::e_ne; } + static inline details::operator_type operation() { return details::e_ne; } + }; + + template + struct and_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(Type t1, Type t2) { return (details::is_true(t1) && details::is_true(t2)) ? T(1) : T(0); } + static inline typename expression_node::node_type type() { return expression_node::e_and; } + static inline details::operator_type operation() { return details::e_and; } + }; + + template + struct nand_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(Type t1, Type t2) { return (details::is_true(t1) && details::is_true(t2)) ? T(0) : T(1); } + static inline typename expression_node::node_type type() { return expression_node::e_nand; } + static inline details::operator_type operation() { return details::e_nand; } + }; + + template + struct or_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(Type t1, Type t2) { return (details::is_true(t1) || details::is_true(t2)) ? T(1) : T(0); } + static inline typename expression_node::node_type type() { return expression_node::e_or; } + static inline details::operator_type operation() { return details::e_or; } + }; + + template + struct nor_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(Type t1, Type t2) { return (details::is_true(t1) || details::is_true(t2)) ? T(0) : T(1); } + static inline typename expression_node::node_type type() { return expression_node::e_nor; } + static inline details::operator_type operation() { return details::e_nor; } + }; + + template + struct xor_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(Type t1, Type t2) { return numeric::xor_opr(t1,t2); } + static inline typename expression_node::node_type type() { return expression_node::e_nor; } + static inline details::operator_type operation() { return details::e_xor; } + }; + + template + struct xnor_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(Type t1, Type t2) { return numeric::xnor_opr(t1,t2); } + static inline typename expression_node::node_type type() { return expression_node::e_nor; } + static inline details::operator_type operation() { return details::e_xnor; } + }; + + template + struct in_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(const T&, const T&) { return std::numeric_limits::quiet_NaN(); } + static inline T process(const std::string& t1, const std::string& t2) { return ((std::string::npos != t2.find(t1)) ? T(1) : T(0)); } + static inline typename expression_node::node_type type() { return expression_node::e_in; } + static inline details::operator_type operation() { return details::e_in; } + }; + + template + struct like_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(const T&, const T&) { return std::numeric_limits::quiet_NaN(); } + static inline T process(const std::string& t1, const std::string& t2) { return (details::wc_match(t2,t1) ? T(1) : T(0)); } + static inline typename expression_node::node_type type() { return expression_node::e_like; } + static inline details::operator_type operation() { return details::e_like; } + }; + + template + struct ilike_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(const T&, const T&) { return std::numeric_limits::quiet_NaN(); } + static inline T process(const std::string& t1, const std::string& t2) { return (details::wc_imatch(t2,t1) ? T(1) : T(0)); } + static inline typename expression_node::node_type type() { return expression_node::e_ilike; } + static inline details::operator_type operation() { return details::e_ilike; } + }; + + template + struct inrange_op : public opr_base + { + typedef typename opr_base::Type Type; + + static inline T process(const T& t0, const T& t1, const T& t2) { return ((t0 <= t1) && (t1 <= t2)) ? T(1) : T(0); } + static inline T process(const std::string& t0, const std::string& t1, const std::string& t2) + { + return ((t0 <= t1) && (t1 <= t2)) ? T(1) : T(0); + } + static inline typename expression_node::node_type type() { return expression_node::e_inranges; } + static inline details::operator_type operation() { return details::e_inrange; } + }; + + template + inline T value(details::expression_node* n) + { + return n->value(); + } + + template + inline T value(std::pair*,bool> n) + { + return n.first->value(); + } + + template + inline T value(const T* t) + { + return (*t); + } + + template + inline T value(const T& t) + { + return t; + } + + template + struct vararg_add_op : public opr_base + { + typedef typename opr_base::Type Type; + + template class Sequence> + static inline T process(const Sequence& arg_list) + { + switch (arg_list.size()) + { + case 0 : return T(0); + case 1 : return process_1(arg_list); + case 2 : return process_2(arg_list); + case 3 : return process_3(arg_list); + case 4 : return process_4(arg_list); + case 5 : return process_5(arg_list); + default : + { + T result = T(0); + + for (std::size_t i = 0; i < arg_list.size(); ++i) + { + result += value(arg_list[i]); + } + + return result; + } + } + } + + template + static inline T process_1(const Sequence& arg_list) + { + return value(arg_list[0]); + } + + template + static inline T process_2(const Sequence& arg_list) + { + return value(arg_list[0]) + value(arg_list[1]); + } + + template + static inline T process_3(const Sequence& arg_list) + { + return value(arg_list[0]) + value(arg_list[1]) + + value(arg_list[2]) ; + } + + template + static inline T process_4(const Sequence& arg_list) + { + return value(arg_list[0]) + value(arg_list[1]) + + value(arg_list[2]) + value(arg_list[3]) ; + } + + template + static inline T process_5(const Sequence& arg_list) + { + return value(arg_list[0]) + value(arg_list[1]) + + value(arg_list[2]) + value(arg_list[3]) + + value(arg_list[4]) ; + } + }; + + template + struct vararg_mul_op : public opr_base + { + typedef typename opr_base::Type Type; + + template class Sequence> + static inline T process(const Sequence& arg_list) + { + switch (arg_list.size()) + { + case 0 : return T(0); + case 1 : return process_1(arg_list); + case 2 : return process_2(arg_list); + case 3 : return process_3(arg_list); + case 4 : return process_4(arg_list); + case 5 : return process_5(arg_list); + default : + { + T result = T(value(arg_list[0])); + + for (std::size_t i = 1; i < arg_list.size(); ++i) + { + result *= value(arg_list[i]); + } + + return result; + } + } + } + + template + static inline T process_1(const Sequence& arg_list) + { + return value(arg_list[0]); + } + + template + static inline T process_2(const Sequence& arg_list) + { + return value(arg_list[0]) * value(arg_list[1]); + } + + template + static inline T process_3(const Sequence& arg_list) + { + return value(arg_list[0]) * value(arg_list[1]) * + value(arg_list[2]) ; + } + + template + static inline T process_4(const Sequence& arg_list) + { + return value(arg_list[0]) * value(arg_list[1]) * + value(arg_list[2]) * value(arg_list[3]) ; + } + + template + static inline T process_5(const Sequence& arg_list) + { + return value(arg_list[0]) * value(arg_list[1]) * + value(arg_list[2]) * value(arg_list[3]) * + value(arg_list[4]) ; + } + }; + + template + struct vararg_avg_op : public opr_base + { + typedef typename opr_base::Type Type; + + template class Sequence> + static inline T process(const Sequence& arg_list) + { + switch (arg_list.size()) + { + case 0 : return T(0); + case 1 : return process_1(arg_list); + case 2 : return process_2(arg_list); + case 3 : return process_3(arg_list); + case 4 : return process_4(arg_list); + case 5 : return process_5(arg_list); + default : return vararg_add_op::process(arg_list) / T(arg_list.size()); + } + } + + template + static inline T process_1(const Sequence& arg_list) + { + return value(arg_list[0]); + } + + template + static inline T process_2(const Sequence& arg_list) + { + return (value(arg_list[0]) + value(arg_list[1])) / T(2); + } + + template + static inline T process_3(const Sequence& arg_list) + { + return (value(arg_list[0]) + value(arg_list[1]) + value(arg_list[2])) / T(3); + } + + template + static inline T process_4(const Sequence& arg_list) + { + return (value(arg_list[0]) + value(arg_list[1]) + + value(arg_list[2]) + value(arg_list[3])) / T(4); + } + + template + static inline T process_5(const Sequence& arg_list) + { + return (value(arg_list[0]) + value(arg_list[1]) + + value(arg_list[2]) + value(arg_list[3]) + + value(arg_list[4])) / T(5); + } + }; + + template + struct vararg_min_op : public opr_base + { + typedef typename opr_base::Type Type; + + template class Sequence> + static inline T process(const Sequence& arg_list) + { + switch (arg_list.size()) + { + case 0 : return T(0); + case 1 : return process_1(arg_list); + case 2 : return process_2(arg_list); + case 3 : return process_3(arg_list); + case 4 : return process_4(arg_list); + case 5 : return process_5(arg_list); + default : + { + T result = T(value(arg_list[0])); + + for (std::size_t i = 1; i < arg_list.size(); ++i) + { + const T v = value(arg_list[i]); + + if (v < result) + result = v; + } + + return result; + } + } + } + + template + static inline T process_1(const Sequence& arg_list) + { + return value(arg_list[0]); + } + + template + static inline T process_2(const Sequence& arg_list) + { + return std::min(value(arg_list[0]),value(arg_list[1])); + } + + template + static inline T process_3(const Sequence& arg_list) + { + return std::min(std::min(value(arg_list[0]),value(arg_list[1])),value(arg_list[2])); + } + + template + static inline T process_4(const Sequence& arg_list) + { + return std::min( + std::min(value(arg_list[0]), value(arg_list[1])), + std::min(value(arg_list[2]), value(arg_list[3]))); + } + + template + static inline T process_5(const Sequence& arg_list) + { + return std::min( + std::min(std::min(value(arg_list[0]), value(arg_list[1])), + std::min(value(arg_list[2]), value(arg_list[3]))), + value(arg_list[4])); + } + }; + + template + struct vararg_max_op : public opr_base + { + typedef typename opr_base::Type Type; + + template class Sequence> + static inline T process(const Sequence& arg_list) + { + switch (arg_list.size()) + { + case 0 : return T(0); + case 1 : return process_1(arg_list); + case 2 : return process_2(arg_list); + case 3 : return process_3(arg_list); + case 4 : return process_4(arg_list); + case 5 : return process_5(arg_list); + default : + { + T result = T(value(arg_list[0])); + + for (std::size_t i = 1; i < arg_list.size(); ++i) + { + const T v = value(arg_list[i]); + + if (v > result) + result = v; + } + + return result; + } + } + } + + template + static inline T process_1(const Sequence& arg_list) + { + return value(arg_list[0]); + } + + template + static inline T process_2(const Sequence& arg_list) + { + return std::max(value(arg_list[0]),value(arg_list[1])); + } + + template + static inline T process_3(const Sequence& arg_list) + { + return std::max(std::max(value(arg_list[0]),value(arg_list[1])),value(arg_list[2])); + } + + template + static inline T process_4(const Sequence& arg_list) + { + return std::max( + std::max(value(arg_list[0]), value(arg_list[1])), + std::max(value(arg_list[2]), value(arg_list[3]))); + } + + template + static inline T process_5(const Sequence& arg_list) + { + return std::max( + std::max(std::max(value(arg_list[0]), value(arg_list[1])), + std::max(value(arg_list[2]), value(arg_list[3]))), + value(arg_list[4])); + } + }; + + template + struct vararg_mand_op : public opr_base + { + typedef typename opr_base::Type Type; + + template class Sequence> + static inline T process(const Sequence& arg_list) + { + switch (arg_list.size()) + { + case 1 : return process_1(arg_list); + case 2 : return process_2(arg_list); + case 3 : return process_3(arg_list); + case 4 : return process_4(arg_list); + case 5 : return process_5(arg_list); + default : + { + for (std::size_t i = 0; i < arg_list.size(); ++i) + { + if (std::equal_to()(T(0), value(arg_list[i]))) + return T(0); + } + + return T(1); + } + } + } + + template + static inline T process_1(const Sequence& arg_list) + { + return std::not_equal_to() + (T(0), value(arg_list[0])) ? T(1) : T(0); + } + + template + static inline T process_2(const Sequence& arg_list) + { + return ( + std::not_equal_to()(T(0), value(arg_list[0])) && + std::not_equal_to()(T(0), value(arg_list[1])) + ) ? T(1) : T(0); + } + + template + static inline T process_3(const Sequence& arg_list) + { + return ( + std::not_equal_to()(T(0), value(arg_list[0])) && + std::not_equal_to()(T(0), value(arg_list[1])) && + std::not_equal_to()(T(0), value(arg_list[2])) + ) ? T(1) : T(0); + } + + template + static inline T process_4(const Sequence& arg_list) + { + return ( + std::not_equal_to()(T(0), value(arg_list[0])) && + std::not_equal_to()(T(0), value(arg_list[1])) && + std::not_equal_to()(T(0), value(arg_list[2])) && + std::not_equal_to()(T(0), value(arg_list[3])) + ) ? T(1) : T(0); + } + + template + static inline T process_5(const Sequence& arg_list) + { + return ( + std::not_equal_to()(T(0), value(arg_list[0])) && + std::not_equal_to()(T(0), value(arg_list[1])) && + std::not_equal_to()(T(0), value(arg_list[2])) && + std::not_equal_to()(T(0), value(arg_list[3])) && + std::not_equal_to()(T(0), value(arg_list[4])) + ) ? T(1) : T(0); + } + }; + + template + struct vararg_mor_op : public opr_base + { + typedef typename opr_base::Type Type; + + template class Sequence> + static inline T process(const Sequence& arg_list) + { + switch (arg_list.size()) + { + case 1 : return process_1(arg_list); + case 2 : return process_2(arg_list); + case 3 : return process_3(arg_list); + case 4 : return process_4(arg_list); + case 5 : return process_5(arg_list); + default : + { + for (std::size_t i = 0; i < arg_list.size(); ++i) + { + if (std::not_equal_to()(T(0), value(arg_list[i]))) + return T(1); + } + + return T(0); + } + } + } + + template + static inline T process_1(const Sequence& arg_list) + { + return std::not_equal_to() + (T(0), value(arg_list[0])) ? T(1) : T(0); + } + + template + static inline T process_2(const Sequence& arg_list) + { + return ( + std::not_equal_to()(T(0), value(arg_list[0])) || + std::not_equal_to()(T(0), value(arg_list[1])) + ) ? T(1) : T(0); + } + + template + static inline T process_3(const Sequence& arg_list) + { + return ( + std::not_equal_to()(T(0), value(arg_list[0])) || + std::not_equal_to()(T(0), value(arg_list[1])) || + std::not_equal_to()(T(0), value(arg_list[2])) + ) ? T(1) : T(0); + } + + template + static inline T process_4(const Sequence& arg_list) + { + return ( + std::not_equal_to()(T(0), value(arg_list[0])) || + std::not_equal_to()(T(0), value(arg_list[1])) || + std::not_equal_to()(T(0), value(arg_list[2])) || + std::not_equal_to()(T(0), value(arg_list[3])) + ) ? T(1) : T(0); + } + + template + static inline T process_5(const Sequence& arg_list) + { + return ( + std::not_equal_to()(T(0), value(arg_list[0])) || + std::not_equal_to()(T(0), value(arg_list[1])) || + std::not_equal_to()(T(0), value(arg_list[2])) || + std::not_equal_to()(T(0), value(arg_list[3])) || + std::not_equal_to()(T(0), value(arg_list[4])) + ) ? T(1) : T(0); + } + }; + + template + struct vararg_multi_op : public opr_base + { + typedef typename opr_base::Type Type; + + template class Sequence> + static inline T process(const Sequence& arg_list) + { + switch (arg_list.size()) + { + case 0 : return std::numeric_limits::quiet_NaN(); + case 1 : return process_1(arg_list); + case 2 : return process_2(arg_list); + case 3 : return process_3(arg_list); + case 4 : return process_4(arg_list); + case 5 : return process_5(arg_list); + case 6 : return process_6(arg_list); + case 7 : return process_7(arg_list); + case 8 : return process_8(arg_list); + default : + { + for (std::size_t i = 0; i < (arg_list.size() - 1); ++i) + { + value(arg_list[i]); + } + + return value(arg_list.back()); + } + } + } + + template + static inline T process_1(const Sequence& arg_list) + { + return value(arg_list[0]); + } + + template + static inline T process_2(const Sequence& arg_list) + { + value(arg_list[0]); + return value(arg_list[1]); + } + + template + static inline T process_3(const Sequence& arg_list) + { + value(arg_list[0]); + value(arg_list[1]); + return value(arg_list[2]); + } + + template + static inline T process_4(const Sequence& arg_list) + { + value(arg_list[0]); + value(arg_list[1]); + value(arg_list[2]); + return value(arg_list[3]); + } + + template + static inline T process_5(const Sequence& arg_list) + { + value(arg_list[0]); + value(arg_list[1]); + value(arg_list[2]); + value(arg_list[3]); + return value(arg_list[4]); + } + + template + static inline T process_6(const Sequence& arg_list) + { + value(arg_list[0]); + value(arg_list[1]); + value(arg_list[2]); + value(arg_list[3]); + value(arg_list[4]); + return value(arg_list[5]); + } + + template + static inline T process_7(const Sequence& arg_list) + { + value(arg_list[0]); + value(arg_list[1]); + value(arg_list[2]); + value(arg_list[3]); + value(arg_list[4]); + value(arg_list[5]); + return value(arg_list[6]); + } + + template + static inline T process_8(const Sequence& arg_list) + { + value(arg_list[0]); + value(arg_list[1]); + value(arg_list[2]); + value(arg_list[3]); + value(arg_list[4]); + value(arg_list[5]); + value(arg_list[6]); + return value(arg_list[7]); + } + }; + + template + struct vec_add_op + { + typedef vector_interface* ivector_ptr; + + static inline T process(const ivector_ptr v) + { + const T* vec = v->vec()->vds().data(); + const std::size_t vec_size = v->vec()->vds().size(); + + loop_unroll::details lud(vec_size); + + if (vec_size <= static_cast(lud.batch_size)) + { + T result = T(0); + int i = 0; + + exprtk_disable_fallthrough_begin + switch (vec_size) + { + #define case_stmt(N) \ + case N : result += vec[i++]; \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(16) case_stmt(15) + case_stmt(14) case_stmt(13) + case_stmt(12) case_stmt(11) + case_stmt(10) case_stmt( 9) + case_stmt( 8) case_stmt( 7) + case_stmt( 6) case_stmt( 5) + #endif + case_stmt( 4) case_stmt( 3) + case_stmt( 2) case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef case_stmt + + return result; + } + + T r[] = { + T(0), T(0), T(0), T(0), T(0), T(0), T(0), T(0), + T(0), T(0), T(0), T(0), T(0), T(0), T(0), T(0) + }; + + const T* upper_bound = vec + lud.upper_bound; + + while (vec < upper_bound) + { + #define exprtk_loop(N) \ + r[N] += vec[N]; \ + + exprtk_loop( 0) exprtk_loop( 1) + exprtk_loop( 2) exprtk_loop( 3) + #ifndef exprtk_disable_superscalar_unroll + exprtk_loop( 4) exprtk_loop( 5) + exprtk_loop( 6) exprtk_loop( 7) + exprtk_loop( 8) exprtk_loop( 9) + exprtk_loop(10) exprtk_loop(11) + exprtk_loop(12) exprtk_loop(13) + exprtk_loop(14) exprtk_loop(15) + #endif + + vec += lud.batch_size; + } + + int i = 0; + + exprtk_disable_fallthrough_begin + switch (lud.remainder) + { + #define case_stmt(N) \ + case N : r[0] += vec[i++]; \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(15) case_stmt(14) + case_stmt(13) case_stmt(12) + case_stmt(11) case_stmt(10) + case_stmt( 9) case_stmt( 8) + case_stmt( 7) case_stmt( 6) + case_stmt( 5) case_stmt( 4) + #endif + case_stmt( 3) case_stmt( 2) + case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef exprtk_loop + #undef case_stmt + + return (r[ 0] + r[ 1] + r[ 2] + r[ 3]) + #ifndef exprtk_disable_superscalar_unroll + + (r[ 4] + r[ 5] + r[ 6] + r[ 7]) + + (r[ 8] + r[ 9] + r[10] + r[11]) + + (r[12] + r[13] + r[14] + r[15]) + #endif + ; + } + }; + + template + struct vec_mul_op + { + typedef vector_interface* ivector_ptr; + + static inline T process(const ivector_ptr v) + { + const T* vec = v->vec()->vds().data(); + const std::size_t vec_size = v->vec()->vds().size(); + + loop_unroll::details lud(vec_size); + + if (vec_size <= static_cast(lud.batch_size)) + { + T result = T(1); + int i = 0; + + exprtk_disable_fallthrough_begin + switch (vec_size) + { + #define case_stmt(N) \ + case N : result *= vec[i++]; \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(16) case_stmt(15) + case_stmt(14) case_stmt(13) + case_stmt(12) case_stmt(11) + case_stmt(10) case_stmt( 9) + case_stmt( 8) case_stmt( 7) + case_stmt( 6) case_stmt( 5) + #endif + case_stmt( 4) case_stmt( 3) + case_stmt( 2) case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef case_stmt + + return result; + } + + T r[] = { + T(1), T(1), T(1), T(1), T(1), T(1), T(1), T(1), + T(1), T(1), T(1), T(1), T(1), T(1), T(1), T(1) + }; + + const T* upper_bound = vec + lud.upper_bound; + + while (vec < upper_bound) + { + #define exprtk_loop(N) \ + r[N] *= vec[N]; \ + + exprtk_loop( 0) exprtk_loop( 1) + exprtk_loop( 2) exprtk_loop( 3) + #ifndef exprtk_disable_superscalar_unroll + exprtk_loop( 4) exprtk_loop( 5) + exprtk_loop( 6) exprtk_loop( 7) + exprtk_loop( 8) exprtk_loop( 9) + exprtk_loop(10) exprtk_loop(11) + exprtk_loop(12) exprtk_loop(13) + exprtk_loop(14) exprtk_loop(15) + #endif + + vec += lud.batch_size; + } + + int i = 0; + + exprtk_disable_fallthrough_begin + switch (lud.remainder) + { + #define case_stmt(N) \ + case N : r[0] *= vec[i++]; \ + + #ifndef exprtk_disable_superscalar_unroll + case_stmt(15) case_stmt(14) + case_stmt(13) case_stmt(12) + case_stmt(11) case_stmt(10) + case_stmt( 9) case_stmt( 8) + case_stmt( 7) case_stmt( 6) + case_stmt( 5) case_stmt( 4) + #endif + case_stmt( 3) case_stmt( 2) + case_stmt( 1) + } + exprtk_disable_fallthrough_end + + #undef exprtk_loop + #undef case_stmt + + return (r[ 0] * r[ 1] * r[ 2] * r[ 3]) + #ifndef exprtk_disable_superscalar_unroll + + (r[ 4] * r[ 5] * r[ 6] * r[ 7]) + + (r[ 8] * r[ 9] * r[10] * r[11]) + + (r[12] * r[13] * r[14] * r[15]) + #endif + ; + } + }; + + template + struct vec_avg_op + { + typedef vector_interface* ivector_ptr; + + static inline T process(const ivector_ptr v) + { + const T vec_size = T(v->vec()->vds().size()); + return vec_add_op::process(v) / vec_size; + } + }; + + template + struct vec_min_op + { + typedef vector_interface* ivector_ptr; + + static inline T process(const ivector_ptr v) + { + const T* vec = v->vec()->vds().data(); + const std::size_t vec_size = v->vec()->vds().size(); + + T result = vec[0]; + + for (std::size_t i = 1; i < vec_size; ++i) + { + const T v_i = vec[i]; + + if (v_i < result) + result = v_i; + } + + return result; + } + }; + + template + struct vec_max_op + { + typedef vector_interface* ivector_ptr; + + static inline T process(const ivector_ptr v) + { + const T* vec = v->vec()->vds().data(); + const std::size_t vec_size = v->vec()->vds().size(); + + T result = vec[0]; + + for (std::size_t i = 1; i < vec_size; ++i) + { + const T v_i = vec[i]; + + if (v_i > result) + result = v_i; + } + + return result; + } + }; + + template + class vov_base_node : public expression_node + { + public: + + virtual ~vov_base_node() {} + + inline virtual operator_type operation() const + { + return details::e_default; + } + + virtual const T& v0() const = 0; + + virtual const T& v1() const = 0; + }; + + template + class cov_base_node : public expression_node + { + public: + + virtual ~cov_base_node() {} + + inline virtual operator_type operation() const + { + return details::e_default; + } + + virtual const T c() const = 0; + + virtual const T& v() const = 0; + }; + + template + class voc_base_node : public expression_node + { + public: + + virtual ~voc_base_node() {} + + inline virtual operator_type operation() const + { + return details::e_default; + } + + virtual const T c() const = 0; + + virtual const T& v() const = 0; + }; + + template + class vob_base_node : public expression_node + { + public: + + virtual ~vob_base_node() {} + + virtual const T& v() const = 0; + }; + + template + class bov_base_node : public expression_node + { + public: + + virtual ~bov_base_node() {} + + virtual const T& v() const = 0; + }; + + template + class cob_base_node : public expression_node + { + public: + + virtual ~cob_base_node() {} + + inline virtual operator_type operation() const + { + return details::e_default; + } + + virtual const T c() const = 0; + + virtual void set_c(const T) = 0; + + virtual expression_node* move_branch(const std::size_t& index) = 0; + }; + + template + class boc_base_node : public expression_node + { + public: + + virtual ~boc_base_node() {} + + inline virtual operator_type operation() const + { + return details::e_default; + } + + virtual const T c() const = 0; + + virtual void set_c(const T) = 0; + + virtual expression_node* move_branch(const std::size_t& index) = 0; + }; + + template + class uv_base_node : public expression_node + { + public: + + virtual ~uv_base_node() {} + + inline virtual operator_type operation() const + { + return details::e_default; + } + + virtual const T& v() const = 0; + }; + + template + class sos_base_node : public expression_node + { + public: + + virtual ~sos_base_node() {} + + inline virtual operator_type operation() const + { + return details::e_default; + } + }; + + template + class sosos_base_node : public expression_node + { + public: + + virtual ~sosos_base_node() {} + + inline virtual operator_type operation() const + { + return details::e_default; + } + }; + + template + class T0oT1oT2_base_node : public expression_node + { + public: + + virtual ~T0oT1oT2_base_node() {} + + virtual std::string type_id() const = 0; + }; + + template + class T0oT1oT2oT3_base_node : public expression_node + { + public: + + virtual ~T0oT1oT2oT3_base_node() {} + + virtual std::string type_id() const = 0; + }; + + template + class unary_variable_node exprtk_final : public uv_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef Operation operation_t; + + explicit unary_variable_node(const T& var) + : v_(var) + {} + + inline T value() const exprtk_override + { + return Operation::process(v_); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return Operation::type(); + } + + inline operator_type operation() const exprtk_override + { + return Operation::operation(); + } + + inline const T& v() const exprtk_override + { + return v_; + } + + private: + + unary_variable_node(const unary_variable_node&) exprtk_delete; + unary_variable_node& operator=(const unary_variable_node&) exprtk_delete; + + const T& v_; + }; + + template + class uvouv_node exprtk_final : public expression_node + { + public: + + // UOpr1(v0) Op UOpr2(v1) + typedef typename details::functor_t functor_t; + typedef typename functor_t::bfunc_t bfunc_t; + typedef typename functor_t::ufunc_t ufunc_t; + typedef expression_node* expression_ptr; + + explicit uvouv_node(const T& var0,const T& var1, + ufunc_t uf0, ufunc_t uf1, bfunc_t bf) + : v0_(var0) + , v1_(var1) + , u0_(uf0 ) + , u1_(uf1 ) + , f_ (bf ) + {} + + inline T value() const exprtk_override + { + return f_(u0_(v0_),u1_(v1_)); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_uvouv; + } + + inline const T& v0() + { + return v0_; + } + + inline const T& v1() + { + return v1_; + } + + inline ufunc_t u0() + { + return u0_; + } + + inline ufunc_t u1() + { + return u1_; + } + + inline ufunc_t f() + { + return f_; + } + + private: + + uvouv_node(const uvouv_node&) exprtk_delete; + uvouv_node& operator=(const uvouv_node&) exprtk_delete; + + const T& v0_; + const T& v1_; + const ufunc_t u0_; + const ufunc_t u1_; + const bfunc_t f_; + }; + + template + class unary_branch_node exprtk_final : public expression_node + { + public: + + typedef Operation operation_t; + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + + explicit unary_branch_node(expression_ptr branch) + { + construct_branch_pair(branch_, branch); + } + + inline T value() const exprtk_override + { + return Operation::process(branch_.first->value()); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return Operation::type(); + } + + inline operator_type operation() + { + return Operation::operation(); + } + + inline expression_node* branch(const std::size_t&) const exprtk_override + { + return branch_.first; + } + + inline void release() + { + branch_.second = false; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(branch_); + } + + private: + + unary_branch_node(const unary_branch_node&) exprtk_delete; + unary_branch_node& operator=(const unary_branch_node&) exprtk_delete; + + branch_t branch_; + }; + + template struct is_const { enum {result = 0}; }; + template struct is_const { enum {result = 1}; }; + template struct is_const_ref { enum {result = 0}; }; + template struct is_const_ref { enum {result = 1}; }; + template struct is_ref { enum {result = 0}; }; + template struct is_ref { enum {result = 1}; }; + template struct is_ref { enum {result = 0}; }; + + template + struct param_to_str { static std::string result() { static const std::string r("v"); return r; } }; + + template <> + struct param_to_str<0> { static std::string result() { static const std::string r("c"); return r; } }; + + #define exprtk_crtype(Type) \ + param_to_str::result>::result() \ + + template + struct T0oT1oT2process + { + typedef typename details::functor_t functor_t; + typedef typename functor_t::bfunc_t bfunc_t; + + struct mode0 + { + static inline T process(const T& t0, const T& t1, const T& t2, const bfunc_t bf0, const bfunc_t bf1) + { + // (T0 o0 T1) o1 T2 + return bf1(bf0(t0,t1),t2); + } + + template + static inline std::string id() + { + static const std::string result = "(" + exprtk_crtype(T0) + "o" + + exprtk_crtype(T1) + ")o(" + + exprtk_crtype(T2) + ")" ; + return result; + } + }; + + struct mode1 + { + static inline T process(const T& t0, const T& t1, const T& t2, const bfunc_t bf0, const bfunc_t bf1) + { + // T0 o0 (T1 o1 T2) + return bf0(t0,bf1(t1,t2)); + } + + template + static inline std::string id() + { + static const std::string result = "(" + exprtk_crtype(T0) + ")o(" + + exprtk_crtype(T1) + "o" + + exprtk_crtype(T2) + ")" ; + return result; + } + }; + }; + + template + struct T0oT1oT20T3process + { + typedef typename details::functor_t functor_t; + typedef typename functor_t::bfunc_t bfunc_t; + + struct mode0 + { + static inline T process(const T& t0, const T& t1, + const T& t2, const T& t3, + const bfunc_t bf0, const bfunc_t bf1, const bfunc_t bf2) + { + // (T0 o0 T1) o1 (T2 o2 T3) + return bf1(bf0(t0,t1),bf2(t2,t3)); + } + + template + static inline std::string id() + { + static const std::string result = "(" + exprtk_crtype(T0) + "o" + + exprtk_crtype(T1) + ")o" + + "(" + exprtk_crtype(T2) + "o" + + exprtk_crtype(T3) + ")" ; + return result; + } + }; + + struct mode1 + { + static inline T process(const T& t0, const T& t1, + const T& t2, const T& t3, + const bfunc_t bf0, const bfunc_t bf1, const bfunc_t bf2) + { + // (T0 o0 (T1 o1 (T2 o2 T3)) + return bf0(t0,bf1(t1,bf2(t2,t3))); + } + template + static inline std::string id() + { + static const std::string result = "(" + exprtk_crtype(T0) + ")o((" + + exprtk_crtype(T1) + ")o(" + + exprtk_crtype(T2) + "o" + + exprtk_crtype(T3) + "))" ; + return result; + } + }; + + struct mode2 + { + static inline T process(const T& t0, const T& t1, + const T& t2, const T& t3, + const bfunc_t bf0, const bfunc_t bf1, const bfunc_t bf2) + { + // (T0 o0 ((T1 o1 T2) o2 T3) + return bf0(t0,bf2(bf1(t1,t2),t3)); + } + + template + static inline std::string id() + { + static const std::string result = "(" + exprtk_crtype(T0) + ")o((" + + exprtk_crtype(T1) + "o" + + exprtk_crtype(T2) + ")o(" + + exprtk_crtype(T3) + "))" ; + return result; + } + }; + + struct mode3 + { + static inline T process(const T& t0, const T& t1, + const T& t2, const T& t3, + const bfunc_t bf0, const bfunc_t bf1, const bfunc_t bf2) + { + // (((T0 o0 T1) o1 T2) o2 T3) + return bf2(bf1(bf0(t0,t1),t2),t3); + } + + template + static inline std::string id() + { + static const std::string result = "((" + exprtk_crtype(T0) + "o" + + exprtk_crtype(T1) + ")o(" + + exprtk_crtype(T2) + "))o(" + + exprtk_crtype(T3) + ")"; + return result; + } + }; + + struct mode4 + { + static inline T process(const T& t0, const T& t1, + const T& t2, const T& t3, + const bfunc_t bf0, const bfunc_t bf1, const bfunc_t bf2) + { + // ((T0 o0 (T1 o1 T2)) o2 T3 + return bf2(bf0(t0,bf1(t1,t2)),t3); + } + + template + static inline std::string id() + { + static const std::string result = "((" + exprtk_crtype(T0) + ")o(" + + exprtk_crtype(T1) + "o" + + exprtk_crtype(T2) + "))o(" + + exprtk_crtype(T3) + ")" ; + return result; + } + }; + }; + + #undef exprtk_crtype + + template + struct nodetype_T0oT1 { static const typename expression_node::node_type result; }; + template + const typename expression_node::node_type nodetype_T0oT1::result = expression_node::e_none; + + #define synthesis_node_type_define(T0_, T1_, v_) \ + template \ + struct nodetype_T0oT1 { static const typename expression_node::node_type result; }; \ + template \ + const typename expression_node::node_type nodetype_T0oT1::result = expression_node:: v_; \ + + synthesis_node_type_define(const T0&, const T1&, e_vov) + synthesis_node_type_define(const T0&, const T1 , e_voc) + synthesis_node_type_define(const T0 , const T1&, e_cov) + synthesis_node_type_define( T0&, T1&, e_none) + synthesis_node_type_define(const T0 , const T1 , e_none) + synthesis_node_type_define( T0&, const T1 , e_none) + synthesis_node_type_define(const T0 , T1&, e_none) + synthesis_node_type_define(const T0&, T1&, e_none) + synthesis_node_type_define( T0&, const T1&, e_none) + #undef synthesis_node_type_define + + template + struct nodetype_T0oT1oT2 { static const typename expression_node::node_type result; }; + template + const typename expression_node::node_type nodetype_T0oT1oT2::result = expression_node::e_none; + + #define synthesis_node_type_define(T0_, T1_, T2_, v_) \ + template \ + struct nodetype_T0oT1oT2 { static const typename expression_node::node_type result; }; \ + template \ + const typename expression_node::node_type nodetype_T0oT1oT2::result = expression_node:: v_; \ + + synthesis_node_type_define(const T0&, const T1&, const T2&, e_vovov) + synthesis_node_type_define(const T0&, const T1&, const T2 , e_vovoc) + synthesis_node_type_define(const T0&, const T1 , const T2&, e_vocov) + synthesis_node_type_define(const T0 , const T1&, const T2&, e_covov) + synthesis_node_type_define(const T0 , const T1&, const T2 , e_covoc) + synthesis_node_type_define(const T0 , const T1 , const T2 , e_none ) + synthesis_node_type_define(const T0 , const T1 , const T2&, e_none ) + synthesis_node_type_define(const T0&, const T1 , const T2 , e_none ) + synthesis_node_type_define( T0&, T1&, T2&, e_none ) + #undef synthesis_node_type_define + + template + struct nodetype_T0oT1oT2oT3 { static const typename expression_node::node_type result; }; + template + const typename expression_node::node_type nodetype_T0oT1oT2oT3::result = expression_node::e_none; + + #define synthesis_node_type_define(T0_, T1_, T2_, T3_, v_) \ + template \ + struct nodetype_T0oT1oT2oT3 { static const typename expression_node::node_type result; }; \ + template \ + const typename expression_node::node_type nodetype_T0oT1oT2oT3::result = expression_node:: v_; \ + + synthesis_node_type_define(const T0&, const T1&, const T2&, const T3&, e_vovovov) + synthesis_node_type_define(const T0&, const T1&, const T2&, const T3 , e_vovovoc) + synthesis_node_type_define(const T0&, const T1&, const T2 , const T3&, e_vovocov) + synthesis_node_type_define(const T0&, const T1 , const T2&, const T3&, e_vocovov) + synthesis_node_type_define(const T0 , const T1&, const T2&, const T3&, e_covovov) + synthesis_node_type_define(const T0 , const T1&, const T2 , const T3&, e_covocov) + synthesis_node_type_define(const T0&, const T1 , const T2&, const T3 , e_vocovoc) + synthesis_node_type_define(const T0 , const T1&, const T2&, const T3 , e_covovoc) + synthesis_node_type_define(const T0&, const T1 , const T2 , const T3&, e_vococov) + synthesis_node_type_define(const T0 , const T1 , const T2 , const T3 , e_none ) + synthesis_node_type_define(const T0 , const T1 , const T2 , const T3&, e_none ) + synthesis_node_type_define(const T0 , const T1 , const T2&, const T3 , e_none ) + synthesis_node_type_define(const T0 , const T1&, const T2 , const T3 , e_none ) + synthesis_node_type_define(const T0&, const T1 , const T2 , const T3 , e_none ) + synthesis_node_type_define(const T0 , const T1 , const T2&, const T3&, e_none ) + synthesis_node_type_define(const T0&, const T1&, const T2 , const T3 , e_none ) + #undef synthesis_node_type_define + + template + class T0oT1 exprtk_final : public expression_node + { + public: + + typedef typename details::functor_t functor_t; + typedef typename functor_t::bfunc_t bfunc_t; + typedef T value_type; + typedef T0oT1 node_type; + + T0oT1(T0 p0, T1 p1, const bfunc_t p2) + : t0_(p0) + , t1_(p1) + , f_ (p2) + {} + + inline typename expression_node::node_type type() const exprtk_override + { + static const typename expression_node::node_type result = nodetype_T0oT1::result; + return result; + } + + inline operator_type operation() const exprtk_override + { + return e_default; + } + + inline T value() const exprtk_override + { + return f_(t0_,t1_); + } + + inline T0 t0() const + { + return t0_; + } + + inline T1 t1() const + { + return t1_; + } + + inline bfunc_t f() const + { + return f_; + } + + template + static inline expression_node* allocate(Allocator& allocator, + T0 p0, T1 p1, + bfunc_t p2) + { + return allocator + .template allocate_type + (p0, p1, p2); + } + + private: + + T0oT1(const T0oT1&) exprtk_delete; + T0oT1& operator=(const T0oT1&) { return (*this); } + + T0 t0_; + T1 t1_; + const bfunc_t f_; + }; + + template + class T0oT1oT2 exprtk_final : public T0oT1oT2_base_node + { + public: + + typedef typename details::functor_t functor_t; + typedef typename functor_t::bfunc_t bfunc_t; + typedef T value_type; + typedef T0oT1oT2 node_type; + typedef ProcessMode process_mode_t; + + T0oT1oT2(T0 p0, T1 p1, T2 p2, const bfunc_t p3, const bfunc_t p4) + : t0_(p0) + , t1_(p1) + , t2_(p2) + , f0_(p3) + , f1_(p4) + {} + + inline typename expression_node::node_type type() const exprtk_override + { + static const typename expression_node::node_type result = nodetype_T0oT1oT2::result; + return result; + } + + inline operator_type operation() + { + return e_default; + } + + inline T value() const exprtk_override + { + return ProcessMode::process(t0_, t1_, t2_, f0_, f1_); + } + + inline T0 t0() const + { + return t0_; + } + + inline T1 t1() const + { + return t1_; + } + + inline T2 t2() const + { + return t2_; + } + + bfunc_t f0() const + { + return f0_; + } + + bfunc_t f1() const + { + return f1_; + } + + std::string type_id() const exprtk_override + { + return id(); + } + + static inline std::string id() + { + return process_mode_t::template id(); + } + + template + static inline expression_node* allocate(Allocator& allocator, T0 p0, T1 p1, T2 p2, bfunc_t p3, bfunc_t p4) + { + return allocator + .template allocate_type + (p0, p1, p2, p3, p4); + } + + private: + + T0oT1oT2(const node_type&) exprtk_delete; + node_type& operator=(const node_type&) exprtk_delete; + + T0 t0_; + T1 t1_; + T2 t2_; + const bfunc_t f0_; + const bfunc_t f1_; + }; + + template + class T0oT1oT2oT3 exprtk_final : public T0oT1oT2oT3_base_node + { + public: + + typedef typename details::functor_t functor_t; + typedef typename functor_t::bfunc_t bfunc_t; + typedef T value_type; + typedef T0_ T0; + typedef T1_ T1; + typedef T2_ T2; + typedef T3_ T3; + typedef T0oT1oT2oT3 node_type; + typedef ProcessMode process_mode_t; + + T0oT1oT2oT3(T0 p0, T1 p1, T2 p2, T3 p3, bfunc_t p4, bfunc_t p5, bfunc_t p6) + : t0_(p0) + , t1_(p1) + , t2_(p2) + , t3_(p3) + , f0_(p4) + , f1_(p5) + , f2_(p6) + {} + + inline T value() const exprtk_override + { + return ProcessMode::process(t0_, t1_, t2_, t3_, f0_, f1_, f2_); + } + + inline T0 t0() const + { + return t0_; + } + + inline T1 t1() const + { + return t1_; + } + + inline T2 t2() const + { + return t2_; + } + + inline T3 t3() const + { + return t3_; + } + + inline bfunc_t f0() const + { + return f0_; + } + + inline bfunc_t f1() const + { + return f1_; + } + + inline bfunc_t f2() const + { + return f2_; + } + + inline std::string type_id() const exprtk_override + { + return id(); + } + + static inline std::string id() + { + return process_mode_t::template id(); + } + + template + static inline expression_node* allocate(Allocator& allocator, + T0 p0, T1 p1, T2 p2, T3 p3, + bfunc_t p4, bfunc_t p5, bfunc_t p6) + { + return allocator + .template allocate_type + (p0, p1, p2, p3, p4, p5, p6); + } + + private: + + T0oT1oT2oT3(const node_type&) exprtk_delete; + node_type& operator=(const node_type&) exprtk_delete; + + T0 t0_; + T1 t1_; + T2 t2_; + T3 t3_; + const bfunc_t f0_; + const bfunc_t f1_; + const bfunc_t f2_; + }; + + template + class T0oT1oT2_sf3 exprtk_final : public T0oT1oT2_base_node + { + public: + + typedef typename details::functor_t functor_t; + typedef typename functor_t::tfunc_t tfunc_t; + typedef T value_type; + typedef T0oT1oT2_sf3 node_type; + + T0oT1oT2_sf3(T0 p0, T1 p1, T2 p2, const tfunc_t p3) + : t0_(p0) + , t1_(p1) + , t2_(p2) + , f_ (p3) + {} + + inline typename expression_node::node_type type() const exprtk_override + { + static const typename expression_node::node_type result = nodetype_T0oT1oT2::result; + return result; + } + + inline operator_type operation() const exprtk_override + { + return e_default; + } + + inline T value() const exprtk_override + { + return f_(t0_, t1_, t2_); + } + + inline T0 t0() const + { + return t0_; + } + + inline T1 t1() const + { + return t1_; + } + + inline T2 t2() const + { + return t2_; + } + + tfunc_t f() const + { + return f_; + } + + std::string type_id() const + { + return id(); + } + + static inline std::string id() + { + return "sf3"; + } + + template + static inline expression_node* allocate(Allocator& allocator, T0 p0, T1 p1, T2 p2, tfunc_t p3) + { + return allocator + .template allocate_type + (p0, p1, p2, p3); + } + + private: + + T0oT1oT2_sf3(const node_type&) exprtk_delete; + node_type& operator=(const node_type&) exprtk_delete; + + T0 t0_; + T1 t1_; + T2 t2_; + const tfunc_t f_; + }; + + template + class sf3ext_type_node : public T0oT1oT2_base_node + { + public: + + virtual ~sf3ext_type_node() {} + + virtual T0 t0() const = 0; + + virtual T1 t1() const = 0; + + virtual T2 t2() const = 0; + }; + + template + class T0oT1oT2_sf3ext exprtk_final : public sf3ext_type_node + { + public: + + typedef T value_type; + typedef T0oT1oT2_sf3ext node_type; + + T0oT1oT2_sf3ext(T0 p0, T1 p1, T2 p2) + : t0_(p0) + , t1_(p1) + , t2_(p2) + {} + + inline typename expression_node::node_type type() const exprtk_override + { + static const typename expression_node::node_type result = nodetype_T0oT1oT2::result; + return result; + } + + inline operator_type operation() + { + return e_default; + } + + inline T value() const exprtk_override + { + return SF3Operation::process(t0_, t1_, t2_); + } + + T0 t0() const exprtk_override + { + return t0_; + } + + T1 t1() const exprtk_override + { + return t1_; + } + + T2 t2() const exprtk_override + { + return t2_; + } + + std::string type_id() const exprtk_override + { + return id(); + } + + static inline std::string id() + { + return SF3Operation::id(); + } + + template + static inline expression_node* allocate(Allocator& allocator, T0 p0, T1 p1, T2 p2) + { + return allocator + .template allocate_type + (p0, p1, p2); + } + + private: + + T0oT1oT2_sf3ext(const node_type&) exprtk_delete; + node_type& operator=(const node_type&) exprtk_delete; + + T0 t0_; + T1 t1_; + T2 t2_; + }; + + template + inline bool is_sf3ext_node(const expression_node* n) + { + switch (n->type()) + { + case expression_node::e_vovov : return true; + case expression_node::e_vovoc : return true; + case expression_node::e_vocov : return true; + case expression_node::e_covov : return true; + case expression_node::e_covoc : return true; + default : return false; + } + } + + template + class T0oT1oT2oT3_sf4 exprtk_final : public T0oT1oT2_base_node + { + public: + + typedef typename details::functor_t functor_t; + typedef typename functor_t::qfunc_t qfunc_t; + typedef T value_type; + typedef T0oT1oT2oT3_sf4 node_type; + + T0oT1oT2oT3_sf4(T0 p0, T1 p1, T2 p2, T3 p3, const qfunc_t p4) + : t0_(p0) + , t1_(p1) + , t2_(p2) + , t3_(p3) + , f_ (p4) + {} + + inline typename expression_node::node_type type() const exprtk_override + { + static const typename expression_node::node_type result = nodetype_T0oT1oT2oT3::result; + return result; + } + + inline operator_type operation() const exprtk_override + { + return e_default; + } + + inline T value() const exprtk_override + { + return f_(t0_, t1_, t2_, t3_); + } + + inline T0 t0() const + { + return t0_; + } + + inline T1 t1() const + { + return t1_; + } + + inline T2 t2() const + { + return t2_; + } + + inline T3 t3() const + { + return t3_; + } + + qfunc_t f() const + { + return f_; + } + + std::string type_id() const + { + return id(); + } + + static inline std::string id() + { + return "sf4"; + } + + template + static inline expression_node* allocate(Allocator& allocator, T0 p0, T1 p1, T2 p2, T3 p3, qfunc_t p4) + { + return allocator + .template allocate_type + (p0, p1, p2, p3, p4); + } + + private: + + T0oT1oT2oT3_sf4(const node_type&) exprtk_delete; + node_type& operator=(const node_type&) exprtk_delete; + + T0 t0_; + T1 t1_; + T2 t2_; + T3 t3_; + const qfunc_t f_; + }; + + template + class T0oT1oT2oT3_sf4ext exprtk_final : public T0oT1oT2oT3_base_node + { + public: + + typedef T value_type; + typedef T0oT1oT2oT3_sf4ext node_type; + + T0oT1oT2oT3_sf4ext(T0 p0, T1 p1, T2 p2, T3 p3) + : t0_(p0) + , t1_(p1) + , t2_(p2) + , t3_(p3) + {} + + inline typename expression_node::node_type type() const exprtk_override + { + static const typename expression_node::node_type result = nodetype_T0oT1oT2oT3::result; + return result; + } + + inline T value() const exprtk_override + { + return SF4Operation::process(t0_, t1_, t2_, t3_); + } + + inline T0 t0() const + { + return t0_; + } + + inline T1 t1() const + { + return t1_; + } + + inline T2 t2() const + { + return t2_; + } + + inline T3 t3() const + { + return t3_; + } + + std::string type_id() const exprtk_override + { + return id(); + } + + static inline std::string id() + { + return SF4Operation::id(); + } + + template + static inline expression_node* allocate(Allocator& allocator, T0 p0, T1 p1, T2 p2, T3 p3) + { + return allocator + .template allocate_type + (p0, p1, p2, p3); + } + + private: + + T0oT1oT2oT3_sf4ext(const node_type&) exprtk_delete; + node_type& operator=(const node_type&) exprtk_delete; + + T0 t0_; + T1 t1_; + T2 t2_; + T3 t3_; + }; + + template + inline bool is_sf4ext_node(const expression_node* n) + { + switch (n->type()) + { + case expression_node::e_vovovov : return true; + case expression_node::e_vovovoc : return true; + case expression_node::e_vovocov : return true; + case expression_node::e_vocovov : return true; + case expression_node::e_covovov : return true; + case expression_node::e_covocov : return true; + case expression_node::e_vocovoc : return true; + case expression_node::e_covovoc : return true; + case expression_node::e_vococov : return true; + default : return false; + } + } + + template + struct T0oT1_define + { + typedef details::T0oT1 type0; + }; + + template + struct T0oT1oT2_define + { + typedef details::T0oT1oT2::mode0> type0; + typedef details::T0oT1oT2::mode1> type1; + typedef details::T0oT1oT2_sf3 sf3_type; + typedef details::sf3ext_type_node sf3_type_node; + }; + + template + struct T0oT1oT2oT3_define + { + typedef details::T0oT1oT2oT3::mode0> type0; + typedef details::T0oT1oT2oT3::mode1> type1; + typedef details::T0oT1oT2oT3::mode2> type2; + typedef details::T0oT1oT2oT3::mode3> type3; + typedef details::T0oT1oT2oT3::mode4> type4; + typedef details::T0oT1oT2oT3_sf4 sf4_type; + }; + + template + class vov_node exprtk_final : public vov_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef Operation operation_t; + + // variable op variable node + explicit vov_node(const T& var0, const T& var1) + : v0_(var0) + , v1_(var1) + {} + + inline T value() const exprtk_override + { + return Operation::process(v0_,v1_); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return Operation::type(); + } + + inline operator_type operation() const exprtk_override + { + return Operation::operation(); + } + + inline const T& v0() const exprtk_override + { + return v0_; + } + + inline const T& v1() const exprtk_override + { + return v1_; + } + + protected: + + const T& v0_; + const T& v1_; + + private: + + vov_node(const vov_node&) exprtk_delete; + vov_node& operator=(const vov_node&) exprtk_delete; + }; + + template + class cov_node exprtk_final : public cov_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef Operation operation_t; + + // constant op variable node + explicit cov_node(const T& const_var, const T& var) + : c_(const_var) + , v_(var) + {} + + inline T value() const exprtk_override + { + return Operation::process(c_,v_); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return Operation::type(); + } + + inline operator_type operation() const exprtk_override + { + return Operation::operation(); + } + + inline const T c() const exprtk_override + { + return c_; + } + + inline const T& v() const exprtk_override + { + return v_; + } + + protected: + + const T c_; + const T& v_; + + private: + + cov_node(const cov_node&) exprtk_delete; + cov_node& operator=(const cov_node&) exprtk_delete; + }; + + template + class voc_node exprtk_final : public voc_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef Operation operation_t; + + // variable op constant node + explicit voc_node(const T& var, const T& const_var) + : v_(var) + , c_(const_var) + {} + + inline T value() const exprtk_override + { + return Operation::process(v_,c_); + } + + inline operator_type operation() const exprtk_override + { + return Operation::operation(); + } + + inline const T c() const exprtk_override + { + return c_; + } + + inline const T& v() const exprtk_override + { + return v_; + } + + protected: + + const T& v_; + const T c_; + + private: + + voc_node(const voc_node&) exprtk_delete; + voc_node& operator=(const voc_node&) exprtk_delete; + }; + + template + class vob_node exprtk_final : public vob_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + typedef Operation operation_t; + + // variable op constant node + explicit vob_node(const T& var, const expression_ptr branch) + : v_(var) + { + construct_branch_pair(branch_, branch); + } + + inline T value() const exprtk_override + { + assert(branch_.first); + return Operation::process(v_,branch_.first->value()); + } + + inline const T& v() const exprtk_override + { + return v_; + } + + inline expression_node* branch(const std::size_t&) const exprtk_override + { + return branch_.first; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::template collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(branch_); + } + + private: + + vob_node(const vob_node&) exprtk_delete; + vob_node& operator=(const vob_node&) exprtk_delete; + + const T& v_; + branch_t branch_; + }; + + template + class bov_node exprtk_final : public bov_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + typedef Operation operation_t; + + // variable op constant node + explicit bov_node(const expression_ptr branch, const T& var) + : v_(var) + { + construct_branch_pair(branch_, branch); + } + + inline T value() const exprtk_override + { + assert(branch_.first); + return Operation::process(branch_.first->value(),v_); + } + + inline const T& v() const exprtk_override + { + return v_; + } + + inline expression_node* branch(const std::size_t&) const exprtk_override + { + return branch_.first; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::template collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(branch_); + } + + private: + + bov_node(const bov_node&) exprtk_delete; + bov_node& operator=(const bov_node&) exprtk_delete; + + const T& v_; + branch_t branch_; + }; + + template + class cob_node exprtk_final : public cob_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + typedef Operation operation_t; + + // variable op constant node + explicit cob_node(const T const_var, const expression_ptr branch) + : c_(const_var) + { + construct_branch_pair(branch_, branch); + } + + inline T value() const exprtk_override + { + assert(branch_.first); + return Operation::process(c_,branch_.first->value()); + } + + inline operator_type operation() const exprtk_override + { + return Operation::operation(); + } + + inline const T c() const exprtk_override + { + return c_; + } + + inline void set_c(const T new_c) exprtk_override + { + (*const_cast(&c_)) = new_c; + } + + inline expression_node* branch(const std::size_t&) const exprtk_override + { + return branch_.first; + } + + inline expression_node* move_branch(const std::size_t&) exprtk_override + { + branch_.second = false; + return branch_.first; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::template collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(branch_); + } + + private: + + cob_node(const cob_node&) exprtk_delete; + cob_node& operator=(const cob_node&) exprtk_delete; + + const T c_; + branch_t branch_; + }; + + template + class boc_node exprtk_final : public boc_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + typedef Operation operation_t; + + // variable op constant node + explicit boc_node(const expression_ptr branch, const T const_var) + : c_(const_var) + { + construct_branch_pair(branch_, branch); + } + + inline T value() const exprtk_override + { + assert(branch_.first); + return Operation::process(branch_.first->value(),c_); + } + + inline operator_type operation() const exprtk_override + { + return Operation::operation(); + } + + inline const T c() const exprtk_override + { + return c_; + } + + inline void set_c(const T new_c) exprtk_override + { + (*const_cast(&c_)) = new_c; + } + + inline expression_node* branch(const std::size_t&) const exprtk_override + { + return branch_.first; + } + + inline expression_node* move_branch(const std::size_t&) exprtk_override + { + branch_.second = false; + return branch_.first; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::template collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(branch_); + } + + private: + + boc_node(const boc_node&) exprtk_delete; + boc_node& operator=(const boc_node&) exprtk_delete; + + const T c_; + branch_t branch_; + }; + + #ifndef exprtk_disable_string_capabilities + template + class sos_node exprtk_final : public sos_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef Operation operation_t; + + // string op string node + explicit sos_node(SType0 p0, SType1 p1) + : s0_(p0) + , s1_(p1) + {} + + inline T value() const exprtk_override + { + return Operation::process(s0_,s1_); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return Operation::type(); + } + + inline operator_type operation() const exprtk_override + { + return Operation::operation(); + } + + inline std::string& s0() + { + return s0_; + } + + inline std::string& s1() + { + return s1_; + } + + protected: + + SType0 s0_; + SType1 s1_; + + private: + + sos_node(const sos_node&) exprtk_delete; + sos_node& operator=(const sos_node&) exprtk_delete; + }; + + template + class str_xrox_node exprtk_final : public sos_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef Operation operation_t; + typedef str_xrox_node node_type; + + // string-range op string node + explicit str_xrox_node(SType0 p0, SType1 p1, RangePack rp0) + : s0_ (p0 ) + , s1_ (p1 ) + , rp0_(rp0) + {} + + ~str_xrox_node() + { + rp0_.free(); + } + + inline T value() const exprtk_override + { + std::size_t r0 = 0; + std::size_t r1 = 0; + + if (rp0_(r0, r1, s0_.size())) + return Operation::process(s0_.substr(r0, (r1 - r0) + 1), s1_); + else + return T(0); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return Operation::type(); + } + + inline operator_type operation() const exprtk_override + { + return Operation::operation(); + } + + inline std::string& s0() + { + return s0_; + } + + inline std::string& s1() + { + return s1_; + } + + protected: + + SType0 s0_; + SType1 s1_; + RangePack rp0_; + + private: + + str_xrox_node(const node_type&) exprtk_delete; + node_type& operator=(const node_type&) exprtk_delete; + }; + + template + class str_xoxr_node exprtk_final : public sos_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef Operation operation_t; + typedef str_xoxr_node node_type; + + // string op string range node + explicit str_xoxr_node(SType0 p0, SType1 p1, RangePack rp1) + : s0_ (p0 ) + , s1_ (p1 ) + , rp1_(rp1) + {} + + ~str_xoxr_node() + { + rp1_.free(); + } + + inline T value() const exprtk_override + { + std::size_t r0 = 0; + std::size_t r1 = 0; + + if (rp1_(r0, r1, s1_.size())) + return Operation::process(s0_, s1_.substr(r0, (r1 - r0) + 1)); + else + return T(0); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return Operation::type(); + } + + inline operator_type operation() const exprtk_override + { + return Operation::operation(); + } + + inline std::string& s0() + { + return s0_; + } + + inline std::string& s1() + { + return s1_; + } + + protected: + + SType0 s0_; + SType1 s1_; + RangePack rp1_; + + private: + + str_xoxr_node(const node_type&) exprtk_delete; + node_type& operator=(const node_type&) exprtk_delete; + }; + + template + class str_xroxr_node exprtk_final : public sos_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef Operation operation_t; + typedef str_xroxr_node node_type; + + // string-range op string-range node + explicit str_xroxr_node(SType0 p0, SType1 p1, RangePack rp0, RangePack rp1) + : s0_ (p0 ) + , s1_ (p1 ) + , rp0_(rp0) + , rp1_(rp1) + {} + + ~str_xroxr_node() + { + rp0_.free(); + rp1_.free(); + } + + inline T value() const exprtk_override + { + std::size_t r0_0 = 0; + std::size_t r0_1 = 0; + std::size_t r1_0 = 0; + std::size_t r1_1 = 0; + + if ( + rp0_(r0_0, r1_0, s0_.size()) && + rp1_(r0_1, r1_1, s1_.size()) + ) + { + return Operation::process( + s0_.substr(r0_0, (r1_0 - r0_0) + 1), + s1_.substr(r0_1, (r1_1 - r0_1) + 1) + ); + } + else + return T(0); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return Operation::type(); + } + + inline operator_type operation() const exprtk_override + { + return Operation::operation(); + } + + inline std::string& s0() + { + return s0_; + } + + inline std::string& s1() + { + return s1_; + } + + protected: + + SType0 s0_; + SType1 s1_; + RangePack rp0_; + RangePack rp1_; + + private: + + str_xroxr_node(const node_type&) exprtk_delete; + node_type& operator=(const node_type&) exprtk_delete; + }; + + template + class str_sogens_node exprtk_final : public binary_node + { + public: + + typedef expression_node * expression_ptr; + typedef string_base_node* str_base_ptr; + typedef range_pack range_t; + typedef range_t* range_ptr; + typedef range_interface irange_t; + typedef irange_t* irange_ptr; + + using binary_node::branch; + + str_sogens_node(const operator_type& opr, + expression_ptr branch0, + expression_ptr branch1) + : binary_node(opr, branch0, branch1) + , str0_base_ptr_ (0) + , str1_base_ptr_ (0) + , str0_range_ptr_(0) + , str1_range_ptr_(0) + { + if (is_generally_string_node(branch(0))) + { + str0_base_ptr_ = dynamic_cast(branch(0)); + + if (0 == str0_base_ptr_) + return; + + irange_ptr range = dynamic_cast(branch(0)); + + if (0 == range) + return; + + str0_range_ptr_ = &(range->range_ref()); + } + + if (is_generally_string_node(branch(1))) + { + str1_base_ptr_ = dynamic_cast(branch(1)); + + if (0 == str1_base_ptr_) + return; + + irange_ptr range = dynamic_cast(branch(1)); + + if (0 == range) + return; + + str1_range_ptr_ = &(range->range_ref()); + } + } + + inline T value() const exprtk_override + { + if ( + str0_base_ptr_ && + str1_base_ptr_ && + str0_range_ptr_ && + str1_range_ptr_ + ) + { + branch(0)->value(); + branch(1)->value(); + + std::size_t str0_r0 = 0; + std::size_t str0_r1 = 0; + + std::size_t str1_r0 = 0; + std::size_t str1_r1 = 0; + + const range_t& range0 = (*str0_range_ptr_); + const range_t& range1 = (*str1_range_ptr_); + + if ( + range0(str0_r0, str0_r1, str0_base_ptr_->size()) && + range1(str1_r0, str1_r1, str1_base_ptr_->size()) + ) + { + return Operation::process( + str0_base_ptr_->str().substr(str0_r0,(str0_r1 - str0_r0) + 1), + str1_base_ptr_->str().substr(str1_r0,(str1_r1 - str1_r0) + 1) + ); + } + } + + return std::numeric_limits::quiet_NaN(); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return Operation::type(); + } + + private: + + str_sogens_node(const str_sogens_node&) exprtk_delete; + str_sogens_node& operator=(const str_sogens_node&) exprtk_delete; + + str_base_ptr str0_base_ptr_; + str_base_ptr str1_base_ptr_; + range_ptr str0_range_ptr_; + range_ptr str1_range_ptr_; + }; + + template + class sosos_node exprtk_final : public sosos_base_node + { + public: + + typedef expression_node* expression_ptr; + typedef Operation operation_t; + typedef sosos_node node_type; + + // variable op variable node + explicit sosos_node(SType0 p0, SType1 p1, SType2 p2) + : s0_(p0) + , s1_(p1) + , s2_(p2) + {} + + inline T value() const exprtk_override + { + return Operation::process(s0_, s1_, s2_); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return Operation::type(); + } + + inline operator_type operation() const exprtk_override + { + return Operation::operation(); + } + + inline std::string& s0() + { + return s0_; + } + + inline std::string& s1() + { + return s1_; + } + + inline std::string& s2() + { + return s2_; + } + + protected: + + SType0 s0_; + SType1 s1_; + SType2 s2_; + + private: + + sosos_node(const node_type&) exprtk_delete; + node_type& operator=(const node_type&) exprtk_delete; + }; + #endif + + template + class ipow_node exprtk_final: public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef PowOp operation_t; + + explicit ipow_node(const T& v) + : v_(v) + {} + + inline T value() const exprtk_override + { + return PowOp::result(v_); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_ipow; + } + + private: + + ipow_node(const ipow_node&) exprtk_delete; + ipow_node& operator=(const ipow_node&) exprtk_delete; + + const T& v_; + }; + + template + class bipow_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + typedef PowOp operation_t; + + explicit bipow_node(expression_ptr branch) + { + construct_branch_pair(branch_, branch); + } + + inline T value() const exprtk_override + { + assert(branch_.first); + return PowOp::result(branch_.first->value()); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_ipow; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(branch_); + } + + private: + + bipow_node(const bipow_node&) exprtk_delete; + bipow_node& operator=(const bipow_node&) exprtk_delete; + + branch_t branch_; + }; + + template + class ipowinv_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef PowOp operation_t; + + explicit ipowinv_node(const T& v) + : v_(v) + {} + + inline T value() const exprtk_override + { + return (T(1) / PowOp::result(v_)); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_ipowinv; + } + + private: + + ipowinv_node(const ipowinv_node&) exprtk_delete; + ipowinv_node& operator=(const ipowinv_node&) exprtk_delete; + + const T& v_; + }; + + template + class bipowninv_node exprtk_final : public expression_node + { + public: + + typedef expression_node* expression_ptr; + typedef std::pair branch_t; + typedef PowOp operation_t; + + explicit bipowninv_node(expression_ptr branch) + { + construct_branch_pair(branch_, branch); + } + + inline T value() const exprtk_override + { + assert(branch_.first); + return (T(1) / PowOp::result(branch_.first->value())); + } + + inline typename expression_node::node_type type() const exprtk_override + { + return expression_node::e_ipowinv; + } + + void collect_nodes(typename expression_node::noderef_list_t& node_delete_list) exprtk_override + { + expression_node::ndb_t::template collect(branch_, node_delete_list); + } + + std::size_t node_depth() const exprtk_override + { + return expression_node::ndb_t::compute_node_depth(branch_); + } + + private: + + bipowninv_node(const bipowninv_node&) exprtk_delete; + bipowninv_node& operator=(const bipowninv_node&) exprtk_delete; + + branch_t branch_; + }; + + template + inline bool is_vov_node(const expression_node* node) + { + return (0 != dynamic_cast*>(node)); + } + + template + inline bool is_cov_node(const expression_node* node) + { + return (0 != dynamic_cast*>(node)); + } + + template + inline bool is_voc_node(const expression_node* node) + { + return (0 != dynamic_cast*>(node)); + } + + template + inline bool is_cob_node(const expression_node* node) + { + return (0 != dynamic_cast*>(node)); + } + + template + inline bool is_boc_node(const expression_node* node) + { + return (0 != dynamic_cast*>(node)); + } + + template + inline bool is_t0ot1ot2_node(const expression_node* node) + { + return (0 != dynamic_cast*>(node)); + } + + template + inline bool is_t0ot1ot2ot3_node(const expression_node* node) + { + return (0 != dynamic_cast*>(node)); + } + + template + inline bool is_uv_node(const expression_node* node) + { + return (0 != dynamic_cast*>(node)); + } + + template + inline bool is_string_node(const expression_node* node) + { + return node && (expression_node::e_stringvar == node->type()); + } + + template + inline bool is_string_range_node(const expression_node* node) + { + return node && (expression_node::e_stringvarrng == node->type()); + } + + template + inline bool is_const_string_node(const expression_node* node) + { + return node && (expression_node::e_stringconst == node->type()); + } + + template + inline bool is_const_string_range_node(const expression_node* node) + { + return node && (expression_node::e_cstringvarrng == node->type()); + } + + template + inline bool is_string_assignment_node(const expression_node* node) + { + return node && (expression_node::e_strass == node->type()); + } + + template + inline bool is_string_concat_node(const expression_node* node) + { + return node && (expression_node::e_strconcat == node->type()); + } + + template + inline bool is_string_function_node(const expression_node* node) + { + return node && (expression_node::e_strfunction == node->type()); + } + + template + inline bool is_string_condition_node(const expression_node* node) + { + return node && (expression_node::e_strcondition == node->type()); + } + + template + inline bool is_string_ccondition_node(const expression_node* node) + { + return node && (expression_node::e_strccondition == node->type()); + } + + template + inline bool is_string_vararg_node(const expression_node* node) + { + return node && (expression_node::e_stringvararg == node->type()); + } + + template + inline bool is_genricstring_range_node(const expression_node* node) + { + return node && (expression_node::e_strgenrange == node->type()); + } + + template + inline bool is_generally_string_node(const expression_node* node) + { + if (node) + { + switch (node->type()) + { + case expression_node::e_stringvar : + case expression_node::e_stringconst : + case expression_node::e_stringvarrng : + case expression_node::e_cstringvarrng : + case expression_node::e_strgenrange : + case expression_node::e_strass : + case expression_node::e_strconcat : + case expression_node::e_strfunction : + case expression_node::e_strcondition : + case expression_node::e_strccondition : + case expression_node::e_stringvararg : return true; + default : return false; + } + } + + return false; + } + + class node_allocator + { + public: + + template + inline expression_node* allocate(OpType& operation, ExprNode (&branch)[1]) + { + expression_node* result = + allocate(operation, branch[0]); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(OpType& operation, ExprNode (&branch)[2]) + { + expression_node* result = + allocate(operation, branch[0], branch[1]); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(OpType& operation, ExprNode (&branch)[3]) + { + expression_node* result = + allocate(operation, branch[0], branch[1], branch[2]); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(OpType& operation, ExprNode (&branch)[4]) + { + expression_node* result = + allocate(operation, branch[0], branch[1], branch[2], branch[3]); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(OpType& operation, ExprNode (&branch)[5]) + { + expression_node* result = + allocate(operation, branch[0],branch[1], branch[2], branch[3], branch[4]); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(OpType& operation, ExprNode (&branch)[6]) + { + expression_node* result = + allocate(operation, branch[0], branch[1], branch[2], branch[3], branch[4], branch[5]); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate() const + { + return (new node_type()); + } + + template class Sequence> + inline expression_node* allocate(const Sequence& seq) const + { + expression_node* + result = (new node_type(seq)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(T1& t1) const + { + expression_node* + result = (new node_type(t1)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_c(const T1& t1) const + { + expression_node* + result = (new node_type(t1)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(const T1& t1, const T2& t2) const + { + expression_node* + result = (new node_type(t1, t2)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_cr(const T1& t1, T2& t2) const + { + expression_node* + result = (new node_type(t1, t2)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_rc(T1& t1, const T2& t2) const + { + expression_node* + result = (new node_type(t1, t2)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_rr(T1& t1, T2& t2) const + { + expression_node* + result = (new node_type(t1, t2)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_tt(T1 t1, T2 t2) const + { + expression_node* + result = (new node_type(t1, t2)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_ttt(T1 t1, T2 t2, T3 t3) const + { + expression_node* + result = (new node_type(t1, t2, t3)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_tttt(T1 t1, T2 t2, T3 t3, T4 t4) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_rrr(T1& t1, T2& t2, T3& t3) const + { + expression_node* + result = (new node_type(t1, t2, t3)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_rrrr(T1& t1, T2& t2, T3& t3, T4& t4) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_rrrrr(T1& t1, T2& t2, T3& t3, T4& t4, T5& t5) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4, t5)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(const T1& t1, const T2& t2, + const T3& t3) const + { + expression_node* + result = (new node_type(t1, t2, t3)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(const T1& t1, const T2& t2, + const T3& t3, const T4& t4) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(const T1& t1, const T2& t2, + const T3& t3, const T4& t4, + const T5& t5) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4, t5)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(const T1& t1, const T2& t2, + const T3& t3, const T4& t4, + const T5& t5, const T6& t6) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4, t5, t6)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(const T1& t1, const T2& t2, + const T3& t3, const T4& t4, + const T5& t5, const T6& t6, + const T7& t7) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4, t5, t6, t7)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(const T1& t1, const T2& t2, + const T3& t3, const T4& t4, + const T5& t5, const T6& t6, + const T7& t7, const T8& t8) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4, t5, t6, t7, t8)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(const T1& t1, const T2& t2, + const T3& t3, const T4& t4, + const T5& t5, const T6& t6, + const T7& t7, const T8& t8, + const T9& t9) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4, t5, t6, t7, t8, t9)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate(const T1& t1, const T2& t2, + const T3& t3, const T4& t4, + const T5& t5, const T6& t6, + const T7& t7, const T8& t8, + const T9& t9, const T10& t10) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4, t5, t6, t7, t8, t9, t10)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_type(T1 t1, T2 t2, T3 t3) const + { + expression_node* + result = (new node_type(t1, t2, t3)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_type(T1 t1, T2 t2, + T3 t3, T4 t4) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_type(T1 t1, T2 t2, + T3 t3, T4 t4, + T5 t5) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4, t5)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_type(T1 t1, T2 t2, + T3 t3, T4 t4, + T5 t5, T6 t6) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4, t5, t6)); + result->node_depth(); + return result; + } + + template + inline expression_node* allocate_type(T1 t1, T2 t2, + T3 t3, T4 t4, + T5 t5, T6 t6, + T7 t7) const + { + expression_node* + result = (new node_type(t1, t2, t3, t4, t5, t6, t7)); + result->node_depth(); + return result; + } + + template + void inline free(expression_node*& e) const + { + exprtk_debug(("node_allocator::free() - deleting expression_node " + "type: %03d addr: %p\n", + static_cast(e->type()), + reinterpret_cast(e))); + delete e; + e = 0; + } + }; + + inline void load_operations_map(std::multimap& m) + { + #define register_op(Symbol, Type, Args) \ + m.insert(std::make_pair(std::string(Symbol),details::base_operation_t(Type,Args))); \ + + register_op("abs" , e_abs , 1) + register_op("acos" , e_acos , 1) + register_op("acosh" , e_acosh , 1) + register_op("asin" , e_asin , 1) + register_op("asinh" , e_asinh , 1) + register_op("atan" , e_atan , 1) + register_op("atanh" , e_atanh , 1) + register_op("ceil" , e_ceil , 1) + register_op("cos" , e_cos , 1) + register_op("cosh" , e_cosh , 1) + register_op("exp" , e_exp , 1) + register_op("expm1" , e_expm1 , 1) + register_op("floor" , e_floor , 1) + register_op("log" , e_log , 1) + register_op("log10" , e_log10 , 1) + register_op("log2" , e_log2 , 1) + register_op("log1p" , e_log1p , 1) + register_op("round" , e_round , 1) + register_op("sin" , e_sin , 1) + register_op("sinc" , e_sinc , 1) + register_op("sinh" , e_sinh , 1) + register_op("sec" , e_sec , 1) + register_op("csc" , e_csc , 1) + register_op("sqrt" , e_sqrt , 1) + register_op("tan" , e_tan , 1) + register_op("tanh" , e_tanh , 1) + register_op("cot" , e_cot , 1) + register_op("rad2deg" , e_r2d , 1) + register_op("deg2rad" , e_d2r , 1) + register_op("deg2grad" , e_d2g , 1) + register_op("grad2deg" , e_g2d , 1) + register_op("sgn" , e_sgn , 1) + register_op("not" , e_notl , 1) + register_op("erf" , e_erf , 1) + register_op("erfc" , e_erfc , 1) + register_op("ncdf" , e_ncdf , 1) + register_op("frac" , e_frac , 1) + register_op("trunc" , e_trunc , 1) + register_op("atan2" , e_atan2 , 2) + register_op("mod" , e_mod , 2) + register_op("logn" , e_logn , 2) + register_op("pow" , e_pow , 2) + register_op("root" , e_root , 2) + register_op("roundn" , e_roundn , 2) + register_op("equal" , e_equal , 2) + register_op("not_equal" , e_nequal , 2) + register_op("hypot" , e_hypot , 2) + register_op("shr" , e_shr , 2) + register_op("shl" , e_shl , 2) + register_op("clamp" , e_clamp , 3) + register_op("iclamp" , e_iclamp , 3) + register_op("inrange" , e_inrange , 3) + #undef register_op + } + + } // namespace details + + class function_traits + { + public: + + function_traits() + : allow_zero_parameters_(false) + , has_side_effects_(true) + , min_num_args_(0) + , max_num_args_(std::numeric_limits::max()) + {} + + inline bool& allow_zero_parameters() + { + return allow_zero_parameters_; + } + + inline bool& has_side_effects() + { + return has_side_effects_; + } + + std::size_t& min_num_args() + { + return min_num_args_; + } + + std::size_t& max_num_args() + { + return max_num_args_; + } + + private: + + bool allow_zero_parameters_; + bool has_side_effects_; + std::size_t min_num_args_; + std::size_t max_num_args_; + }; + + template + void enable_zero_parameters(FunctionType& func) + { + func.allow_zero_parameters() = true; + + if (0 != func.min_num_args()) + { + func.min_num_args() = 0; + } + } + + template + void disable_zero_parameters(FunctionType& func) + { + func.allow_zero_parameters() = false; + } + + template + void enable_has_side_effects(FunctionType& func) + { + func.has_side_effects() = true; + } + + template + void disable_has_side_effects(FunctionType& func) + { + func.has_side_effects() = false; + } + + template + void set_min_num_args(FunctionType& func, const std::size_t& num_args) + { + func.min_num_args() = num_args; + + if ((0 != func.min_num_args()) && func.allow_zero_parameters()) + func.allow_zero_parameters() = false; + } + + template + void set_max_num_args(FunctionType& func, const std::size_t& num_args) + { + func.max_num_args() = num_args; + } + + template + class ifunction : public function_traits + { + public: + + explicit ifunction(const std::size_t& pc) + : param_count(pc) + {} + + virtual ~ifunction() {} + + #define empty_method_body(N) \ + { \ + exprtk_debug(("ifunction::operator() - Operator(" #N ") has not been overridden\n")); \ + return std::numeric_limits::quiet_NaN(); \ + } \ + + inline virtual T operator() () + empty_method_body(0) + + inline virtual T operator() (const T&) + empty_method_body(1) + + inline virtual T operator() (const T&,const T&) + empty_method_body(2) + + inline virtual T operator() (const T&, const T&, const T&) + empty_method_body(3) + + inline virtual T operator() (const T&, const T&, const T&, const T&) + empty_method_body(4) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&) + empty_method_body(5) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&) + empty_method_body(6) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&) + empty_method_body(7) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&) + empty_method_body(8) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&) + empty_method_body(9) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&) + empty_method_body(10) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, + const T&) + empty_method_body(11) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, + const T&, const T&) + empty_method_body(12) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, + const T&, const T&, const T&) + empty_method_body(13) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, + const T&, const T&, const T&, const T&) + empty_method_body(14) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, + const T&, const T&, const T&, const T&, const T&) + empty_method_body(15) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, + const T&, const T&, const T&, const T&, const T&, const T&) + empty_method_body(16) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, + const T&, const T&, const T&, const T&, const T&, const T&, const T&) + empty_method_body(17) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, + const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&) + empty_method_body(18) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, + const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&) + empty_method_body(19) + + inline virtual T operator() (const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, + const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&, const T&) + empty_method_body(20) + + #undef empty_method_body + + std::size_t param_count; + }; + + template + class ivararg_function : public function_traits + { + public: + + virtual ~ivararg_function() {} + + inline virtual T operator() (const std::vector&) + { + exprtk_debug(("ivararg_function::operator() - Operator has not been overridden\n")); + return std::numeric_limits::quiet_NaN(); + } + }; + + template + class igeneric_function : public function_traits + { + public: + + enum return_type + { + e_rtrn_scalar = 0, + e_rtrn_string = 1, + e_rtrn_overload = 2 + }; + + typedef T type; + typedef type_store generic_type; + typedef typename generic_type::parameter_list parameter_list_t; + + igeneric_function(const std::string& param_seq = "", const return_type rtr_type = e_rtrn_scalar) + : parameter_sequence(param_seq) + , rtrn_type(rtr_type) + {} + + virtual ~igeneric_function() {} + + #define igeneric_function_empty_body(N) \ + { \ + exprtk_debug(("igeneric_function::operator() - Operator(" #N ") has not been overridden\n")); \ + return std::numeric_limits::quiet_NaN(); \ + } \ + + // f(i_0,i_1,....,i_N) --> Scalar + inline virtual T operator() (parameter_list_t) + igeneric_function_empty_body(1) + + // f(i_0,i_1,....,i_N) --> String + inline virtual T operator() (std::string&, parameter_list_t) + igeneric_function_empty_body(2) + + // f(psi,i_0,i_1,....,i_N) --> Scalar + inline virtual T operator() (const std::size_t&, parameter_list_t) + igeneric_function_empty_body(3) + + // f(psi,i_0,i_1,....,i_N) --> String + inline virtual T operator() (const std::size_t&, std::string&, parameter_list_t) + igeneric_function_empty_body(4) + + std::string parameter_sequence; + return_type rtrn_type; + }; + + #ifndef exprtk_disable_string_capabilities + template + class stringvar_base + { + public: + + typedef typename details::stringvar_node stringvar_node_t; + + stringvar_base(const std::string& name, stringvar_node_t* svn) + : name_(name) + , string_varnode_(svn) + {} + + bool valid() const + { + return !name_.empty() && (0 != string_varnode_); + } + + std::string name() const + { + assert(string_varnode_); + return name_; + } + + void rebase(std::string& s) + { + assert(string_varnode_); + string_varnode_->rebase(s); + } + + private: + + std::string name_; + stringvar_node_t* string_varnode_; + }; + #endif + + template class parser; + template class expression_helper; + + template + class symbol_table + { + public: + + enum symtab_mutability_type + { + e_unknown = 0, + e_mutable = 1, + e_immutable = 2 + }; + + typedef T (*ff00_functor)(); + typedef T (*ff01_functor)(T); + typedef T (*ff02_functor)(T, T); + typedef T (*ff03_functor)(T, T, T); + typedef T (*ff04_functor)(T, T, T, T); + typedef T (*ff05_functor)(T, T, T, T, T); + typedef T (*ff06_functor)(T, T, T, T, T, T); + typedef T (*ff07_functor)(T, T, T, T, T, T, T); + typedef T (*ff08_functor)(T, T, T, T, T, T, T, T); + typedef T (*ff09_functor)(T, T, T, T, T, T, T, T, T); + typedef T (*ff10_functor)(T, T, T, T, T, T, T, T, T, T); + typedef T (*ff11_functor)(T, T, T, T, T, T, T, T, T, T, T); + typedef T (*ff12_functor)(T, T, T, T, T, T, T, T, T, T, T, T); + typedef T (*ff13_functor)(T, T, T, T, T, T, T, T, T, T, T, T, T); + typedef T (*ff14_functor)(T, T, T, T, T, T, T, T, T, T, T, T, T, T); + typedef T (*ff15_functor)(T, T, T, T, T, T, T, T, T, T, T, T, T, T, T); + + protected: + + struct freefunc00 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc00(ff00_functor ff) : exprtk::ifunction(0), f(ff) {} + inline T operator() () + { return f(); } + ff00_functor f; + }; + + struct freefunc01 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc01(ff01_functor ff) : exprtk::ifunction(1), f(ff) {} + inline T operator() (const T& v0) + { return f(v0); } + ff01_functor f; + }; + + struct freefunc02 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc02(ff02_functor ff) : exprtk::ifunction(2), f(ff) {} + inline T operator() (const T& v0, const T& v1) + { return f(v0, v1); } + ff02_functor f; + }; + + struct freefunc03 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc03(ff03_functor ff) : exprtk::ifunction(3), f(ff) {} + inline T operator() (const T& v0, const T& v1, const T& v2) + { return f(v0, v1, v2); } + ff03_functor f; + }; + + struct freefunc04 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc04(ff04_functor ff) : exprtk::ifunction(4), f(ff) {} + inline T operator() (const T& v0, const T& v1, const T& v2, const T& v3) + { return f(v0, v1, v2, v3); } + ff04_functor f; + }; + + struct freefunc05 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc05(ff05_functor ff) : exprtk::ifunction(5), f(ff) {} + inline T operator() (const T& v0, const T& v1, const T& v2, const T& v3, const T& v4) + { return f(v0, v1, v2, v3, v4); } + ff05_functor f; + }; + + struct freefunc06 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc06(ff06_functor ff) : exprtk::ifunction(6), f(ff) {} + inline T operator() (const T& v0, const T& v1, const T& v2, const T& v3, const T& v4, const T& v5) + { return f(v0, v1, v2, v3, v4, v5); } + ff06_functor f; + }; + + struct freefunc07 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc07(ff07_functor ff) : exprtk::ifunction(7), f(ff) {} + inline T operator() (const T& v0, const T& v1, const T& v2, const T& v3, const T& v4, + const T& v5, const T& v6) + { return f(v0, v1, v2, v3, v4, v5, v6); } + ff07_functor f; + }; + + struct freefunc08 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc08(ff08_functor ff) : exprtk::ifunction(8), f(ff) {} + inline T operator() (const T& v0, const T& v1, const T& v2, const T& v3, const T& v4, + const T& v5, const T& v6, const T& v7) + { return f(v0, v1, v2, v3, v4, v5, v6, v7); } + ff08_functor f; + }; + + struct freefunc09 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc09(ff09_functor ff) : exprtk::ifunction(9), f(ff) {} + inline T operator() (const T& v0, const T& v1, const T& v2, const T& v3, const T& v4, + const T& v5, const T& v6, const T& v7, const T& v8) + { return f(v0, v1, v2, v3, v4, v5, v6, v7, v8); } + ff09_functor f; + }; + + struct freefunc10 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc10(ff10_functor ff) : exprtk::ifunction(10), f(ff) {} + inline T operator() (const T& v0, const T& v1, const T& v2, const T& v3, const T& v4, + const T& v5, const T& v6, const T& v7, const T& v8, const T& v9) + { return f(v0, v1, v2, v3, v4, v5, v6, v7, v8, v9); } + ff10_functor f; + }; + + struct freefunc11 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc11(ff11_functor ff) : exprtk::ifunction(11), f(ff) {} + inline T operator() (const T& v0, const T& v1, const T& v2, const T& v3, const T& v4, + const T& v5, const T& v6, const T& v7, const T& v8, const T& v9, const T& v10) + { return f(v0, v1, v2, v3, v4, v5, v6, v7, v8, v9, v10); } + ff11_functor f; + }; + + struct freefunc12 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc12(ff12_functor ff) : exprtk::ifunction(12), f(ff) {} + inline T operator() (const T& v00, const T& v01, const T& v02, const T& v03, const T& v04, + const T& v05, const T& v06, const T& v07, const T& v08, const T& v09, + const T& v10, const T& v11) + { return f(v00, v01, v02, v03, v04, v05, v06, v07, v08, v09, v10, v11); } + ff12_functor f; + }; + + struct freefunc13 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc13(ff13_functor ff) : exprtk::ifunction(13), f(ff) {} + inline T operator() (const T& v00, const T& v01, const T& v02, const T& v03, const T& v04, + const T& v05, const T& v06, const T& v07, const T& v08, const T& v09, + const T& v10, const T& v11, const T& v12) + { return f(v00, v01, v02, v03, v04, v05, v06, v07, v08, v09, v10, v11, v12); } + ff13_functor f; + }; + + struct freefunc14 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc14(ff14_functor ff) : exprtk::ifunction(14), f(ff) {} + inline T operator() (const T& v00, const T& v01, const T& v02, const T& v03, const T& v04, + const T& v05, const T& v06, const T& v07, const T& v08, const T& v09, + const T& v10, const T& v11, const T& v12, const T& v13) + { return f(v00, v01, v02, v03, v04, v05, v06, v07, v08, v09, v10, v11, v12, v13); } + ff14_functor f; + }; + + struct freefunc15 : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + explicit freefunc15(ff15_functor ff) : exprtk::ifunction(15), f(ff) {} + inline T operator() (const T& v00, const T& v01, const T& v02, const T& v03, const T& v04, + const T& v05, const T& v06, const T& v07, const T& v08, const T& v09, + const T& v10, const T& v11, const T& v12, const T& v13, const T& v14) + { return f(v00, v01, v02, v03, v04, v05, v06, v07, v08, v09, v10, v11, v12, v13, v14); } + ff15_functor f; + }; + + template + struct type_store + { + typedef details::expression_node* expression_ptr; + typedef typename details::variable_node variable_node_t; + typedef ifunction ifunction_t; + typedef ivararg_function ivararg_function_t; + typedef igeneric_function igeneric_function_t; + typedef details::vector_holder vector_t; + #ifndef exprtk_disable_string_capabilities + typedef typename details::stringvar_node stringvar_node_t; + #endif + + typedef Type type_t; + typedef type_t* type_ptr; + typedef std::pair type_pair_t; + typedef std::map type_map_t; + typedef typename type_map_t::iterator tm_itr_t; + typedef typename type_map_t::const_iterator tm_const_itr_t; + + enum { lut_size = 256 }; + + type_map_t map; + std::size_t size; + + type_store() + : size(0) + {} + + struct deleter + { + #define exprtk_define_process(Type) \ + static inline void process(std::pair& n) \ + { \ + delete n.second; \ + } \ + + exprtk_define_process(variable_node_t ) + exprtk_define_process(vector_t ) + #ifndef exprtk_disable_string_capabilities + exprtk_define_process(stringvar_node_t) + #endif + + #undef exprtk_define_process + + template + static inline void process(std::pair&) + {} + }; + + inline bool symbol_exists(const std::string& symbol_name) const + { + if (symbol_name.empty()) + return false; + else if (map.end() != map.find(symbol_name)) + return true; + else + return false; + } + + template + inline std::string entity_name(const PtrType& ptr) const + { + if (map.empty()) + return std::string(); + + tm_const_itr_t itr = map.begin(); + + while (map.end() != itr) + { + if (itr->second.second == ptr) + { + return itr->first; + } + else + ++itr; + } + + return std::string(); + } + + inline bool is_constant(const std::string& symbol_name) const + { + if (symbol_name.empty()) + return false; + else + { + const tm_const_itr_t itr = map.find(symbol_name); + + if (map.end() == itr) + return false; + else + return (*itr).second.first; + } + } + + template + inline bool add_impl(const std::string& symbol_name, RType t, const bool is_const) + { + if (symbol_name.size() > 1) + { + for (std::size_t i = 0; i < details::reserved_symbols_size; ++i) + { + if (details::imatch(symbol_name, details::reserved_symbols[i])) + { + return false; + } + } + } + + const tm_itr_t itr = map.find(symbol_name); + + if (map.end() == itr) + { + map[symbol_name] = Tie::make(t,is_const); + ++size; + } + + return true; + } + + struct tie_array + { + static inline std::pair make(std::pair v, const bool is_const = false) + { + return std::make_pair(is_const, new vector_t(v.first, v.second)); + } + }; + + struct tie_stdvec + { + template + static inline std::pair make(std::vector& v, const bool is_const = false) + { + return std::make_pair(is_const, new vector_t(v)); + } + }; + + struct tie_vecview + { + static inline std::pair make(exprtk::vector_view& v, const bool is_const = false) + { + return std::make_pair(is_const, new vector_t(v)); + } + }; + + struct tie_stddeq + { + template + static inline std::pair make(std::deque& v, const bool is_const = false) + { + return std::make_pair(is_const, new vector_t(v)); + } + }; + + template + inline bool add(const std::string& symbol_name, T (&v)[v_size], const bool is_const = false) + { + return add_impl > + (symbol_name, std::make_pair(v,v_size), is_const); + } + + inline bool add(const std::string& symbol_name, T* v, const std::size_t v_size, const bool is_const = false) + { + return add_impl > + (symbol_name, std::make_pair(v,v_size), is_const); + } + + template + inline bool add(const std::string& symbol_name, std::vector& v, const bool is_const = false) + { + return add_impl&> + (symbol_name, v, is_const); + } + + inline bool add(const std::string& symbol_name, exprtk::vector_view& v, const bool is_const = false) + { + return add_impl&> + (symbol_name, v, is_const); + } + + template + inline bool add(const std::string& symbol_name, std::deque& v, const bool is_const = false) + { + return add_impl&> + (symbol_name, v, is_const); + } + + inline bool add(const std::string& symbol_name, RawType& t_, const bool is_const = false) + { + struct tie + { + static inline std::pair make(T& t, const bool is_constant = false) + { + return std::make_pair(is_constant, new variable_node_t(t)); + } + + #ifndef exprtk_disable_string_capabilities + static inline std::pair make(std::string& t, const bool is_constant = false) + { + return std::make_pair(is_constant, new stringvar_node_t(t)); + } + #endif + + static inline std::pair make(function_t& t, const bool is_constant = false) + { + return std::make_pair(is_constant,&t); + } + + static inline std::pair make(vararg_function_t& t, const bool is_constant = false) + { + return std::make_pair(is_constant,&t); + } + + static inline std::pair make(generic_function_t& t, const bool is_constant = false) + { + return std::make_pair(is_constant,&t); + } + }; + + const tm_itr_t itr = map.find(symbol_name); + + if (map.end() == itr) + { + map[symbol_name] = tie::make(t_,is_const); + ++size; + } + + return true; + } + + inline type_ptr get(const std::string& symbol_name) const + { + const tm_const_itr_t itr = map.find(symbol_name); + + if (map.end() == itr) + return reinterpret_cast(0); + else + return itr->second.second; + } + + template + struct ptr_match + { + static inline bool test(const PtrType, const void*) + { + return false; + } + }; + + template + struct ptr_match + { + static inline bool test(const variable_node_t* p, const void* ptr) + { + exprtk_debug(("ptr_match::test() - %p <--> %p\n",(void*)(&(p->ref())),ptr)); + return (&(p->ref()) == ptr); + } + }; + + inline type_ptr get_from_varptr(const void* ptr) const + { + tm_const_itr_t itr = map.begin(); + + while (map.end() != itr) + { + type_ptr ret_ptr = itr->second.second; + + if (ptr_match::test(ret_ptr,ptr)) + { + return ret_ptr; + } + + ++itr; + } + + return type_ptr(0); + } + + inline bool remove(const std::string& symbol_name, const bool delete_node = true) + { + const tm_itr_t itr = map.find(symbol_name); + + if (map.end() != itr) + { + if (delete_node) + { + deleter::process((*itr).second); + } + + map.erase(itr); + --size; + + return true; + } + else + return false; + } + + inline RawType& type_ref(const std::string& symbol_name) + { + struct init_type + { + static inline double set(double) { return (0.0); } + static inline double set(long double) { return (0.0); } + static inline float set(float) { return (0.0f); } + static inline std::string set(std::string) { return std::string(""); } + }; + + static RawType null_type = init_type::set(RawType()); + + const tm_const_itr_t itr = map.find(symbol_name); + + if (map.end() == itr) + return null_type; + else + return itr->second.second->ref(); + } + + inline void clear(const bool delete_node = true) + { + if (!map.empty()) + { + if (delete_node) + { + tm_itr_t itr = map.begin(); + tm_itr_t end = map.end (); + + while (end != itr) + { + deleter::process((*itr).second); + ++itr; + } + } + + map.clear(); + } + + size = 0; + } + + template class Sequence> + inline std::size_t get_list(Sequence,Allocator>& list) const + { + std::size_t count = 0; + + if (!map.empty()) + { + tm_const_itr_t itr = map.begin(); + tm_const_itr_t end = map.end (); + + while (end != itr) + { + list.push_back(std::make_pair((*itr).first,itr->second.second->ref())); + ++itr; + ++count; + } + } + + return count; + } + + template class Sequence> + inline std::size_t get_list(Sequence& vlist) const + { + std::size_t count = 0; + + if (!map.empty()) + { + tm_const_itr_t itr = map.begin(); + tm_const_itr_t end = map.end (); + + while (end != itr) + { + vlist.push_back((*itr).first); + ++itr; + ++count; + } + } + + return count; + } + }; + + typedef details::expression_node* expression_ptr; + typedef typename details::variable_node variable_t; + typedef typename details::vector_holder vector_holder_t; + typedef variable_t* variable_ptr; + #ifndef exprtk_disable_string_capabilities + typedef typename details::stringvar_node stringvar_t; + typedef stringvar_t* stringvar_ptr; + #endif + typedef ifunction function_t; + typedef ivararg_function vararg_function_t; + typedef igeneric_function generic_function_t; + typedef function_t* function_ptr; + typedef vararg_function_t* vararg_function_ptr; + typedef generic_function_t* generic_function_ptr; + + static const std::size_t lut_size = 256; + + // Symbol Table Holder + struct control_block + { + struct st_data + { + type_store variable_store; + type_store function_store; + type_store vararg_function_store; + type_store generic_function_store; + type_store string_function_store; + type_store overload_function_store; + type_store vector_store; + #ifndef exprtk_disable_string_capabilities + type_store stringvar_store; + #endif + + st_data() + { + for (std::size_t i = 0; i < details::reserved_words_size; ++i) + { + reserved_symbol_table_.insert(details::reserved_words[i]); + } + + for (std::size_t i = 0; i < details::reserved_symbols_size; ++i) + { + reserved_symbol_table_.insert(details::reserved_symbols[i]); + } + } + + ~st_data() + { + for (std::size_t i = 0; i < free_function_list_.size(); ++i) + { + delete free_function_list_[i]; + } + } + + inline bool is_reserved_symbol(const std::string& symbol) const + { + return (reserved_symbol_table_.end() != reserved_symbol_table_.find(symbol)); + } + + static inline st_data* create() + { + return (new st_data); + } + + static inline void destroy(st_data*& sd) + { + delete sd; + sd = reinterpret_cast(0); + } + + std::list local_symbol_list_; + std::list local_stringvar_list_; + std::set reserved_symbol_table_; + std::vector*> free_function_list_; + }; + + control_block() + : ref_count(1) + , data_(st_data::create()) + , mutability_(e_mutable) + {} + + explicit control_block(st_data* data) + : ref_count(1) + , data_(data) + , mutability_(e_mutable) + {} + + ~control_block() + { + if (data_ && (0 == ref_count)) + { + st_data::destroy(data_); + } + } + + static inline control_block* create() + { + return (new control_block); + } + + template + static inline void destroy(control_block*& cntrl_blck, SymTab* sym_tab) + { + if (cntrl_blck) + { + if ( + (0 != cntrl_blck->ref_count) && + (0 == --cntrl_blck->ref_count) + ) + { + if (sym_tab) + sym_tab->clear(); + + delete cntrl_blck; + } + + cntrl_blck = 0; + } + } + + void set_mutability(const symtab_mutability_type mutability) + { + mutability_ = mutability; + } + + std::size_t ref_count; + st_data* data_; + symtab_mutability_type mutability_; + }; + + public: + + symbol_table(const symtab_mutability_type mutability = e_mutable) + : control_block_(control_block::create()) + { + control_block_->set_mutability(mutability); + clear(); + } + + ~symbol_table() + { + exprtk::details::dump_ptr("~symbol_table", this); + control_block::destroy(control_block_, this); + } + + symbol_table(const symbol_table& st) + { + control_block_ = st.control_block_; + control_block_->ref_count++; + } + + inline symbol_table& operator=(const symbol_table& st) + { + if (this != &st) + { + control_block::destroy(control_block_,reinterpret_cast*>(0)); + + control_block_ = st.control_block_; + control_block_->ref_count++; + } + + return (*this); + } + + inline bool operator==(const symbol_table& st) const + { + return (this == &st) || (control_block_ == st.control_block_); + } + + inline symtab_mutability_type mutability() const + { + return valid() ? control_block_->mutability_ : e_unknown; + } + + inline void clear_variables(const bool delete_node = true) + { + local_data().variable_store.clear(delete_node); + } + + inline void clear_functions() + { + local_data().function_store.clear(); + } + + inline void clear_strings() + { + #ifndef exprtk_disable_string_capabilities + local_data().stringvar_store.clear(); + #endif + } + + inline void clear_vectors() + { + local_data().vector_store.clear(); + } + + inline void clear_local_constants() + { + local_data().local_symbol_list_.clear(); + } + + inline void clear() + { + if (!valid()) return; + clear_variables (); + clear_functions (); + clear_strings (); + clear_vectors (); + clear_local_constants(); + } + + inline std::size_t variable_count() const + { + if (valid()) + return local_data().variable_store.size; + else + return 0; + } + + #ifndef exprtk_disable_string_capabilities + inline std::size_t stringvar_count() const + { + if (valid()) + return local_data().stringvar_store.size; + else + return 0; + } + #endif + + inline std::size_t function_count() const + { + if (valid()) + return local_data().function_store.size; + else + return 0; + } + + inline std::size_t vector_count() const + { + if (valid()) + return local_data().vector_store.size; + else + return 0; + } + + inline variable_ptr get_variable(const std::string& variable_name) const + { + if (!valid()) + return reinterpret_cast(0); + else if (!valid_symbol(variable_name)) + return reinterpret_cast(0); + else + return local_data().variable_store.get(variable_name); + } + + inline variable_ptr get_variable(const T& var_ref) const + { + if (!valid()) + return reinterpret_cast(0); + else + return local_data().variable_store.get_from_varptr( + reinterpret_cast(&var_ref)); + } + + #ifndef exprtk_disable_string_capabilities + inline stringvar_ptr get_stringvar(const std::string& string_name) const + { + if (!valid()) + return reinterpret_cast(0); + else if (!valid_symbol(string_name)) + return reinterpret_cast(0); + else + return local_data().stringvar_store.get(string_name); + } + + inline stringvar_base get_stringvar_base(const std::string& string_name) const + { + static stringvar_base null_stringvar_base("",reinterpret_cast(0)); + if (!valid()) + return null_stringvar_base; + else if (!valid_symbol(string_name)) + return null_stringvar_base; + + stringvar_ptr stringvar = local_data().stringvar_store.get(string_name); + + if (0 == stringvar) + { + return null_stringvar_base; + } + + return stringvar_base(string_name,stringvar); + } + #endif + + inline function_ptr get_function(const std::string& function_name) const + { + if (!valid()) + return reinterpret_cast(0); + else if (!valid_symbol(function_name)) + return reinterpret_cast(0); + else + return local_data().function_store.get(function_name); + } + + inline vararg_function_ptr get_vararg_function(const std::string& vararg_function_name) const + { + if (!valid()) + return reinterpret_cast(0); + else if (!valid_symbol(vararg_function_name)) + return reinterpret_cast(0); + else + return local_data().vararg_function_store.get(vararg_function_name); + } + + inline generic_function_ptr get_generic_function(const std::string& function_name) const + { + if (!valid()) + return reinterpret_cast(0); + else if (!valid_symbol(function_name)) + return reinterpret_cast(0); + else + return local_data().generic_function_store.get(function_name); + } + + inline generic_function_ptr get_string_function(const std::string& function_name) const + { + if (!valid()) + return reinterpret_cast(0); + else if (!valid_symbol(function_name)) + return reinterpret_cast(0); + else + return local_data().string_function_store.get(function_name); + } + + inline generic_function_ptr get_overload_function(const std::string& function_name) const + { + if (!valid()) + return reinterpret_cast(0); + else if (!valid_symbol(function_name)) + return reinterpret_cast(0); + else + return local_data().overload_function_store.get(function_name); + } + + typedef vector_holder_t* vector_holder_ptr; + + inline vector_holder_ptr get_vector(const std::string& vector_name) const + { + if (!valid()) + return reinterpret_cast(0); + else if (!valid_symbol(vector_name)) + return reinterpret_cast(0); + else + return local_data().vector_store.get(vector_name); + } + + inline T& variable_ref(const std::string& symbol_name) + { + static T null_var = T(0); + if (!valid()) + return null_var; + else if (!valid_symbol(symbol_name)) + return null_var; + else + return local_data().variable_store.type_ref(symbol_name); + } + + #ifndef exprtk_disable_string_capabilities + inline std::string& stringvar_ref(const std::string& symbol_name) + { + static std::string null_stringvar; + if (!valid()) + return null_stringvar; + else if (!valid_symbol(symbol_name)) + return null_stringvar; + else + return local_data().stringvar_store.type_ref(symbol_name); + } + #endif + + inline bool is_constant_node(const std::string& symbol_name) const + { + if (!valid()) + return false; + else if (!valid_symbol(symbol_name)) + return false; + else + return local_data().variable_store.is_constant(symbol_name); + } + + #ifndef exprtk_disable_string_capabilities + inline bool is_constant_string(const std::string& symbol_name) const + { + if (!valid()) + return false; + else if (!valid_symbol(symbol_name)) + return false; + else if (!local_data().stringvar_store.symbol_exists(symbol_name)) + return false; + else + return local_data().stringvar_store.is_constant(symbol_name); + } + #endif + + inline bool create_variable(const std::string& variable_name, const T& value = T(0)) + { + if (!valid()) + return false; + else if (!valid_symbol(variable_name)) + return false; + else if (symbol_exists(variable_name)) + return false; + + local_data().local_symbol_list_.push_back(value); + T& t = local_data().local_symbol_list_.back(); + + return add_variable(variable_name,t); + } + + #ifndef exprtk_disable_string_capabilities + inline bool create_stringvar(const std::string& stringvar_name, const std::string& value = std::string("")) + { + if (!valid()) + return false; + else if (!valid_symbol(stringvar_name)) + return false; + else if (symbol_exists(stringvar_name)) + return false; + + local_data().local_stringvar_list_.push_back(value); + std::string& s = local_data().local_stringvar_list_.back(); + + return add_stringvar(stringvar_name,s); + } + #endif + + inline bool add_variable(const std::string& variable_name, T& t, const bool is_constant = false) + { + if (!valid()) + return false; + else if (!valid_symbol(variable_name)) + return false; + else if (symbol_exists(variable_name)) + return false; + else + return local_data().variable_store.add(variable_name, t, is_constant); + } + + inline bool add_constant(const std::string& constant_name, const T& value) + { + if (!valid()) + return false; + else if (!valid_symbol(constant_name)) + return false; + else if (symbol_exists(constant_name)) + return false; + + local_data().local_symbol_list_.push_back(value); + T& t = local_data().local_symbol_list_.back(); + + return add_variable(constant_name, t, true); + } + + #ifndef exprtk_disable_string_capabilities + inline bool add_stringvar(const std::string& stringvar_name, std::string& s, const bool is_constant = false) + { + if (!valid()) + return false; + else if (!valid_symbol(stringvar_name)) + return false; + else if (symbol_exists(stringvar_name)) + return false; + else + return local_data().stringvar_store.add(stringvar_name, s, is_constant); + } + #endif + + inline bool add_function(const std::string& function_name, function_t& function) + { + if (!valid()) + return false; + else if (!valid_symbol(function_name)) + return false; + else if (symbol_exists(function_name)) + return false; + else + return local_data().function_store.add(function_name,function); + } + + inline bool add_function(const std::string& vararg_function_name, vararg_function_t& vararg_function) + { + if (!valid()) + return false; + else if (!valid_symbol(vararg_function_name)) + return false; + else if (symbol_exists(vararg_function_name)) + return false; + else + return local_data().vararg_function_store.add(vararg_function_name,vararg_function); + } + + inline bool add_function(const std::string& function_name, generic_function_t& function) + { + if (!valid()) + return false; + else if (!valid_symbol(function_name)) + return false; + else if (symbol_exists(function_name)) + return false; + else + { + switch (function.rtrn_type) + { + case generic_function_t::e_rtrn_scalar : + return (std::string::npos == function.parameter_sequence.find_first_not_of("STVZ*?|")) ? + local_data().generic_function_store.add(function_name,function) : false; + + case generic_function_t::e_rtrn_string : + return (std::string::npos == function.parameter_sequence.find_first_not_of("STVZ*?|")) ? + local_data().string_function_store.add(function_name,function) : false; + + case generic_function_t::e_rtrn_overload : + return (std::string::npos == function.parameter_sequence.find_first_not_of("STVZ*?|:")) ? + local_data().overload_function_store.add(function_name,function) : false; + } + } + + return false; + } + + #define exprtk_define_freefunction(NN) \ + inline bool add_function(const std::string& function_name, ff##NN##_functor function) \ + { \ + if (!valid()) \ + { return false; } \ + if (!valid_symbol(function_name)) \ + { return false; } \ + if (symbol_exists(function_name)) \ + { return false; } \ + \ + exprtk::ifunction* ifunc = new freefunc##NN(function); \ + \ + local_data().free_function_list_.push_back(ifunc); \ + \ + return add_function(function_name,(*local_data().free_function_list_.back())); \ + } \ + + exprtk_define_freefunction(00) exprtk_define_freefunction(01) + exprtk_define_freefunction(02) exprtk_define_freefunction(03) + exprtk_define_freefunction(04) exprtk_define_freefunction(05) + exprtk_define_freefunction(06) exprtk_define_freefunction(07) + exprtk_define_freefunction(08) exprtk_define_freefunction(09) + exprtk_define_freefunction(10) exprtk_define_freefunction(11) + exprtk_define_freefunction(12) exprtk_define_freefunction(13) + exprtk_define_freefunction(14) exprtk_define_freefunction(15) + + #undef exprtk_define_freefunction + + inline bool add_reserved_function(const std::string& function_name, function_t& function) + { + if (!valid()) + return false; + else if (!valid_symbol(function_name,false)) + return false; + else if (symbol_exists(function_name,false)) + return false; + else + return local_data().function_store.add(function_name,function); + } + + inline bool add_reserved_function(const std::string& vararg_function_name, vararg_function_t& vararg_function) + { + if (!valid()) + return false; + else if (!valid_symbol(vararg_function_name,false)) + return false; + else if (symbol_exists(vararg_function_name,false)) + return false; + else + return local_data().vararg_function_store.add(vararg_function_name,vararg_function); + } + + inline bool add_reserved_function(const std::string& function_name, generic_function_t& function) + { + if (!valid()) + return false; + else if (!valid_symbol(function_name,false)) + return false; + else if (symbol_exists(function_name,false)) + return false; + else + { + switch (function.rtrn_type) + { + case generic_function_t::e_rtrn_scalar : + return (std::string::npos == function.parameter_sequence.find_first_not_of("STVZ*?|")) ? + local_data().generic_function_store.add(function_name,function) : false; + + case generic_function_t::e_rtrn_string : + return (std::string::npos == function.parameter_sequence.find_first_not_of("STVZ*?|")) ? + local_data().string_function_store.add(function_name,function) : false; + + case generic_function_t::e_rtrn_overload : + return (std::string::npos == function.parameter_sequence.find_first_not_of("STVZ*?|:")) ? + local_data().overload_function_store.add(function_name,function) : false; + } + } + + return false; + } + + template + inline bool add_vector(const std::string& vector_name, T (&v)[N]) + { + if (!valid()) + return false; + else if (!valid_symbol(vector_name)) + return false; + else if (symbol_exists(vector_name)) + return false; + else + return local_data().vector_store.add(vector_name,v); + } + + inline bool add_vector(const std::string& vector_name, T* v, const std::size_t& v_size) + { + if (!valid()) + return false; + else if (!valid_symbol(vector_name)) + return false; + else if (symbol_exists(vector_name)) + return false; + else if (0 == v_size) + return false; + else + return local_data().vector_store.add(vector_name, v, v_size); + } + + template + inline bool add_vector(const std::string& vector_name, std::vector& v) + { + if (!valid()) + return false; + else if (!valid_symbol(vector_name)) + return false; + else if (symbol_exists(vector_name)) + return false; + else if (0 == v.size()) + return false; + else + return local_data().vector_store.add(vector_name,v); + } + + inline bool add_vector(const std::string& vector_name, exprtk::vector_view& v) + { + if (!valid()) + return false; + else if (!valid_symbol(vector_name)) + return false; + else if (symbol_exists(vector_name)) + return false; + else if (0 == v.size()) + return false; + else + return local_data().vector_store.add(vector_name,v); + } + + inline bool remove_variable(const std::string& variable_name, const bool delete_node = true) + { + if (!valid()) + return false; + else + return local_data().variable_store.remove(variable_name, delete_node); + } + + #ifndef exprtk_disable_string_capabilities + inline bool remove_stringvar(const std::string& string_name) + { + if (!valid()) + return false; + else + return local_data().stringvar_store.remove(string_name); + } + #endif + + inline bool remove_function(const std::string& function_name) + { + if (!valid()) + return false; + else + return local_data().function_store.remove(function_name); + } + + inline bool remove_vararg_function(const std::string& vararg_function_name) + { + if (!valid()) + return false; + else + return local_data().vararg_function_store.remove(vararg_function_name); + } + + inline bool remove_vector(const std::string& vector_name) + { + if (!valid()) + return false; + else + return local_data().vector_store.remove(vector_name); + } + + inline bool add_constants() + { + return add_pi () && + add_epsilon () && + add_infinity() ; + } + + inline bool add_pi() + { + const typename details::numeric::details::number_type::type num_type; + static const T local_pi = details::numeric::details::const_pi_impl(num_type); + return add_constant("pi",local_pi); + } + + inline bool add_epsilon() + { + static const T local_epsilon = details::numeric::details::epsilon_type::value(); + return add_constant("epsilon",local_epsilon); + } + + inline bool add_infinity() + { + static const T local_infinity = std::numeric_limits::infinity(); + return add_constant("inf",local_infinity); + } + + template + inline bool add_package(Package& package) + { + return package.register_package(*this); + } + + template class Sequence> + inline std::size_t get_variable_list(Sequence,Allocator>& vlist) const + { + if (!valid()) + return 0; + else + return local_data().variable_store.get_list(vlist); + } + + template class Sequence> + inline std::size_t get_variable_list(Sequence& vlist) const + { + if (!valid()) + return 0; + else + return local_data().variable_store.get_list(vlist); + } + + #ifndef exprtk_disable_string_capabilities + template class Sequence> + inline std::size_t get_stringvar_list(Sequence,Allocator>& svlist) const + { + if (!valid()) + return 0; + else + return local_data().stringvar_store.get_list(svlist); + } + + template class Sequence> + inline std::size_t get_stringvar_list(Sequence& svlist) const + { + if (!valid()) + return 0; + else + return local_data().stringvar_store.get_list(svlist); + } + #endif + + template class Sequence> + inline std::size_t get_vector_list(Sequence& vlist) const + { + if (!valid()) + return 0; + else + return local_data().vector_store.get_list(vlist); + } + + inline bool symbol_exists(const std::string& symbol_name, const bool check_reserved_symb = true) const + { + /* + Function will return true if symbol_name exists as either a + reserved symbol, variable, stringvar, vector or function name + in any of the type stores. + */ + if (!valid()) + return false; + else if (local_data().variable_store.symbol_exists(symbol_name)) + return true; + #ifndef exprtk_disable_string_capabilities + else if (local_data().stringvar_store.symbol_exists(symbol_name)) + return true; + #endif + else if (local_data().vector_store.symbol_exists(symbol_name)) + return true; + else if (local_data().function_store.symbol_exists(symbol_name)) + return true; + else if (check_reserved_symb && local_data().is_reserved_symbol(symbol_name)) + return true; + else + return false; + } + + inline bool is_variable(const std::string& variable_name) const + { + if (!valid()) + return false; + else + return local_data().variable_store.symbol_exists(variable_name); + } + + #ifndef exprtk_disable_string_capabilities + inline bool is_stringvar(const std::string& stringvar_name) const + { + if (!valid()) + return false; + else + return local_data().stringvar_store.symbol_exists(stringvar_name); + } + + inline bool is_conststr_stringvar(const std::string& symbol_name) const + { + if (!valid()) + return false; + else if (!valid_symbol(symbol_name)) + return false; + else if (!local_data().stringvar_store.symbol_exists(symbol_name)) + return false; + + return ( + local_data().stringvar_store.symbol_exists(symbol_name) || + local_data().stringvar_store.is_constant (symbol_name) + ); + } + #endif + + inline bool is_function(const std::string& function_name) const + { + if (!valid()) + return false; + else + return local_data().function_store.symbol_exists(function_name); + } + + inline bool is_vararg_function(const std::string& vararg_function_name) const + { + if (!valid()) + return false; + else + return local_data().vararg_function_store.symbol_exists(vararg_function_name); + } + + inline bool is_vector(const std::string& vector_name) const + { + if (!valid()) + return false; + else + return local_data().vector_store.symbol_exists(vector_name); + } + + inline std::string get_variable_name(const expression_ptr& ptr) const + { + return local_data().variable_store.entity_name(ptr); + } + + inline std::string get_vector_name(const vector_holder_ptr& ptr) const + { + return local_data().vector_store.entity_name(ptr); + } + + #ifndef exprtk_disable_string_capabilities + inline std::string get_stringvar_name(const expression_ptr& ptr) const + { + return local_data().stringvar_store.entity_name(ptr); + } + + inline std::string get_conststr_stringvar_name(const expression_ptr& ptr) const + { + return local_data().stringvar_store.entity_name(ptr); + } + #endif + + inline bool valid() const + { + // Symbol table sanity check. + return control_block_ && control_block_->data_; + } + + inline void load_from(const symbol_table& st) + { + { + std::vector name_list; + + st.local_data().function_store.get_list(name_list); + + if (!name_list.empty()) + { + for (std::size_t i = 0; i < name_list.size(); ++i) + { + exprtk::ifunction& ifunc = *st.get_function(name_list[i]); + add_function(name_list[i],ifunc); + } + } + } + + { + std::vector name_list; + + st.local_data().vararg_function_store.get_list(name_list); + + if (!name_list.empty()) + { + for (std::size_t i = 0; i < name_list.size(); ++i) + { + exprtk::ivararg_function& ivafunc = *st.get_vararg_function(name_list[i]); + add_function(name_list[i],ivafunc); + } + } + } + + { + std::vector name_list; + + st.local_data().generic_function_store.get_list(name_list); + + if (!name_list.empty()) + { + for (std::size_t i = 0; i < name_list.size(); ++i) + { + exprtk::igeneric_function& ifunc = *st.get_generic_function(name_list[i]); + add_function(name_list[i],ifunc); + } + } + } + + { + std::vector name_list; + + st.local_data().string_function_store.get_list(name_list); + + if (!name_list.empty()) + { + for (std::size_t i = 0; i < name_list.size(); ++i) + { + exprtk::igeneric_function& ifunc = *st.get_string_function(name_list[i]); + add_function(name_list[i],ifunc); + } + } + } + + { + std::vector name_list; + + st.local_data().overload_function_store.get_list(name_list); + + if (!name_list.empty()) + { + for (std::size_t i = 0; i < name_list.size(); ++i) + { + exprtk::igeneric_function& ifunc = *st.get_overload_function(name_list[i]); + add_function(name_list[i],ifunc); + } + } + } + } + + private: + + inline bool valid_symbol(const std::string& symbol, const bool check_reserved_symb = true) const + { + if (symbol.empty()) + return false; + else if (!details::is_letter(symbol[0])) + return false; + else if (symbol.size() > 1) + { + for (std::size_t i = 1; i < symbol.size(); ++i) + { + if ( + !details::is_letter_or_digit(symbol[i]) && + ('_' != symbol[i]) + ) + { + if ((i < (symbol.size() - 1)) && ('.' == symbol[i])) + continue; + else + return false; + } + } + } + + return (check_reserved_symb) ? (!local_data().is_reserved_symbol(symbol)) : true; + } + + inline bool valid_function(const std::string& symbol) const + { + if (symbol.empty()) + return false; + else if (!details::is_letter(symbol[0])) + return false; + else if (symbol.size() > 1) + { + for (std::size_t i = 1; i < symbol.size(); ++i) + { + if ( + !details::is_letter_or_digit(symbol[i]) && + ('_' != symbol[i]) + ) + { + if ((i < (symbol.size() - 1)) && ('.' == symbol[i])) + continue; + else + return false; + } + } + } + + return true; + } + + typedef typename control_block::st_data local_data_t; + + inline local_data_t& local_data() + { + return *(control_block_->data_); + } + + inline const local_data_t& local_data() const + { + return *(control_block_->data_); + } + + control_block* control_block_; + + friend class parser; + }; // class symbol_table + + template + class function_compositor; + + template + class expression + { + private: + + typedef details::expression_node* expression_ptr; + typedef details::vector_holder* vector_holder_ptr; + typedef std::vector > symtab_list_t; + + struct control_block + { + enum data_type + { + e_unknown , + e_expr , + e_vecholder, + e_data , + e_vecdata , + e_string + }; + + struct data_pack + { + data_pack() + : pointer(0) + , type(e_unknown) + , size(0) + {} + + data_pack(void* ptr, const data_type dt, const std::size_t sz = 0) + : pointer(ptr) + , type(dt) + , size(sz) + {} + + void* pointer; + data_type type; + std::size_t size; + }; + + typedef std::vector local_data_list_t; + typedef results_context results_context_t; + typedef control_block* cntrl_blck_ptr_t; + + control_block() + : ref_count(0) + , expr (0) + , results (0) + , retinv_null(false) + , return_invoked(&retinv_null) + {} + + explicit control_block(expression_ptr e) + : ref_count(1) + , expr (e) + , results (0) + , retinv_null(false) + , return_invoked(&retinv_null) + {} + + ~control_block() + { + if (expr && details::branch_deletable(expr)) + { + destroy_node(expr); + } + + if (!local_data_list.empty()) + { + for (std::size_t i = 0; i < local_data_list.size(); ++i) + { + switch (local_data_list[i].type) + { + case e_expr : delete reinterpret_cast(local_data_list[i].pointer); + break; + + case e_vecholder : delete reinterpret_cast(local_data_list[i].pointer); + break; + + case e_data : delete reinterpret_cast(local_data_list[i].pointer); + break; + + case e_vecdata : delete [] reinterpret_cast(local_data_list[i].pointer); + break; + + case e_string : delete reinterpret_cast(local_data_list[i].pointer); + break; + + default : break; + } + } + } + + if (results) + { + delete results; + } + } + + static inline cntrl_blck_ptr_t create(expression_ptr e) + { + return new control_block(e); + } + + static inline void destroy(cntrl_blck_ptr_t& cntrl_blck) + { + if (cntrl_blck) + { + if ( + (0 != cntrl_blck->ref_count) && + (0 == --cntrl_blck->ref_count) + ) + { + delete cntrl_blck; + } + + cntrl_blck = 0; + } + } + + std::size_t ref_count; + expression_ptr expr; + local_data_list_t local_data_list; + results_context_t* results; + bool retinv_null; + bool* return_invoked; + + friend class function_compositor; + }; + + public: + + expression() + : control_block_(0) + { + set_expression(new details::null_node()); + } + + expression(const expression& e) + : control_block_ (e.control_block_ ) + , symbol_table_list_(e.symbol_table_list_) + { + control_block_->ref_count++; + } + + explicit expression(const symbol_table& symbol_table) + : control_block_(0) + { + set_expression(new details::null_node()); + symbol_table_list_.push_back(symbol_table); + } + + inline expression& operator=(const expression& e) + { + if (this != &e) + { + if (control_block_) + { + if ( + (0 != control_block_->ref_count) && + (0 == --control_block_->ref_count) + ) + { + delete control_block_; + } + + control_block_ = 0; + } + + control_block_ = e.control_block_; + control_block_->ref_count++; + symbol_table_list_ = e.symbol_table_list_; + } + + return *this; + } + + inline bool operator==(const expression& e) const + { + return (this == &e); + } + + inline bool operator!() const + { + return ( + (0 == control_block_ ) || + (0 == control_block_->expr) + ); + } + + inline expression& release() + { + exprtk::details::dump_ptr("expression::release", this); + control_block::destroy(control_block_); + + return (*this); + } + + ~expression() + { + control_block::destroy(control_block_); + } + + inline T value() const + { + assert(control_block_ ); + assert(control_block_->expr); + + return control_block_->expr->value(); + } + + inline T operator() () const + { + return value(); + } + + inline operator T() const + { + return value(); + } + + inline operator bool() const + { + return details::is_true(value()); + } + + inline void register_symbol_table(symbol_table& st) + { + for (std::size_t i = 0; i < symbol_table_list_.size(); ++i) + { + if (&st == &symbol_table_list_[i]) + { + return; + } + } + + symbol_table_list_.push_back(st); + } + + inline const symbol_table& get_symbol_table(const std::size_t& index = 0) const + { + return symbol_table_list_[index]; + } + + inline symbol_table& get_symbol_table(const std::size_t& index = 0) + { + return symbol_table_list_[index]; + } + + typedef results_context results_context_t; + + inline const results_context_t& results() const + { + if (control_block_->results) + return (*control_block_->results); + else + { + static const results_context_t null_results; + return null_results; + } + } + + inline bool return_invoked() const + { + return (*control_block_->return_invoked); + } + + private: + + inline symtab_list_t get_symbol_table_list() const + { + return symbol_table_list_; + } + + inline void set_expression(const expression_ptr expr) + { + if (expr) + { + if (control_block_) + { + if (0 == --control_block_->ref_count) + { + delete control_block_; + } + } + + control_block_ = control_block::create(expr); + } + } + + inline void register_local_var(expression_ptr expr) + { + if (expr) + { + if (control_block_) + { + control_block_-> + local_data_list.push_back( + typename expression::control_block:: + data_pack(reinterpret_cast(expr), + control_block::e_expr)); + } + } + } + + inline void register_local_var(vector_holder_ptr vec_holder) + { + if (vec_holder) + { + if (control_block_) + { + control_block_-> + local_data_list.push_back( + typename expression::control_block:: + data_pack(reinterpret_cast(vec_holder), + control_block::e_vecholder)); + } + } + } + + inline void register_local_data(void* data, const std::size_t& size = 0, const std::size_t data_mode = 0) + { + if (data) + { + if (control_block_) + { + typename control_block::data_type dt = control_block::e_data; + + switch (data_mode) + { + case 0 : dt = control_block::e_data; break; + case 1 : dt = control_block::e_vecdata; break; + case 2 : dt = control_block::e_string; break; + } + + control_block_-> + local_data_list.push_back( + typename expression::control_block:: + data_pack(reinterpret_cast(data), dt, size)); + } + } + } + + inline const typename control_block::local_data_list_t& local_data_list() + { + if (control_block_) + { + return control_block_->local_data_list; + } + else + { + static typename control_block::local_data_list_t null_local_data_list; + return null_local_data_list; + } + } + + inline void register_return_results(results_context_t* rc) + { + if (control_block_ && rc) + { + control_block_->results = rc; + } + } + + inline void set_retinvk(bool* retinvk_ptr) + { + if (control_block_) + { + control_block_->return_invoked = retinvk_ptr; + } + } + + control_block* control_block_; + symtab_list_t symbol_table_list_; + + friend class parser; + friend class expression_helper; + friend class function_compositor; + }; // class expression + + template + class expression_helper + { + public: + + static inline bool is_constant(const expression& expr) + { + return details::is_constant_node(expr.control_block_->expr); + } + + static inline bool is_variable(const expression& expr) + { + return details::is_variable_node(expr.control_block_->expr); + } + + static inline bool is_unary(const expression& expr) + { + return details::is_unary_node(expr.control_block_->expr); + } + + static inline bool is_binary(const expression& expr) + { + return details::is_binary_node(expr.control_block_->expr); + } + + static inline bool is_function(const expression& expr) + { + return details::is_function(expr.control_block_->expr); + } + + static inline bool is_null(const expression& expr) + { + return details::is_null_node(expr.control_block_->expr); + } + }; + + template + inline bool is_valid(const expression& expr) + { + return !expression_helper::is_null(expr); + } + + namespace parser_error + { + enum error_mode + { + e_unknown = 0, + e_syntax = 1, + e_token = 2, + e_numeric = 4, + e_symtab = 5, + e_lexer = 6, + e_helper = 7, + e_parser = 8 + }; + + struct type + { + type() + : mode(parser_error::e_unknown) + , line_no (0) + , column_no(0) + {} + + lexer::token token; + error_mode mode; + std::string diagnostic; + std::string src_location; + std::string error_line; + std::size_t line_no; + std::size_t column_no; + }; + + inline type make_error(const error_mode mode, + const std::string& diagnostic = "", + const std::string& src_location = "") + { + type t; + t.mode = mode; + t.token.type = lexer::token::e_error; + t.diagnostic = diagnostic; + t.src_location = src_location; + exprtk_debug(("%s\n",diagnostic .c_str())); + return t; + } + + inline type make_error(const error_mode mode, + const lexer::token& tk, + const std::string& diagnostic = "", + const std::string& src_location = "") + { + type t; + t.mode = mode; + t.token = tk; + t.diagnostic = diagnostic; + t.src_location = src_location; + exprtk_debug(("%s\n",diagnostic .c_str())); + return t; + } + + inline std::string to_str(error_mode mode) + { + switch (mode) + { + case e_unknown : return std::string("Unknown Error"); + case e_syntax : return std::string("Syntax Error" ); + case e_token : return std::string("Token Error" ); + case e_numeric : return std::string("Numeric Error"); + case e_symtab : return std::string("Symbol Error" ); + case e_lexer : return std::string("Lexer Error" ); + case e_helper : return std::string("Helper Error" ); + case e_parser : return std::string("Parser Error" ); + default : return std::string("Unknown Error"); + } + } + + inline bool update_error(type& error, const std::string& expression) + { + if ( + expression.empty() || + (error.token.position > expression.size()) || + (std::numeric_limits::max() == error.token.position) + ) + { + return false; + } + + std::size_t error_line_start = 0; + + for (std::size_t i = error.token.position; i > 0; --i) + { + const details::char_t c = expression[i]; + + if (('\n' == c) || ('\r' == c)) + { + error_line_start = i + 1; + break; + } + } + + std::size_t next_nl_position = std::min(expression.size(), + expression.find_first_of('\n',error.token.position + 1)); + + error.column_no = error.token.position - error_line_start; + error.error_line = expression.substr(error_line_start, + next_nl_position - error_line_start); + + error.line_no = 0; + + for (std::size_t i = 0; i < next_nl_position; ++i) + { + if ('\n' == expression[i]) + ++error.line_no; + } + + return true; + } + + inline void dump_error(const type& error) + { + printf("Position: %02d Type: [%s] Msg: %s\n", + static_cast(error.token.position), + exprtk::parser_error::to_str(error.mode).c_str(), + error.diagnostic.c_str()); + } + } + + namespace details + { + template + inline void disable_type_checking(Parser& p) + { + p.state_.type_check_enabled = false; + } + } + + template + class parser : public lexer::parser_helper + { + private: + + enum precedence_level + { + e_level00, e_level01, e_level02, e_level03, e_level04, + e_level05, e_level06, e_level07, e_level08, e_level09, + e_level10, e_level11, e_level12, e_level13, e_level14 + }; + + typedef const T& cref_t; + typedef const T const_t; + typedef ifunction F; + typedef ivararg_function VAF; + typedef igeneric_function GF; + typedef ifunction ifunction_t; + typedef ivararg_function ivararg_function_t; + typedef igeneric_function igeneric_function_t; + typedef details::expression_node expression_node_t; + typedef details::literal_node literal_node_t; + typedef details::unary_node unary_node_t; + typedef details::binary_node binary_node_t; + typedef details::trinary_node trinary_node_t; + typedef details::quaternary_node quaternary_node_t; + typedef details::conditional_node conditional_node_t; + typedef details::cons_conditional_node cons_conditional_node_t; + typedef details::while_loop_node while_loop_node_t; + typedef details::repeat_until_loop_node repeat_until_loop_node_t; + typedef details::for_loop_node for_loop_node_t; + typedef details::while_loop_rtc_node while_loop_rtc_node_t; + typedef details::repeat_until_loop_rtc_node repeat_until_loop_rtc_node_t; + typedef details::for_loop_rtc_node for_loop_rtc_node_t; + #ifndef exprtk_disable_break_continue + typedef details::while_loop_bc_node while_loop_bc_node_t; + typedef details::repeat_until_loop_bc_node repeat_until_loop_bc_node_t; + typedef details::for_loop_bc_node for_loop_bc_node_t; + typedef details::while_loop_bc_rtc_node while_loop_bc_rtc_node_t; + typedef details::repeat_until_loop_bc_rtc_node repeat_until_loop_bc_rtc_node_t; + typedef details::for_loop_bc_rtc_node for_loop_bc_rtc_node_t; + #endif + typedef details::switch_node switch_node_t; + typedef details::variable_node variable_node_t; + typedef details::vector_elem_node vector_elem_node_t; + typedef details::rebasevector_elem_node rebasevector_elem_node_t; + typedef details::rebasevector_celem_node rebasevector_celem_node_t; + typedef details::vector_node vector_node_t; + typedef details::range_pack range_t; + #ifndef exprtk_disable_string_capabilities + typedef details::stringvar_node stringvar_node_t; + typedef details::string_literal_node string_literal_node_t; + typedef details::string_range_node string_range_node_t; + typedef details::const_string_range_node const_string_range_node_t; + typedef details::generic_string_range_node generic_string_range_node_t; + typedef details::string_concat_node string_concat_node_t; + typedef details::assignment_string_node assignment_string_node_t; + typedef details::assignment_string_range_node assignment_string_range_node_t; + typedef details::conditional_string_node conditional_string_node_t; + typedef details::cons_conditional_str_node cons_conditional_str_node_t; + #endif + typedef details::assignment_node assignment_node_t; + typedef details::assignment_vec_elem_node assignment_vec_elem_node_t; + typedef details::assignment_rebasevec_elem_node assignment_rebasevec_elem_node_t; + typedef details::assignment_rebasevec_celem_node assignment_rebasevec_celem_node_t; + typedef details::assignment_vec_node assignment_vec_node_t; + typedef details::assignment_vecvec_node assignment_vecvec_node_t; + typedef details::conditional_vector_node conditional_vector_node_t; + typedef details::scand_node scand_node_t; + typedef details::scor_node scor_node_t; + typedef lexer::token token_t; + typedef expression_node_t* expression_node_ptr; + typedef expression expression_t; + typedef symbol_table symbol_table_t; + typedef typename expression::symtab_list_t symbol_table_list_t; + typedef details::vector_holder* vector_holder_ptr; + + typedef typename details::functor_t functor_t; + typedef typename functor_t::qfunc_t quaternary_functor_t; + typedef typename functor_t::tfunc_t trinary_functor_t; + typedef typename functor_t::bfunc_t binary_functor_t; + typedef typename functor_t::ufunc_t unary_functor_t; + + typedef details::operator_type operator_t; + + typedef std::map unary_op_map_t; + typedef std::map binary_op_map_t; + typedef std::map trinary_op_map_t; + + typedef std::map > sf3_map_t; + typedef std::map > sf4_map_t; + + typedef std::map inv_binary_op_map_t; + typedef std::multimap base_ops_map_t; + typedef std::set disabled_func_set_t; + + typedef details::T0oT1_define vov_t; + typedef details::T0oT1_define cov_t; + typedef details::T0oT1_define voc_t; + + typedef details::T0oT1oT2_define vovov_t; + typedef details::T0oT1oT2_define vovoc_t; + typedef details::T0oT1oT2_define vocov_t; + typedef details::T0oT1oT2_define covov_t; + typedef details::T0oT1oT2_define covoc_t; + typedef details::T0oT1oT2_define cocov_t; + typedef details::T0oT1oT2_define vococ_t; + + typedef details::T0oT1oT2oT3_define vovovov_t; + typedef details::T0oT1oT2oT3_define vovovoc_t; + typedef details::T0oT1oT2oT3_define vovocov_t; + typedef details::T0oT1oT2oT3_define vocovov_t; + typedef details::T0oT1oT2oT3_define covovov_t; + + typedef details::T0oT1oT2oT3_define covocov_t; + typedef details::T0oT1oT2oT3_define vocovoc_t; + typedef details::T0oT1oT2oT3_define covovoc_t; + typedef details::T0oT1oT2oT3_define vococov_t; + + typedef results_context results_context_t; + + typedef parser_helper prsrhlpr_t; + + struct scope_element + { + enum element_type + { + e_none , + e_variable, + e_vector , + e_vecelem , + e_string + }; + + typedef details::vector_holder vector_holder_t; + typedef variable_node_t* variable_node_ptr; + typedef vector_holder_t* vector_holder_ptr; + typedef expression_node_t* expression_node_ptr; + #ifndef exprtk_disable_string_capabilities + typedef stringvar_node_t* stringvar_node_ptr; + #endif + + scope_element() + : name("???") + , size (std::numeric_limits::max()) + , index(std::numeric_limits::max()) + , depth(std::numeric_limits::max()) + , ref_count(0) + , ip_index (0) + , type (e_none) + , active(false) + , data (0) + , var_node (0) + , vec_node (0) + #ifndef exprtk_disable_string_capabilities + , str_node(0) + #endif + {} + + bool operator < (const scope_element& se) const + { + if (ip_index < se.ip_index) + return true; + else if (ip_index > se.ip_index) + return false; + else if (depth < se.depth) + return true; + else if (depth > se.depth) + return false; + else if (index < se.index) + return true; + else if (index > se.index) + return false; + else + return (name < se.name); + } + + void clear() + { + name = "???"; + size = std::numeric_limits::max(); + index = std::numeric_limits::max(); + depth = std::numeric_limits::max(); + type = e_none; + active = false; + ref_count = 0; + ip_index = 0; + data = 0; + var_node = 0; + vec_node = 0; + #ifndef exprtk_disable_string_capabilities + str_node = 0; + #endif + } + + std::string name; + std::size_t size; + std::size_t index; + std::size_t depth; + std::size_t ref_count; + std::size_t ip_index; + element_type type; + bool active; + void* data; + expression_node_ptr var_node; + vector_holder_ptr vec_node; + #ifndef exprtk_disable_string_capabilities + stringvar_node_ptr str_node; + #endif + }; + + class scope_element_manager + { + public: + + typedef expression_node_t* expression_node_ptr; + typedef variable_node_t* variable_node_ptr; + typedef parser parser_t; + + explicit scope_element_manager(parser& p) + : parser_(p) + , input_param_cnt_(0) + {} + + inline std::size_t size() const + { + return element_.size(); + } + + inline bool empty() const + { + return element_.empty(); + } + + inline scope_element& get_element(const std::size_t& index) + { + if (index < element_.size()) + return element_[index]; + else + return null_element_; + } + + inline scope_element& get_element(const std::string& var_name, + const std::size_t index = std::numeric_limits::max()) + { + const std::size_t current_depth = parser_.state_.scope_depth; + + for (std::size_t i = 0; i < element_.size(); ++i) + { + scope_element& se = element_[i]; + + if (se.depth > current_depth) + continue; + else if ( + details::imatch(se.name, var_name) && + (se.index == index) + ) + return se; + } + + return null_element_; + } + + inline scope_element& get_active_element(const std::string& var_name, + const std::size_t index = std::numeric_limits::max()) + { + const std::size_t current_depth = parser_.state_.scope_depth; + + for (std::size_t i = 0; i < element_.size(); ++i) + { + scope_element& se = element_[i]; + + if (se.depth > current_depth) + continue; + else if ( + details::imatch(se.name, var_name) && + (se.index == index) && + (se.active) + ) + return se; + } + + return null_element_; + } + + inline bool add_element(const scope_element& se) + { + for (std::size_t i = 0; i < element_.size(); ++i) + { + scope_element& cse = element_[i]; + + if ( + details::imatch(cse.name, se.name) && + (cse.depth <= se.depth) && + (cse.index == se.index) && + (cse.size == se.size ) && + (cse.type == se.type ) && + (cse.active) + ) + return false; + } + + element_.push_back(se); + std::sort(element_.begin(),element_.end()); + + return true; + } + + inline void deactivate(const std::size_t& scope_depth) + { + exprtk_debug(("deactivate() - Scope depth: %d\n", + static_cast(parser_.state_.scope_depth))); + + for (std::size_t i = 0; i < element_.size(); ++i) + { + scope_element& se = element_[i]; + + if (se.active && (se.depth >= scope_depth)) + { + exprtk_debug(("deactivate() - element[%02d] '%s'\n", + static_cast(i), + se.name.c_str())); + + se.active = false; + } + } + } + + inline void free_element(scope_element& se) + { + exprtk_debug(("free_element() - se[%s]\n", se.name.c_str())); + + switch (se.type) + { + case scope_element::e_variable : delete reinterpret_cast(se.data); + delete se.var_node; + break; + + case scope_element::e_vector : delete[] reinterpret_cast(se.data); + delete se.vec_node; + break; + + case scope_element::e_vecelem : delete se.var_node; + break; + + #ifndef exprtk_disable_string_capabilities + case scope_element::e_string : delete reinterpret_cast(se.data); + delete se.str_node; + break; + #endif + + default : return; + } + + se.clear(); + } + + inline void cleanup() + { + for (std::size_t i = 0; i < element_.size(); ++i) + { + free_element(element_[i]); + } + + element_.clear(); + + input_param_cnt_ = 0; + } + + inline std::size_t next_ip_index() + { + return ++input_param_cnt_; + } + + inline expression_node_ptr get_variable(const T& v) + { + for (std::size_t i = 0; i < element_.size(); ++i) + { + scope_element& se = element_[i]; + + if ( + se.active && + se.var_node && + details::is_variable_node(se.var_node) + ) + { + variable_node_ptr vn = reinterpret_cast(se.var_node); + + if (&(vn->ref()) == (&v)) + { + return se.var_node; + } + } + } + + return expression_node_ptr(0); + } + + private: + + scope_element_manager(const scope_element_manager&) exprtk_delete; + scope_element_manager& operator=(const scope_element_manager&) exprtk_delete; + + parser_t& parser_; + std::vector element_; + scope_element null_element_; + std::size_t input_param_cnt_; + }; + + class scope_handler + { + public: + + typedef parser parser_t; + + explicit scope_handler(parser& p) + : parser_(p) + { + parser_.state_.scope_depth++; + #ifdef exprtk_enable_debugging + const std::string depth(2 * parser_.state_.scope_depth,'-'); + exprtk_debug(("%s> Scope Depth: %02d\n", + depth.c_str(), + static_cast(parser_.state_.scope_depth))); + #endif + } + + ~scope_handler() + { + parser_.sem_.deactivate(parser_.state_.scope_depth); + parser_.state_.scope_depth--; + #ifdef exprtk_enable_debugging + const std::string depth(2 * parser_.state_.scope_depth,'-'); + exprtk_debug(("<%s Scope Depth: %02d\n", + depth.c_str(), + static_cast(parser_.state_.scope_depth))); + #endif + } + + private: + + scope_handler(const scope_handler&) exprtk_delete; + scope_handler& operator=(const scope_handler&) exprtk_delete; + + parser_t& parser_; + }; + + template + struct halfopen_range_policy + { + static inline bool is_within(const T_& v, const T_& begin, const T_& end) + { + assert(begin <= end); + return (begin <= v) && (v < end); + } + + static inline bool is_less(const T_& v, const T_& begin) + { + return (v < begin); + } + + static inline bool is_greater(const T_& v, const T_& end) + { + return (end <= v); + } + + static inline bool end_inclusive() + { + return false; + } + }; + + template + struct closed_range_policy + { + static inline bool is_within(const T_& v, const T_& begin, const T_& end) + { + assert(begin <= end); + return (begin <= v) && (v <= end); + } + + static inline bool is_less(const T_& v, const T_& begin) + { + return (v < begin); + } + + static inline bool is_greater(const T_& v, const T_& end) + { + return (end < v); + } + + static inline bool end_inclusive() + { + return true; + } + }; + + template > + class interval_container_t + { + public: + + typedef IntervalPointType interval_point_t; + typedef std::pair interval_t; + typedef std::map interval_map_t; + typedef typename interval_map_t::const_iterator interval_map_citr_t; + + std::size_t size() const + { + return interval_map_.size(); + } + + void reset() + { + interval_map_.clear(); + } + + bool in_interval(const interval_point_t point, interval_t& interval) const + { + interval_map_citr_t itr = RangePolicy::end_inclusive() ? + interval_map_.lower_bound(point): + interval_map_.upper_bound(point); + + for (; itr != interval_map_.end(); ++itr) + { + const interval_point_t& begin = itr->second.first; + const interval_point_t& end = itr->second.second; + + if (RangePolicy::is_within(point, begin, end)) + { + interval = interval_t(begin,end); + return true; + } + else if (RangePolicy::is_greater(point, end)) + { + break; + } + } + + return false; + } + + bool in_interval(const interval_point_t point) const + { + interval_t interval; + return in_interval(point,interval); + } + + bool add_interval(const interval_point_t begin, const interval_point_t end) + { + if ((end <= begin) || in_interval(begin) || in_interval(end)) + { + return false; + } + + interval_map_[end] = std::make_pair(begin, end); + + return true; + } + + bool add_interval(const interval_t interval) + { + return add_interval(interval.first, interval.second); + } + + private: + + interval_map_t interval_map_; + }; + + class stack_limit_handler + { + public: + + typedef parser parser_t; + + explicit stack_limit_handler(parser& p) + : parser_(p) + , limit_exceeded_(false) + { + if (++parser_.state_.stack_depth > parser_.settings_.max_stack_depth_) + { + limit_exceeded_ = true; + parser_.set_error( + make_error(parser_error::e_parser, + "ERR000 - Current stack depth " + details::to_str(parser_.state_.stack_depth) + + " exceeds maximum allowed stack depth of " + details::to_str(parser_.settings_.max_stack_depth_), + exprtk_error_location)); + } + } + + ~stack_limit_handler() + { + parser_.state_.stack_depth--; + } + + bool operator!() + { + return limit_exceeded_; + } + + private: + + stack_limit_handler(const stack_limit_handler&) exprtk_delete; + stack_limit_handler& operator=(const stack_limit_handler&) exprtk_delete; + + parser_t& parser_; + bool limit_exceeded_; + }; + + struct symtab_store + { + symbol_table_list_t symtab_list_; + + typedef typename symbol_table_t::local_data_t local_data_t; + typedef typename symbol_table_t::variable_ptr variable_ptr; + typedef typename symbol_table_t::function_ptr function_ptr; + #ifndef exprtk_disable_string_capabilities + typedef typename symbol_table_t::stringvar_ptr stringvar_ptr; + #endif + typedef typename symbol_table_t::vector_holder_ptr vector_holder_ptr; + typedef typename symbol_table_t::vararg_function_ptr vararg_function_ptr; + typedef typename symbol_table_t::generic_function_ptr generic_function_ptr; + + struct variable_context + { + variable_context() + : symbol_table(0) + , variable(0) + {} + + const symbol_table_t* symbol_table; + variable_ptr variable; + }; + + struct vector_context + { + vector_context() + : symbol_table(0) + , vector_holder(0) + {} + + const symbol_table_t* symbol_table; + vector_holder_ptr vector_holder; + }; + + #ifndef exprtk_disable_string_capabilities + struct string_context + { + string_context() + : symbol_table(0) + , str_var(0) + {} + + const symbol_table_t* symbol_table; + stringvar_ptr str_var; + }; + #endif + + inline bool empty() const + { + return symtab_list_.empty(); + } + + inline void clear() + { + symtab_list_.clear(); + } + + inline bool valid() const + { + if (!empty()) + { + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (symtab_list_[i].valid()) + return true; + } + } + + return false; + } + + inline bool valid_symbol(const std::string& symbol) const + { + if (!symtab_list_.empty()) + return symtab_list_[0].valid_symbol(symbol); + else + return false; + } + + inline bool valid_function_name(const std::string& symbol) const + { + if (!symtab_list_.empty()) + return symtab_list_[0].valid_function(symbol); + else + return false; + } + + inline variable_context get_variable_context(const std::string& variable_name) const + { + variable_context result; + if (!valid_symbol(variable_name)) + return result; + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + { + continue; + } + + result.variable = local_data(i) + .variable_store.get(variable_name); + if (result.variable) + { + result.symbol_table = &symtab_list_[i]; + break; + } + } + + return result; + } + + inline variable_ptr get_variable(const std::string& variable_name) const + { + if (!valid_symbol(variable_name)) + return reinterpret_cast(0); + + variable_ptr result = reinterpret_cast(0); + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else + result = local_data(i) + .variable_store.get(variable_name); + + if (result) break; + } + + return result; + } + + inline variable_ptr get_variable(const T& var_ref) const + { + variable_ptr result = reinterpret_cast(0); + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else + result = local_data(i).variable_store + .get_from_varptr(reinterpret_cast(&var_ref)); + + if (result) break; + } + + return result; + } + + #ifndef exprtk_disable_string_capabilities + inline string_context get_string_context(const std::string& string_name) const + { + string_context result; + + if (!valid_symbol(string_name)) + return result; + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + { + continue; + } + + result.str_var = local_data(i).stringvar_store.get(string_name); + + if (result.str_var) + { + result.symbol_table = &symtab_list_[i]; + break; + } + } + + return result; + } + + inline stringvar_ptr get_stringvar(const std::string& string_name) const + { + if (!valid_symbol(string_name)) + return reinterpret_cast(0); + + stringvar_ptr result = reinterpret_cast(0); + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else + result = local_data(i) + .stringvar_store.get(string_name); + + if (result) break; + } + + return result; + } + #endif + + inline function_ptr get_function(const std::string& function_name) const + { + if (!valid_function_name(function_name)) + return reinterpret_cast(0); + + function_ptr result = reinterpret_cast(0); + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else + result = local_data(i) + .function_store.get(function_name); + + if (result) break; + } + + return result; + } + + inline vararg_function_ptr get_vararg_function(const std::string& vararg_function_name) const + { + if (!valid_function_name(vararg_function_name)) + return reinterpret_cast(0); + + vararg_function_ptr result = reinterpret_cast(0); + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else + result = local_data(i) + .vararg_function_store.get(vararg_function_name); + + if (result) break; + } + + return result; + } + + inline generic_function_ptr get_generic_function(const std::string& function_name) const + { + if (!valid_function_name(function_name)) + return reinterpret_cast(0); + + generic_function_ptr result = reinterpret_cast(0); + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else + result = local_data(i) + .generic_function_store.get(function_name); + + if (result) break; + } + + return result; + } + + inline generic_function_ptr get_string_function(const std::string& function_name) const + { + if (!valid_function_name(function_name)) + return reinterpret_cast(0); + + generic_function_ptr result = reinterpret_cast(0); + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else + result = + local_data(i).string_function_store.get(function_name); + + if (result) break; + } + + return result; + } + + inline generic_function_ptr get_overload_function(const std::string& function_name) const + { + if (!valid_function_name(function_name)) + return reinterpret_cast(0); + + generic_function_ptr result = reinterpret_cast(0); + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else + result = + local_data(i).overload_function_store.get(function_name); + + if (result) break; + } + + return result; + } + + inline vector_context get_vector_context(const std::string& vector_name) const + { + vector_context result; + if (!valid_symbol(vector_name)) + return result; + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + { + continue; + } + + result.vector_holder = local_data(i).vector_store.get(vector_name); + + if (result.vector_holder) + { + result.symbol_table = &symtab_list_[i]; + break; + } + } + + return result; + } + + inline vector_holder_ptr get_vector(const std::string& vector_name) const + { + if (!valid_symbol(vector_name)) + return reinterpret_cast(0); + + vector_holder_ptr result = reinterpret_cast(0); + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else + result = + local_data(i).vector_store.get(vector_name); + + if (result) break; + } + + return result; + } + + inline bool is_constant_node(const std::string& symbol_name) const + { + if (!valid_symbol(symbol_name)) + return false; + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else if (local_data(i).variable_store.is_constant(symbol_name)) + return true; + } + + return false; + } + + #ifndef exprtk_disable_string_capabilities + inline bool is_constant_string(const std::string& symbol_name) const + { + if (!valid_symbol(symbol_name)) + return false; + + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else if (!local_data(i).stringvar_store.symbol_exists(symbol_name)) + continue; + else if (local_data(i).stringvar_store.is_constant(symbol_name)) + return true; + } + + return false; + } + #endif + + inline bool symbol_exists(const std::string& symbol) const + { + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else if (symtab_list_[i].symbol_exists(symbol)) + return true; + } + + return false; + } + + inline bool is_variable(const std::string& variable_name) const + { + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else if ( + symtab_list_[i].local_data().variable_store + .symbol_exists(variable_name) + ) + return true; + } + + return false; + } + + #ifndef exprtk_disable_string_capabilities + inline bool is_stringvar(const std::string& stringvar_name) const + { + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else if ( + symtab_list_[i].local_data().stringvar_store + .symbol_exists(stringvar_name) + ) + return true; + } + + return false; + } + + inline bool is_conststr_stringvar(const std::string& symbol_name) const + { + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else if ( + symtab_list_[i].local_data().stringvar_store + .symbol_exists(symbol_name) + ) + { + return ( + local_data(i).stringvar_store.symbol_exists(symbol_name) || + local_data(i).stringvar_store.is_constant (symbol_name) + ); + + } + } + + return false; + } + #endif + + inline bool is_function(const std::string& function_name) const + { + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else if ( + local_data(i).vararg_function_store + .symbol_exists(function_name) + ) + return true; + } + + return false; + } + + inline bool is_vararg_function(const std::string& vararg_function_name) const + { + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else if ( + local_data(i).vararg_function_store + .symbol_exists(vararg_function_name) + ) + return true; + } + + return false; + } + + inline bool is_vector(const std::string& vector_name) const + { + for (std::size_t i = 0; i < symtab_list_.size(); ++i) + { + if (!symtab_list_[i].valid()) + continue; + else if ( + local_data(i).vector_store + .symbol_exists(vector_name) + ) + return true; + } + + return false; + } + + inline std::string get_variable_name(const expression_node_ptr& ptr) const + { + return local_data().variable_store.entity_name(ptr); + } + + inline std::string get_vector_name(const vector_holder_ptr& ptr) const + { + return local_data().vector_store.entity_name(ptr); + } + + #ifndef exprtk_disable_string_capabilities + inline std::string get_stringvar_name(const expression_node_ptr& ptr) const + { + return local_data().stringvar_store.entity_name(ptr); + } + + inline std::string get_conststr_stringvar_name(const expression_node_ptr& ptr) const + { + return local_data().stringvar_store.entity_name(ptr); + } + #endif + + inline local_data_t& local_data(const std::size_t& index = 0) + { + return symtab_list_[index].local_data(); + } + + inline const local_data_t& local_data(const std::size_t& index = 0) const + { + return symtab_list_[index].local_data(); + } + + inline symbol_table_t& get_symbol_table(const std::size_t& index = 0) + { + return symtab_list_[index]; + } + }; + + struct parser_state + { + parser_state() + : type_check_enabled(true) + { + reset(); + } + + void reset() + { + parsing_return_stmt = false; + parsing_break_stmt = false; + return_stmt_present = false; + side_effect_present = false; + scope_depth = 0; + stack_depth = 0; + parsing_loop_stmt_count = 0; + } + + #ifndef exprtk_enable_debugging + void activate_side_effect(const std::string&) + #else + void activate_side_effect(const std::string& source) + #endif + { + if (!side_effect_present) + { + side_effect_present = true; + + exprtk_debug(("activate_side_effect() - caller: %s\n",source.c_str())); + } + } + + bool parsing_return_stmt; + bool parsing_break_stmt; + bool return_stmt_present; + bool side_effect_present; + bool type_check_enabled; + std::size_t scope_depth; + std::size_t stack_depth; + std::size_t parsing_loop_stmt_count; + }; + + public: + + struct unknown_symbol_resolver + { + + enum usr_symbol_type + { + e_usr_unknown_type = 0, + e_usr_variable_type = 1, + e_usr_constant_type = 2 + }; + + enum usr_mode + { + e_usrmode_default = 0, + e_usrmode_extended = 1 + }; + + usr_mode mode; + + unknown_symbol_resolver(const usr_mode m = e_usrmode_default) + : mode(m) + {} + + virtual ~unknown_symbol_resolver() {} + + virtual bool process(const std::string& /*unknown_symbol*/, + usr_symbol_type& st, + T& default_value, + std::string& error_message) + { + if (e_usrmode_default != mode) + return false; + + st = e_usr_variable_type; + default_value = T(0); + error_message.clear(); + + return true; + } + + virtual bool process(const std::string& /* unknown_symbol */, + symbol_table_t& /* symbol_table */, + std::string& /* error_message */) + { + return false; + } + }; + + enum collect_type + { + e_ct_none = 0, + e_ct_variables = 1, + e_ct_functions = 2, + e_ct_assignments = 4 + }; + + enum symbol_type + { + e_st_unknown = 0, + e_st_variable = 1, + e_st_vector = 2, + e_st_vecelem = 3, + e_st_string = 4, + e_st_function = 5, + e_st_local_variable = 6, + e_st_local_vector = 7, + e_st_local_string = 8 + }; + + class dependent_entity_collector + { + public: + + typedef std::pair symbol_t; + typedef std::vector symbol_list_t; + + dependent_entity_collector(const std::size_t options = e_ct_none) + : options_(options) + , collect_variables_ ((options_ & e_ct_variables ) == e_ct_variables ) + , collect_functions_ ((options_ & e_ct_functions ) == e_ct_functions ) + , collect_assignments_((options_ & e_ct_assignments) == e_ct_assignments) + , return_present_ (false) + , final_stmt_return_(false) + {} + + template class Sequence> + inline std::size_t symbols(Sequence& symbols_list) + { + if (!collect_variables_ && !collect_functions_) + return 0; + else if (symbol_name_list_.empty()) + return 0; + + for (std::size_t i = 0; i < symbol_name_list_.size(); ++i) + { + details::case_normalise(symbol_name_list_[i].first); + } + + std::sort(symbol_name_list_.begin(),symbol_name_list_.end()); + + std::unique_copy(symbol_name_list_.begin(), + symbol_name_list_.end (), + std::back_inserter(symbols_list)); + + return symbols_list.size(); + } + + template class Sequence> + inline std::size_t assignment_symbols(Sequence& assignment_list) + { + if (!collect_assignments_) + return 0; + else if (assignment_name_list_.empty()) + return 0; + + for (std::size_t i = 0; i < assignment_name_list_.size(); ++i) + { + details::case_normalise(assignment_name_list_[i].first); + } + + std::sort(assignment_name_list_.begin(),assignment_name_list_.end()); + + std::unique_copy(assignment_name_list_.begin(), + assignment_name_list_.end (), + std::back_inserter(assignment_list)); + + return assignment_list.size(); + } + + void clear() + { + symbol_name_list_ .clear(); + assignment_name_list_.clear(); + retparam_list_ .clear(); + return_present_ = false; + final_stmt_return_ = false; + } + + bool& collect_variables() + { + return collect_variables_; + } + + bool& collect_functions() + { + return collect_functions_; + } + + bool& collect_assignments() + { + return collect_assignments_; + } + + bool return_present() const + { + return return_present_; + } + + bool final_stmt_return() const + { + return final_stmt_return_; + } + + typedef std::vector retparam_list_t; + + retparam_list_t return_param_type_list() const + { + return retparam_list_; + } + + private: + + inline void add_symbol(const std::string& symbol, const symbol_type st) + { + switch (st) + { + case e_st_variable : + case e_st_vector : + case e_st_string : + case e_st_local_variable : + case e_st_local_vector : + case e_st_local_string : if (collect_variables_) + symbol_name_list_ + .push_back(std::make_pair(symbol, st)); + break; + + case e_st_function : if (collect_functions_) + symbol_name_list_ + .push_back(std::make_pair(symbol, st)); + break; + + default : return; + } + } + + inline void add_assignment(const std::string& symbol, const symbol_type st) + { + switch (st) + { + case e_st_variable : + case e_st_vector : + case e_st_string : if (collect_assignments_) + assignment_name_list_ + .push_back(std::make_pair(symbol, st)); + break; + + default : return; + } + } + + std::size_t options_; + bool collect_variables_; + bool collect_functions_; + bool collect_assignments_; + bool return_present_; + bool final_stmt_return_; + symbol_list_t symbol_name_list_; + symbol_list_t assignment_name_list_; + retparam_list_t retparam_list_; + + friend class parser; + }; + + class settings_store + { + private: + + typedef std::set disabled_entity_set_t; + typedef disabled_entity_set_t::iterator des_itr_t; + + public: + + enum settings_compilation_options + { + e_unknown = 0, + e_replacer = 1, + e_joiner = 2, + e_numeric_check = 4, + e_bracket_check = 8, + e_sequence_check = 16, + e_commutative_check = 32, + e_strength_reduction = 64, + e_disable_vardef = 128, + e_collect_vars = 256, + e_collect_funcs = 512, + e_collect_assings = 1024, + e_disable_usr_on_rsrvd = 2048, + e_disable_zero_return = 4096 + }; + + enum settings_base_funcs + { + e_bf_unknown = 0, + e_bf_abs , e_bf_acos , e_bf_acosh , e_bf_asin , + e_bf_asinh , e_bf_atan , e_bf_atan2 , e_bf_atanh , + e_bf_avg , e_bf_ceil , e_bf_clamp , e_bf_cos , + e_bf_cosh , e_bf_cot , e_bf_csc , e_bf_equal , + e_bf_erf , e_bf_erfc , e_bf_exp , e_bf_expm1 , + e_bf_floor , e_bf_frac , e_bf_hypot , e_bf_iclamp , + e_bf_like , e_bf_log , e_bf_log10 , e_bf_log1p , + e_bf_log2 , e_bf_logn , e_bf_mand , e_bf_max , + e_bf_min , e_bf_mod , e_bf_mor , e_bf_mul , + e_bf_ncdf , e_bf_pow , e_bf_root , e_bf_round , + e_bf_roundn , e_bf_sec , e_bf_sgn , e_bf_sin , + e_bf_sinc , e_bf_sinh , e_bf_sqrt , e_bf_sum , + e_bf_swap , e_bf_tan , e_bf_tanh , e_bf_trunc , + e_bf_not_equal , e_bf_inrange , e_bf_deg2grad , e_bf_deg2rad , + e_bf_rad2deg , e_bf_grad2deg + }; + + enum settings_control_structs + { + e_ctrl_unknown = 0, + e_ctrl_ifelse, + e_ctrl_switch, + e_ctrl_for_loop, + e_ctrl_while_loop, + e_ctrl_repeat_loop, + e_ctrl_return + }; + + enum settings_logic_opr + { + e_logic_unknown = 0, + e_logic_and, e_logic_nand , e_logic_nor , + e_logic_not, e_logic_or , e_logic_xnor, + e_logic_xor, e_logic_scand, e_logic_scor + }; + + enum settings_arithmetic_opr + { + e_arith_unknown = 0, + e_arith_add, e_arith_sub, e_arith_mul, + e_arith_div, e_arith_mod, e_arith_pow + }; + + enum settings_assignment_opr + { + e_assign_unknown = 0, + e_assign_assign, e_assign_addass, e_assign_subass, + e_assign_mulass, e_assign_divass, e_assign_modass + }; + + enum settings_inequality_opr + { + e_ineq_unknown = 0, + e_ineq_lt , e_ineq_lte, e_ineq_eq , + e_ineq_equal, e_ineq_ne , e_ineq_nequal, + e_ineq_gte , e_ineq_gt + }; + + static const std::size_t compile_all_opts = + e_replacer + + e_joiner + + e_numeric_check + + e_bracket_check + + e_sequence_check + + e_commutative_check + + e_strength_reduction; + + settings_store(const std::size_t compile_options = compile_all_opts) + : max_stack_depth_(400) + , max_node_depth_(10000) + { + load_compile_options(compile_options); + } + + settings_store& enable_all_base_functions() + { + disabled_func_set_.clear(); + return (*this); + } + + settings_store& enable_all_control_structures() + { + disabled_ctrl_set_.clear(); + return (*this); + } + + settings_store& enable_all_logic_ops() + { + disabled_logic_set_.clear(); + return (*this); + } + + settings_store& enable_all_arithmetic_ops() + { + disabled_arithmetic_set_.clear(); + return (*this); + } + + settings_store& enable_all_assignment_ops() + { + disabled_assignment_set_.clear(); + return (*this); + } + + settings_store& enable_all_inequality_ops() + { + disabled_inequality_set_.clear(); + return (*this); + } + + settings_store& enable_local_vardef() + { + disable_vardef_ = false; + return (*this); + } + + settings_store& disable_all_base_functions() + { + std::copy(details::base_function_list, + details::base_function_list + details::base_function_list_size, + std::insert_iterator + (disabled_func_set_, disabled_func_set_.begin())); + return (*this); + } + + settings_store& disable_all_control_structures() + { + std::copy(details::cntrl_struct_list, + details::cntrl_struct_list + details::cntrl_struct_list_size, + std::insert_iterator + (disabled_ctrl_set_, disabled_ctrl_set_.begin())); + return (*this); + } + + settings_store& disable_all_logic_ops() + { + std::copy(details::logic_ops_list, + details::logic_ops_list + details::logic_ops_list_size, + std::insert_iterator + (disabled_logic_set_, disabled_logic_set_.begin())); + return (*this); + } + + settings_store& disable_all_arithmetic_ops() + { + std::copy(details::arithmetic_ops_list, + details::arithmetic_ops_list + details::arithmetic_ops_list_size, + std::insert_iterator + (disabled_arithmetic_set_, disabled_arithmetic_set_.begin())); + return (*this); + } + + settings_store& disable_all_assignment_ops() + { + std::copy(details::assignment_ops_list, + details::assignment_ops_list + details::assignment_ops_list_size, + std::insert_iterator + (disabled_assignment_set_, disabled_assignment_set_.begin())); + return (*this); + } + + settings_store& disable_all_inequality_ops() + { + std::copy(details::inequality_ops_list, + details::inequality_ops_list + details::inequality_ops_list_size, + std::insert_iterator + (disabled_inequality_set_, disabled_inequality_set_.begin())); + return (*this); + } + + settings_store& disable_local_vardef() + { + disable_vardef_ = true; + return (*this); + } + + bool replacer_enabled () const { return enable_replacer_; } + bool commutative_check_enabled () const { return enable_commutative_check_; } + bool joiner_enabled () const { return enable_joiner_; } + bool numeric_check_enabled () const { return enable_numeric_check_; } + bool bracket_check_enabled () const { return enable_bracket_check_; } + bool sequence_check_enabled () const { return enable_sequence_check_; } + bool strength_reduction_enabled () const { return enable_strength_reduction_; } + bool collect_variables_enabled () const { return enable_collect_vars_; } + bool collect_functions_enabled () const { return enable_collect_funcs_; } + bool collect_assignments_enabled() const { return enable_collect_assings_; } + bool vardef_disabled () const { return disable_vardef_; } + bool rsrvd_sym_usr_disabled () const { return disable_rsrvd_sym_usr_; } + bool zero_return_disabled () const { return disable_zero_return_; } + + bool function_enabled(const std::string& function_name) const + { + if (disabled_func_set_.empty()) + return true; + else + return (disabled_func_set_.end() == disabled_func_set_.find(function_name)); + } + + bool control_struct_enabled(const std::string& control_struct) const + { + if (disabled_ctrl_set_.empty()) + return true; + else + return (disabled_ctrl_set_.end() == disabled_ctrl_set_.find(control_struct)); + } + + bool logic_enabled(const std::string& logic_operation) const + { + if (disabled_logic_set_.empty()) + return true; + else + return (disabled_logic_set_.end() == disabled_logic_set_.find(logic_operation)); + } + + bool arithmetic_enabled(const details::operator_type& arithmetic_operation) const + { + if (disabled_logic_set_.empty()) + return true; + else + return disabled_arithmetic_set_.end() == disabled_arithmetic_set_ + .find(arith_opr_to_string(arithmetic_operation)); + } + + bool assignment_enabled(const details::operator_type& assignment) const + { + if (disabled_assignment_set_.empty()) + return true; + else + return disabled_assignment_set_.end() == disabled_assignment_set_ + .find(assign_opr_to_string(assignment)); + } + + bool inequality_enabled(const details::operator_type& inequality) const + { + if (disabled_inequality_set_.empty()) + return true; + else + return disabled_inequality_set_.end() == disabled_inequality_set_ + .find(inequality_opr_to_string(inequality)); + } + + bool function_disabled(const std::string& function_name) const + { + if (disabled_func_set_.empty()) + return false; + else + return (disabled_func_set_.end() != disabled_func_set_.find(function_name)); + } + + bool control_struct_disabled(const std::string& control_struct) const + { + if (disabled_ctrl_set_.empty()) + return false; + else + return (disabled_ctrl_set_.end() != disabled_ctrl_set_.find(control_struct)); + } + + bool logic_disabled(const std::string& logic_operation) const + { + if (disabled_logic_set_.empty()) + return false; + else + return (disabled_logic_set_.end() != disabled_logic_set_.find(logic_operation)); + } + + bool assignment_disabled(const details::operator_type assignment_operation) const + { + if (disabled_assignment_set_.empty()) + return false; + else + return disabled_assignment_set_.end() != disabled_assignment_set_ + .find(assign_opr_to_string(assignment_operation)); + } + + bool logic_disabled(const details::operator_type logic_operation) const + { + if (disabled_logic_set_.empty()) + return false; + else + return disabled_logic_set_.end() != disabled_logic_set_ + .find(logic_opr_to_string(logic_operation)); + } + + bool arithmetic_disabled(const details::operator_type arithmetic_operation) const + { + if (disabled_arithmetic_set_.empty()) + return false; + else + return disabled_arithmetic_set_.end() != disabled_arithmetic_set_ + .find(arith_opr_to_string(arithmetic_operation)); + } + + bool inequality_disabled(const details::operator_type& inequality) const + { + if (disabled_inequality_set_.empty()) + return false; + else + return disabled_inequality_set_.end() != disabled_inequality_set_ + .find(inequality_opr_to_string(inequality)); + } + + settings_store& disable_base_function(settings_base_funcs bf) + { + if ( + (e_bf_unknown != bf) && + (static_cast(bf) < (details::base_function_list_size + 1)) + ) + { + disabled_func_set_.insert(details::base_function_list[bf - 1]); + } + + return (*this); + } + + settings_store& disable_control_structure(settings_control_structs ctrl_struct) + { + if ( + (e_ctrl_unknown != ctrl_struct) && + (static_cast(ctrl_struct) < (details::cntrl_struct_list_size + 1)) + ) + { + disabled_ctrl_set_.insert(details::cntrl_struct_list[ctrl_struct - 1]); + } + + return (*this); + } + + settings_store& disable_logic_operation(settings_logic_opr logic) + { + if ( + (e_logic_unknown != logic) && + (static_cast(logic) < (details::logic_ops_list_size + 1)) + ) + { + disabled_logic_set_.insert(details::logic_ops_list[logic - 1]); + } + + return (*this); + } + + settings_store& disable_arithmetic_operation(settings_arithmetic_opr arithmetic) + { + if ( + (e_arith_unknown != arithmetic) && + (static_cast(arithmetic) < (details::arithmetic_ops_list_size + 1)) + ) + { + disabled_arithmetic_set_.insert(details::arithmetic_ops_list[arithmetic - 1]); + } + + return (*this); + } + + settings_store& disable_assignment_operation(settings_assignment_opr assignment) + { + if ( + (e_assign_unknown != assignment) && + (static_cast(assignment) < (details::assignment_ops_list_size + 1)) + ) + { + disabled_assignment_set_.insert(details::assignment_ops_list[assignment - 1]); + } + + return (*this); + } + + settings_store& disable_inequality_operation(settings_inequality_opr inequality) + { + if ( + (e_ineq_unknown != inequality) && + (static_cast(inequality) < (details::inequality_ops_list_size + 1)) + ) + { + disabled_inequality_set_.insert(details::inequality_ops_list[inequality - 1]); + } + + return (*this); + } + + settings_store& enable_base_function(settings_base_funcs bf) + { + if ( + (e_bf_unknown != bf) && + (static_cast(bf) < (details::base_function_list_size + 1)) + ) + { + const des_itr_t itr = disabled_func_set_.find(details::base_function_list[bf - 1]); + + if (disabled_func_set_.end() != itr) + { + disabled_func_set_.erase(itr); + } + } + + return (*this); + } + + settings_store& enable_control_structure(settings_control_structs ctrl_struct) + { + if ( + (e_ctrl_unknown != ctrl_struct) && + (static_cast(ctrl_struct) < (details::cntrl_struct_list_size + 1)) + ) + { + const des_itr_t itr = disabled_ctrl_set_.find(details::cntrl_struct_list[ctrl_struct - 1]); + + if (disabled_ctrl_set_.end() != itr) + { + disabled_ctrl_set_.erase(itr); + } + } + + return (*this); + } + + settings_store& enable_logic_operation(settings_logic_opr logic) + { + if ( + (e_logic_unknown != logic) && + (static_cast(logic) < (details::logic_ops_list_size + 1)) + ) + { + const des_itr_t itr = disabled_logic_set_.find(details::logic_ops_list[logic - 1]); + + if (disabled_logic_set_.end() != itr) + { + disabled_logic_set_.erase(itr); + } + } + + return (*this); + } + + settings_store& enable_arithmetic_operation(settings_arithmetic_opr arithmetic) + { + if ( + (e_arith_unknown != arithmetic) && + (static_cast(arithmetic) < (details::arithmetic_ops_list_size + 1)) + ) + { + const des_itr_t itr = disabled_arithmetic_set_.find(details::arithmetic_ops_list[arithmetic - 1]); + + if (disabled_arithmetic_set_.end() != itr) + { + disabled_arithmetic_set_.erase(itr); + } + } + + return (*this); + } + + settings_store& enable_assignment_operation(settings_assignment_opr assignment) + { + if ( + (e_assign_unknown != assignment) && + (static_cast(assignment) < (details::assignment_ops_list_size + 1)) + ) + { + const des_itr_t itr = disabled_assignment_set_.find(details::assignment_ops_list[assignment - 1]); + + if (disabled_assignment_set_.end() != itr) + { + disabled_assignment_set_.erase(itr); + } + } + + return (*this); + } + + settings_store& enable_inequality_operation(settings_inequality_opr inequality) + { + if ( + (e_ineq_unknown != inequality) && + (static_cast(inequality) < (details::inequality_ops_list_size + 1)) + ) + { + const des_itr_t itr = disabled_inequality_set_.find(details::inequality_ops_list[inequality - 1]); + + if (disabled_inequality_set_.end() != itr) + { + disabled_inequality_set_.erase(itr); + } + } + + return (*this); + } + + void set_max_stack_depth(const std::size_t max_stack_depth) + { + max_stack_depth_ = max_stack_depth; + } + + void set_max_node_depth(const std::size_t max_node_depth) + { + max_node_depth_ = max_node_depth; + } + + private: + + void load_compile_options(const std::size_t compile_options) + { + enable_replacer_ = (compile_options & e_replacer ) == e_replacer; + enable_joiner_ = (compile_options & e_joiner ) == e_joiner; + enable_numeric_check_ = (compile_options & e_numeric_check ) == e_numeric_check; + enable_bracket_check_ = (compile_options & e_bracket_check ) == e_bracket_check; + enable_sequence_check_ = (compile_options & e_sequence_check ) == e_sequence_check; + enable_commutative_check_ = (compile_options & e_commutative_check ) == e_commutative_check; + enable_strength_reduction_ = (compile_options & e_strength_reduction ) == e_strength_reduction; + enable_collect_vars_ = (compile_options & e_collect_vars ) == e_collect_vars; + enable_collect_funcs_ = (compile_options & e_collect_funcs ) == e_collect_funcs; + enable_collect_assings_ = (compile_options & e_collect_assings ) == e_collect_assings; + disable_vardef_ = (compile_options & e_disable_vardef ) == e_disable_vardef; + disable_rsrvd_sym_usr_ = (compile_options & e_disable_usr_on_rsrvd) == e_disable_usr_on_rsrvd; + disable_zero_return_ = (compile_options & e_disable_zero_return ) == e_disable_zero_return; + } + + std::string assign_opr_to_string(details::operator_type opr) const + { + switch (opr) + { + case details::e_assign : return ":="; + case details::e_addass : return "+="; + case details::e_subass : return "-="; + case details::e_mulass : return "*="; + case details::e_divass : return "/="; + case details::e_modass : return "%="; + default : return "" ; + } + } + + std::string arith_opr_to_string(details::operator_type opr) const + { + switch (opr) + { + case details::e_add : return "+"; + case details::e_sub : return "-"; + case details::e_mul : return "*"; + case details::e_div : return "/"; + case details::e_mod : return "%"; + default : return "" ; + } + } + + std::string inequality_opr_to_string(details::operator_type opr) const + { + switch (opr) + { + case details::e_lt : return "<" ; + case details::e_lte : return "<="; + case details::e_eq : return "=="; + case details::e_equal : return "=" ; + case details::e_ne : return "!="; + case details::e_nequal: return "<>"; + case details::e_gte : return ">="; + case details::e_gt : return ">" ; + default : return "" ; + } + } + + std::string logic_opr_to_string(details::operator_type opr) const + { + switch (opr) + { + case details::e_and : return "and" ; + case details::e_or : return "or" ; + case details::e_xor : return "xor" ; + case details::e_nand : return "nand"; + case details::e_nor : return "nor" ; + case details::e_xnor : return "xnor"; + case details::e_notl : return "not" ; + default : return "" ; + } + } + + bool enable_replacer_; + bool enable_joiner_; + bool enable_numeric_check_; + bool enable_bracket_check_; + bool enable_sequence_check_; + bool enable_commutative_check_; + bool enable_strength_reduction_; + bool enable_collect_vars_; + bool enable_collect_funcs_; + bool enable_collect_assings_; + bool disable_vardef_; + bool disable_rsrvd_sym_usr_; + bool disable_zero_return_; + + disabled_entity_set_t disabled_func_set_ ; + disabled_entity_set_t disabled_ctrl_set_ ; + disabled_entity_set_t disabled_logic_set_; + disabled_entity_set_t disabled_arithmetic_set_; + disabled_entity_set_t disabled_assignment_set_; + disabled_entity_set_t disabled_inequality_set_; + + std::size_t max_stack_depth_; + std::size_t max_node_depth_; + + friend class parser; + }; + + typedef settings_store settings_t; + + parser(const settings_t& settings = settings_t()) + : settings_(settings) + , resolve_unknown_symbol_(false) + , results_context_(0) + , unknown_symbol_resolver_(reinterpret_cast(0)) + #ifdef _MSC_VER + #pragma warning(push) + #pragma warning (disable:4355) + #endif + , sem_(*this) + #ifdef _MSC_VER + #pragma warning(pop) + #endif + , operator_joiner_2_(2) + , operator_joiner_3_(3) + , loop_runtime_check_(0) + { + init_precompilation(); + + load_operations_map (base_ops_map_ ); + load_unary_operations_map (unary_op_map_ ); + load_binary_operations_map (binary_op_map_ ); + load_inv_binary_operations_map(inv_binary_op_map_); + load_sf3_map (sf3_map_ ); + load_sf4_map (sf4_map_ ); + + expression_generator_.init_synthesize_map(); + expression_generator_.set_parser(*this); + expression_generator_.set_uom(unary_op_map_); + expression_generator_.set_bom(binary_op_map_); + expression_generator_.set_ibom(inv_binary_op_map_); + expression_generator_.set_sf3m(sf3_map_); + expression_generator_.set_sf4m(sf4_map_); + expression_generator_.set_strength_reduction_state(settings_.strength_reduction_enabled()); + } + + ~parser() {} + + inline void init_precompilation() + { + dec_.collect_variables() = + settings_.collect_variables_enabled(); + + dec_.collect_functions() = + settings_.collect_functions_enabled(); + + dec_.collect_assignments() = + settings_.collect_assignments_enabled(); + + if (settings_.replacer_enabled()) + { + symbol_replacer_.clear(); + symbol_replacer_.add_replace("true" , "1", lexer::token::e_number); + symbol_replacer_.add_replace("false", "0", lexer::token::e_number); + helper_assembly_.token_modifier_list.clear(); + helper_assembly_.register_modifier(&symbol_replacer_); + } + + if (settings_.commutative_check_enabled()) + { + for (std::size_t i = 0; i < details::reserved_words_size; ++i) + { + commutative_inserter_.ignore_symbol(details::reserved_words[i]); + } + + helper_assembly_.token_inserter_list.clear(); + helper_assembly_.register_inserter(&commutative_inserter_); + } + + if (settings_.joiner_enabled()) + { + helper_assembly_.token_joiner_list.clear(); + helper_assembly_.register_joiner(&operator_joiner_2_); + helper_assembly_.register_joiner(&operator_joiner_3_); + } + + if ( + settings_.numeric_check_enabled () || + settings_.bracket_check_enabled () || + settings_.sequence_check_enabled() + ) + { + helper_assembly_.token_scanner_list.clear(); + + if (settings_.numeric_check_enabled()) + { + helper_assembly_.register_scanner(&numeric_checker_); + } + + if (settings_.bracket_check_enabled()) + { + helper_assembly_.register_scanner(&bracket_checker_); + } + + if (settings_.sequence_check_enabled()) + { + helper_assembly_.register_scanner(&sequence_validator_ ); + helper_assembly_.register_scanner(&sequence_validator_3tkns_); + } + } + } + + inline bool compile(const std::string& expression_string, expression& expr) + { + state_ .reset(); + error_list_ .clear(); + brkcnt_list_ .clear(); + synthesis_error_.clear(); + sem_ .cleanup(); + + return_cleanup(); + + expression_generator_.set_allocator(node_allocator_); + + if (expression_string.empty()) + { + set_error( + make_error(parser_error::e_syntax, + "ERR001 - Empty expression!", + exprtk_error_location)); + + return false; + } + + if (!init(expression_string)) + { + process_lexer_errors(); + return false; + } + + if (lexer().empty()) + { + set_error( + make_error(parser_error::e_syntax, + "ERR002 - Empty expression!", + exprtk_error_location)); + + return false; + } + + if (!run_assemblies()) + { + return false; + } + + symtab_store_.symtab_list_ = expr.get_symbol_table_list(); + dec_.clear(); + + lexer().begin(); + + next_token(); + + expression_node_ptr e = parse_corpus(); + + if ((0 != e) && (token_t::e_eof == current_token().type)) + { + bool* retinvk_ptr = 0; + + if (state_.return_stmt_present) + { + dec_.return_present_ = true; + + e = expression_generator_ + .return_envelope(e, results_context_, retinvk_ptr); + } + + expr.set_expression(e); + expr.set_retinvk(retinvk_ptr); + + register_local_vars(expr); + register_return_results(expr); + + return !(!expr); + } + else + { + if (error_list_.empty()) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR003 - Invalid expression encountered", + exprtk_error_location)); + } + + if ((0 != e) && branch_deletable(e)) + { + destroy_node(e); + } + + dec_.clear (); + sem_.cleanup (); + return_cleanup(); + + return false; + } + } + + inline expression_t compile(const std::string& expression_string, symbol_table_t& symtab) + { + expression_t expression; + expression.register_symbol_table(symtab); + compile(expression_string,expression); + return expression; + } + + void process_lexer_errors() + { + for (std::size_t i = 0; i < lexer().size(); ++i) + { + if (lexer()[i].is_error()) + { + std::string diagnostic = "ERR004 - "; + + switch (lexer()[i].type) + { + case lexer::token::e_error : diagnostic += "General token error"; + break; + + case lexer::token::e_err_symbol : diagnostic += "Symbol error"; + break; + + case lexer::token::e_err_number : diagnostic += "Invalid numeric token"; + break; + + case lexer::token::e_err_string : diagnostic += "Invalid string token"; + break; + + case lexer::token::e_err_sfunc : diagnostic += "Invalid special function token"; + break; + + default : diagnostic += "Unknown compiler error"; + } + + set_error( + make_error(parser_error::e_lexer, + lexer()[i], + diagnostic + ": " + lexer()[i].value, + exprtk_error_location)); + } + } + } + + inline bool run_assemblies() + { + if (settings_.commutative_check_enabled()) + { + helper_assembly_.run_inserters(lexer()); + } + + if (settings_.joiner_enabled()) + { + helper_assembly_.run_joiners(lexer()); + } + + if (settings_.replacer_enabled()) + { + helper_assembly_.run_modifiers(lexer()); + } + + if ( + settings_.numeric_check_enabled () || + settings_.bracket_check_enabled () || + settings_.sequence_check_enabled() + ) + { + if (!helper_assembly_.run_scanners(lexer())) + { + if (helper_assembly_.error_token_scanner) + { + lexer::helper::bracket_checker* bracket_checker_ptr = 0; + lexer::helper::numeric_checker* numeric_checker_ptr = 0; + lexer::helper::sequence_validator* sequence_validator_ptr = 0; + lexer::helper::sequence_validator_3tokens* sequence_validator3_ptr = 0; + + if (0 != (bracket_checker_ptr = dynamic_cast(helper_assembly_.error_token_scanner))) + { + set_error( + make_error(parser_error::e_token, + bracket_checker_ptr->error_token(), + "ERR005 - Mismatched brackets: '" + bracket_checker_ptr->error_token().value + "'", + exprtk_error_location)); + } + else if (0 != (numeric_checker_ptr = dynamic_cast*>(helper_assembly_.error_token_scanner))) + { + for (std::size_t i = 0; i < numeric_checker_ptr->error_count(); ++i) + { + lexer::token error_token = lexer()[numeric_checker_ptr->error_index(i)]; + + set_error( + make_error(parser_error::e_token, + error_token, + "ERR006 - Invalid numeric token: '" + error_token.value + "'", + exprtk_error_location)); + } + + if (numeric_checker_ptr->error_count()) + { + numeric_checker_ptr->clear_errors(); + } + } + else if (0 != (sequence_validator_ptr = dynamic_cast(helper_assembly_.error_token_scanner))) + { + for (std::size_t i = 0; i < sequence_validator_ptr->error_count(); ++i) + { + std::pair error_token = sequence_validator_ptr->error(i); + + set_error( + make_error(parser_error::e_token, + error_token.first, + "ERR007 - Invalid token sequence: '" + + error_token.first.value + "' and '" + + error_token.second.value + "'", + exprtk_error_location)); + } + + if (sequence_validator_ptr->error_count()) + { + sequence_validator_ptr->clear_errors(); + } + } + else if (0 != (sequence_validator3_ptr = dynamic_cast(helper_assembly_.error_token_scanner))) + { + for (std::size_t i = 0; i < sequence_validator3_ptr->error_count(); ++i) + { + std::pair error_token = sequence_validator3_ptr->error(i); + + set_error( + make_error(parser_error::e_token, + error_token.first, + "ERR008 - Invalid token sequence: '" + + error_token.first.value + "' and '" + + error_token.second.value + "'", + exprtk_error_location)); + } + + if (sequence_validator3_ptr->error_count()) + { + sequence_validator3_ptr->clear_errors(); + } + } + } + + return false; + } + } + + return true; + } + + inline settings_store& settings() + { + return settings_; + } + + inline parser_error::type get_error(const std::size_t& index) const + { + if (index < error_list_.size()) + return error_list_[index]; + else + throw std::invalid_argument("parser::get_error() - Invalid error index specificed"); + } + + inline std::string error() const + { + if (!error_list_.empty()) + { + return error_list_[0].diagnostic; + } + else + return std::string("No Error"); + } + + inline std::size_t error_count() const + { + return error_list_.size(); + } + + inline dependent_entity_collector& dec() + { + return dec_; + } + + inline bool replace_symbol(const std::string& old_symbol, const std::string& new_symbol) + { + if (!settings_.replacer_enabled()) + return false; + else if (details::is_reserved_word(old_symbol)) + return false; + else + return symbol_replacer_.add_replace(old_symbol,new_symbol,lexer::token::e_symbol); + } + + inline bool remove_replace_symbol(const std::string& symbol) + { + if (!settings_.replacer_enabled()) + return false; + else if (details::is_reserved_word(symbol)) + return false; + else + return symbol_replacer_.remove(symbol); + } + + inline void enable_unknown_symbol_resolver(unknown_symbol_resolver* usr = reinterpret_cast(0)) + { + resolve_unknown_symbol_ = true; + + if (usr) + unknown_symbol_resolver_ = usr; + else + unknown_symbol_resolver_ = &default_usr_; + } + + inline void enable_unknown_symbol_resolver(unknown_symbol_resolver& usr) + { + enable_unknown_symbol_resolver(&usr); + } + + inline void disable_unknown_symbol_resolver() + { + resolve_unknown_symbol_ = false; + unknown_symbol_resolver_ = &default_usr_; + } + + inline void register_loop_runtime_check(loop_runtime_check& lrtchk) + { + loop_runtime_check_ = &lrtchk; + } + + inline void clear_loop_runtime_check() + { + loop_runtime_check_ = loop_runtime_check_ptr(0); + } + + private: + + inline bool valid_base_operation(const std::string& symbol) const + { + const std::size_t length = symbol.size(); + + if ( + (length < 3) || // Shortest base op symbol length + (length > 9) // Longest base op symbol length + ) + return false; + else + return settings_.function_enabled(symbol) && + (base_ops_map_.end() != base_ops_map_.find(symbol)); + } + + inline bool valid_vararg_operation(const std::string& symbol) const + { + static const std::string s_sum = "sum" ; + static const std::string s_mul = "mul" ; + static const std::string s_avg = "avg" ; + static const std::string s_min = "min" ; + static const std::string s_max = "max" ; + static const std::string s_mand = "mand"; + static const std::string s_mor = "mor" ; + static const std::string s_multi = "~" ; + static const std::string s_mswitch = "[*]" ; + + return + ( + details::imatch(symbol,s_sum ) || + details::imatch(symbol,s_mul ) || + details::imatch(symbol,s_avg ) || + details::imatch(symbol,s_min ) || + details::imatch(symbol,s_max ) || + details::imatch(symbol,s_mand ) || + details::imatch(symbol,s_mor ) || + details::imatch(symbol,s_multi ) || + details::imatch(symbol,s_mswitch) + ) && + settings_.function_enabled(symbol); + } + + bool is_invalid_logic_operation(const details::operator_type operation) const + { + return settings_.logic_disabled(operation); + } + + bool is_invalid_arithmetic_operation(const details::operator_type operation) const + { + return settings_.arithmetic_disabled(operation); + } + + bool is_invalid_assignment_operation(const details::operator_type operation) const + { + return settings_.assignment_disabled(operation); + } + + bool is_invalid_inequality_operation(const details::operator_type operation) const + { + return settings_.inequality_disabled(operation); + } + + #ifdef exprtk_enable_debugging + inline void next_token() + { + const std::string ct_str = current_token().value; + const std::size_t ct_pos = current_token().position; + parser_helper::next_token(); + const std::string depth(2 * state_.scope_depth,' '); + exprtk_debug(("%s" + "prev[%s | %04d] --> curr[%s | %04d] stack_level: %3d\n", + depth.c_str(), + ct_str.c_str(), + static_cast(ct_pos), + current_token().value.c_str(), + static_cast(current_token().position), + static_cast(state_.stack_depth))); + } + #endif + + inline expression_node_ptr parse_corpus() + { + std::vector arg_list; + std::vector side_effect_list; + + scoped_vec_delete sdd((*this),arg_list); + + lexer::token begin_token; + lexer::token end_token; + + for ( ; ; ) + { + state_.side_effect_present = false; + + begin_token = current_token(); + + expression_node_ptr arg = parse_expression(); + + if (0 == arg) + { + if (error_list_.empty()) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR009 - Invalid expression encountered", + exprtk_error_location)); + } + + return error_node(); + } + else + { + arg_list.push_back(arg); + + side_effect_list.push_back(state_.side_effect_present); + + end_token = current_token(); + + const std::string sub_expr = construct_subexpr(begin_token, end_token); + + exprtk_debug(("parse_corpus(%02d) Subexpr: %s\n", + static_cast(arg_list.size() - 1), + sub_expr.c_str())); + + exprtk_debug(("parse_corpus(%02d) - Side effect present: %s\n", + static_cast(arg_list.size() - 1), + state_.side_effect_present ? "true" : "false")); + + exprtk_debug(("-------------------------------------------------\n")); + } + + if (lexer().finished()) + break; + else if (token_is(token_t::e_eof,prsrhlpr_t::e_hold)) + { + if (lexer().finished()) + break; + else + next_token(); + } + } + + if ( + !arg_list.empty() && + is_return_node(arg_list.back()) + ) + { + dec_.final_stmt_return_ = true; + } + + const expression_node_ptr result = simplify(arg_list,side_effect_list); + + sdd.delete_ptr = (0 == result); + + return result; + } + + std::string construct_subexpr(lexer::token& begin_token, lexer::token& end_token) + { + std::string result = lexer().substr(begin_token.position,end_token.position); + + for (std::size_t i = 0; i < result.size(); ++i) + { + if (details::is_whitespace(result[i])) result[i] = ' '; + } + + return result; + } + + static const precedence_level default_precedence = e_level00; + + struct state_t + { + inline void set(const precedence_level& l, + const precedence_level& r, + const details::operator_type& o) + { + left = l; + right = r; + operation = o; + } + + inline void reset() + { + left = e_level00; + right = e_level00; + operation = details::e_default; + } + + precedence_level left; + precedence_level right; + details::operator_type operation; + }; + + inline expression_node_ptr parse_expression(precedence_level precedence = e_level00) + { + stack_limit_handler slh(*this); + + if (!slh) + { + return error_node(); + } + + expression_node_ptr expression = parse_branch(precedence); + + if (0 == expression) + { + return error_node(); + } + + bool break_loop = false; + + state_t current_state; + + for ( ; ; ) + { + current_state.reset(); + + switch (current_token().type) + { + case token_t::e_assign : current_state.set(e_level00, e_level00, details::e_assign); break; + case token_t::e_addass : current_state.set(e_level00, e_level00, details::e_addass); break; + case token_t::e_subass : current_state.set(e_level00, e_level00, details::e_subass); break; + case token_t::e_mulass : current_state.set(e_level00, e_level00, details::e_mulass); break; + case token_t::e_divass : current_state.set(e_level00, e_level00, details::e_divass); break; + case token_t::e_modass : current_state.set(e_level00, e_level00, details::e_modass); break; + case token_t::e_swap : current_state.set(e_level00, e_level00, details::e_swap ); break; + case token_t::e_lt : current_state.set(e_level05, e_level06, details::e_lt ); break; + case token_t::e_lte : current_state.set(e_level05, e_level06, details::e_lte ); break; + case token_t::e_eq : current_state.set(e_level05, e_level06, details::e_eq ); break; + case token_t::e_ne : current_state.set(e_level05, e_level06, details::e_ne ); break; + case token_t::e_gte : current_state.set(e_level05, e_level06, details::e_gte ); break; + case token_t::e_gt : current_state.set(e_level05, e_level06, details::e_gt ); break; + case token_t::e_add : current_state.set(e_level07, e_level08, details::e_add ); break; + case token_t::e_sub : current_state.set(e_level07, e_level08, details::e_sub ); break; + case token_t::e_div : current_state.set(e_level10, e_level11, details::e_div ); break; + case token_t::e_mul : current_state.set(e_level10, e_level11, details::e_mul ); break; + case token_t::e_mod : current_state.set(e_level10, e_level11, details::e_mod ); break; + case token_t::e_pow : current_state.set(e_level12, e_level12, details::e_pow ); break; + default : if (token_t::e_symbol == current_token().type) + { + static const std::string s_and = "and" ; + static const std::string s_nand = "nand" ; + static const std::string s_or = "or" ; + static const std::string s_nor = "nor" ; + static const std::string s_xor = "xor" ; + static const std::string s_xnor = "xnor" ; + static const std::string s_in = "in" ; + static const std::string s_like = "like" ; + static const std::string s_ilike = "ilike"; + static const std::string s_and1 = "&" ; + static const std::string s_or1 = "|" ; + static const std::string s_not = "not" ; + + if (details::imatch(current_token().value,s_and)) + { + current_state.set(e_level03, e_level04, details::e_and); + break; + } + else if (details::imatch(current_token().value,s_and1)) + { + #ifndef exprtk_disable_sc_andor + current_state.set(e_level03, e_level04, details::e_scand); + #else + current_state.set(e_level03, e_level04, details::e_and); + #endif + break; + } + else if (details::imatch(current_token().value,s_nand)) + { + current_state.set(e_level03, e_level04, details::e_nand); + break; + } + else if (details::imatch(current_token().value,s_or)) + { + current_state.set(e_level01, e_level02, details::e_or); + break; + } + else if (details::imatch(current_token().value,s_or1)) + { + #ifndef exprtk_disable_sc_andor + current_state.set(e_level01, e_level02, details::e_scor); + #else + current_state.set(e_level01, e_level02, details::e_or); + #endif + break; + } + else if (details::imatch(current_token().value,s_nor)) + { + current_state.set(e_level01, e_level02, details::e_nor); + break; + } + else if (details::imatch(current_token().value,s_xor)) + { + current_state.set(e_level01, e_level02, details::e_xor); + break; + } + else if (details::imatch(current_token().value,s_xnor)) + { + current_state.set(e_level01, e_level02, details::e_xnor); + break; + } + else if (details::imatch(current_token().value,s_in)) + { + current_state.set(e_level04, e_level04, details::e_in); + break; + } + else if (details::imatch(current_token().value,s_like)) + { + current_state.set(e_level04, e_level04, details::e_like); + break; + } + else if (details::imatch(current_token().value,s_ilike)) + { + current_state.set(e_level04, e_level04, details::e_ilike); + break; + } + else if (details::imatch(current_token().value,s_not)) + { + break; + } + } + + break_loop = true; + } + + if (break_loop) + { + parse_pending_string_rangesize(expression); + break; + } + else if (current_state.left < precedence) + break; + + const lexer::token prev_token = current_token(); + + next_token(); + + expression_node_ptr right_branch = error_node(); + expression_node_ptr new_expression = error_node(); + + if (is_invalid_logic_operation(current_state.operation)) + { + free_node(node_allocator_,expression); + + set_error( + make_error(parser_error::e_syntax, + prev_token, + "ERR010 - Invalid or disabled logic operation '" + details::to_str(current_state.operation) + "'", + exprtk_error_location)); + + return error_node(); + } + else if (is_invalid_arithmetic_operation(current_state.operation)) + { + free_node(node_allocator_,expression); + + set_error( + make_error(parser_error::e_syntax, + prev_token, + "ERR011 - Invalid or disabled arithmetic operation '" + details::to_str(current_state.operation) + "'", + exprtk_error_location)); + + return error_node(); + } + else if (is_invalid_inequality_operation(current_state.operation)) + { + free_node(node_allocator_,expression); + + set_error( + make_error(parser_error::e_syntax, + prev_token, + "ERR012 - Invalid inequality operation '" + details::to_str(current_state.operation) + "'", + exprtk_error_location)); + + return error_node(); + } + else if (is_invalid_assignment_operation(current_state.operation)) + { + free_node(node_allocator_,expression); + + set_error( + make_error(parser_error::e_syntax, + prev_token, + "ERR013 - Invalid or disabled assignment operation '" + details::to_str(current_state.operation) + "'", + exprtk_error_location)); + + return error_node(); + } + + if (0 != (right_branch = parse_expression(current_state.right))) + { + if ( + details::is_return_node(expression ) || + details::is_return_node(right_branch) + ) + { + free_node(node_allocator_, expression ); + free_node(node_allocator_, right_branch); + + set_error( + make_error(parser_error::e_syntax, + prev_token, + "ERR014 - Return statements cannot be part of sub-expressions", + exprtk_error_location)); + + return error_node(); + } + + new_expression = expression_generator_ + ( + current_state.operation, + expression, + right_branch + ); + } + + if (0 == new_expression) + { + if (error_list_.empty()) + { + set_error( + make_error(parser_error::e_syntax, + prev_token, + !synthesis_error_.empty() ? + synthesis_error_ : + "ERR015 - General parsing error at token: '" + prev_token.value + "'", + exprtk_error_location)); + } + + free_node(node_allocator_, expression ); + free_node(node_allocator_, right_branch); + + return error_node(); + } + else + { + if ( + token_is(token_t::e_ternary,prsrhlpr_t::e_hold) && + (e_level00 == precedence) + ) + { + expression = parse_ternary_conditional_statement(new_expression); + } + else + expression = new_expression; + + parse_pending_string_rangesize(expression); + } + } + + if ((0 != expression) && (expression->node_depth() > settings_.max_node_depth_)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR016 - Expression depth of " + details::to_str(static_cast(expression->node_depth())) + + " exceeds maximum allowed expression depth of " + details::to_str(static_cast(settings_.max_node_depth_)), + exprtk_error_location)); + + free_node(node_allocator_,expression); + + return error_node(); + } + + return expression; + } + + bool simplify_unary_negation_branch(expression_node_ptr& node) + { + { + typedef details::unary_branch_node > ubn_t; + ubn_t* n = dynamic_cast(node); + + if (n) + { + expression_node_ptr un_r = n->branch(0); + n->release(); + free_node(node_allocator_,node); + node = un_r; + + return true; + } + } + + { + typedef details::unary_variable_node > uvn_t; + + uvn_t* n = dynamic_cast(node); + + if (n) + { + const T& v = n->v(); + expression_node_ptr return_node = error_node(); + + if ( + (0 != (return_node = symtab_store_.get_variable(v))) || + (0 != (return_node = sem_ .get_variable(v))) + ) + { + free_node(node_allocator_,node); + node = return_node; + + return true; + } + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR017 - Failed to find variable node in symbol table", + exprtk_error_location)); + + free_node(node_allocator_,node); + + return false; + } + } + } + + return false; + } + + static inline expression_node_ptr error_node() + { + return reinterpret_cast(0); + } + + struct scoped_expression_delete + { + scoped_expression_delete(parser& pr, expression_node_ptr& expression) + : delete_ptr(true) + , parser_(pr) + , expression_(expression) + {} + + ~scoped_expression_delete() + { + if (delete_ptr) + { + free_node(parser_.node_allocator_, expression_); + } + } + + bool delete_ptr; + parser& parser_; + expression_node_ptr& expression_; + + private: + + scoped_expression_delete(const scoped_expression_delete&) exprtk_delete; + scoped_expression_delete& operator=(const scoped_expression_delete&) exprtk_delete; + }; + + template + struct scoped_delete + { + typedef Type* ptr_t; + + scoped_delete(parser& pr, ptr_t& p) + : delete_ptr(true) + , parser_(pr) + , p_(&p) + {} + + scoped_delete(parser& pr, ptr_t (&p)[N]) + : delete_ptr(true) + , parser_(pr) + , p_(&p[0]) + {} + + ~scoped_delete() + { + if (delete_ptr) + { + for (std::size_t i = 0; i < N; ++i) + { + free_node(parser_.node_allocator_, p_[i]); + } + } + } + + bool delete_ptr; + parser& parser_; + ptr_t* p_; + + private: + + scoped_delete(const scoped_delete&) exprtk_delete; + scoped_delete& operator=(const scoped_delete&) exprtk_delete; + }; + + template + struct scoped_deq_delete + { + typedef Type* ptr_t; + + scoped_deq_delete(parser& pr, std::deque& deq) + : delete_ptr(true) + , parser_(pr) + , deq_(deq) + {} + + ~scoped_deq_delete() + { + if (delete_ptr && !deq_.empty()) + { + for (std::size_t i = 0; i < deq_.size(); ++i) + { + free_node(parser_.node_allocator_,deq_[i]); + } + + deq_.clear(); + } + } + + bool delete_ptr; + parser& parser_; + std::deque& deq_; + + private: + + scoped_deq_delete(const scoped_deq_delete&) exprtk_delete; + scoped_deq_delete& operator=(const scoped_deq_delete&) exprtk_delete; + }; + + template + struct scoped_vec_delete + { + typedef Type* ptr_t; + + scoped_vec_delete(parser& pr, std::vector& vec) + : delete_ptr(true) + , parser_(pr) + , vec_(vec) + {} + + ~scoped_vec_delete() + { + if (delete_ptr && !vec_.empty()) + { + for (std::size_t i = 0; i < vec_.size(); ++i) + { + free_node(parser_.node_allocator_,vec_[i]); + } + + vec_.clear(); + } + } + + bool delete_ptr; + parser& parser_; + std::vector& vec_; + + private: + + scoped_vec_delete(const scoped_vec_delete&) exprtk_delete; + scoped_vec_delete& operator=(const scoped_vec_delete&) exprtk_delete; + }; + + struct scoped_bool_negator + { + explicit scoped_bool_negator(bool& bb) + : b(bb) + { b = !b; } + + ~scoped_bool_negator() + { b = !b; } + + bool& b; + }; + + struct scoped_bool_or_restorer + { + explicit scoped_bool_or_restorer(bool& bb) + : b(bb) + , original_value_(bb) + {} + + ~scoped_bool_or_restorer() + { + b = b || original_value_; + } + + bool& b; + bool original_value_; + }; + + struct scoped_inc_dec + { + explicit scoped_inc_dec(std::size_t& v) + : v_(v) + { ++v_; } + + ~scoped_inc_dec() + { + assert(v_ > 0); + --v_; + } + + std::size_t& v_; + }; + + inline expression_node_ptr parse_function_invocation(ifunction* function, const std::string& function_name) + { + expression_node_ptr func_node = reinterpret_cast(0); + + switch (function->param_count) + { + case 0 : func_node = parse_function_call_0 (function,function_name); break; + case 1 : func_node = parse_function_call< 1>(function,function_name); break; + case 2 : func_node = parse_function_call< 2>(function,function_name); break; + case 3 : func_node = parse_function_call< 3>(function,function_name); break; + case 4 : func_node = parse_function_call< 4>(function,function_name); break; + case 5 : func_node = parse_function_call< 5>(function,function_name); break; + case 6 : func_node = parse_function_call< 6>(function,function_name); break; + case 7 : func_node = parse_function_call< 7>(function,function_name); break; + case 8 : func_node = parse_function_call< 8>(function,function_name); break; + case 9 : func_node = parse_function_call< 9>(function,function_name); break; + case 10 : func_node = parse_function_call<10>(function,function_name); break; + case 11 : func_node = parse_function_call<11>(function,function_name); break; + case 12 : func_node = parse_function_call<12>(function,function_name); break; + case 13 : func_node = parse_function_call<13>(function,function_name); break; + case 14 : func_node = parse_function_call<14>(function,function_name); break; + case 15 : func_node = parse_function_call<15>(function,function_name); break; + case 16 : func_node = parse_function_call<16>(function,function_name); break; + case 17 : func_node = parse_function_call<17>(function,function_name); break; + case 18 : func_node = parse_function_call<18>(function,function_name); break; + case 19 : func_node = parse_function_call<19>(function,function_name); break; + case 20 : func_node = parse_function_call<20>(function,function_name); break; + default : { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR018 - Invalid number of parameters for function: '" + function_name + "'", + exprtk_error_location)); + + return error_node(); + } + } + + if (func_node) + return func_node; + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR019 - Failed to generate call to function: '" + function_name + "'", + exprtk_error_location)); + + return error_node(); + } + } + + template + inline expression_node_ptr parse_function_call(ifunction* function, const std::string& function_name) + { + #ifdef _MSC_VER + #pragma warning(push) + #pragma warning(disable: 4127) + #endif + if (0 == NumberofParameters) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR020 - Expecting ifunction '" + function_name + "' to have non-zero parameter count", + exprtk_error_location)); + + return error_node(); + } + #ifdef _MSC_VER + #pragma warning(pop) + #endif + + expression_node_ptr branch[NumberofParameters]; + expression_node_ptr result = error_node(); + + std::fill_n(branch, NumberofParameters, reinterpret_cast(0)); + + scoped_delete sd((*this),branch); + + next_token(); + + if (!token_is(token_t::e_lbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR021 - Expecting argument list for function: '" + function_name + "'", + exprtk_error_location)); + + return error_node(); + } + + for (int i = 0; i < static_cast(NumberofParameters); ++i) + { + branch[i] = parse_expression(); + + if (0 == branch[i]) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR022 - Failed to parse argument " + details::to_str(i) + " for function: '" + function_name + "'", + exprtk_error_location)); + + return error_node(); + } + else if (i < static_cast(NumberofParameters - 1)) + { + if (!token_is(token_t::e_comma)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR023 - Invalid number of arguments for function: '" + function_name + "'", + exprtk_error_location)); + + return error_node(); + } + } + } + + if (!token_is(token_t::e_rbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR024 - Invalid number of arguments for function: '" + function_name + "'", + exprtk_error_location)); + + return error_node(); + } + else + result = expression_generator_.function(function,branch); + + sd.delete_ptr = (0 == result); + + return result; + } + + inline expression_node_ptr parse_function_call_0(ifunction* function, const std::string& function_name) + { + expression_node_ptr result = expression_generator_.function(function); + + state_.side_effect_present = function->has_side_effects(); + + next_token(); + + if ( + token_is(token_t::e_lbracket) && + !token_is(token_t::e_rbracket) + ) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR025 - Expecting '()' to proceed call to function: '" + function_name + "'", + exprtk_error_location)); + + free_node(node_allocator_,result); + + return error_node(); + } + else + return result; + } + + template + inline std::size_t parse_base_function_call(expression_node_ptr (¶m_list)[MaxNumberofParameters], const std::string& function_name = "") + { + std::fill_n(param_list, MaxNumberofParameters, reinterpret_cast(0)); + + scoped_delete sd((*this),param_list); + + next_token(); + + if (!token_is(token_t::e_lbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR026 - Expected a '(' at start of function call to '" + function_name + + "', instead got: '" + current_token().value + "'", + exprtk_error_location)); + + return 0; + } + + if (token_is(token_t::e_rbracket, e_hold)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR027 - Expected at least one input parameter for function call '" + function_name + "'", + exprtk_error_location)); + + return 0; + } + + std::size_t param_index = 0; + + for (; param_index < MaxNumberofParameters; ++param_index) + { + param_list[param_index] = parse_expression(); + + if (0 == param_list[param_index]) + return 0; + else if (token_is(token_t::e_rbracket)) + { + sd.delete_ptr = false; + break; + } + else if (token_is(token_t::e_comma)) + continue; + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR028 - Expected a ',' between function input parameters, instead got: '" + current_token().value + "'", + exprtk_error_location)); + + return 0; + } + } + + if (sd.delete_ptr) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR029 - Invalid number of input parameters passed to function '" + function_name + "'", + exprtk_error_location)); + + return 0; + } + + return (param_index + 1); + } + + inline expression_node_ptr parse_base_operation() + { + typedef std::pair map_range_t; + + const std::string operation_name = current_token().value; + const token_t diagnostic_token = current_token(); + + map_range_t itr_range = base_ops_map_.equal_range(operation_name); + + if (0 == std::distance(itr_range.first,itr_range.second)) + { + set_error( + make_error(parser_error::e_syntax, + diagnostic_token, + "ERR030 - No entry found for base operation: " + operation_name, + exprtk_error_location)); + + return error_node(); + } + + static const std::size_t MaxNumberofParameters = 4; + expression_node_ptr param_list[MaxNumberofParameters] = {0}; + + const std::size_t parameter_count = parse_base_function_call(param_list, operation_name); + + if ((parameter_count > 0) && (parameter_count <= MaxNumberofParameters)) + { + for (base_ops_map_t::iterator itr = itr_range.first; itr != itr_range.second; ++itr) + { + const details::base_operation_t& operation = itr->second; + + if (operation.num_params == parameter_count) + { + switch (parameter_count) + { + #define base_opr_case(N) \ + case N : { \ + expression_node_ptr pl##N[N] = {0}; \ + std::copy(param_list, param_list + N, pl##N); \ + lodge_symbol(operation_name, e_st_function); \ + return expression_generator_(operation.type, pl##N); \ + } \ + + base_opr_case(1) + base_opr_case(2) + base_opr_case(3) + base_opr_case(4) + #undef base_opr_case + } + } + } + } + + for (std::size_t i = 0; i < MaxNumberofParameters; ++i) + { + free_node(node_allocator_, param_list[i]); + } + + set_error( + make_error(parser_error::e_syntax, + diagnostic_token, + "ERR031 - Invalid number of input parameters for call to function: '" + operation_name + "'", + exprtk_error_location)); + + return error_node(); + } + + inline expression_node_ptr parse_conditional_statement_01(expression_node_ptr condition) + { + // Parse: [if][(][condition][,][consequent][,][alternative][)] + + expression_node_ptr consequent = error_node(); + expression_node_ptr alternative = error_node(); + + bool result = true; + + if (!token_is(token_t::e_comma)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR032 - Expected ',' between if-statement condition and consequent", + exprtk_error_location)); + result = false; + } + else if (0 == (consequent = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR033 - Failed to parse consequent for if-statement", + exprtk_error_location)); + result = false; + } + else if (!token_is(token_t::e_comma)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR034 - Expected ',' between if-statement consequent and alternative", + exprtk_error_location)); + result = false; + } + else if (0 == (alternative = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR035 - Failed to parse alternative for if-statement", + exprtk_error_location)); + result = false; + } + else if (!token_is(token_t::e_rbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR036 - Expected ')' at the end of if-statement", + exprtk_error_location)); + result = false; + } + + #ifndef exprtk_disable_string_capabilities + if (result) + { + const bool consq_is_str = is_generally_string_node(consequent ); + const bool alter_is_str = is_generally_string_node(alternative); + + if (consq_is_str || alter_is_str) + { + if (consq_is_str && alter_is_str) + { + return expression_generator_ + .conditional_string(condition, consequent, alternative); + } + + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR037 - Return types of if-statement differ: string/non-string", + exprtk_error_location)); + + result = false; + } + } + #endif + + if (result) + { + const bool consq_is_vec = is_ivector_node(consequent ); + const bool alter_is_vec = is_ivector_node(alternative); + + if (consq_is_vec || alter_is_vec) + { + if (consq_is_vec && alter_is_vec) + { + return expression_generator_ + .conditional_vector(condition, consequent, alternative); + } + + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR038 - Return types of if-statement differ: vector/non-vector", + exprtk_error_location)); + + result = false; + } + } + + if (!result) + { + free_node(node_allocator_, condition ); + free_node(node_allocator_, consequent ); + free_node(node_allocator_, alternative); + + return error_node(); + } + else + return expression_generator_ + .conditional(condition, consequent, alternative); + } + + inline expression_node_ptr parse_conditional_statement_02(expression_node_ptr condition) + { + expression_node_ptr consequent = error_node(); + expression_node_ptr alternative = error_node(); + + bool result = true; + + if (token_is(token_t::e_lcrlbracket,prsrhlpr_t::e_hold)) + { + if (0 == (consequent = parse_multi_sequence("if-statement-01"))) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR039 - Failed to parse body of consequent for if-statement", + exprtk_error_location)); + + result = false; + } + } + else + { + if ( + settings_.commutative_check_enabled() && + token_is(token_t::e_mul,prsrhlpr_t::e_hold) + ) + { + next_token(); + } + + if (0 != (consequent = parse_expression())) + { + if (!token_is(token_t::e_eof)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR040 - Expected ';' at the end of the consequent for if-statement", + exprtk_error_location)); + + result = false; + } + } + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR041 - Failed to parse body of consequent for if-statement", + exprtk_error_location)); + + result = false; + } + } + + if (result) + { + if (details::imatch(current_token().value,"else")) + { + next_token(); + + if (token_is(token_t::e_lcrlbracket,prsrhlpr_t::e_hold)) + { + if (0 == (alternative = parse_multi_sequence("else-statement-01"))) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR042 - Failed to parse body of the 'else' for if-statement", + exprtk_error_location)); + + result = false; + } + } + else if (details::imatch(current_token().value,"if")) + { + if (0 == (alternative = parse_conditional_statement())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR043 - Failed to parse body of if-else statement", + exprtk_error_location)); + + result = false; + } + } + else if (0 != (alternative = parse_expression())) + { + if (!token_is(token_t::e_eof)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR044 - Expected ';' at the end of the 'else-if' for the if-statement", + exprtk_error_location)); + + result = false; + } + } + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR045 - Failed to parse body of the 'else' for if-statement", + exprtk_error_location)); + + result = false; + } + } + } + + #ifndef exprtk_disable_string_capabilities + if (result) + { + const bool consq_is_str = is_generally_string_node(consequent ); + const bool alter_is_str = is_generally_string_node(alternative); + + if (consq_is_str || alter_is_str) + { + if (consq_is_str && alter_is_str) + { + return expression_generator_ + .conditional_string(condition, consequent, alternative); + } + + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR046 - Return types of if-statement differ: string/non-string", + exprtk_error_location)); + + result = false; + } + } + #endif + + if (result) + { + const bool consq_is_vec = is_ivector_node(consequent ); + const bool alter_is_vec = is_ivector_node(alternative); + + if (consq_is_vec || alter_is_vec) + { + if (consq_is_vec && alter_is_vec) + { + return expression_generator_ + .conditional_vector(condition, consequent, alternative); + } + + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR047 - Return types of if-statement differ: vector/non-vector", + exprtk_error_location)); + + result = false; + } + } + + if (!result) + { + free_node(node_allocator_, condition ); + free_node(node_allocator_, consequent ); + free_node(node_allocator_, alternative); + + return error_node(); + } + else + return expression_generator_ + .conditional(condition, consequent, alternative); + } + + inline expression_node_ptr parse_conditional_statement() + { + expression_node_ptr condition = error_node(); + + next_token(); + + if (!token_is(token_t::e_lbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR048 - Expected '(' at start of if-statement, instead got: '" + current_token().value + "'", + exprtk_error_location)); + + return error_node(); + } + else if (0 == (condition = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR049 - Failed to parse condition for if-statement", + exprtk_error_location)); + + return error_node(); + } + else if (token_is(token_t::e_comma,prsrhlpr_t::e_hold)) + { + // if (x,y,z) + return parse_conditional_statement_01(condition); + } + else if (token_is(token_t::e_rbracket)) + { + /* + 00. if (x) y; + 01. if (x) y; else z; + 02. if (x) y; else {z0; ... zn;} + 03. if (x) y; else if (z) w; + 04. if (x) y; else if (z) w; else u; + 05. if (x) y; else if (z) w; else {u0; ... un;} + 06. if (x) y; else if (z) {w0; ... wn;} + 07. if (x) {y0; ... yn;} + 08. if (x) {y0; ... yn;} else z; + 09. if (x) {y0; ... yn;} else {z0; ... zn;}; + 10. if (x) {y0; ... yn;} else if (z) w; + 11. if (x) {y0; ... yn;} else if (z) w; else u; + 12. if (x) {y0; ... nex;} else if (z) w; else {u0 ... un;} + 13. if (x) {y0; ... yn;} else if (z) {w0; ... wn;} + */ + return parse_conditional_statement_02(condition); + } + + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR050 - Invalid if-statement", + exprtk_error_location)); + + free_node(node_allocator_,condition); + + return error_node(); + } + + inline expression_node_ptr parse_ternary_conditional_statement(expression_node_ptr condition) + { + // Parse: [condition][?][consequent][:][alternative] + expression_node_ptr consequent = error_node(); + expression_node_ptr alternative = error_node(); + + bool result = true; + + if (0 == condition) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR051 - Encountered invalid condition branch for ternary if-statement", + exprtk_error_location)); + + return error_node(); + } + else if (!token_is(token_t::e_ternary)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR052 - Expected '?' after condition of ternary if-statement", + exprtk_error_location)); + + result = false; + } + else if (0 == (consequent = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR053 - Failed to parse consequent for ternary if-statement", + exprtk_error_location)); + + result = false; + } + else if (!token_is(token_t::e_colon)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR054 - Expected ':' between ternary if-statement consequent and alternative", + exprtk_error_location)); + + result = false; + } + else if (0 == (alternative = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR055 - Failed to parse alternative for ternary if-statement", + exprtk_error_location)); + + result = false; + } + + #ifndef exprtk_disable_string_capabilities + if (result) + { + const bool consq_is_str = is_generally_string_node(consequent ); + const bool alter_is_str = is_generally_string_node(alternative); + + if (consq_is_str || alter_is_str) + { + if (consq_is_str && alter_is_str) + { + return expression_generator_ + .conditional_string(condition, consequent, alternative); + } + + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR056 - Return types of ternary differ: string/non-string", + exprtk_error_location)); + + result = false; + } + } + #endif + + if (result) + { + const bool consq_is_vec = is_ivector_node(consequent ); + const bool alter_is_vec = is_ivector_node(alternative); + + if (consq_is_vec || alter_is_vec) + { + if (consq_is_vec && alter_is_vec) + { + return expression_generator_ + .conditional_vector(condition, consequent, alternative); + } + + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR057 - Return types of ternary differ: vector/non-vector", + exprtk_error_location)); + + result = false; + } + } + + if (!result) + { + free_node(node_allocator_, condition ); + free_node(node_allocator_, consequent ); + free_node(node_allocator_, alternative); + + return error_node(); + } + else + return expression_generator_ + .conditional(condition, consequent, alternative); + } + + inline expression_node_ptr parse_not_statement() + { + if (settings_.logic_disabled("not")) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR058 - Invalid or disabled logic operation 'not'", + exprtk_error_location)); + + return error_node(); + } + + return parse_base_operation(); + } + + void handle_brkcnt_scope_exit() + { + assert(!brkcnt_list_.empty()); + brkcnt_list_.pop_front(); + } + + inline expression_node_ptr parse_while_loop() + { + // Parse: [while][(][test expr][)][{][expression][}] + expression_node_ptr condition = error_node(); + expression_node_ptr branch = error_node(); + expression_node_ptr result_node = error_node(); + + bool result = true; + + next_token(); + + if (!token_is(token_t::e_lbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR059 - Expected '(' at start of while-loop condition statement", + exprtk_error_location)); + + return error_node(); + } + else if (0 == (condition = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR060 - Failed to parse condition for while-loop", + exprtk_error_location)); + + return error_node(); + } + else if (!token_is(token_t::e_rbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR061 - Expected ')' at end of while-loop condition statement", + exprtk_error_location)); + + result = false; + } + + brkcnt_list_.push_front(false); + + if (result) + { + scoped_inc_dec sid(state_.parsing_loop_stmt_count); + + if (0 == (branch = parse_multi_sequence("while-loop", true))) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR062 - Failed to parse body of while-loop")); + result = false; + } + else if (0 == (result_node = expression_generator_.while_loop(condition, + branch, + brkcnt_list_.front()))) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR063 - Failed to synthesize while-loop", + exprtk_error_location)); + + result = false; + } + } + + handle_brkcnt_scope_exit(); + + if (!result) + { + free_node(node_allocator_, branch ); + free_node(node_allocator_, condition ); + free_node(node_allocator_, result_node); + + return error_node(); + } + + return result_node; + } + + inline expression_node_ptr parse_repeat_until_loop() + { + // Parse: [repeat][{][expression][}][until][(][test expr][)] + expression_node_ptr condition = error_node(); + expression_node_ptr branch = error_node(); + next_token(); + + std::vector arg_list; + std::vector side_effect_list; + + scoped_vec_delete sdd((*this),arg_list); + + brkcnt_list_.push_front(false); + + if (details::imatch(current_token().value,"until")) + { + next_token(); + branch = node_allocator_.allocate >(); + } + else + { + const token_t::token_type seperator = token_t::e_eof; + + scope_handler sh(*this); + + scoped_bool_or_restorer sbr(state_.side_effect_present); + + scoped_inc_dec sid(state_.parsing_loop_stmt_count); + + for ( ; ; ) + { + state_.side_effect_present = false; + + expression_node_ptr arg = parse_expression(); + + if (0 == arg) + return error_node(); + else + { + arg_list.push_back(arg); + side_effect_list.push_back(state_.side_effect_present); + } + + if (details::imatch(current_token().value,"until")) + { + next_token(); + break; + } + + const bool is_next_until = peek_token_is(token_t::e_symbol) && + peek_token_is("until"); + + if (!token_is(seperator) && is_next_until) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR064 - Expected '" + token_t::to_str(seperator) + "' in body of repeat until loop", + exprtk_error_location)); + + return error_node(); + } + + if (details::imatch(current_token().value,"until")) + { + next_token(); + break; + } + } + + branch = simplify(arg_list,side_effect_list); + + sdd.delete_ptr = (0 == branch); + + if (sdd.delete_ptr) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR065 - Failed to parse body of repeat until loop", + exprtk_error_location)); + + return error_node(); + } + } + + if (!token_is(token_t::e_lbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR066 - Expected '(' before condition statement of repeat until loop", + exprtk_error_location)); + + free_node(node_allocator_,branch); + return error_node(); + } + else if (0 == (condition = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR067 - Failed to parse condition for repeat until loop", + exprtk_error_location)); + + free_node(node_allocator_,branch); + return error_node(); + } + else if (!token_is(token_t::e_rbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR068 - Expected ')' after condition of repeat until loop", + exprtk_error_location)); + + free_node(node_allocator_, branch ); + free_node(node_allocator_, condition); + + return error_node(); + } + + expression_node_ptr result; + + result = expression_generator_ + .repeat_until_loop(condition, branch, brkcnt_list_.front()); + + if (0 == result) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR069 - Failed to synthesize repeat until loop", + exprtk_error_location)); + + free_node(node_allocator_,condition); + + return error_node(); + } + + handle_brkcnt_scope_exit(); + + return result; + } + + inline expression_node_ptr parse_for_loop() + { + expression_node_ptr initialiser = error_node(); + expression_node_ptr condition = error_node(); + expression_node_ptr incrementor = error_node(); + expression_node_ptr loop_body = error_node(); + + scope_element* se = 0; + bool result = true; + + next_token(); + + scope_handler sh(*this); + + if (!token_is(token_t::e_lbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR070 - Expected '(' at start of for-loop", + exprtk_error_location)); + + return error_node(); + } + + if (!token_is(token_t::e_eof)) + { + if ( + !token_is(token_t::e_symbol,prsrhlpr_t::e_hold) && + details::imatch(current_token().value,"var") + ) + { + next_token(); + + if (!token_is(token_t::e_symbol,prsrhlpr_t::e_hold)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR071 - Expected a variable at the start of initialiser section of for-loop", + exprtk_error_location)); + + return error_node(); + } + else if (!peek_token_is(token_t::e_assign)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR072 - Expected variable assignment of initialiser section of for-loop", + exprtk_error_location)); + + return error_node(); + } + + const std::string loop_counter_symbol = current_token().value; + + se = &sem_.get_element(loop_counter_symbol); + + if ((se->name == loop_counter_symbol) && se->active) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR073 - For-loop variable '" + loop_counter_symbol+ "' is being shadowed by a previous declaration", + exprtk_error_location)); + + return error_node(); + } + else if (!symtab_store_.is_variable(loop_counter_symbol)) + { + if ( + !se->active && + (se->name == loop_counter_symbol) && + (se->type == scope_element::e_variable) + ) + { + se->active = true; + se->ref_count++; + } + else + { + scope_element nse; + nse.name = loop_counter_symbol; + nse.active = true; + nse.ref_count = 1; + nse.type = scope_element::e_variable; + nse.depth = state_.scope_depth; + nse.data = new T(T(0)); + nse.var_node = node_allocator_.allocate(*reinterpret_cast(nse.data)); + + if (!sem_.add_element(nse)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR074 - Failed to add new local variable '" + loop_counter_symbol + "' to SEM", + exprtk_error_location)); + + sem_.free_element(nse); + + result = false; + } + else + { + exprtk_debug(("parse_for_loop() - INFO - Added new local variable: %s\n",nse.name.c_str())); + + state_.activate_side_effect("parse_for_loop()"); + } + } + } + } + + if (0 == (initialiser = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR075 - Failed to parse initialiser of for-loop", + exprtk_error_location)); + + result = false; + } + else if (!token_is(token_t::e_eof)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR076 - Expected ';' after initialiser of for-loop", + exprtk_error_location)); + + result = false; + } + } + + if (!token_is(token_t::e_eof)) + { + if (0 == (condition = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR077 - Failed to parse condition of for-loop", + exprtk_error_location)); + + result = false; + } + else if (!token_is(token_t::e_eof)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR078 - Expected ';' after condition section of for-loop", + exprtk_error_location)); + + result = false; + } + } + + if (!token_is(token_t::e_rbracket)) + { + if (0 == (incrementor = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR079 - Failed to parse incrementor of for-loop", + exprtk_error_location)); + + result = false; + } + else if (!token_is(token_t::e_rbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR080 - Expected ')' after incrementor section of for-loop", + exprtk_error_location)); + + result = false; + } + } + + if (result) + { + brkcnt_list_.push_front(false); + + scoped_inc_dec sid(state_.parsing_loop_stmt_count); + + if (0 == (loop_body = parse_multi_sequence("for-loop", true))) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR081 - Failed to parse body of for-loop", + exprtk_error_location)); + + result = false; + } + } + + if (!result) + { + if (se) + { + se->ref_count--; + } + + free_node(node_allocator_, initialiser); + free_node(node_allocator_, condition ); + free_node(node_allocator_, incrementor); + free_node(node_allocator_, loop_body ); + return error_node(); + } + + expression_node_ptr result_node = + expression_generator_.for_loop(initialiser, + condition, + incrementor, + loop_body, + brkcnt_list_.front()); + handle_brkcnt_scope_exit(); + + return result_node; + } + + inline expression_node_ptr parse_switch_statement() + { + std::vector arg_list; + expression_node_ptr result = error_node(); + + if (!details::imatch(current_token().value,"switch")) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR082 - Expected keyword 'switch'", + exprtk_error_location)); + + return error_node(); + } + + scoped_vec_delete svd((*this),arg_list); + + next_token(); + + if (!token_is(token_t::e_lcrlbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR083 - Expected '{' for call to switch statement", + exprtk_error_location)); + + return error_node(); + } + + expression_node_ptr default_statement = error_node(); + + scoped_expression_delete defstmt_delete((*this), default_statement); + + for ( ; ; ) + { + if (details::imatch("case",current_token().value)) + { + next_token(); + + expression_node_ptr condition = parse_expression(); + + if (0 == condition) + return error_node(); + else if (!token_is(token_t::e_colon)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR084 - Expected ':' for case of switch statement", + exprtk_error_location)); + + free_node(node_allocator_, condition); + + return error_node(); + } + + expression_node_ptr consequent = parse_expression(); + + if (0 == consequent) + { + free_node(node_allocator_, condition); + + return error_node(); + } + else if (!token_is(token_t::e_eof)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR085 - Expected ';' at end of case for switch statement", + exprtk_error_location)); + + free_node(node_allocator_, condition ); + free_node(node_allocator_, consequent); + + return error_node(); + } + + // Can we optimise away the case statement? + if (is_constant_node(condition) && is_false(condition)) + { + free_node(node_allocator_, condition ); + free_node(node_allocator_, consequent); + } + else + { + arg_list.push_back(condition ); + arg_list.push_back(consequent); + } + + } + else if (details::imatch("default",current_token().value)) + { + if (0 != default_statement) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR086 - Multiple default cases for switch statement", + exprtk_error_location)); + + return error_node(); + } + + next_token(); + + if (!token_is(token_t::e_colon)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR087 - Expected ':' for default of switch statement", + exprtk_error_location)); + + return error_node(); + } + + if (token_is(token_t::e_lcrlbracket,prsrhlpr_t::e_hold)) + default_statement = parse_multi_sequence("switch-default"); + else + default_statement = parse_expression(); + + if (0 == default_statement) + return error_node(); + else if (!token_is(token_t::e_eof)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR088 - Expected ';' at end of default for switch statement", + exprtk_error_location)); + + return error_node(); + } + } + else if (token_is(token_t::e_rcrlbracket)) + break; + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR089 - Expected '}' at end of switch statement", + exprtk_error_location)); + + return error_node(); + } + } + + const bool default_statement_present = (0 != default_statement); + + if (default_statement_present) + { + arg_list.push_back(default_statement); + } + + result = expression_generator_.switch_statement(arg_list, (0 != default_statement)); + + svd.delete_ptr = (0 == result); + defstmt_delete.delete_ptr = (0 == result); + + return result; + } + + inline expression_node_ptr parse_multi_switch_statement() + { + std::vector arg_list; + + if (!details::imatch(current_token().value,"[*]")) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR090 - Expected token '[*]'", + exprtk_error_location)); + + return error_node(); + } + + scoped_vec_delete svd((*this),arg_list); + + next_token(); + + if (!token_is(token_t::e_lcrlbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR091 - Expected '{' for call to [*] statement", + exprtk_error_location)); + + return error_node(); + } + + for ( ; ; ) + { + if (!details::imatch("case",current_token().value)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR092 - Expected a 'case' statement for multi-switch", + exprtk_error_location)); + + return error_node(); + } + + next_token(); + + expression_node_ptr condition = parse_expression(); + + if (0 == condition) + return error_node(); + + if (!token_is(token_t::e_colon)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR093 - Expected ':' for case of [*] statement", + exprtk_error_location)); + + return error_node(); + } + + expression_node_ptr consequent = parse_expression(); + + if (0 == consequent) + return error_node(); + + if (!token_is(token_t::e_eof)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR094 - Expected ';' at end of case for [*] statement", + exprtk_error_location)); + + return error_node(); + } + + // Can we optimise away the case statement? + if (is_constant_node(condition) && is_false(condition)) + { + free_node(node_allocator_, condition ); + free_node(node_allocator_, consequent); + } + else + { + arg_list.push_back(condition ); + arg_list.push_back(consequent); + } + + if (token_is(token_t::e_rcrlbracket,prsrhlpr_t::e_hold)) + { + break; + } + } + + if (!token_is(token_t::e_rcrlbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR095 - Expected '}' at end of [*] statement", + exprtk_error_location)); + + return error_node(); + } + + const expression_node_ptr result = expression_generator_.multi_switch_statement(arg_list); + + svd.delete_ptr = (0 == result); + + return result; + } + + inline expression_node_ptr parse_vararg_function() + { + std::vector arg_list; + + details::operator_type opt_type = details::e_default; + const std::string symbol = current_token().value; + + if (details::imatch(symbol,"~")) + { + next_token(); + return parse_multi_sequence(); + } + else if (details::imatch(symbol,"[*]")) + { + return parse_multi_switch_statement(); + } + else if (details::imatch(symbol, "avg" )) opt_type = details::e_avg ; + else if (details::imatch(symbol, "mand")) opt_type = details::e_mand; + else if (details::imatch(symbol, "max" )) opt_type = details::e_max ; + else if (details::imatch(symbol, "min" )) opt_type = details::e_min ; + else if (details::imatch(symbol, "mor" )) opt_type = details::e_mor ; + else if (details::imatch(symbol, "mul" )) opt_type = details::e_prod; + else if (details::imatch(symbol, "sum" )) opt_type = details::e_sum ; + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR096 - Unsupported built-in vararg function: " + symbol, + exprtk_error_location)); + + return error_node(); + } + + scoped_vec_delete sdd((*this),arg_list); + + lodge_symbol(symbol, e_st_function); + + next_token(); + + if (!token_is(token_t::e_lbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR097 - Expected '(' for call to vararg function: " + symbol, + exprtk_error_location)); + + return error_node(); + } + + if (token_is(token_t::e_rbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR098 - vararg function: " + symbol + + " requires at least one input parameter", + exprtk_error_location)); + + return error_node(); + } + + for ( ; ; ) + { + expression_node_ptr arg = parse_expression(); + + if (0 == arg) + return error_node(); + else + arg_list.push_back(arg); + + if (token_is(token_t::e_rbracket)) + break; + else if (!token_is(token_t::e_comma)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR099 - Expected ',' for call to vararg function: " + symbol, + exprtk_error_location)); + + return error_node(); + } + } + + const expression_node_ptr result = expression_generator_.vararg_function(opt_type,arg_list); + + sdd.delete_ptr = (0 == result); + return result; + } + + #ifndef exprtk_disable_string_capabilities + inline expression_node_ptr parse_string_range_statement(expression_node_ptr& expression) + { + if (!token_is(token_t::e_lsqrbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR100 - Expected '[' as start of string range definition", + exprtk_error_location)); + + free_node(node_allocator_,expression); + + return error_node(); + } + else if (token_is(token_t::e_rsqrbracket)) + { + return node_allocator_.allocate >(expression); + } + + range_t rp; + + if (!parse_range(rp,true)) + { + free_node(node_allocator_,expression); + + return error_node(); + } + + expression_node_ptr result = expression_generator_(expression,rp); + + if (0 == result) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR101 - Failed to generate string range node", + exprtk_error_location)); + + free_node(node_allocator_,expression); + rp.free(); + } + + rp.clear(); + + return result; + } + #else + inline expression_node_ptr parse_string_range_statement(expression_node_ptr&) + { + return error_node(); + } + #endif + + inline void parse_pending_string_rangesize(expression_node_ptr& expression) + { + // Allow no more than 100 range calls, eg: s[][][]...[][] + const std::size_t max_rangesize_parses = 100; + + std::size_t i = 0; + + while + ( + (0 != expression) && + (i++ < max_rangesize_parses) && + error_list_.empty() && + is_generally_string_node(expression) && + token_is(token_t::e_lsqrbracket,prsrhlpr_t::e_hold) + ) + { + expression = parse_string_range_statement(expression); + } + } + + template class Sequence> + inline expression_node_ptr simplify(Sequence& expression_list, + Sequence& side_effect_list, + const bool specialise_on_final_type = false) + { + if (expression_list.empty()) + return error_node(); + else if (1 == expression_list.size()) + return expression_list[0]; + + Sequence tmp_expression_list; + + bool return_node_present = false; + + for (std::size_t i = 0; i < (expression_list.size() - 1); ++i) + { + if (is_variable_node(expression_list[i])) + continue; + else if ( + is_return_node (expression_list[i]) || + is_break_node (expression_list[i]) || + is_continue_node(expression_list[i]) + ) + { + tmp_expression_list.push_back(expression_list[i]); + + // Remove all subexpressions after first short-circuit + // node has been encountered. + + for (std::size_t j = i + 1; j < expression_list.size(); ++j) + { + free_node(node_allocator_,expression_list[j]); + } + + return_node_present = true; + + break; + } + else if ( + is_constant_node(expression_list[i]) || + is_null_node (expression_list[i]) || + !side_effect_list[i] + ) + { + free_node(node_allocator_,expression_list[i]); + continue; + } + else + tmp_expression_list.push_back(expression_list[i]); + } + + if (!return_node_present) + { + tmp_expression_list.push_back(expression_list.back()); + } + + expression_list.swap(tmp_expression_list); + + if (tmp_expression_list.size() > expression_list.size()) + { + exprtk_debug(("simplify() - Reduced subexpressions from %d to %d\n", + static_cast(tmp_expression_list.size()), + static_cast(expression_list .size()))); + } + + if ( + return_node_present || + side_effect_list.back() || + (expression_list.size() > 1) + ) + state_.activate_side_effect("simplify()"); + + if (1 == expression_list.size()) + return expression_list[0]; + else if (specialise_on_final_type && is_generally_string_node(expression_list.back())) + return expression_generator_.vararg_function(details::e_smulti,expression_list); + else + return expression_generator_.vararg_function(details::e_multi,expression_list); + } + + inline expression_node_ptr parse_multi_sequence(const std::string& source = "", + const bool enforce_crlbrackets = false) + { + token_t::token_type open_bracket = token_t::e_lcrlbracket; + token_t::token_type close_bracket = token_t::e_rcrlbracket; + token_t::token_type seperator = token_t::e_eof; + + if (!token_is(open_bracket)) + { + if (!enforce_crlbrackets && token_is(token_t::e_lbracket)) + { + open_bracket = token_t::e_lbracket; + close_bracket = token_t::e_rbracket; + seperator = token_t::e_comma; + } + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR102 - Expected '" + token_t::to_str(open_bracket) + "' for call to multi-sequence" + + ((!source.empty()) ? std::string(" section of " + source): ""), + exprtk_error_location)); + + return error_node(); + } + } + else if (token_is(close_bracket)) + { + return node_allocator_.allocate >(); + } + + std::vector arg_list; + std::vector side_effect_list; + + expression_node_ptr result = error_node(); + + scoped_vec_delete sdd((*this),arg_list); + + scope_handler sh(*this); + + scoped_bool_or_restorer sbr(state_.side_effect_present); + + for ( ; ; ) + { + state_.side_effect_present = false; + + expression_node_ptr arg = parse_expression(); + + if (0 == arg) + return error_node(); + else + { + arg_list.push_back(arg); + side_effect_list.push_back(state_.side_effect_present); + } + + if (token_is(close_bracket)) + break; + + const bool is_next_close = peek_token_is(close_bracket); + + if (!token_is(seperator) && is_next_close) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR103 - Expected '" + details::to_str(seperator) + "' for call to multi-sequence section of " + source, + exprtk_error_location)); + + return error_node(); + } + + if (token_is(close_bracket)) + break; + } + + result = simplify(arg_list, side_effect_list, source.empty()); + + sdd.delete_ptr = (0 == result); + return result; + } + + inline bool parse_range(range_t& rp, const bool skip_lsqr = false) + { + // Examples of valid ranges: + // 1. [1:5] -> 1..5 + // 2. [ :5] -> 0..5 + // 3. [1: ] -> 1..end + // 4. [x:y] -> x..y where x <= y + // 5. [x+1:y/2] -> x+1..y/2 where x+1 <= y/2 + // 6. [ :y] -> 0..y where 0 <= y + // 7. [x: ] -> x..end where x <= end + + rp.clear(); + + if (!skip_lsqr && !token_is(token_t::e_lsqrbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR104 - Expected '[' for start of range", + exprtk_error_location)); + + return false; + } + + if (token_is(token_t::e_colon)) + { + rp.n0_c.first = true; + rp.n0_c.second = 0; + rp.cache.first = 0; + } + else + { + expression_node_ptr r0 = parse_expression(); + + if (0 == r0) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR105 - Failed parse begin section of range", + exprtk_error_location)); + + return false; + } + else if (is_constant_node(r0)) + { + const T r0_value = r0->value(); + + if (r0_value >= T(0)) + { + rp.n0_c.first = true; + rp.n0_c.second = static_cast(details::numeric::to_int64(r0_value)); + rp.cache.first = rp.n0_c.second; + } + + free_node(node_allocator_,r0); + + if (r0_value < T(0)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR106 - Range lower bound less than zero! Constraint: r0 >= 0", + exprtk_error_location)); + + return false; + } + } + else + { + rp.n0_e.first = true; + rp.n0_e.second = r0; + } + + if (!token_is(token_t::e_colon)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR107 - Expected ':' for break in range", + exprtk_error_location)); + + rp.free(); + + return false; + } + } + + if (token_is(token_t::e_rsqrbracket)) + { + rp.n1_c.first = true; + rp.n1_c.second = std::numeric_limits::max(); + } + else + { + expression_node_ptr r1 = parse_expression(); + + if (0 == r1) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR108 - Failed parse end section of range", + exprtk_error_location)); + + rp.free(); + + return false; + } + else if (is_constant_node(r1)) + { + const T r1_value = r1->value(); + + if (r1_value >= T(0)) + { + rp.n1_c.first = true; + rp.n1_c.second = static_cast(details::numeric::to_int64(r1_value)); + rp.cache.second = rp.n1_c.second; + } + + free_node(node_allocator_,r1); + + if (r1_value < T(0)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR109 - Range upper bound less than zero! Constraint: r1 >= 0", + exprtk_error_location)); + + rp.free(); + + return false; + } + } + else + { + rp.n1_e.first = true; + rp.n1_e.second = r1; + } + + if (!token_is(token_t::e_rsqrbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR110 - Expected ']' for start of range", + exprtk_error_location)); + + rp.free(); + + return false; + } + } + + if (rp.const_range()) + { + std::size_t r0 = 0; + std::size_t r1 = 0; + + bool rp_result = false; + + try + { + rp_result = rp(r0, r1); + } + catch (std::runtime_error&) + {} + + if (!rp_result || (r0 > r1)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR111 - Invalid range, Constraint: r0 <= r1", + exprtk_error_location)); + + return false; + } + } + + return true; + } + + inline void lodge_symbol(const std::string& symbol, + const symbol_type st) + { + dec_.add_symbol(symbol,st); + } + + #ifndef exprtk_disable_string_capabilities + inline expression_node_ptr parse_string() + { + const std::string symbol = current_token().value; + + typedef details::stringvar_node* strvar_node_t; + + expression_node_ptr result = error_node(); + strvar_node_t const_str_node = static_cast(0); + + scope_element& se = sem_.get_active_element(symbol); + + if (scope_element::e_string == se.type) + { + se.active = true; + result = se.str_node; + lodge_symbol(symbol, e_st_local_string); + } + else + { + typedef typename symtab_store::string_context str_ctxt_t; + str_ctxt_t str_ctx = symtab_store_.get_string_context(symbol); + + if ((0 == str_ctx.str_var) || !symtab_store_.is_conststr_stringvar(symbol)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR112 - Unknown string symbol", + exprtk_error_location)); + + return error_node(); + } + + assert(str_ctx.str_var != 0); + assert(str_ctx.symbol_table != 0); + + result = str_ctx.str_var; + + if (symtab_store_.is_constant_string(symbol)) + { + const_str_node = static_cast(result); + result = expression_generator_(const_str_node->str()); + } + else if (symbol_table_t::e_immutable == str_ctx.symbol_table->mutability()) + { + lodge_immutable_symbol( + current_token(), + make_memory_range(str_ctx.str_var->base(), str_ctx.str_var->size())); + } + + lodge_symbol(symbol, e_st_string); + } + + if (peek_token_is(token_t::e_lsqrbracket)) + { + next_token(); + + if (peek_token_is(token_t::e_rsqrbracket)) + { + next_token(); + next_token(); + + if (const_str_node) + { + free_node(node_allocator_,result); + + return expression_generator_(T(const_str_node->size())); + } + else + return node_allocator_.allocate > + (static_cast*>(result)->ref()); + } + + range_t rp; + + if (!parse_range(rp)) + { + free_node(node_allocator_,result); + + return error_node(); + } + else if (const_str_node) + { + free_node(node_allocator_,result); + result = expression_generator_(const_str_node->ref(),rp); + } + else + result = expression_generator_(static_cast*> + (result)->ref(), rp); + + if (result) + rp.clear(); + } + else + next_token(); + + return result; + } + #else + inline expression_node_ptr parse_string() + { + return error_node(); + } + #endif + + #ifndef exprtk_disable_string_capabilities + inline expression_node_ptr parse_const_string() + { + const std::string const_str = current_token().value; + expression_node_ptr result = expression_generator_(const_str); + + if (peek_token_is(token_t::e_lsqrbracket)) + { + next_token(); + + if (peek_token_is(token_t::e_rsqrbracket)) + { + next_token(); + next_token(); + + free_node(node_allocator_,result); + + return expression_generator_(T(const_str.size())); + } + + range_t rp; + + if (!parse_range(rp)) + { + free_node(node_allocator_,result); + rp.free(); + + return error_node(); + } + + free_node(node_allocator_,result); + + if (rp.n1_c.first && (rp.n1_c.second == std::numeric_limits::max())) + { + rp.n1_c.second = const_str.size() - 1; + rp.cache.second = rp.n1_c.second; + } + + if ( + (rp.n0_c.first && (rp.n0_c.second >= const_str.size())) || + (rp.n1_c.first && (rp.n1_c.second >= const_str.size())) + ) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR113 - Overflow in range for string: '" + const_str + "'[" + + (rp.n0_c.first ? details::to_str(static_cast(rp.n0_c.second)) : "?") + ":" + + (rp.n1_c.first ? details::to_str(static_cast(rp.n1_c.second)) : "?") + "]", + exprtk_error_location)); + + rp.free(); + + return error_node(); + } + + result = expression_generator_(const_str,rp); + + if (result) + rp.clear(); + } + else + next_token(); + + return result; + } + #else + inline expression_node_ptr parse_const_string() + { + return error_node(); + } + #endif + + inline expression_node_ptr parse_vector() + { + const std::string symbol = current_token().value; + + vector_holder_ptr vec = vector_holder_ptr(0); + + const scope_element& se = sem_.get_active_element(symbol); + + if ( + !details::imatch(se.name, symbol) || + (se.depth > state_.scope_depth) || + (scope_element::e_vector != se.type) + ) + { + typedef typename symtab_store::vector_context vec_ctxt_t; + vec_ctxt_t vec_ctx = symtab_store_.get_vector_context(symbol); + + if (0 == vec_ctx.vector_holder) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR114 - Symbol '" + symbol+ " not a vector", + exprtk_error_location)); + + return error_node(); + } + + assert(0 != vec_ctx.vector_holder); + assert(0 != vec_ctx.symbol_table ); + + vec = vec_ctx.vector_holder; + + if (symbol_table_t::e_immutable == vec_ctx.symbol_table->mutability()) + { + lodge_immutable_symbol( + current_token(), + make_memory_range(vec->data(), vec->size())); + } + } + else + vec = se.vec_node; + + assert(0 != vec); + + expression_node_ptr index_expr = error_node(); + + next_token(); + + if (!token_is(token_t::e_lsqrbracket)) + { + return node_allocator_.allocate(vec); + } + else if (token_is(token_t::e_rsqrbracket)) + { + return expression_generator_(T(vec->size())); + } + else if (0 == (index_expr = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR115 - Failed to parse index for vector: '" + symbol + "'", + exprtk_error_location)); + + return error_node(); + } + else if (!token_is(token_t::e_rsqrbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR116 - Expected ']' for index of vector: '" + symbol + "'", + exprtk_error_location)); + + free_node(node_allocator_,index_expr); + + return error_node(); + } + + // Perform compile-time range check + if (details::is_constant_node(index_expr)) + { + const std::size_t index = static_cast(details::numeric::to_int32(index_expr->value())); + const std::size_t vec_size = vec->size(); + + if (index >= vec_size) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR117 - Index of " + details::to_str(index) + " out of range for " + "vector '" + symbol + "' of size " + details::to_str(vec_size), + exprtk_error_location)); + + free_node(node_allocator_,index_expr); + + return error_node(); + } + } + + return expression_generator_.vector_element(symbol, vec, index_expr); + } + + inline expression_node_ptr parse_vararg_function_call(ivararg_function* vararg_function, const std::string& vararg_function_name) + { + std::vector arg_list; + + expression_node_ptr result = error_node(); + + scoped_vec_delete sdd((*this),arg_list); + + next_token(); + + if (token_is(token_t::e_lbracket)) + { + if (token_is(token_t::e_rbracket)) + { + if (!vararg_function->allow_zero_parameters()) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR118 - Zero parameter call to vararg function: " + + vararg_function_name + " not allowed", + exprtk_error_location)); + + return error_node(); + } + } + else + { + for ( ; ; ) + { + expression_node_ptr arg = parse_expression(); + + if (0 == arg) + return error_node(); + else + arg_list.push_back(arg); + + if (token_is(token_t::e_rbracket)) + break; + else if (!token_is(token_t::e_comma)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR119 - Expected ',' for call to vararg function: " + + vararg_function_name, + exprtk_error_location)); + + return error_node(); + } + } + } + } + else if (!vararg_function->allow_zero_parameters()) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR120 - Zero parameter call to vararg function: " + + vararg_function_name + " not allowed", + exprtk_error_location)); + + return error_node(); + } + + if (arg_list.size() < vararg_function->min_num_args()) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR121 - Invalid number of parameters to call to vararg function: " + + vararg_function_name + ", require at least " + + details::to_str(static_cast(vararg_function->min_num_args())) + " parameters", + exprtk_error_location)); + + return error_node(); + } + else if (arg_list.size() > vararg_function->max_num_args()) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR122 - Invalid number of parameters to call to vararg function: " + + vararg_function_name + ", require no more than " + + details::to_str(static_cast(vararg_function->max_num_args())) + " parameters", + exprtk_error_location)); + + return error_node(); + } + + result = expression_generator_.vararg_function_call(vararg_function,arg_list); + + sdd.delete_ptr = (0 == result); + + return result; + } + + class type_checker + { + public: + + enum return_type_t + { + e_overload = ' ', + e_numeric = 'T', + e_string = 'S' + }; + + struct function_prototype_t + { + return_type_t return_type; + std::string param_seq; + }; + + typedef parser parser_t; + typedef std::vector function_definition_list_t; + + type_checker(parser_t& p, + const std::string& func_name, + const std::string& func_prototypes, + const return_type_t default_return_type) + : invalid_state_(true) + , parser_(p) + , function_name_(func_name) + , default_return_type_(default_return_type) + { + parse_function_prototypes(func_prototypes); + } + + bool verify(const std::string& param_seq, std::size_t& pseq_index) + { + if (function_definition_list_.empty()) + return true; + + std::vector > error_list; + + for (std::size_t i = 0; i < function_definition_list_.size(); ++i) + { + details::char_t diff_value = 0; + std::size_t diff_index = 0; + + const bool result = details::sequence_match(function_definition_list_[i].param_seq, + param_seq, + diff_index, diff_value); + + if (result) + { + pseq_index = i; + return true; + } + else + error_list.push_back(std::make_pair(diff_index, diff_value)); + } + + if (1 == error_list.size()) + { + parser_. + set_error( + make_error(parser_error::e_syntax, + parser_.current_token(), + "ERR123 - Failed parameter type check for function '" + function_name_ + "', " + "Expected '" + function_definition_list_[0].param_seq + + "' call set: '" + param_seq + "'", + exprtk_error_location)); + } + else + { + // find first with largest diff_index; + std::size_t max_diff_index = 0; + + for (std::size_t i = 1; i < error_list.size(); ++i) + { + if (error_list[i].first > error_list[max_diff_index].first) + { + max_diff_index = i; + } + } + + parser_. + set_error( + make_error(parser_error::e_syntax, + parser_.current_token(), + "ERR124 - Failed parameter type check for function '" + function_name_ + "', " + "Best match: '" + function_definition_list_[max_diff_index].param_seq + + "' call set: '" + param_seq + "'", + exprtk_error_location)); + } + + return false; + } + + std::size_t paramseq_count() const + { + return function_definition_list_.size(); + } + + std::string paramseq(const std::size_t& index) const + { + return function_definition_list_[index].param_seq; + } + + return_type_t return_type(const std::size_t& index) const + { + return function_definition_list_[index].return_type; + } + + bool invalid() const + { + return !invalid_state_; + } + + bool allow_zero_parameters() const + { + + for (std::size_t i = 0; i < function_definition_list_.size(); ++i) + { + if (std::string::npos != function_definition_list_[i].param_seq.find("Z")) + { + return true; + } + } + + return false; + } + + private: + + std::vector split_param_seq(const std::string& param_seq, const details::char_t delimiter = '|') const + { + std::string::const_iterator current_begin = param_seq.begin(); + std::string::const_iterator iter = param_seq.begin(); + + std::vector result; + + while (iter != param_seq.end()) + { + if (*iter == delimiter) + { + result.push_back(std::string(current_begin, iter)); + current_begin = ++iter; + } + else + ++iter; + } + + if (current_begin != iter) + { + result.push_back(std::string(current_begin, iter)); + } + + return result; + } + + inline bool is_valid_token(std::string param_seq, + function_prototype_t& funcproto) const + { + // Determine return type + funcproto.return_type = default_return_type_; + + if (param_seq.size() > 2) + { + if (':' == param_seq[1]) + { + // Note: Only overloaded igeneric functions can have return + // type definitions. + if (type_checker::e_overload != default_return_type_) + return false; + + switch (param_seq[0]) + { + case 'T' : funcproto.return_type = type_checker::e_numeric; + break; + + case 'S' : funcproto.return_type = type_checker::e_string; + break; + + default : return false; + } + + param_seq.erase(0,2); + } + } + + if ( + (std::string::npos != param_seq.find("?*")) || + (std::string::npos != param_seq.find("**")) + ) + { + return false; + } + else if ( + (std::string::npos == param_seq.find_first_not_of("STV*?|")) || + ("Z" == param_seq) + ) + { + funcproto.param_seq = param_seq; + return true; + } + + return false; + } + + void parse_function_prototypes(const std::string& func_prototypes) + { + if (func_prototypes.empty()) + return; + + std::vector param_seq_list = split_param_seq(func_prototypes); + + typedef std::map param_seq_map_t; + param_seq_map_t param_seq_map; + + for (std::size_t i = 0; i < param_seq_list.size(); ++i) + { + function_prototype_t func_proto; + + if (!is_valid_token(param_seq_list[i], func_proto)) + { + invalid_state_ = false; + + parser_. + set_error( + make_error(parser_error::e_syntax, + parser_.current_token(), + "ERR125 - Invalid parameter sequence of '" + param_seq_list[i] + + "' for function: " + function_name_, + exprtk_error_location)); + return; + } + + param_seq_map_t::const_iterator seq_itr = param_seq_map.find(param_seq_list[i]); + + if (param_seq_map.end() != seq_itr) + { + invalid_state_ = false; + + parser_. + set_error( + make_error(parser_error::e_syntax, + parser_.current_token(), + "ERR126 - Function '" + function_name_ + "' has a parameter sequence conflict between " + + "pseq_idx[" + details::to_str(seq_itr->second) + "] and" + + "pseq_idx[" + details::to_str(i) + "] " + + "param seq: " + param_seq_list[i], + exprtk_error_location)); + return; + } + + function_definition_list_.push_back(func_proto); + } + } + + type_checker(const type_checker&) exprtk_delete; + type_checker& operator=(const type_checker&) exprtk_delete; + + bool invalid_state_; + parser_t& parser_; + std::string function_name_; + const return_type_t default_return_type_; + function_definition_list_t function_definition_list_; + }; + + inline expression_node_ptr parse_generic_function_call(igeneric_function* function, const std::string& function_name) + { + std::vector arg_list; + + scoped_vec_delete sdd((*this),arg_list); + + next_token(); + + std::string param_type_list; + + type_checker tc( + (*this), + function_name, + function->parameter_sequence, + type_checker::e_string); + + if (tc.invalid()) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR127 - Type checker instantiation failure for generic function: " + function_name, + exprtk_error_location)); + + return error_node(); + } + + if (token_is(token_t::e_lbracket)) + { + if (token_is(token_t::e_rbracket)) + { + if ( + !function->allow_zero_parameters() && + !tc .allow_zero_parameters() + ) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR128 - Zero parameter call to generic function: " + + function_name + " not allowed", + exprtk_error_location)); + + return error_node(); + } + } + else + { + for ( ; ; ) + { + expression_node_ptr arg = parse_expression(); + + if (0 == arg) + return error_node(); + + if (is_ivector_node(arg)) + param_type_list += 'V'; + else if (is_generally_string_node(arg)) + param_type_list += 'S'; + else // Everything else is assumed to be a scalar returning expression + param_type_list += 'T'; + + arg_list.push_back(arg); + + if (token_is(token_t::e_rbracket)) + break; + else if (!token_is(token_t::e_comma)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR129 - Expected ',' for call to generic function: " + function_name, + exprtk_error_location)); + + return error_node(); + } + } + } + } + else if ( + !function->parameter_sequence.empty() && + function->allow_zero_parameters () && + !tc .allow_zero_parameters () + ) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR130 - Zero parameter call to generic function: " + + function_name + " not allowed", + exprtk_error_location)); + + return error_node(); + } + + std::size_t param_seq_index = 0; + + if ( + state_.type_check_enabled && + !tc.verify(param_type_list, param_seq_index) + ) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR131 - Invalid input parameter sequence for call to generic function: " + function_name, + exprtk_error_location)); + + return error_node(); + } + + expression_node_ptr result = error_node(); + + if (tc.paramseq_count() <= 1) + result = expression_generator_ + .generic_function_call(function, arg_list); + else + result = expression_generator_ + .generic_function_call(function, arg_list, param_seq_index); + + sdd.delete_ptr = (0 == result); + + return result; + } + + inline bool parse_igeneric_function_params(std::string& param_type_list, + std::vector& arg_list, + const std::string& function_name, + igeneric_function* function, + const type_checker& tc) + { + if (token_is(token_t::e_lbracket)) + { + if (token_is(token_t::e_rbracket)) + { + if ( + !function->allow_zero_parameters() && + !tc .allow_zero_parameters() + ) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR132 - Zero parameter call to generic function: " + + function_name + " not allowed", + exprtk_error_location)); + + return false; + } + } + else + { + for ( ; ; ) + { + expression_node_ptr arg = parse_expression(); + + if (0 == arg) + return false; + + if (is_ivector_node(arg)) + param_type_list += 'V'; + else if (is_generally_string_node(arg)) + param_type_list += 'S'; + else // Everything else is a scalar returning expression + param_type_list += 'T'; + + arg_list.push_back(arg); + + if (token_is(token_t::e_rbracket)) + break; + else if (!token_is(token_t::e_comma)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR133 - Expected ',' for call to string function: " + function_name, + exprtk_error_location)); + + return false; + } + } + } + + return true; + } + else + return false; + } + + #ifndef exprtk_disable_string_capabilities + inline expression_node_ptr parse_string_function_call(igeneric_function* function, const std::string& function_name) + { + // Move pass the function name + next_token(); + + std::string param_type_list; + + type_checker tc((*this), function_name, function->parameter_sequence, type_checker::e_string); + + if ( + (!function->parameter_sequence.empty()) && + (0 == tc.paramseq_count()) + ) + { + return error_node(); + } + + std::vector arg_list; + scoped_vec_delete sdd((*this),arg_list); + + if (!parse_igeneric_function_params(param_type_list, arg_list, function_name, function, tc)) + { + return error_node(); + } + + std::size_t param_seq_index = 0; + + if (!tc.verify(param_type_list, param_seq_index)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR134 - Invalid input parameter sequence for call to string function: " + function_name, + exprtk_error_location)); + + return error_node(); + } + + expression_node_ptr result = error_node(); + + if (tc.paramseq_count() <= 1) + result = expression_generator_ + .string_function_call(function, arg_list); + else + result = expression_generator_ + .string_function_call(function, arg_list, param_seq_index); + + sdd.delete_ptr = (0 == result); + + return result; + } + + inline expression_node_ptr parse_overload_function_call(igeneric_function* function, const std::string& function_name) + { + // Move pass the function name + next_token(); + + std::string param_type_list; + + type_checker tc((*this), function_name, function->parameter_sequence, type_checker::e_overload); + + if ( + (!function->parameter_sequence.empty()) && + (0 == tc.paramseq_count()) + ) + { + return error_node(); + } + + std::vector arg_list; + scoped_vec_delete sdd((*this),arg_list); + + if (!parse_igeneric_function_params(param_type_list, arg_list, function_name, function, tc)) + { + return error_node(); + } + + std::size_t param_seq_index = 0; + + if (!tc.verify(param_type_list, param_seq_index)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR135 - Invalid input parameter sequence for call to overloaded function: " + function_name, + exprtk_error_location)); + + return error_node(); + } + + expression_node_ptr result = error_node(); + + if (type_checker::e_numeric == tc.return_type(param_seq_index)) + { + if (tc.paramseq_count() <= 1) + result = expression_generator_ + .generic_function_call(function, arg_list); + else + result = expression_generator_ + .generic_function_call(function, arg_list, param_seq_index); + } + else if (type_checker::e_string == tc.return_type(param_seq_index)) + { + if (tc.paramseq_count() <= 1) + result = expression_generator_ + .string_function_call(function, arg_list); + else + result = expression_generator_ + .string_function_call(function, arg_list, param_seq_index); + } + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR136 - Invalid return type for call to overloaded function: " + function_name, + exprtk_error_location)); + } + + sdd.delete_ptr = (0 == result); + return result; + } + #endif + + template + struct parse_special_function_impl + { + static inline expression_node_ptr process(parser& p, const details::operator_type opt_type, const std::string& sf_name) + { + expression_node_ptr branch[NumberOfParameters]; + expression_node_ptr result = error_node(); + + std::fill_n(branch, NumberOfParameters, reinterpret_cast(0)); + + scoped_delete sd(p,branch); + + p.next_token(); + + if (!p.token_is(token_t::e_lbracket)) + { + p.set_error( + make_error(parser_error::e_syntax, + p.current_token(), + "ERR137 - Expected '(' for special function '" + sf_name + "'", + exprtk_error_location)); + + return error_node(); + } + + for (std::size_t i = 0; i < NumberOfParameters; ++i) + { + branch[i] = p.parse_expression(); + + if (0 == branch[i]) + { + return p.error_node(); + } + else if (i < (NumberOfParameters - 1)) + { + if (!p.token_is(token_t::e_comma)) + { + p.set_error( + make_error(parser_error::e_syntax, + p.current_token(), + "ERR138 - Expected ',' before next parameter of special function '" + sf_name + "'", + exprtk_error_location)); + + return p.error_node(); + } + } + } + + if (!p.token_is(token_t::e_rbracket)) + { + p.set_error( + make_error(parser_error::e_syntax, + p.current_token(), + "ERR139 - Invalid number of parameters for special function '" + sf_name + "'", + exprtk_error_location)); + + return p.error_node(); + } + else + result = p.expression_generator_.special_function(opt_type,branch); + + sd.delete_ptr = (0 == result); + + return result; + } + }; + + inline expression_node_ptr parse_special_function() + { + const std::string sf_name = current_token().value; + + // Expect: $fDD(expr0,expr1,expr2) or $fDD(expr0,expr1,expr2,expr3) + if ( + !details::is_digit(sf_name[2]) || + !details::is_digit(sf_name[3]) + ) + { + set_error( + make_error(parser_error::e_token, + current_token(), + "ERR140 - Invalid special function[1]: " + sf_name, + exprtk_error_location)); + + return error_node(); + } + + const int id = (sf_name[2] - '0') * 10 + + (sf_name[3] - '0'); + + if (id >= details::e_sffinal) + { + set_error( + make_error(parser_error::e_token, + current_token(), + "ERR141 - Invalid special function[2]: " + sf_name, + exprtk_error_location)); + + return error_node(); + } + + const int sf_3_to_4 = details::e_sf48; + const details::operator_type opt_type = details::operator_type(id + 1000); + const std::size_t NumberOfParameters = (id < (sf_3_to_4 - 1000)) ? 3U : 4U; + + switch (NumberOfParameters) + { + case 3 : return parse_special_function_impl::process((*this), opt_type, sf_name); + case 4 : return parse_special_function_impl::process((*this), opt_type, sf_name); + default : return error_node(); + } + } + + inline expression_node_ptr parse_null_statement() + { + next_token(); + return node_allocator_.allocate >(); + } + + #ifndef exprtk_disable_break_continue + inline expression_node_ptr parse_break_statement() + { + if (state_.parsing_break_stmt) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR142 - Invoking 'break' within a break call is not allowed", + exprtk_error_location)); + + return error_node(); + } + else if (0 == state_.parsing_loop_stmt_count) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR143 - Invalid use of 'break', allowed only in the scope of a loop", + exprtk_error_location)); + + return error_node(); + } + + scoped_bool_negator sbn(state_.parsing_break_stmt); + + if (!brkcnt_list_.empty()) + { + next_token(); + + brkcnt_list_.front() = true; + + expression_node_ptr return_expr = error_node(); + + if (token_is(token_t::e_lsqrbracket)) + { + if (0 == (return_expr = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR144 - Failed to parse return expression for 'break' statement", + exprtk_error_location)); + + return error_node(); + } + else if (!token_is(token_t::e_rsqrbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR145 - Expected ']' at the completion of break's return expression", + exprtk_error_location)); + + free_node(node_allocator_,return_expr); + + return error_node(); + } + } + + state_.activate_side_effect("parse_break_statement()"); + + return node_allocator_.allocate >(return_expr); + } + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR146 - Invalid use of 'break', allowed only in the scope of a loop", + exprtk_error_location)); + } + + return error_node(); + } + + inline expression_node_ptr parse_continue_statement() + { + if (0 == state_.parsing_loop_stmt_count) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR147 - Invalid use of 'continue', allowed only in the scope of a loop", + exprtk_error_location)); + + return error_node(); + } + else + { + next_token(); + + brkcnt_list_.front() = true; + state_.activate_side_effect("parse_continue_statement()"); + + return node_allocator_.allocate >(); + } + } + #endif + + inline expression_node_ptr parse_define_vector_statement(const std::string& vec_name) + { + expression_node_ptr size_expr = error_node(); + + if (!token_is(token_t::e_lsqrbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR148 - Expected '[' as part of vector size definition", + exprtk_error_location)); + + return error_node(); + } + else if (0 == (size_expr = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR149 - Failed to determine size of vector '" + vec_name + "'", + exprtk_error_location)); + + return error_node(); + } + else if (!is_constant_node(size_expr)) + { + free_node(node_allocator_,size_expr); + + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR150 - Expected a literal number as size of vector '" + vec_name + "'", + exprtk_error_location)); + + return error_node(); + } + + const T vector_size = size_expr->value(); + + free_node(node_allocator_,size_expr); + + const T max_vector_size = T(2000000000.0); + + if ( + (vector_size <= T(0)) || + std::not_equal_to() + (T(0),vector_size - details::numeric::trunc(vector_size)) || + (vector_size > max_vector_size) + ) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR151 - Invalid vector size. Must be an integer in the range [0,2e9], size: " + + details::to_str(details::numeric::to_int32(vector_size)), + exprtk_error_location)); + + return error_node(); + } + + std::vector vec_initilizer_list; + + scoped_vec_delete svd((*this),vec_initilizer_list); + + bool single_value_initialiser = false; + bool vec_to_vec_initialiser = false; + bool null_initialisation = false; + + if (!token_is(token_t::e_rsqrbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR152 - Expected ']' as part of vector size definition", + exprtk_error_location)); + + return error_node(); + } + else if (!token_is(token_t::e_eof)) + { + if (!token_is(token_t::e_assign)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR153 - Expected ':=' as part of vector definition", + exprtk_error_location)); + + return error_node(); + } + else if (token_is(token_t::e_lsqrbracket)) + { + expression_node_ptr initialiser = parse_expression(); + + if (0 == initialiser) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR154 - Failed to parse single vector initialiser", + exprtk_error_location)); + + return error_node(); + } + + vec_initilizer_list.push_back(initialiser); + + if (!token_is(token_t::e_rsqrbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR155 - Expected ']' to close single value vector initialiser", + exprtk_error_location)); + + return error_node(); + } + + single_value_initialiser = true; + } + else if (!token_is(token_t::e_lcrlbracket)) + { + expression_node_ptr initialiser = error_node(); + + // Is this a vector to vector assignment and initialisation? + if (token_t::e_symbol == current_token().type) + { + // Is it a locally defined vector? + const scope_element& se = sem_.get_active_element(current_token().value); + + if (scope_element::e_vector == se.type) + { + if (0 != (initialiser = parse_expression())) + vec_initilizer_list.push_back(initialiser); + else + return error_node(); + } + // Are we dealing with a user defined vector? + else if (symtab_store_.is_vector(current_token().value)) + { + lodge_symbol(current_token().value, e_st_vector); + + if (0 != (initialiser = parse_expression())) + vec_initilizer_list.push_back(initialiser); + else + return error_node(); + } + // Are we dealing with a null initialisation vector definition? + else if (token_is(token_t::e_symbol,"null")) + null_initialisation = true; + } + + if (!null_initialisation) + { + if (0 == initialiser) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR156 - Expected '{' as part of vector initialiser list", + exprtk_error_location)); + + return error_node(); + } + else + vec_to_vec_initialiser = true; + } + } + else if (!token_is(token_t::e_rcrlbracket)) + { + for ( ; ; ) + { + expression_node_ptr initialiser = parse_expression(); + + if (0 == initialiser) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR157 - Expected '{' as part of vector initialiser list", + exprtk_error_location)); + + return error_node(); + } + else + vec_initilizer_list.push_back(initialiser); + + if (token_is(token_t::e_rcrlbracket)) + break; + + const bool is_next_close = peek_token_is(token_t::e_rcrlbracket); + + if (!token_is(token_t::e_comma) && is_next_close) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR158 - Expected ',' between vector initialisers", + exprtk_error_location)); + + return error_node(); + } + + if (token_is(token_t::e_rcrlbracket)) + break; + } + } + + if ( + !token_is(token_t::e_rbracket , prsrhlpr_t::e_hold) && + !token_is(token_t::e_rcrlbracket, prsrhlpr_t::e_hold) && + !token_is(token_t::e_rsqrbracket, prsrhlpr_t::e_hold) + ) + { + if (!token_is(token_t::e_eof)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR159 - Expected ';' at end of vector definition", + exprtk_error_location)); + + return error_node(); + } + } + + if (T(vec_initilizer_list.size()) > vector_size) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR160 - Initialiser list larger than the number of elements in the vector: '" + vec_name + "'", + exprtk_error_location)); + + return error_node(); + } + } + + typename symbol_table_t::vector_holder_ptr vec_holder = typename symbol_table_t::vector_holder_ptr(0); + + const std::size_t vec_size = static_cast(details::numeric::to_int32(vector_size)); + + scope_element& se = sem_.get_element(vec_name); + + if (se.name == vec_name) + { + if (se.active) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR161 - Illegal redefinition of local vector: '" + vec_name + "'", + exprtk_error_location)); + + return error_node(); + } + else if ( + (se.size == vec_size) && + (scope_element::e_vector == se.type) + ) + { + vec_holder = se.vec_node; + se.active = true; + se.depth = state_.scope_depth; + se.ref_count++; + } + } + + if (0 == vec_holder) + { + scope_element nse; + nse.name = vec_name; + nse.active = true; + nse.ref_count = 1; + nse.type = scope_element::e_vector; + nse.depth = state_.scope_depth; + nse.size = vec_size; + nse.data = new T[vec_size]; + nse.vec_node = new typename scope_element::vector_holder_t(reinterpret_cast(nse.data),nse.size); + + if (!sem_.add_element(nse)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR162 - Failed to add new local vector '" + vec_name + "' to SEM", + exprtk_error_location)); + + sem_.free_element(nse); + + return error_node(); + } + + vec_holder = nse.vec_node; + + exprtk_debug(("parse_define_vector_statement() - INFO - Added new local vector: %s[%d]\n", + nse.name.c_str(), + static_cast(nse.size))); + } + + state_.activate_side_effect("parse_define_vector_statement()"); + + lodge_symbol(vec_name, e_st_local_vector); + + expression_node_ptr result = error_node(); + + if (null_initialisation) + result = expression_generator_(T(0.0)); + else if (vec_to_vec_initialiser) + { + expression_node_ptr vec_node = node_allocator_.allocate(vec_holder); + + result = expression_generator_( + details::e_assign, + vec_node, + vec_initilizer_list[0]); + } + else + result = node_allocator_ + .allocate >( + (*vec_holder)[0], + vec_size, + vec_initilizer_list, + single_value_initialiser); + + svd.delete_ptr = (0 == result); + + return result; + } + + #ifndef exprtk_disable_string_capabilities + inline expression_node_ptr parse_define_string_statement(const std::string& str_name, expression_node_ptr initialisation_expression) + { + stringvar_node_t* str_node = reinterpret_cast(0); + + scope_element& se = sem_.get_element(str_name); + + if (se.name == str_name) + { + if (se.active) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR163 - Illegal redefinition of local variable: '" + str_name + "'", + exprtk_error_location)); + + free_node(node_allocator_,initialisation_expression); + + return error_node(); + } + else if (scope_element::e_string == se.type) + { + str_node = se.str_node; + se.active = true; + se.depth = state_.scope_depth; + se.ref_count++; + } + } + + if (0 == str_node) + { + scope_element nse; + nse.name = str_name; + nse.active = true; + nse.ref_count = 1; + nse.type = scope_element::e_string; + nse.depth = state_.scope_depth; + nse.data = new std::string; + nse.str_node = new stringvar_node_t(*reinterpret_cast(nse.data)); + + if (!sem_.add_element(nse)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR164 - Failed to add new local string variable '" + str_name + "' to SEM", + exprtk_error_location)); + + free_node(node_allocator_,initialisation_expression); + + sem_.free_element(nse); + + return error_node(); + } + + str_node = nse.str_node; + + exprtk_debug(("parse_define_string_statement() - INFO - Added new local string variable: %s\n",nse.name.c_str())); + } + + lodge_symbol(str_name, e_st_local_string); + + state_.activate_side_effect("parse_define_string_statement()"); + + expression_node_ptr branch[2] = {0}; + + branch[0] = str_node; + branch[1] = initialisation_expression; + + return expression_generator_(details::e_assign,branch); + } + #else + inline expression_node_ptr parse_define_string_statement(const std::string&, expression_node_ptr) + { + return error_node(); + } + #endif + + inline bool local_variable_is_shadowed(const std::string& symbol) + { + const scope_element& se = sem_.get_element(symbol); + return (se.name == symbol) && se.active; + } + + inline expression_node_ptr parse_define_var_statement() + { + if (settings_.vardef_disabled()) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR165 - Illegal variable definition", + exprtk_error_location)); + + return error_node(); + } + else if (!details::imatch(current_token().value,"var")) + { + return error_node(); + } + else + next_token(); + + const std::string var_name = current_token().value; + + expression_node_ptr initialisation_expression = error_node(); + + if (!token_is(token_t::e_symbol)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR166 - Expected a symbol for variable definition", + exprtk_error_location)); + + return error_node(); + } + else if (details::is_reserved_symbol(var_name)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR167 - Illegal redefinition of reserved keyword: '" + var_name + "'", + exprtk_error_location)); + + return error_node(); + } + else if (symtab_store_.symbol_exists(var_name)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR168 - Illegal redefinition of variable '" + var_name + "'", + exprtk_error_location)); + + return error_node(); + } + else if (local_variable_is_shadowed(var_name)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR169 - Illegal redefinition of local variable: '" + var_name + "'", + exprtk_error_location)); + + return error_node(); + } + else if (token_is(token_t::e_lsqrbracket,prsrhlpr_t::e_hold)) + { + return parse_define_vector_statement(var_name); + } + else if (token_is(token_t::e_lcrlbracket,prsrhlpr_t::e_hold)) + { + return parse_uninitialised_var_statement(var_name); + } + else if (token_is(token_t::e_assign)) + { + if (0 == (initialisation_expression = parse_expression())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR170 - Failed to parse initialisation expression", + exprtk_error_location)); + + return error_node(); + } + } + + if ( + !token_is(token_t::e_rbracket , prsrhlpr_t::e_hold) && + !token_is(token_t::e_rcrlbracket, prsrhlpr_t::e_hold) && + !token_is(token_t::e_rsqrbracket, prsrhlpr_t::e_hold) + ) + { + if (!token_is(token_t::e_eof,prsrhlpr_t::e_hold)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR171 - Expected ';' after variable definition", + exprtk_error_location)); + + free_node(node_allocator_,initialisation_expression); + + return error_node(); + } + } + + if ( + (0 != initialisation_expression) && + details::is_generally_string_node(initialisation_expression) + ) + { + return parse_define_string_statement(var_name,initialisation_expression); + } + + expression_node_ptr var_node = reinterpret_cast(0); + + scope_element& se = sem_.get_element(var_name); + + if (se.name == var_name) + { + if (se.active) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR172 - Illegal redefinition of local variable: '" + var_name + "'", + exprtk_error_location)); + + free_node(node_allocator_, initialisation_expression); + + return error_node(); + } + else if (scope_element::e_variable == se.type) + { + var_node = se.var_node; + se.active = true; + se.depth = state_.scope_depth; + se.ref_count++; + } + } + + if (0 == var_node) + { + scope_element nse; + nse.name = var_name; + nse.active = true; + nse.ref_count = 1; + nse.type = scope_element::e_variable; + nse.depth = state_.scope_depth; + nse.data = new T(T(0)); + nse.var_node = node_allocator_.allocate(*reinterpret_cast(nse.data)); + + if (!sem_.add_element(nse)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR173 - Failed to add new local variable '" + var_name + "' to SEM", + exprtk_error_location)); + + free_node(node_allocator_, initialisation_expression); + + sem_.free_element(nse); + + return error_node(); + } + + var_node = nse.var_node; + + exprtk_debug(("parse_define_var_statement() - INFO - Added new local variable: %s\n",nse.name.c_str())); + } + + state_.activate_side_effect("parse_define_var_statement()"); + + lodge_symbol(var_name, e_st_local_variable); + + expression_node_ptr branch[2] = {0}; + + branch[0] = var_node; + branch[1] = initialisation_expression ? initialisation_expression : expression_generator_(T(0)); + + return expression_generator_(details::e_assign,branch); + } + + inline expression_node_ptr parse_uninitialised_var_statement(const std::string& var_name) + { + if ( + !token_is(token_t::e_lcrlbracket) || + !token_is(token_t::e_rcrlbracket) + ) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR174 - Expected a '{}' for uninitialised var definition", + exprtk_error_location)); + + return error_node(); + } + else if (!token_is(token_t::e_eof,prsrhlpr_t::e_hold)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR175 - Expected ';' after uninitialised variable definition", + exprtk_error_location)); + + return error_node(); + } + + expression_node_ptr var_node = reinterpret_cast(0); + + scope_element& se = sem_.get_element(var_name); + + if (se.name == var_name) + { + if (se.active) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR176 - Illegal redefinition of local variable: '" + var_name + "'", + exprtk_error_location)); + + return error_node(); + } + else if (scope_element::e_variable == se.type) + { + var_node = se.var_node; + se.active = true; + se.ref_count++; + } + } + + if (0 == var_node) + { + scope_element nse; + nse.name = var_name; + nse.active = true; + nse.ref_count = 1; + nse.type = scope_element::e_variable; + nse.depth = state_.scope_depth; + nse.ip_index = sem_.next_ip_index(); + nse.data = new T(T(0)); + nse.var_node = node_allocator_.allocate(*reinterpret_cast(nse.data)); + + if (!sem_.add_element(nse)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR177 - Failed to add new local variable '" + var_name + "' to SEM", + exprtk_error_location)); + + sem_.free_element(nse); + + return error_node(); + } + + exprtk_debug(("parse_uninitialised_var_statement() - INFO - Added new local variable: %s\n", + nse.name.c_str())); + } + + lodge_symbol(var_name, e_st_local_variable); + + state_.activate_side_effect("parse_uninitialised_var_statement()"); + + return expression_generator_(T(0)); + } + + inline expression_node_ptr parse_swap_statement() + { + if (!details::imatch(current_token().value,"swap")) + { + return error_node(); + } + else + next_token(); + + if (!token_is(token_t::e_lbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR178 - Expected '(' at start of swap statement", + exprtk_error_location)); + + return error_node(); + } + + expression_node_ptr variable0 = error_node(); + expression_node_ptr variable1 = error_node(); + + bool variable0_generated = false; + bool variable1_generated = false; + + const std::string var0_name = current_token().value; + + if (!token_is(token_t::e_symbol,prsrhlpr_t::e_hold)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR179 - Expected a symbol for variable or vector element definition", + exprtk_error_location)); + + return error_node(); + } + else if (peek_token_is(token_t::e_lsqrbracket)) + { + if (0 == (variable0 = parse_vector())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR180 - First parameter to swap is an invalid vector element: '" + var0_name + "'", + exprtk_error_location)); + + return error_node(); + } + + variable0_generated = true; + } + else + { + if (symtab_store_.is_variable(var0_name)) + { + variable0 = symtab_store_.get_variable(var0_name); + } + + const scope_element& se = sem_.get_element(var0_name); + + if ( + (se.active) && + (se.name == var0_name) && + (scope_element::e_variable == se.type) + ) + { + variable0 = se.var_node; + } + + lodge_symbol(var0_name, e_st_variable); + + if (0 == variable0) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR181 - First parameter to swap is an invalid variable: '" + var0_name + "'", + exprtk_error_location)); + + return error_node(); + } + else + next_token(); + } + + if (!token_is(token_t::e_comma)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR182 - Expected ',' between parameters to swap", + exprtk_error_location)); + + if (variable0_generated) + { + free_node(node_allocator_,variable0); + } + + return error_node(); + } + + const std::string var1_name = current_token().value; + + if (!token_is(token_t::e_symbol,prsrhlpr_t::e_hold)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR183 - Expected a symbol for variable or vector element definition", + exprtk_error_location)); + + if (variable0_generated) + { + free_node(node_allocator_,variable0); + } + + return error_node(); + } + else if (peek_token_is(token_t::e_lsqrbracket)) + { + if (0 == (variable1 = parse_vector())) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR184 - Second parameter to swap is an invalid vector element: '" + var1_name + "'", + exprtk_error_location)); + + if (variable0_generated) + { + free_node(node_allocator_,variable0); + } + + return error_node(); + } + + variable1_generated = true; + } + else + { + if (symtab_store_.is_variable(var1_name)) + { + variable1 = symtab_store_.get_variable(var1_name); + } + + const scope_element& se = sem_.get_element(var1_name); + + if ( + (se.active) && + (se.name == var1_name) && + (scope_element::e_variable == se.type) + ) + { + variable1 = se.var_node; + } + + lodge_symbol(var1_name, e_st_variable); + + if (0 == variable1) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR185 - Second parameter to swap is an invalid variable: '" + var1_name + "'", + exprtk_error_location)); + + if (variable0_generated) + { + free_node(node_allocator_,variable0); + } + + return error_node(); + } + else + next_token(); + } + + if (!token_is(token_t::e_rbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR186 - Expected ')' at end of swap statement", + exprtk_error_location)); + + if (variable0_generated) + { + free_node(node_allocator_,variable0); + } + + if (variable1_generated) + { + free_node(node_allocator_,variable1); + } + + return error_node(); + } + + typedef details::variable_node* variable_node_ptr; + + variable_node_ptr v0 = variable_node_ptr(0); + variable_node_ptr v1 = variable_node_ptr(0); + + expression_node_ptr result = error_node(); + + if ( + (0 != (v0 = dynamic_cast(variable0))) && + (0 != (v1 = dynamic_cast(variable1))) + ) + { + result = node_allocator_.allocate >(v0, v1); + + if (variable0_generated) + { + free_node(node_allocator_,variable0); + } + + if (variable1_generated) + { + free_node(node_allocator_,variable1); + } + } + else + result = node_allocator_.allocate > + (variable0, variable1); + + state_.activate_side_effect("parse_swap_statement()"); + + return result; + } + + #ifndef exprtk_disable_return_statement + inline expression_node_ptr parse_return_statement() + { + if (state_.parsing_return_stmt) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR187 - Return call within a return call is not allowed", + exprtk_error_location)); + + return error_node(); + } + + scoped_bool_negator sbn(state_.parsing_return_stmt); + + std::vector arg_list; + + scoped_vec_delete sdd((*this),arg_list); + + if (!details::imatch(current_token().value,"return")) + { + return error_node(); + } + else + next_token(); + + if (!token_is(token_t::e_lsqrbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR188 - Expected '[' at start of return statement", + exprtk_error_location)); + + return error_node(); + } + else if (!token_is(token_t::e_rsqrbracket)) + { + for ( ; ; ) + { + expression_node_ptr arg = parse_expression(); + + if (0 == arg) + return error_node(); + + arg_list.push_back(arg); + + if (token_is(token_t::e_rsqrbracket)) + break; + else if (!token_is(token_t::e_comma)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR189 - Expected ',' between values during call to return", + exprtk_error_location)); + + return error_node(); + } + } + } + else if (settings_.zero_return_disabled()) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR190 - Zero parameter return statement not allowed", + exprtk_error_location)); + + return error_node(); + } + + const lexer::token prev_token = current_token(); + + if (token_is(token_t::e_rsqrbracket)) + { + if (!arg_list.empty()) + { + set_error( + make_error(parser_error::e_syntax, + prev_token, + "ERR191 - Invalid ']' found during return call", + exprtk_error_location)); + + return error_node(); + } + } + + std::string ret_param_type_list; + + for (std::size_t i = 0; i < arg_list.size(); ++i) + { + if (0 == arg_list[i]) + return error_node(); + else if (is_ivector_node(arg_list[i])) + ret_param_type_list += 'V'; + else if (is_generally_string_node(arg_list[i])) + ret_param_type_list += 'S'; + else + ret_param_type_list += 'T'; + } + + dec_.retparam_list_.push_back(ret_param_type_list); + + expression_node_ptr result = expression_generator_.return_call(arg_list); + + sdd.delete_ptr = (0 == result); + + state_.return_stmt_present = true; + + state_.activate_side_effect("parse_return_statement()"); + + return result; + } + #else + inline expression_node_ptr parse_return_statement() + { + return error_node(); + } + #endif + + inline bool post_variable_process(const std::string& symbol) + { + if ( + peek_token_is(token_t::e_lbracket ) || + peek_token_is(token_t::e_lcrlbracket) || + peek_token_is(token_t::e_lsqrbracket) + ) + { + if (!settings_.commutative_check_enabled()) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR192 - Invalid sequence of variable '" + symbol + "' and bracket", + exprtk_error_location)); + + return false; + } + + lexer().insert_front(token_t::e_mul); + } + + return true; + } + + inline bool post_bracket_process(const typename token_t::token_type& token, expression_node_ptr& branch) + { + bool implied_mul = false; + + if (details::is_generally_string_node(branch)) + return true; + + const lexer::parser_helper::token_advance_mode hold = prsrhlpr_t::e_hold; + + switch (token) + { + case token_t::e_lcrlbracket : implied_mul = token_is(token_t::e_lbracket ,hold) || + token_is(token_t::e_lcrlbracket,hold) || + token_is(token_t::e_lsqrbracket,hold) ; + break; + + case token_t::e_lbracket : implied_mul = token_is(token_t::e_lbracket ,hold) || + token_is(token_t::e_lcrlbracket,hold) || + token_is(token_t::e_lsqrbracket,hold) ; + break; + + case token_t::e_lsqrbracket : implied_mul = token_is(token_t::e_lbracket ,hold) || + token_is(token_t::e_lcrlbracket,hold) || + token_is(token_t::e_lsqrbracket,hold) ; + break; + + default : return true; + } + + if (implied_mul) + { + if (!settings_.commutative_check_enabled()) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR193 - Invalid sequence of brackets", + exprtk_error_location)); + + return false; + } + else if (token_t::e_eof != current_token().type) + { + lexer().insert_front(current_token().type); + lexer().insert_front(token_t::e_mul); + next_token(); + } + } + + return true; + } + + typedef typename interval_container_t::interval_t interval_t; + typedef interval_container_t immutable_memory_map_t; + typedef std::map immutable_symtok_map_t; + + inline interval_t make_memory_range(const T& t) + { + const T* begin = reinterpret_cast(&t); + const T* end = begin + 1; + return interval_t(begin, end); + } + + inline interval_t make_memory_range(const T* begin, const std::size_t size) + { + return interval_t(begin, begin + size); + } + + inline interval_t make_memory_range(details::char_cptr begin, const std::size_t size) + { + return interval_t(begin, begin + size); + } + + void lodge_immutable_symbol(const lexer::token& token, const interval_t interval) + { + immutable_memory_map_.add_interval(interval); + immutable_symtok_map_[interval] = token; + } + + inline expression_node_ptr parse_symtab_symbol() + { + const std::string symbol = current_token().value; + + // Are we dealing with a variable or a special constant? + typedef typename symtab_store::variable_context var_ctxt_t; + var_ctxt_t var_ctx = symtab_store_.get_variable_context(symbol); + + if (var_ctx.variable) + { + assert(var_ctx.symbol_table); + + expression_node_ptr result_variable = var_ctx.variable; + + if (symtab_store_.is_constant_node(symbol)) + { + result_variable = expression_generator_(var_ctx.variable->value()); + } + else if (symbol_table_t::e_immutable == var_ctx.symbol_table->mutability()) + { + lodge_immutable_symbol(current_token(), make_memory_range(var_ctx.variable->ref())); + result_variable = var_ctx.variable; + } + + if (!post_variable_process(symbol)) + return error_node(); + + lodge_symbol(symbol, e_st_variable); + + next_token(); + + return result_variable; + } + + // Are we dealing with a locally defined variable, vector or string? + if (!sem_.empty()) + { + scope_element& se = sem_.get_active_element(symbol); + + if (se.active && details::imatch(se.name, symbol)) + { + if (scope_element::e_variable == se.type) + { + se.active = true; + lodge_symbol(symbol, e_st_local_variable); + + if (!post_variable_process(symbol)) + return error_node(); + + next_token(); + + return se.var_node; + } + else if (scope_element::e_vector == se.type) + { + return parse_vector(); + } + #ifndef exprtk_disable_string_capabilities + else if (scope_element::e_string == se.type) + { + return parse_string(); + } + #endif + } + } + + #ifndef exprtk_disable_string_capabilities + // Are we dealing with a string variable? + if (symtab_store_.is_stringvar(symbol)) + { + return parse_string(); + } + #endif + + { + // Are we dealing with a function? + ifunction* function = symtab_store_.get_function(symbol); + + if (function) + { + lodge_symbol(symbol, e_st_function); + + expression_node_ptr func_node = + parse_function_invocation(function,symbol); + + if (func_node) + return func_node; + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR194 - Failed to generate node for function: '" + symbol + "'", + exprtk_error_location)); + + return error_node(); + } + } + } + + { + // Are we dealing with a vararg function? + ivararg_function* vararg_function = symtab_store_.get_vararg_function(symbol); + + if (vararg_function) + { + lodge_symbol(symbol, e_st_function); + + expression_node_ptr vararg_func_node = + parse_vararg_function_call(vararg_function, symbol); + + if (vararg_func_node) + return vararg_func_node; + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR195 - Failed to generate node for vararg function: '" + symbol + "'", + exprtk_error_location)); + + return error_node(); + } + } + } + + { + // Are we dealing with a vararg generic function? + igeneric_function* generic_function = symtab_store_.get_generic_function(symbol); + + if (generic_function) + { + lodge_symbol(symbol, e_st_function); + + expression_node_ptr genericfunc_node = + parse_generic_function_call(generic_function, symbol); + + if (genericfunc_node) + return genericfunc_node; + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR196 - Failed to generate node for generic function: '" + symbol + "'", + exprtk_error_location)); + + return error_node(); + } + } + } + + #ifndef exprtk_disable_string_capabilities + { + // Are we dealing with a vararg string returning function? + igeneric_function* string_function = symtab_store_.get_string_function(symbol); + + if (string_function) + { + lodge_symbol(symbol, e_st_function); + + expression_node_ptr stringfunc_node = + parse_string_function_call(string_function, symbol); + + if (stringfunc_node) + return stringfunc_node; + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR197 - Failed to generate node for string function: '" + symbol + "'", + exprtk_error_location)); + + return error_node(); + } + } + } + + { + // Are we dealing with a vararg overloaded scalar/string returning function? + igeneric_function* overload_function = symtab_store_.get_overload_function(symbol); + + if (overload_function) + { + lodge_symbol(symbol, e_st_function); + + expression_node_ptr overloadfunc_node = + parse_overload_function_call(overload_function, symbol); + + if (overloadfunc_node) + return overloadfunc_node; + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR198 - Failed to generate node for overload function: '" + symbol + "'", + exprtk_error_location)); + + return error_node(); + } + } + } + #endif + + // Are we dealing with a vector? + if (symtab_store_.is_vector(symbol)) + { + lodge_symbol(symbol, e_st_vector); + return parse_vector(); + } + + if (details::is_reserved_symbol(symbol)) + { + if ( + settings_.function_enabled(symbol) || + !details::is_base_function(symbol) + ) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR199 - Invalid use of reserved symbol '" + symbol + "'", + exprtk_error_location)); + + return error_node(); + } + } + + // Should we handle unknown symbols? + if (resolve_unknown_symbol_ && unknown_symbol_resolver_) + { + if (!(settings_.rsrvd_sym_usr_disabled() && details::is_reserved_symbol(symbol))) + { + symbol_table_t& symtab = symtab_store_.get_symbol_table(); + + std::string error_message; + + if (unknown_symbol_resolver::e_usrmode_default == unknown_symbol_resolver_->mode) + { + T default_value = T(0); + + typename unknown_symbol_resolver::usr_symbol_type usr_symbol_type = unknown_symbol_resolver::e_usr_unknown_type; + + if (unknown_symbol_resolver_->process(symbol, usr_symbol_type, default_value, error_message)) + { + bool create_result = false; + + switch (usr_symbol_type) + { + case unknown_symbol_resolver::e_usr_variable_type : create_result = symtab.create_variable(symbol, default_value); + break; + + case unknown_symbol_resolver::e_usr_constant_type : create_result = symtab.add_constant(symbol, default_value); + break; + + default : create_result = false; + } + + if (create_result) + { + expression_node_ptr var = symtab_store_.get_variable(symbol); + + if (var) + { + if (symtab_store_.is_constant_node(symbol)) + { + var = expression_generator_(var->value()); + } + + lodge_symbol(symbol, e_st_variable); + + if (!post_variable_process(symbol)) + return error_node(); + + next_token(); + + return var; + } + } + } + + set_error( + make_error(parser_error::e_symtab, + current_token(), + "ERR200 - Failed to create variable: '" + symbol + "'" + + (error_message.empty() ? "" : " - " + error_message), + exprtk_error_location)); + + } + else if (unknown_symbol_resolver::e_usrmode_extended == unknown_symbol_resolver_->mode) + { + if (unknown_symbol_resolver_->process(symbol, symtab, error_message)) + { + expression_node_ptr result = parse_symtab_symbol(); + + if (result) + { + return result; + } + } + + set_error( + make_error(parser_error::e_symtab, + current_token(), + "ERR201 - Failed to resolve symbol: '" + symbol + "'" + + (error_message.empty() ? "" : " - " + error_message), + exprtk_error_location)); + } + + return error_node(); + } + } + + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR202 - Undefined symbol: '" + symbol + "'", + exprtk_error_location)); + + return error_node(); + } + + inline expression_node_ptr parse_symbol() + { + static const std::string symbol_if = "if" ; + static const std::string symbol_while = "while" ; + static const std::string symbol_repeat = "repeat" ; + static const std::string symbol_for = "for" ; + static const std::string symbol_switch = "switch" ; + static const std::string symbol_null = "null" ; + static const std::string symbol_break = "break" ; + static const std::string symbol_continue = "continue"; + static const std::string symbol_var = "var" ; + static const std::string symbol_swap = "swap" ; + static const std::string symbol_return = "return" ; + static const std::string symbol_not = "not" ; + + const std::string symbol = current_token().value; + + if (valid_vararg_operation(symbol)) + { + return parse_vararg_function(); + } + else if (details::imatch(symbol, symbol_not)) + { + return parse_not_statement(); + } + else if (valid_base_operation(symbol)) + { + return parse_base_operation(); + } + else if ( + details::imatch(symbol, symbol_if) && + settings_.control_struct_enabled(symbol) + ) + { + return parse_conditional_statement(); + } + else if ( + details::imatch(symbol, symbol_while) && + settings_.control_struct_enabled(symbol) + ) + { + return parse_while_loop(); + } + else if ( + details::imatch(symbol, symbol_repeat) && + settings_.control_struct_enabled(symbol) + ) + { + return parse_repeat_until_loop(); + } + else if ( + details::imatch(symbol, symbol_for) && + settings_.control_struct_enabled(symbol) + ) + { + return parse_for_loop(); + } + else if ( + details::imatch(symbol, symbol_switch) && + settings_.control_struct_enabled(symbol) + ) + { + return parse_switch_statement(); + } + else if (details::is_valid_sf_symbol(symbol)) + { + return parse_special_function(); + } + else if (details::imatch(symbol, symbol_null)) + { + return parse_null_statement(); + } + #ifndef exprtk_disable_break_continue + else if (details::imatch(symbol, symbol_break)) + { + return parse_break_statement(); + } + else if (details::imatch(symbol, symbol_continue)) + { + return parse_continue_statement(); + } + #endif + else if (details::imatch(symbol, symbol_var)) + { + return parse_define_var_statement(); + } + else if (details::imatch(symbol, symbol_swap)) + { + return parse_swap_statement(); + } + #ifndef exprtk_disable_return_statement + else if ( + details::imatch(symbol, symbol_return) && + settings_.control_struct_enabled(symbol) + ) + { + return parse_return_statement(); + } + #endif + else if (symtab_store_.valid() || !sem_.empty()) + { + return parse_symtab_symbol(); + } + else + { + set_error( + make_error(parser_error::e_symtab, + current_token(), + "ERR203 - Variable or function detected, yet symbol-table is invalid, Symbol: " + symbol, + exprtk_error_location)); + + return error_node(); + } + } + + inline expression_node_ptr parse_branch(precedence_level precedence = e_level00) + { + stack_limit_handler slh(*this); + + if (!slh) + { + return error_node(); + } + + expression_node_ptr branch = error_node(); + + if (token_t::e_number == current_token().type) + { + T numeric_value = T(0); + + if (details::string_to_real(current_token().value, numeric_value)) + { + expression_node_ptr literal_exp = expression_generator_(numeric_value); + + if (0 == literal_exp) + { + set_error( + make_error(parser_error::e_numeric, + current_token(), + "ERR204 - Failed generate node for scalar: '" + current_token().value + "'", + exprtk_error_location)); + + return error_node(); + } + + next_token(); + branch = literal_exp; + } + else + { + set_error( + make_error(parser_error::e_numeric, + current_token(), + "ERR205 - Failed to convert '" + current_token().value + "' to a number", + exprtk_error_location)); + + return error_node(); + } + } + else if (token_t::e_symbol == current_token().type) + { + branch = parse_symbol(); + } + #ifndef exprtk_disable_string_capabilities + else if (token_t::e_string == current_token().type) + { + branch = parse_const_string(); + } + #endif + else if (token_t::e_lbracket == current_token().type) + { + next_token(); + + if (0 == (branch = parse_expression())) + return error_node(); + else if (!token_is(token_t::e_rbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR206 - Expected ')' instead of: '" + current_token().value + "'", + exprtk_error_location)); + + details::free_node(node_allocator_,branch); + + return error_node(); + } + else if (!post_bracket_process(token_t::e_lbracket,branch)) + { + details::free_node(node_allocator_,branch); + + return error_node(); + } + } + else if (token_t::e_lsqrbracket == current_token().type) + { + next_token(); + + if (0 == (branch = parse_expression())) + return error_node(); + else if (!token_is(token_t::e_rsqrbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR207 - Expected ']' instead of: '" + current_token().value + "'", + exprtk_error_location)); + + details::free_node(node_allocator_,branch); + + return error_node(); + } + else if (!post_bracket_process(token_t::e_lsqrbracket,branch)) + { + details::free_node(node_allocator_,branch); + + return error_node(); + } + } + else if (token_t::e_lcrlbracket == current_token().type) + { + next_token(); + + if (0 == (branch = parse_expression())) + return error_node(); + else if (!token_is(token_t::e_rcrlbracket)) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR208 - Expected '}' instead of: '" + current_token().value + "'", + exprtk_error_location)); + + details::free_node(node_allocator_,branch); + + return error_node(); + } + else if (!post_bracket_process(token_t::e_lcrlbracket,branch)) + { + details::free_node(node_allocator_,branch); + + return error_node(); + } + } + else if (token_t::e_sub == current_token().type) + { + next_token(); + branch = parse_expression(e_level11); + + if ( + branch && + !( + details::is_neg_unary_node (branch) && + simplify_unary_negation_branch(branch) + ) + ) + { + expression_node_ptr result = expression_generator_(details::e_neg,branch); + + if (0 == result) + { + details::free_node(node_allocator_,branch); + + return error_node(); + } + else + branch = result; + } + } + else if (token_t::e_add == current_token().type) + { + next_token(); + branch = parse_expression(e_level13); + } + else if (token_t::e_eof == current_token().type) + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR209 - Premature end of expression[1]", + exprtk_error_location)); + + return error_node(); + } + else + { + set_error( + make_error(parser_error::e_syntax, + current_token(), + "ERR210 - Premature end of expression[2]", + exprtk_error_location)); + + return error_node(); + } + + if ( + branch && + (e_level00 == precedence) && + token_is(token_t::e_ternary,prsrhlpr_t::e_hold) + ) + { + branch = parse_ternary_conditional_statement(branch); + } + + parse_pending_string_rangesize(branch); + + return branch; + } + + template + class expression_generator + { + public: + + typedef details::expression_node* expression_node_ptr; + typedef expression_node_ptr (*synthesize_functor_t)(expression_generator&, const details::operator_type& operation, expression_node_ptr (&branch)[2]); + typedef std::map synthesize_map_t; + typedef typename exprtk::parser parser_t; + typedef const Type& vtype; + typedef const Type ctype; + + inline void init_synthesize_map() + { + #ifndef exprtk_disable_enhanced_features + synthesize_map_["(v)o(v)"] = synthesize_vov_expression::process; + synthesize_map_["(c)o(v)"] = synthesize_cov_expression::process; + synthesize_map_["(v)o(c)"] = synthesize_voc_expression::process; + + #define register_synthezier(S) \ + synthesize_map_[S ::node_type::id()] = S ::process; \ + + register_synthezier(synthesize_vovov_expression0) + register_synthezier(synthesize_vovov_expression1) + register_synthezier(synthesize_vovoc_expression0) + register_synthezier(synthesize_vovoc_expression1) + register_synthezier(synthesize_vocov_expression0) + register_synthezier(synthesize_vocov_expression1) + register_synthezier(synthesize_covov_expression0) + register_synthezier(synthesize_covov_expression1) + register_synthezier(synthesize_covoc_expression0) + register_synthezier(synthesize_covoc_expression1) + register_synthezier(synthesize_cocov_expression1) + register_synthezier(synthesize_vococ_expression0) + + register_synthezier(synthesize_vovovov_expression0) + register_synthezier(synthesize_vovovoc_expression0) + register_synthezier(synthesize_vovocov_expression0) + register_synthezier(synthesize_vocovov_expression0) + register_synthezier(synthesize_covovov_expression0) + register_synthezier(synthesize_covocov_expression0) + register_synthezier(synthesize_vocovoc_expression0) + register_synthezier(synthesize_covovoc_expression0) + register_synthezier(synthesize_vococov_expression0) + + register_synthezier(synthesize_vovovov_expression1) + register_synthezier(synthesize_vovovoc_expression1) + register_synthezier(synthesize_vovocov_expression1) + register_synthezier(synthesize_vocovov_expression1) + register_synthezier(synthesize_covovov_expression1) + register_synthezier(synthesize_covocov_expression1) + register_synthezier(synthesize_vocovoc_expression1) + register_synthezier(synthesize_covovoc_expression1) + register_synthezier(synthesize_vococov_expression1) + + register_synthezier(synthesize_vovovov_expression2) + register_synthezier(synthesize_vovovoc_expression2) + register_synthezier(synthesize_vovocov_expression2) + register_synthezier(synthesize_vocovov_expression2) + register_synthezier(synthesize_covovov_expression2) + register_synthezier(synthesize_covocov_expression2) + register_synthezier(synthesize_vocovoc_expression2) + register_synthezier(synthesize_covovoc_expression2) + + register_synthezier(synthesize_vovovov_expression3) + register_synthezier(synthesize_vovovoc_expression3) + register_synthezier(synthesize_vovocov_expression3) + register_synthezier(synthesize_vocovov_expression3) + register_synthezier(synthesize_covovov_expression3) + register_synthezier(synthesize_covocov_expression3) + register_synthezier(synthesize_vocovoc_expression3) + register_synthezier(synthesize_covovoc_expression3) + register_synthezier(synthesize_vococov_expression3) + + register_synthezier(synthesize_vovovov_expression4) + register_synthezier(synthesize_vovovoc_expression4) + register_synthezier(synthesize_vovocov_expression4) + register_synthezier(synthesize_vocovov_expression4) + register_synthezier(synthesize_covovov_expression4) + register_synthezier(synthesize_covocov_expression4) + register_synthezier(synthesize_vocovoc_expression4) + register_synthezier(synthesize_covovoc_expression4) + #endif + } + + inline void set_parser(parser_t& p) + { + parser_ = &p; + } + + inline void set_uom(unary_op_map_t& unary_op_map) + { + unary_op_map_ = &unary_op_map; + } + + inline void set_bom(binary_op_map_t& binary_op_map) + { + binary_op_map_ = &binary_op_map; + } + + inline void set_ibom(inv_binary_op_map_t& inv_binary_op_map) + { + inv_binary_op_map_ = &inv_binary_op_map; + } + + inline void set_sf3m(sf3_map_t& sf3_map) + { + sf3_map_ = &sf3_map; + } + + inline void set_sf4m(sf4_map_t& sf4_map) + { + sf4_map_ = &sf4_map; + } + + inline void set_allocator(details::node_allocator& na) + { + node_allocator_ = &na; + } + + inline void set_strength_reduction_state(const bool enabled) + { + strength_reduction_enabled_ = enabled; + } + + inline bool strength_reduction_enabled() const + { + return strength_reduction_enabled_; + } + + inline bool valid_operator(const details::operator_type& operation, binary_functor_t& bop) + { + typename binary_op_map_t::iterator bop_itr = binary_op_map_->find(operation); + + if ((*binary_op_map_).end() == bop_itr) + return false; + + bop = bop_itr->second; + + return true; + } + + inline bool valid_operator(const details::operator_type& operation, unary_functor_t& uop) + { + typename unary_op_map_t::iterator uop_itr = unary_op_map_->find(operation); + + if ((*unary_op_map_).end() == uop_itr) + return false; + + uop = uop_itr->second; + + return true; + } + + inline details::operator_type get_operator(const binary_functor_t& bop) const + { + return (*inv_binary_op_map_).find(bop)->second; + } + + inline expression_node_ptr operator() (const Type& v) const + { + return node_allocator_->allocate(v); + } + + #ifndef exprtk_disable_string_capabilities + inline expression_node_ptr operator() (const std::string& s) const + { + return node_allocator_->allocate(s); + } + + inline expression_node_ptr operator() (std::string& s, range_t& rp) const + { + return node_allocator_->allocate_rr(s,rp); + } + + inline expression_node_ptr operator() (const std::string& s, range_t& rp) const + { + return node_allocator_->allocate_tt(s,rp); + } + + inline expression_node_ptr operator() (expression_node_ptr branch, range_t& rp) const + { + if (is_generally_string_node(branch)) + return node_allocator_->allocate_tt(branch,rp); + else + return error_node(); + } + #endif + + inline bool unary_optimisable(const details::operator_type& operation) const + { + return (details::e_abs == operation) || (details::e_acos == operation) || + (details::e_acosh == operation) || (details::e_asin == operation) || + (details::e_asinh == operation) || (details::e_atan == operation) || + (details::e_atanh == operation) || (details::e_ceil == operation) || + (details::e_cos == operation) || (details::e_cosh == operation) || + (details::e_exp == operation) || (details::e_expm1 == operation) || + (details::e_floor == operation) || (details::e_log == operation) || + (details::e_log10 == operation) || (details::e_log2 == operation) || + (details::e_log1p == operation) || (details::e_neg == operation) || + (details::e_pos == operation) || (details::e_round == operation) || + (details::e_sin == operation) || (details::e_sinc == operation) || + (details::e_sinh == operation) || (details::e_sqrt == operation) || + (details::e_tan == operation) || (details::e_tanh == operation) || + (details::e_cot == operation) || (details::e_sec == operation) || + (details::e_csc == operation) || (details::e_r2d == operation) || + (details::e_d2r == operation) || (details::e_d2g == operation) || + (details::e_g2d == operation) || (details::e_notl == operation) || + (details::e_sgn == operation) || (details::e_erf == operation) || + (details::e_erfc == operation) || (details::e_ncdf == operation) || + (details::e_frac == operation) || (details::e_trunc == operation) ; + } + + inline bool sf3_optimisable(const std::string& sf3id, trinary_functor_t& tfunc) const + { + typename sf3_map_t::const_iterator itr = sf3_map_->find(sf3id); + + if (sf3_map_->end() == itr) + return false; + else + tfunc = itr->second.first; + + return true; + } + + inline bool sf4_optimisable(const std::string& sf4id, quaternary_functor_t& qfunc) const + { + typename sf4_map_t::const_iterator itr = sf4_map_->find(sf4id); + + if (sf4_map_->end() == itr) + return false; + else + qfunc = itr->second.first; + + return true; + } + + inline bool sf3_optimisable(const std::string& sf3id, details::operator_type& operation) const + { + typename sf3_map_t::const_iterator itr = sf3_map_->find(sf3id); + + if (sf3_map_->end() == itr) + return false; + else + operation = itr->second.second; + + return true; + } + + inline bool sf4_optimisable(const std::string& sf4id, details::operator_type& operation) const + { + typename sf4_map_t::const_iterator itr = sf4_map_->find(sf4id); + + if (sf4_map_->end() == itr) + return false; + else + operation = itr->second.second; + + return true; + } + + inline expression_node_ptr operator() (const details::operator_type& operation, expression_node_ptr (&branch)[1]) + { + if (0 == branch[0]) + { + return error_node(); + } + else if (details::is_null_node(branch[0])) + { + return branch[0]; + } + else if (details::is_break_node(branch[0])) + { + return error_node(); + } + else if (details::is_continue_node(branch[0])) + { + return error_node(); + } + else if (details::is_constant_node(branch[0])) + { + return synthesize_expression(operation,branch); + } + else if (unary_optimisable(operation) && details::is_variable_node(branch[0])) + { + return synthesize_uv_expression(operation,branch); + } + else if (unary_optimisable(operation) && details::is_ivector_node(branch[0])) + { + return synthesize_uvec_expression(operation,branch); + } + else + return synthesize_unary_expression(operation,branch); + } + + inline bool is_assignment_operation(const details::operator_type& operation) const + { + return ( + (details::e_addass == operation) || + (details::e_subass == operation) || + (details::e_mulass == operation) || + (details::e_divass == operation) || + (details::e_modass == operation) + ) && + parser_->settings_.assignment_enabled(operation); + } + + #ifndef exprtk_disable_string_capabilities + inline bool valid_string_operation(const details::operator_type& operation) const + { + return (details::e_add == operation) || + (details::e_lt == operation) || + (details::e_lte == operation) || + (details::e_gt == operation) || + (details::e_gte == operation) || + (details::e_eq == operation) || + (details::e_ne == operation) || + (details::e_in == operation) || + (details::e_like == operation) || + (details::e_ilike == operation) || + (details::e_assign == operation) || + (details::e_addass == operation) || + (details::e_swap == operation) ; + } + #else + inline bool valid_string_operation(const details::operator_type&) const + { + return false; + } + #endif + + inline std::string to_str(const details::operator_type& operation) const + { + switch (operation) + { + case details::e_add : return "+" ; + case details::e_sub : return "-" ; + case details::e_mul : return "*" ; + case details::e_div : return "/" ; + case details::e_mod : return "%" ; + case details::e_pow : return "^" ; + case details::e_lt : return "<" ; + case details::e_lte : return "<=" ; + case details::e_gt : return ">" ; + case details::e_gte : return ">=" ; + case details::e_eq : return "==" ; + case details::e_ne : return "!=" ; + case details::e_and : return "and" ; + case details::e_nand : return "nand" ; + case details::e_or : return "or" ; + case details::e_nor : return "nor" ; + case details::e_xor : return "xor" ; + case details::e_xnor : return "xnor" ; + default : return "UNKNOWN"; + } + } + + inline bool operation_optimisable(const details::operator_type& operation) const + { + return (details::e_add == operation) || + (details::e_sub == operation) || + (details::e_mul == operation) || + (details::e_div == operation) || + (details::e_mod == operation) || + (details::e_pow == operation) || + (details::e_lt == operation) || + (details::e_lte == operation) || + (details::e_gt == operation) || + (details::e_gte == operation) || + (details::e_eq == operation) || + (details::e_ne == operation) || + (details::e_and == operation) || + (details::e_nand == operation) || + (details::e_or == operation) || + (details::e_nor == operation) || + (details::e_xor == operation) || + (details::e_xnor == operation) ; + } + + inline std::string branch_to_id(expression_node_ptr branch) const + { + static const std::string null_str ("(null)" ); + static const std::string const_str ("(c)" ); + static const std::string var_str ("(v)" ); + static const std::string vov_str ("(vov)" ); + static const std::string cov_str ("(cov)" ); + static const std::string voc_str ("(voc)" ); + static const std::string str_str ("(s)" ); + static const std::string strrng_str ("(rngs)" ); + static const std::string cs_str ("(cs)" ); + static const std::string cstrrng_str("(crngs)"); + + if (details::is_null_node(branch)) + return null_str; + else if (details::is_constant_node(branch)) + return const_str; + else if (details::is_variable_node(branch)) + return var_str; + else if (details::is_vov_node(branch)) + return vov_str; + else if (details::is_cov_node(branch)) + return cov_str; + else if (details::is_voc_node(branch)) + return voc_str; + else if (details::is_string_node(branch)) + return str_str; + else if (details::is_const_string_node(branch)) + return cs_str; + else if (details::is_string_range_node(branch)) + return strrng_str; + else if (details::is_const_string_range_node(branch)) + return cstrrng_str; + else if (details::is_t0ot1ot2_node(branch)) + return "(" + dynamic_cast*>(branch)->type_id() + ")"; + else if (details::is_t0ot1ot2ot3_node(branch)) + return "(" + dynamic_cast*>(branch)->type_id() + ")"; + else + return "ERROR"; + } + + inline std::string branch_to_id(expression_node_ptr (&branch)[2]) const + { + return branch_to_id(branch[0]) + std::string("o") + branch_to_id(branch[1]); + } + + inline bool cov_optimisable(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if (!operation_optimisable(operation)) + return false; + else + return details::is_constant_node(branch[0]) && + details::is_variable_node(branch[1]) ; + } + + inline bool voc_optimisable(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if (!operation_optimisable(operation)) + return false; + else + return details::is_variable_node(branch[0]) && + details::is_constant_node(branch[1]) ; + } + + inline bool vov_optimisable(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if (!operation_optimisable(operation)) + return false; + else + return details::is_variable_node(branch[0]) && + details::is_variable_node(branch[1]) ; + } + + inline bool cob_optimisable(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if (!operation_optimisable(operation)) + return false; + else + return details::is_constant_node(branch[0]) && + !details::is_constant_node(branch[1]) ; + } + + inline bool boc_optimisable(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if (!operation_optimisable(operation)) + return false; + else + return !details::is_constant_node(branch[0]) && + details::is_constant_node(branch[1]) ; + } + + inline bool cocob_optimisable(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if ( + (details::e_add == operation) || + (details::e_sub == operation) || + (details::e_mul == operation) || + (details::e_div == operation) + ) + { + return (details::is_constant_node(branch[0]) && details::is_cob_node(branch[1])) || + (details::is_constant_node(branch[1]) && details::is_cob_node(branch[0])) ; + } + else + return false; + } + + inline bool coboc_optimisable(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if ( + (details::e_add == operation) || + (details::e_sub == operation) || + (details::e_mul == operation) || + (details::e_div == operation) + ) + { + return (details::is_constant_node(branch[0]) && details::is_boc_node(branch[1])) || + (details::is_constant_node(branch[1]) && details::is_boc_node(branch[0])) ; + } + else + return false; + } + + inline bool uvouv_optimisable(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if (!operation_optimisable(operation)) + return false; + else + return details::is_uv_node(branch[0]) && + details::is_uv_node(branch[1]) ; + } + + inline bool vob_optimisable(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if (!operation_optimisable(operation)) + return false; + else + return details::is_variable_node(branch[0]) && + !details::is_variable_node(branch[1]) ; + } + + inline bool bov_optimisable(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if (!operation_optimisable(operation)) + return false; + else + return !details::is_variable_node(branch[0]) && + details::is_variable_node(branch[1]) ; + } + + inline bool binext_optimisable(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if (!operation_optimisable(operation)) + return false; + else + return !details::is_constant_node(branch[0]) || + !details::is_constant_node(branch[1]) ; + } + + inline bool is_invalid_assignment_op(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if (is_assignment_operation(operation)) + { + const bool b1_is_genstring = details::is_generally_string_node(branch[1]); + + if (details::is_string_node(branch[0])) + return !b1_is_genstring; + else + return ( + !details::is_variable_node (branch[0]) && + !details::is_vector_elem_node (branch[0]) && + !details::is_rebasevector_elem_node (branch[0]) && + !details::is_rebasevector_celem_node(branch[0]) && + !details::is_vector_node (branch[0]) + ) + || b1_is_genstring; + } + else + return false; + } + + inline bool is_constpow_operation(const details::operator_type& operation, expression_node_ptr(&branch)[2]) const + { + if ( + !details::is_constant_node(branch[1]) || + details::is_constant_node(branch[0]) || + details::is_variable_node(branch[0]) || + details::is_vector_node (branch[0]) || + details::is_generally_string_node(branch[0]) + ) + return false; + + const Type c = static_cast*>(branch[1])->value(); + + return cardinal_pow_optimisable(operation, c); + } + + inline bool is_invalid_break_continue_op(expression_node_ptr (&branch)[2]) const + { + return ( + details::is_break_node (branch[0]) || + details::is_break_node (branch[1]) || + details::is_continue_node(branch[0]) || + details::is_continue_node(branch[1]) + ); + } + + inline bool is_invalid_string_op(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + const bool b0_string = is_generally_string_node(branch[0]); + const bool b1_string = is_generally_string_node(branch[1]); + + bool result = false; + + if (b0_string != b1_string) + result = true; + else if (!valid_string_operation(operation) && b0_string && b1_string) + result = true; + + if (result) + { + parser_->set_synthesis_error("Invalid string operation"); + } + + return result; + } + + inline bool is_invalid_string_op(const details::operator_type& operation, expression_node_ptr (&branch)[3]) const + { + const bool b0_string = is_generally_string_node(branch[0]); + const bool b1_string = is_generally_string_node(branch[1]); + const bool b2_string = is_generally_string_node(branch[2]); + + bool result = false; + + if ((b0_string != b1_string) || (b1_string != b2_string)) + result = true; + else if ((details::e_inrange != operation) && b0_string && b1_string && b2_string) + result = true; + + if (result) + { + parser_->set_synthesis_error("Invalid string operation"); + } + + return result; + } + + inline bool is_string_operation(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + const bool b0_string = is_generally_string_node(branch[0]); + const bool b1_string = is_generally_string_node(branch[1]); + + return (b0_string && b1_string && valid_string_operation(operation)); + } + + inline bool is_string_operation(const details::operator_type& operation, expression_node_ptr (&branch)[3]) const + { + const bool b0_string = is_generally_string_node(branch[0]); + const bool b1_string = is_generally_string_node(branch[1]); + const bool b2_string = is_generally_string_node(branch[2]); + + return (b0_string && b1_string && b2_string && (details::e_inrange == operation)); + } + + #ifndef exprtk_disable_sc_andor + inline bool is_shortcircuit_expression(const details::operator_type& operation) const + { + return ( + (details::e_scand == operation) || + (details::e_scor == operation) + ); + } + #else + inline bool is_shortcircuit_expression(const details::operator_type&) const + { + return false; + } + #endif + + inline bool is_null_present(expression_node_ptr (&branch)[2]) const + { + return ( + details::is_null_node(branch[0]) || + details::is_null_node(branch[1]) + ); + } + + inline bool is_vector_eqineq_logic_operation(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if (!is_ivector_node(branch[0]) && !is_ivector_node(branch[1])) + return false; + else + return ( + (details::e_lt == operation) || + (details::e_lte == operation) || + (details::e_gt == operation) || + (details::e_gte == operation) || + (details::e_eq == operation) || + (details::e_ne == operation) || + (details::e_equal == operation) || + (details::e_and == operation) || + (details::e_nand == operation) || + (details::e_or == operation) || + (details::e_nor == operation) || + (details::e_xor == operation) || + (details::e_xnor == operation) + ); + } + + inline bool is_vector_arithmetic_operation(const details::operator_type& operation, expression_node_ptr (&branch)[2]) const + { + if (!is_ivector_node(branch[0]) && !is_ivector_node(branch[1])) + return false; + else + return ( + (details::e_add == operation) || + (details::e_sub == operation) || + (details::e_mul == operation) || + (details::e_div == operation) || + (details::e_pow == operation) + ); + } + + inline expression_node_ptr operator() (const details::operator_type& operation, expression_node_ptr (&branch)[2]) + { + if ((0 == branch[0]) || (0 == branch[1])) + { + return error_node(); + } + else if (is_invalid_string_op(operation,branch)) + { + return error_node(); + } + else if (is_invalid_assignment_op(operation,branch)) + { + return error_node(); + } + else if (is_invalid_break_continue_op(branch)) + { + return error_node(); + } + else if (details::e_assign == operation) + { + return synthesize_assignment_expression(operation, branch); + } + else if (details::e_swap == operation) + { + return synthesize_swap_expression(branch); + } + else if (is_assignment_operation(operation)) + { + return synthesize_assignment_operation_expression(operation, branch); + } + else if (is_vector_eqineq_logic_operation(operation, branch)) + { + return synthesize_veceqineqlogic_operation_expression(operation, branch); + } + else if (is_vector_arithmetic_operation(operation, branch)) + { + return synthesize_vecarithmetic_operation_expression(operation, branch); + } + else if (is_shortcircuit_expression(operation)) + { + return synthesize_shortcircuit_expression(operation, branch); + } + else if (is_string_operation(operation, branch)) + { + return synthesize_string_expression(operation, branch); + } + else if (is_null_present(branch)) + { + return synthesize_null_expression(operation, branch); + } + #ifndef exprtk_disable_cardinal_pow_optimisation + else if (is_constpow_operation(operation, branch)) + { + return cardinal_pow_optimisation(branch); + } + #endif + + expression_node_ptr result = error_node(); + + #ifndef exprtk_disable_enhanced_features + if (synthesize_expression(operation, branch, result)) + { + return result; + } + else + #endif + + { + /* + Possible reductions: + 1. c o cob -> cob + 2. cob o c -> cob + 3. c o boc -> boc + 4. boc o c -> boc + */ + result = error_node(); + + if (cocob_optimisable(operation, branch)) + { + result = synthesize_cocob_expression::process((*this), operation, branch); + } + else if (coboc_optimisable(operation, branch) && (0 == result)) + { + result = synthesize_coboc_expression::process((*this), operation, branch); + } + + if (result) + return result; + } + + if (uvouv_optimisable(operation, branch)) + { + return synthesize_uvouv_expression(operation, branch); + } + else if (vob_optimisable(operation, branch)) + { + return synthesize_vob_expression::process((*this), operation, branch); + } + else if (bov_optimisable(operation, branch)) + { + return synthesize_bov_expression::process((*this), operation, branch); + } + else if (cob_optimisable(operation, branch)) + { + return synthesize_cob_expression::process((*this), operation, branch); + } + else if (boc_optimisable(operation, branch)) + { + return synthesize_boc_expression::process((*this), operation, branch); + } + #ifndef exprtk_disable_enhanced_features + else if (cov_optimisable(operation, branch)) + { + return synthesize_cov_expression::process((*this), operation, branch); + } + #endif + else if (binext_optimisable(operation, branch)) + { + return synthesize_binary_ext_expression::process((*this), operation, branch); + } + else + return synthesize_expression(operation, branch); + } + + inline expression_node_ptr operator() (const details::operator_type& operation, expression_node_ptr (&branch)[3]) + { + if ( + (0 == branch[0]) || + (0 == branch[1]) || + (0 == branch[2]) + ) + { + details::free_all_nodes(*node_allocator_,branch); + + return error_node(); + } + else if (is_invalid_string_op(operation, branch)) + { + return error_node(); + } + else if (is_string_operation(operation, branch)) + { + return synthesize_string_expression(operation, branch); + } + else + return synthesize_expression(operation, branch); + } + + inline expression_node_ptr operator() (const details::operator_type& operation, expression_node_ptr (&branch)[4]) + { + return synthesize_expression(operation,branch); + } + + inline expression_node_ptr operator() (const details::operator_type& operation, expression_node_ptr b0) + { + expression_node_ptr branch[1] = { b0 }; + return (*this)(operation,branch); + } + + inline expression_node_ptr operator() (const details::operator_type& operation, expression_node_ptr& b0, expression_node_ptr& b1) + { + expression_node_ptr result = error_node(); + + if ((0 != b0) && (0 != b1)) + { + expression_node_ptr branch[2] = { b0, b1 }; + result = expression_generator::operator()(operation, branch); + b0 = branch[0]; + b1 = branch[1]; + } + + return result; + } + + inline expression_node_ptr conditional(expression_node_ptr condition, + expression_node_ptr consequent, + expression_node_ptr alternative) const + { + if ((0 == condition) || (0 == consequent)) + { + details::free_node(*node_allocator_, condition ); + details::free_node(*node_allocator_, consequent ); + details::free_node(*node_allocator_, alternative); + + return error_node(); + } + // Can the condition be immediately evaluated? if so optimise. + else if (details::is_constant_node(condition)) + { + // True branch + if (details::is_true(condition)) + { + details::free_node(*node_allocator_, condition ); + details::free_node(*node_allocator_, alternative); + + return consequent; + } + // False branch + else + { + details::free_node(*node_allocator_, condition ); + details::free_node(*node_allocator_, consequent); + + if (alternative) + return alternative; + else + return node_allocator_->allocate >(); + } + } + else if ((0 != consequent) && (0 != alternative)) + { + return node_allocator_-> + allocate(condition, consequent, alternative); + } + else + return node_allocator_-> + allocate(condition, consequent); + } + + #ifndef exprtk_disable_string_capabilities + inline expression_node_ptr conditional_string(expression_node_ptr condition, + expression_node_ptr consequent, + expression_node_ptr alternative) const + { + if ((0 == condition) || (0 == consequent)) + { + details::free_node(*node_allocator_, condition ); + details::free_node(*node_allocator_, consequent ); + details::free_node(*node_allocator_, alternative); + + return error_node(); + } + // Can the condition be immediately evaluated? if so optimise. + else if (details::is_constant_node(condition)) + { + // True branch + if (details::is_true(condition)) + { + details::free_node(*node_allocator_, condition ); + details::free_node(*node_allocator_, alternative); + + return consequent; + } + // False branch + else + { + details::free_node(*node_allocator_, condition ); + details::free_node(*node_allocator_, consequent); + + if (alternative) + return alternative; + else + return node_allocator_-> + allocate_c >(""); + } + } + else if ((0 != consequent) && (0 != alternative)) + return node_allocator_-> + allocate(condition, consequent, alternative); + else + return error_node(); + } + #else + inline expression_node_ptr conditional_string(expression_node_ptr, + expression_node_ptr, + expression_node_ptr) const + { + return error_node(); + } + #endif + + inline expression_node_ptr conditional_vector(expression_node_ptr condition, + expression_node_ptr consequent, + expression_node_ptr alternative) const + { + if ((0 == condition) || (0 == consequent)) + { + details::free_node(*node_allocator_, condition ); + details::free_node(*node_allocator_, consequent ); + details::free_node(*node_allocator_, alternative); + + return error_node(); + } + // Can the condition be immediately evaluated? if so optimise. + else if (details::is_constant_node(condition)) + { + // True branch + if (details::is_true(condition)) + { + details::free_node(*node_allocator_, condition ); + details::free_node(*node_allocator_, alternative); + + return consequent; + } + // False branch + else + { + details::free_node(*node_allocator_, condition ); + details::free_node(*node_allocator_, consequent); + + if (alternative) + return alternative; + else + return node_allocator_->allocate >(); + + } + } + else if ((0 != consequent) && (0 != alternative)) + { + return node_allocator_-> + allocate(condition, consequent, alternative); + } + else + return error_node(); + } + + inline loop_runtime_check_ptr get_loop_runtime_check(const loop_runtime_check::loop_types loop_type) const + { + if ( + parser_->loop_runtime_check_ && + (loop_type == (parser_->loop_runtime_check_->loop_set & loop_type)) + ) + { + return parser_->loop_runtime_check_; + } + + return loop_runtime_check_ptr(0); + } + + inline expression_node_ptr while_loop(expression_node_ptr& condition, + expression_node_ptr& branch, + const bool break_continue_present = false) const + { + if (!break_continue_present && details::is_constant_node(condition)) + { + expression_node_ptr result = error_node(); + if (details::is_true(condition)) + // Infinite loops are not allowed. + result = error_node(); + else + result = node_allocator_->allocate >(); + + details::free_node(*node_allocator_, condition); + details::free_node(*node_allocator_, branch ); + + return result; + } + else if (details::is_null_node(condition)) + { + details::free_node(*node_allocator_,condition); + + return branch; + } + + loop_runtime_check_ptr rtc = get_loop_runtime_check(loop_runtime_check::e_while_loop); + + if (!break_continue_present) + { + if (rtc) + return node_allocator_->allocate + (condition, branch, rtc); + else + return node_allocator_->allocate + (condition, branch); + } + #ifndef exprtk_disable_break_continue + else + { + if (rtc) + return node_allocator_->allocate + (condition, branch, rtc); + else + return node_allocator_->allocate + (condition, branch); + } + #else + return error_node(); + #endif + } + + inline expression_node_ptr repeat_until_loop(expression_node_ptr& condition, + expression_node_ptr& branch, + const bool break_continue_present = false) const + { + if (!break_continue_present && details::is_constant_node(condition)) + { + if ( + details::is_true(condition) && + details::is_constant_node(branch) + ) + { + free_node(*node_allocator_,condition); + + return branch; + } + + details::free_node(*node_allocator_, condition); + details::free_node(*node_allocator_, branch ); + + return error_node(); + } + else if (details::is_null_node(condition)) + { + details::free_node(*node_allocator_,condition); + + return branch; + } + + loop_runtime_check_ptr rtc = get_loop_runtime_check(loop_runtime_check::e_repeat_until_loop); + + if (!break_continue_present) + { + if (rtc) + return node_allocator_->allocate + (condition, branch, rtc); + else + return node_allocator_->allocate + (condition, branch); + } + #ifndef exprtk_disable_break_continue + else + { + if (rtc) + return node_allocator_->allocate + (condition, branch, rtc); + else + return node_allocator_->allocate + (condition, branch); + } + #else + return error_node(); + #endif + } + + inline expression_node_ptr for_loop(expression_node_ptr& initialiser, + expression_node_ptr& condition, + expression_node_ptr& incrementor, + expression_node_ptr& loop_body, + bool break_continue_present = false) const + { + if (!break_continue_present && details::is_constant_node(condition)) + { + expression_node_ptr result = error_node(); + + if (details::is_true(condition)) + // Infinite loops are not allowed. + result = error_node(); + else + result = node_allocator_->allocate >(); + + details::free_node(*node_allocator_, initialiser); + details::free_node(*node_allocator_, condition ); + details::free_node(*node_allocator_, incrementor); + details::free_node(*node_allocator_, loop_body ); + + return result; + } + else if (details::is_null_node(condition) || (0 == condition)) + { + details::free_node(*node_allocator_, initialiser); + details::free_node(*node_allocator_, condition ); + details::free_node(*node_allocator_, incrementor); + + return loop_body; + } + + loop_runtime_check_ptr rtc = get_loop_runtime_check(loop_runtime_check::e_for_loop); + + if (!break_continue_present) + { + if (rtc) + return node_allocator_->allocate + ( + initialiser, + condition, + incrementor, + loop_body, + rtc + ); + else + return node_allocator_->allocate + ( + initialiser, + condition, + incrementor, + loop_body + ); + } + #ifndef exprtk_disable_break_continue + else + { + if (rtc) + return node_allocator_->allocate + ( + initialiser, + condition, + incrementor, + loop_body, + rtc + ); + else + return node_allocator_->allocate + ( + initialiser, + condition, + incrementor, + loop_body + ); + } + #else + return error_node(); + #endif + } + + template class Sequence> + inline expression_node_ptr const_optimise_switch(Sequence& arg_list) + { + expression_node_ptr result = error_node(); + + for (std::size_t i = 0; i < (arg_list.size() / 2); ++i) + { + expression_node_ptr condition = arg_list[(2 * i) ]; + expression_node_ptr consequent = arg_list[(2 * i) + 1]; + + if ((0 == result) && details::is_true(condition)) + { + result = consequent; + break; + } + } + + if (0 == result) + { + result = arg_list.back(); + } + + for (std::size_t i = 0; i < arg_list.size(); ++i) + { + expression_node_ptr current_expr = arg_list[i]; + + if (current_expr && (current_expr != result)) + { + free_node(*node_allocator_,current_expr); + } + } + + return result; + } + + template class Sequence> + inline expression_node_ptr const_optimise_mswitch(Sequence& arg_list) + { + expression_node_ptr result = error_node(); + + for (std::size_t i = 0; i < (arg_list.size() / 2); ++i) + { + expression_node_ptr condition = arg_list[(2 * i) ]; + expression_node_ptr consequent = arg_list[(2 * i) + 1]; + + if (details::is_true(condition)) + { + result = consequent; + } + } + + if (0 == result) + { + T zero = T(0); + result = node_allocator_->allocate(zero); + } + + for (std::size_t i = 0; i < arg_list.size(); ++i) + { + expression_node_ptr& current_expr = arg_list[i]; + + if (current_expr && (current_expr != result)) + { + details::free_node(*node_allocator_,current_expr); + } + } + + return result; + } + + struct switch_nodes + { + typedef std::vector > arg_list_t; + + #define case_stmt(N) \ + if (is_true(arg[(2 * N)].first)) { return arg[(2 * N) + 1].first->value(); } \ + + struct switch_impl_1 + { + static inline T process(const arg_list_t& arg) + { + case_stmt(0) + + assert(arg.size() == ((2 * 1) + 1)); + + return arg.back().first->value(); + } + }; + + struct switch_impl_2 + { + static inline T process(const arg_list_t& arg) + { + case_stmt(0) case_stmt(1) + + assert(arg.size() == ((2 * 2) + 1)); + + return arg.back().first->value(); + } + }; + + struct switch_impl_3 + { + static inline T process(const arg_list_t& arg) + { + case_stmt(0) case_stmt(1) + case_stmt(2) + + assert(arg.size() == ((2 * 3) + 1)); + + return arg.back().first->value(); + } + }; + + struct switch_impl_4 + { + static inline T process(const arg_list_t& arg) + { + case_stmt(0) case_stmt(1) + case_stmt(2) case_stmt(3) + + assert(arg.size() == ((2 * 4) + 1)); + + return arg.back().first->value(); + } + }; + + struct switch_impl_5 + { + static inline T process(const arg_list_t& arg) + { + case_stmt(0) case_stmt(1) + case_stmt(2) case_stmt(3) + case_stmt(4) + + assert(arg.size() == ((2 * 5) + 1)); + + return arg.back().first->value(); + } + }; + + struct switch_impl_6 + { + static inline T process(const arg_list_t& arg) + { + case_stmt(0) case_stmt(1) + case_stmt(2) case_stmt(3) + case_stmt(4) case_stmt(5) + + assert(arg.size() == ((2 * 6) + 1)); + + return arg.back().first->value(); + } + }; + + struct switch_impl_7 + { + static inline T process(const arg_list_t& arg) + { + case_stmt(0) case_stmt(1) + case_stmt(2) case_stmt(3) + case_stmt(4) case_stmt(5) + case_stmt(6) + + assert(arg.size() == ((2 * 7) + 1)); + + return arg.back().first->value(); + } + }; + + #undef case_stmt + }; + + template class Sequence> + inline expression_node_ptr switch_statement(Sequence& arg_list, const bool default_statement_present) + { + if (arg_list.empty()) + return error_node(); + else if ( + !all_nodes_valid(arg_list) || + (!default_statement_present && (arg_list.size() < 2)) + ) + { + details::free_all_nodes(*node_allocator_,arg_list); + + return error_node(); + } + else if (is_constant_foldable(arg_list)) + return const_optimise_switch(arg_list); + + switch ((arg_list.size() - 1) / 2) + { + #define case_stmt(N) \ + case N : \ + return node_allocator_-> \ + allocate >(arg_list); \ + + case_stmt(1) + case_stmt(2) + case_stmt(3) + case_stmt(4) + case_stmt(5) + case_stmt(6) + case_stmt(7) + #undef case_stmt + + default : return node_allocator_->allocate >(arg_list); + } + } + + template class Sequence> + inline expression_node_ptr multi_switch_statement(Sequence& arg_list) + { + if (!all_nodes_valid(arg_list)) + { + details::free_all_nodes(*node_allocator_,arg_list); + + return error_node(); + } + else if (is_constant_foldable(arg_list)) + return const_optimise_mswitch(arg_list); + else + return node_allocator_->allocate >(arg_list); + } + + #define unary_opr_switch_statements \ + case_stmt(details::e_abs , details::abs_op ) \ + case_stmt(details::e_acos , details::acos_op ) \ + case_stmt(details::e_acosh , details::acosh_op) \ + case_stmt(details::e_asin , details::asin_op ) \ + case_stmt(details::e_asinh , details::asinh_op) \ + case_stmt(details::e_atan , details::atan_op ) \ + case_stmt(details::e_atanh , details::atanh_op) \ + case_stmt(details::e_ceil , details::ceil_op ) \ + case_stmt(details::e_cos , details::cos_op ) \ + case_stmt(details::e_cosh , details::cosh_op ) \ + case_stmt(details::e_exp , details::exp_op ) \ + case_stmt(details::e_expm1 , details::expm1_op) \ + case_stmt(details::e_floor , details::floor_op) \ + case_stmt(details::e_log , details::log_op ) \ + case_stmt(details::e_log10 , details::log10_op) \ + case_stmt(details::e_log2 , details::log2_op ) \ + case_stmt(details::e_log1p , details::log1p_op) \ + case_stmt(details::e_neg , details::neg_op ) \ + case_stmt(details::e_pos , details::pos_op ) \ + case_stmt(details::e_round , details::round_op) \ + case_stmt(details::e_sin , details::sin_op ) \ + case_stmt(details::e_sinc , details::sinc_op ) \ + case_stmt(details::e_sinh , details::sinh_op ) \ + case_stmt(details::e_sqrt , details::sqrt_op ) \ + case_stmt(details::e_tan , details::tan_op ) \ + case_stmt(details::e_tanh , details::tanh_op ) \ + case_stmt(details::e_cot , details::cot_op ) \ + case_stmt(details::e_sec , details::sec_op ) \ + case_stmt(details::e_csc , details::csc_op ) \ + case_stmt(details::e_r2d , details::r2d_op ) \ + case_stmt(details::e_d2r , details::d2r_op ) \ + case_stmt(details::e_d2g , details::d2g_op ) \ + case_stmt(details::e_g2d , details::g2d_op ) \ + case_stmt(details::e_notl , details::notl_op ) \ + case_stmt(details::e_sgn , details::sgn_op ) \ + case_stmt(details::e_erf , details::erf_op ) \ + case_stmt(details::e_erfc , details::erfc_op ) \ + case_stmt(details::e_ncdf , details::ncdf_op ) \ + case_stmt(details::e_frac , details::frac_op ) \ + case_stmt(details::e_trunc , details::trunc_op) \ + + inline expression_node_ptr synthesize_uv_expression(const details::operator_type& operation, + expression_node_ptr (&branch)[1]) + { + T& v = static_cast*>(branch[0])->ref(); + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + allocate > >(v); \ + + unary_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + + inline expression_node_ptr synthesize_uvec_expression(const details::operator_type& operation, + expression_node_ptr (&branch)[1]) + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + allocate > > \ + (operation, branch[0]); \ + + unary_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + + inline expression_node_ptr synthesize_unary_expression(const details::operator_type& operation, + expression_node_ptr (&branch)[1]) + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + allocate > >(branch[0]); \ + + unary_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + + inline expression_node_ptr const_optimise_sf3(const details::operator_type& operation, + expression_node_ptr (&branch)[3]) + { + expression_node_ptr temp_node = error_node(); + + switch (operation) + { + #define case_stmt(op) \ + case details::e_sf##op : temp_node = node_allocator_-> \ + allocate > > \ + (operation, branch); \ + break; \ + + case_stmt(00) case_stmt(01) case_stmt(02) case_stmt(03) + case_stmt(04) case_stmt(05) case_stmt(06) case_stmt(07) + case_stmt(08) case_stmt(09) case_stmt(10) case_stmt(11) + case_stmt(12) case_stmt(13) case_stmt(14) case_stmt(15) + case_stmt(16) case_stmt(17) case_stmt(18) case_stmt(19) + case_stmt(20) case_stmt(21) case_stmt(22) case_stmt(23) + case_stmt(24) case_stmt(25) case_stmt(26) case_stmt(27) + case_stmt(28) case_stmt(29) case_stmt(30) case_stmt(31) + case_stmt(32) case_stmt(33) case_stmt(34) case_stmt(35) + case_stmt(36) case_stmt(37) case_stmt(38) case_stmt(39) + case_stmt(40) case_stmt(41) case_stmt(42) case_stmt(43) + case_stmt(44) case_stmt(45) case_stmt(46) case_stmt(47) + #undef case_stmt + default : return error_node(); + } + + const T v = temp_node->value(); + + details::free_node(*node_allocator_,temp_node); + + return node_allocator_->allocate(v); + } + + inline expression_node_ptr varnode_optimise_sf3(const details::operator_type& operation, expression_node_ptr (&branch)[3]) + { + typedef details::variable_node* variable_ptr; + + const Type& v0 = static_cast(branch[0])->ref(); + const Type& v1 = static_cast(branch[1])->ref(); + const Type& v2 = static_cast(branch[2])->ref(); + + switch (operation) + { + #define case_stmt(op) \ + case details::e_sf##op : return node_allocator_-> \ + allocate_rrr > > \ + (v0, v1, v2); \ + + case_stmt(00) case_stmt(01) case_stmt(02) case_stmt(03) + case_stmt(04) case_stmt(05) case_stmt(06) case_stmt(07) + case_stmt(08) case_stmt(09) case_stmt(10) case_stmt(11) + case_stmt(12) case_stmt(13) case_stmt(14) case_stmt(15) + case_stmt(16) case_stmt(17) case_stmt(18) case_stmt(19) + case_stmt(20) case_stmt(21) case_stmt(22) case_stmt(23) + case_stmt(24) case_stmt(25) case_stmt(26) case_stmt(27) + case_stmt(28) case_stmt(29) case_stmt(30) case_stmt(31) + case_stmt(32) case_stmt(33) case_stmt(34) case_stmt(35) + case_stmt(36) case_stmt(37) case_stmt(38) case_stmt(39) + case_stmt(40) case_stmt(41) case_stmt(42) case_stmt(43) + case_stmt(44) case_stmt(45) case_stmt(46) case_stmt(47) + #undef case_stmt + default : return error_node(); + } + } + + inline expression_node_ptr special_function(const details::operator_type& operation, expression_node_ptr (&branch)[3]) + { + if (!all_nodes_valid(branch)) + return error_node(); + else if (is_constant_foldable(branch)) + return const_optimise_sf3(operation,branch); + else if (all_nodes_variables(branch)) + return varnode_optimise_sf3(operation,branch); + else + { + switch (operation) + { + #define case_stmt(op) \ + case details::e_sf##op : return node_allocator_-> \ + allocate > > \ + (operation, branch); \ + + case_stmt(00) case_stmt(01) case_stmt(02) case_stmt(03) + case_stmt(04) case_stmt(05) case_stmt(06) case_stmt(07) + case_stmt(08) case_stmt(09) case_stmt(10) case_stmt(11) + case_stmt(12) case_stmt(13) case_stmt(14) case_stmt(15) + case_stmt(16) case_stmt(17) case_stmt(18) case_stmt(19) + case_stmt(20) case_stmt(21) case_stmt(22) case_stmt(23) + case_stmt(24) case_stmt(25) case_stmt(26) case_stmt(27) + case_stmt(28) case_stmt(29) case_stmt(30) case_stmt(31) + case_stmt(32) case_stmt(33) case_stmt(34) case_stmt(35) + case_stmt(36) case_stmt(37) case_stmt(38) case_stmt(39) + case_stmt(40) case_stmt(41) case_stmt(42) case_stmt(43) + case_stmt(44) case_stmt(45) case_stmt(46) case_stmt(47) + #undef case_stmt + default : return error_node(); + } + } + } + + inline expression_node_ptr const_optimise_sf4(const details::operator_type& operation, expression_node_ptr (&branch)[4]) + { + expression_node_ptr temp_node = error_node(); + + switch (operation) + { + #define case_stmt(op) \ + case details::e_sf##op : temp_node = node_allocator_-> \ + allocate > > \ + (operation, branch); \ + break; \ + + case_stmt(48) case_stmt(49) case_stmt(50) case_stmt(51) + case_stmt(52) case_stmt(53) case_stmt(54) case_stmt(55) + case_stmt(56) case_stmt(57) case_stmt(58) case_stmt(59) + case_stmt(60) case_stmt(61) case_stmt(62) case_stmt(63) + case_stmt(64) case_stmt(65) case_stmt(66) case_stmt(67) + case_stmt(68) case_stmt(69) case_stmt(70) case_stmt(71) + case_stmt(72) case_stmt(73) case_stmt(74) case_stmt(75) + case_stmt(76) case_stmt(77) case_stmt(78) case_stmt(79) + case_stmt(80) case_stmt(81) case_stmt(82) case_stmt(83) + case_stmt(84) case_stmt(85) case_stmt(86) case_stmt(87) + case_stmt(88) case_stmt(89) case_stmt(90) case_stmt(91) + case_stmt(92) case_stmt(93) case_stmt(94) case_stmt(95) + case_stmt(96) case_stmt(97) case_stmt(98) case_stmt(99) + #undef case_stmt + default : return error_node(); + } + + const T v = temp_node->value(); + + details::free_node(*node_allocator_,temp_node); + + return node_allocator_->allocate(v); + } + + inline expression_node_ptr varnode_optimise_sf4(const details::operator_type& operation, expression_node_ptr (&branch)[4]) + { + typedef details::variable_node* variable_ptr; + + const Type& v0 = static_cast(branch[0])->ref(); + const Type& v1 = static_cast(branch[1])->ref(); + const Type& v2 = static_cast(branch[2])->ref(); + const Type& v3 = static_cast(branch[3])->ref(); + + switch (operation) + { + #define case_stmt(op) \ + case details::e_sf##op : return node_allocator_-> \ + allocate_rrrr > > \ + (v0, v1, v2, v3); \ + + case_stmt(48) case_stmt(49) case_stmt(50) case_stmt(51) + case_stmt(52) case_stmt(53) case_stmt(54) case_stmt(55) + case_stmt(56) case_stmt(57) case_stmt(58) case_stmt(59) + case_stmt(60) case_stmt(61) case_stmt(62) case_stmt(63) + case_stmt(64) case_stmt(65) case_stmt(66) case_stmt(67) + case_stmt(68) case_stmt(69) case_stmt(70) case_stmt(71) + case_stmt(72) case_stmt(73) case_stmt(74) case_stmt(75) + case_stmt(76) case_stmt(77) case_stmt(78) case_stmt(79) + case_stmt(80) case_stmt(81) case_stmt(82) case_stmt(83) + case_stmt(84) case_stmt(85) case_stmt(86) case_stmt(87) + case_stmt(88) case_stmt(89) case_stmt(90) case_stmt(91) + case_stmt(92) case_stmt(93) case_stmt(94) case_stmt(95) + case_stmt(96) case_stmt(97) case_stmt(98) case_stmt(99) + #undef case_stmt + default : return error_node(); + } + } + + inline expression_node_ptr special_function(const details::operator_type& operation, expression_node_ptr (&branch)[4]) + { + if (!all_nodes_valid(branch)) + return error_node(); + else if (is_constant_foldable(branch)) + return const_optimise_sf4(operation,branch); + else if (all_nodes_variables(branch)) + return varnode_optimise_sf4(operation,branch); + switch (operation) + { + #define case_stmt(op) \ + case details::e_sf##op : return node_allocator_-> \ + allocate > > \ + (operation, branch); \ + + case_stmt(48) case_stmt(49) case_stmt(50) case_stmt(51) + case_stmt(52) case_stmt(53) case_stmt(54) case_stmt(55) + case_stmt(56) case_stmt(57) case_stmt(58) case_stmt(59) + case_stmt(60) case_stmt(61) case_stmt(62) case_stmt(63) + case_stmt(64) case_stmt(65) case_stmt(66) case_stmt(67) + case_stmt(68) case_stmt(69) case_stmt(70) case_stmt(71) + case_stmt(72) case_stmt(73) case_stmt(74) case_stmt(75) + case_stmt(76) case_stmt(77) case_stmt(78) case_stmt(79) + case_stmt(80) case_stmt(81) case_stmt(82) case_stmt(83) + case_stmt(84) case_stmt(85) case_stmt(86) case_stmt(87) + case_stmt(88) case_stmt(89) case_stmt(90) case_stmt(91) + case_stmt(92) case_stmt(93) case_stmt(94) case_stmt(95) + case_stmt(96) case_stmt(97) case_stmt(98) case_stmt(99) + #undef case_stmt + default : return error_node(); + } + } + + template class Sequence> + inline expression_node_ptr const_optimise_varargfunc(const details::operator_type& operation, Sequence& arg_list) + { + expression_node_ptr temp_node = error_node(); + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : temp_node = node_allocator_-> \ + allocate > > \ + (arg_list); \ + break; \ + + case_stmt(details::e_sum , details::vararg_add_op ) + case_stmt(details::e_prod , details::vararg_mul_op ) + case_stmt(details::e_avg , details::vararg_avg_op ) + case_stmt(details::e_min , details::vararg_min_op ) + case_stmt(details::e_max , details::vararg_max_op ) + case_stmt(details::e_mand , details::vararg_mand_op ) + case_stmt(details::e_mor , details::vararg_mor_op ) + case_stmt(details::e_multi , details::vararg_multi_op) + #undef case_stmt + default : return error_node(); + } + + const T v = temp_node->value(); + + details::free_node(*node_allocator_,temp_node); + + return node_allocator_->allocate(v); + } + + inline bool special_one_parameter_vararg(const details::operator_type& operation) const + { + return ( + (details::e_sum == operation) || + (details::e_prod == operation) || + (details::e_avg == operation) || + (details::e_min == operation) || + (details::e_max == operation) + ); + } + + template class Sequence> + inline expression_node_ptr varnode_optimise_varargfunc(const details::operator_type& operation, Sequence& arg_list) + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + allocate > >(arg_list); \ + + case_stmt(details::e_sum , details::vararg_add_op ) + case_stmt(details::e_prod , details::vararg_mul_op ) + case_stmt(details::e_avg , details::vararg_avg_op ) + case_stmt(details::e_min , details::vararg_min_op ) + case_stmt(details::e_max , details::vararg_max_op ) + case_stmt(details::e_mand , details::vararg_mand_op ) + case_stmt(details::e_mor , details::vararg_mor_op ) + case_stmt(details::e_multi , details::vararg_multi_op) + #undef case_stmt + default : return error_node(); + } + } + + template class Sequence> + inline expression_node_ptr vectorize_func(const details::operator_type& operation, Sequence& arg_list) + { + if (1 == arg_list.size()) + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + allocate > >(arg_list[0]); \ + + case_stmt(details::e_sum , details::vec_add_op) + case_stmt(details::e_prod , details::vec_mul_op) + case_stmt(details::e_avg , details::vec_avg_op) + case_stmt(details::e_min , details::vec_min_op) + case_stmt(details::e_max , details::vec_max_op) + #undef case_stmt + default : return error_node(); + } + } + else + return error_node(); + } + + template class Sequence> + inline expression_node_ptr vararg_function(const details::operator_type& operation, Sequence& arg_list) + { + if (!all_nodes_valid(arg_list)) + { + details::free_all_nodes(*node_allocator_,arg_list); + + return error_node(); + } + else if (is_constant_foldable(arg_list)) + return const_optimise_varargfunc(operation,arg_list); + else if ((arg_list.size() == 1) && details::is_ivector_node(arg_list[0])) + return vectorize_func(operation,arg_list); + else if ((arg_list.size() == 1) && special_one_parameter_vararg(operation)) + return arg_list[0]; + else if (all_nodes_variables(arg_list)) + return varnode_optimise_varargfunc(operation,arg_list); + + #ifndef exprtk_disable_string_capabilities + if (details::e_smulti == operation) + { + return node_allocator_-> + allocate > >(arg_list); + } + else + #endif + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + allocate > >(arg_list); \ + + case_stmt(details::e_sum , details::vararg_add_op ) + case_stmt(details::e_prod , details::vararg_mul_op ) + case_stmt(details::e_avg , details::vararg_avg_op ) + case_stmt(details::e_min , details::vararg_min_op ) + case_stmt(details::e_max , details::vararg_max_op ) + case_stmt(details::e_mand , details::vararg_mand_op ) + case_stmt(details::e_mor , details::vararg_mor_op ) + case_stmt(details::e_multi , details::vararg_multi_op) + #undef case_stmt + default : return error_node(); + } + } + } + + template + inline expression_node_ptr function(ifunction_t* f, expression_node_ptr (&b)[N]) + { + typedef typename details::function_N_node function_N_node_t; + expression_node_ptr result = synthesize_expression(f,b); + + if (0 == result) + return error_node(); + else + { + // Can the function call be completely optimised? + if (details::is_constant_node(result)) + return result; + else if (!all_nodes_valid(b)) + { + details::free_node(*node_allocator_,result); + std::fill_n(b, N, reinterpret_cast(0)); + + return error_node(); + } + else if (N != f->param_count) + { + details::free_node(*node_allocator_,result); + std::fill_n(b, N, reinterpret_cast(0)); + + return error_node(); + } + + function_N_node_t* func_node_ptr = reinterpret_cast(result); + + if (!func_node_ptr->init_branches(b)) + { + details::free_node(*node_allocator_,result); + std::fill_n(b, N, reinterpret_cast(0)); + + return error_node(); + } + + return result; + } + } + + inline expression_node_ptr function(ifunction_t* f) + { + typedef typename details::function_N_node function_N_node_t; + return node_allocator_->allocate(f); + } + + inline expression_node_ptr vararg_function_call(ivararg_function_t* vaf, + std::vector& arg_list) + { + if (!all_nodes_valid(arg_list)) + { + details::free_all_nodes(*node_allocator_,arg_list); + + return error_node(); + } + + typedef details::vararg_function_node alloc_type; + + expression_node_ptr result = node_allocator_->allocate(vaf,arg_list); + + if ( + !arg_list.empty() && + !vaf->has_side_effects() && + is_constant_foldable(arg_list) + ) + { + const Type v = result->value(); + details::free_node(*node_allocator_,result); + result = node_allocator_->allocate(v); + } + + parser_->state_.activate_side_effect("vararg_function_call()"); + + return result; + } + + inline expression_node_ptr generic_function_call(igeneric_function_t* gf, + std::vector& arg_list, + const std::size_t& param_seq_index = std::numeric_limits::max()) + { + if (!all_nodes_valid(arg_list)) + { + details::free_all_nodes(*node_allocator_,arg_list); + return error_node(); + } + + typedef details::generic_function_node alloc_type1; + typedef details::multimode_genfunction_node alloc_type2; + + const std::size_t no_psi = std::numeric_limits::max(); + + expression_node_ptr result = error_node(); + + if (no_psi == param_seq_index) + result = node_allocator_->allocate(arg_list,gf); + else + result = node_allocator_->allocate(gf, param_seq_index, arg_list); + + alloc_type1* genfunc_node_ptr = static_cast(result); + + if ( + !arg_list.empty() && + !gf->has_side_effects() && + parser_->state_.type_check_enabled && + is_constant_foldable(arg_list) + ) + { + genfunc_node_ptr->init_branches(); + + const Type v = result->value(); + + details::free_node(*node_allocator_,result); + + return node_allocator_->allocate(v); + } + else if (genfunc_node_ptr->init_branches()) + { + parser_->state_.activate_side_effect("generic_function_call()"); + + return result; + } + else + { + details::free_node(*node_allocator_, result); + details::free_all_nodes(*node_allocator_, arg_list); + + return error_node(); + } + } + + #ifndef exprtk_disable_string_capabilities + inline expression_node_ptr string_function_call(igeneric_function_t* gf, + std::vector& arg_list, + const std::size_t& param_seq_index = std::numeric_limits::max()) + { + if (!all_nodes_valid(arg_list)) + { + details::free_all_nodes(*node_allocator_,arg_list); + return error_node(); + } + + typedef details::string_function_node alloc_type1; + typedef details::multimode_strfunction_node alloc_type2; + + const std::size_t no_psi = std::numeric_limits::max(); + + expression_node_ptr result = error_node(); + + if (no_psi == param_seq_index) + result = node_allocator_->allocate(gf,arg_list); + else + result = node_allocator_->allocate(gf, param_seq_index, arg_list); + + alloc_type1* strfunc_node_ptr = static_cast(result); + + if ( + !arg_list.empty() && + !gf->has_side_effects() && + is_constant_foldable(arg_list) + ) + { + strfunc_node_ptr->init_branches(); + + const Type v = result->value(); + + details::free_node(*node_allocator_,result); + + return node_allocator_->allocate(v); + } + else if (strfunc_node_ptr->init_branches()) + { + parser_->state_.activate_side_effect("string_function_call()"); + + return result; + } + else + { + details::free_node (*node_allocator_,result ); + details::free_all_nodes(*node_allocator_,arg_list); + + return error_node(); + } + } + #endif + + #ifndef exprtk_disable_return_statement + inline expression_node_ptr return_call(std::vector& arg_list) + { + if (!all_nodes_valid(arg_list)) + { + details::free_all_nodes(*node_allocator_,arg_list); + return error_node(); + } + + typedef details::return_node alloc_type; + + expression_node_ptr result = node_allocator_-> + allocate_rr(arg_list,parser_->results_ctx()); + + alloc_type* return_node_ptr = static_cast(result); + + if (return_node_ptr->init_branches()) + { + parser_->state_.activate_side_effect("return_call()"); + + return result; + } + else + { + details::free_node (*node_allocator_, result ); + details::free_all_nodes(*node_allocator_, arg_list); + + return error_node(); + } + } + + inline expression_node_ptr return_envelope(expression_node_ptr body, + results_context_t* rc, + bool*& return_invoked) + { + typedef details::return_envelope_node alloc_type; + + expression_node_ptr result = node_allocator_-> + allocate_cr(body,(*rc)); + + return_invoked = static_cast(result)->retinvk_ptr(); + + return result; + } + #else + inline expression_node_ptr return_call(std::vector&) + { + return error_node(); + } + + inline expression_node_ptr return_envelope(expression_node_ptr, + results_context_t*, + bool*&) + { + return error_node(); + } + #endif + + inline expression_node_ptr vector_element(const std::string& symbol, + vector_holder_ptr vector_base, + expression_node_ptr index) + { + expression_node_ptr result = error_node(); + + if (details::is_constant_node(index)) + { + std::size_t i = static_cast(details::numeric::to_int64(index->value())); + + details::free_node(*node_allocator_,index); + + if (vector_base->rebaseable()) + { + return node_allocator_->allocate(i,vector_base); + } + + const scope_element& se = parser_->sem_.get_element(symbol,i); + + if (se.index == i) + { + result = se.var_node; + } + else + { + scope_element nse; + nse.name = symbol; + nse.active = true; + nse.ref_count = 1; + nse.type = scope_element::e_vecelem; + nse.index = i; + nse.depth = parser_->state_.scope_depth; + nse.data = 0; + nse.var_node = node_allocator_->allocate((*(*vector_base)[i])); + + if (!parser_->sem_.add_element(nse)) + { + parser_->set_synthesis_error("Failed to add new local vector element to SEM [1]"); + + parser_->sem_.free_element(nse); + + result = error_node(); + } + + exprtk_debug(("vector_element() - INFO - Added new local vector element: %s\n",nse.name.c_str())); + + parser_->state_.activate_side_effect("vector_element()"); + + result = nse.var_node; + } + } + else if (vector_base->rebaseable()) + result = node_allocator_->allocate(index,vector_base); + else + result = node_allocator_->allocate(index,vector_base); + + return result; + } + + private: + + template + inline bool is_constant_foldable(NodePtr (&b)[N]) const + { + for (std::size_t i = 0; i < N; ++i) + { + if (0 == b[i]) + return false; + else if (!details::is_constant_node(b[i])) + return false; + } + + return true; + } + + template class Sequence> + inline bool is_constant_foldable(const Sequence& b) const + { + for (std::size_t i = 0; i < b.size(); ++i) + { + if (0 == b[i]) + return false; + else if (!details::is_constant_node(b[i])) + return false; + } + + return true; + } + + void lodge_assignment(symbol_type cst, expression_node_ptr node) + { + parser_->state_.activate_side_effect("lodge_assignment()"); + + if (!parser_->dec_.collect_assignments()) + return; + + std::string symbol_name; + + switch (cst) + { + case e_st_variable : symbol_name = parser_->symtab_store_ + .get_variable_name(node); + break; + + #ifndef exprtk_disable_string_capabilities + case e_st_string : symbol_name = parser_->symtab_store_ + .get_stringvar_name(node); + break; + #endif + + case e_st_vector : { + typedef details::vector_holder vector_holder_t; + + vector_holder_t& vh = static_cast(node)->vec_holder(); + + symbol_name = parser_->symtab_store_.get_vector_name(&vh); + } + break; + + case e_st_vecelem : { + typedef details::vector_holder vector_holder_t; + + vector_holder_t& vh = static_cast(node)->vec_holder(); + + symbol_name = parser_->symtab_store_.get_vector_name(&vh); + + cst = e_st_vector; + } + break; + + default : return; + } + + if (!symbol_name.empty()) + { + parser_->dec_.add_assignment(symbol_name,cst); + } + } + + const void* base_ptr(expression_node_ptr node) + { + if (node) + { + switch(node->type()) + { + case details::expression_node::e_variable: + return reinterpret_cast(&static_cast(node)->ref()); + + case details::expression_node::e_vecelem: + return reinterpret_cast(&static_cast(node)->ref()); + + case details::expression_node::e_rbvecelem: + return reinterpret_cast(&static_cast(node)->ref()); + + case details::expression_node::e_rbveccelem: + return reinterpret_cast(&static_cast(node)->ref()); + + case details::expression_node::e_vector: + return reinterpret_cast(static_cast(node)->vec_holder().data()); + + #ifndef exprtk_disable_string_capabilities + case details::expression_node::e_stringvar: + return reinterpret_cast((static_cast(node)->base())); + + case details::expression_node::e_stringvarrng: + return reinterpret_cast((static_cast(node)->base())); + #endif + default : return reinterpret_cast(0); + } + } + + return reinterpret_cast(0); + } + + bool assign_immutable_symbol(expression_node_ptr node) + { + interval_t interval; + const void* baseptr_addr = base_ptr(node); + + exprtk_debug(("assign_immutable_symbol - base ptr addr: %p\n", baseptr_addr)); + + if (parser_->immutable_memory_map_.in_interval(baseptr_addr,interval)) + { + typename immutable_symtok_map_t::iterator itr = parser_->immutable_symtok_map_.find(interval); + + if (parser_->immutable_symtok_map_.end() != itr) + { + token_t& token = itr->second; + parser_->set_error( + parser_error::make_error(parser_error::e_parser, + token, + "ERR211 - Symbol '" + token.value + "' cannot be assigned-to as it is immutable.", + exprtk_error_location)); + } + else + parser_->set_synthesis_error("Unable to assign symbol is immutable."); + + return true; + } + + return false; + } + + inline expression_node_ptr synthesize_assignment_expression(const details::operator_type& operation, expression_node_ptr (&branch)[2]) + { + if (assign_immutable_symbol(branch[0])) + { + return error_node(); + } + else if (details::is_variable_node(branch[0])) + { + lodge_assignment(e_st_variable,branch[0]); + return synthesize_expression(operation,branch); + } + else if (details::is_vector_elem_node(branch[0])) + { + lodge_assignment(e_st_vecelem,branch[0]); + return synthesize_expression(operation, branch); + } + else if (details::is_rebasevector_elem_node(branch[0])) + { + lodge_assignment(e_st_vecelem,branch[0]); + return synthesize_expression(operation, branch); + } + else if (details::is_rebasevector_celem_node(branch[0])) + { + lodge_assignment(e_st_vecelem,branch[0]); + return synthesize_expression(operation, branch); + } + #ifndef exprtk_disable_string_capabilities + else if (details::is_string_node(branch[0])) + { + lodge_assignment(e_st_string,branch[0]); + return synthesize_expression(operation, branch); + } + else if (details::is_string_range_node(branch[0])) + { + lodge_assignment(e_st_string,branch[0]); + return synthesize_expression(operation, branch); + } + #endif + else if (details::is_vector_node(branch[0])) + { + lodge_assignment(e_st_vector,branch[0]); + + if (details::is_ivector_node(branch[1])) + return synthesize_expression(operation, branch); + else + return synthesize_expression(operation, branch); + } + else + { + parser_->set_synthesis_error("Invalid assignment operation.[1]"); + + return error_node(); + } + } + + inline expression_node_ptr synthesize_assignment_operation_expression(const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + if (assign_immutable_symbol(branch[0])) + { + return error_node(); + } + + if (details::is_variable_node(branch[0])) + { + lodge_assignment(e_st_variable,branch[0]); + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + template allocate_rrr > > \ + (operation, branch[0], branch[1]); \ + + case_stmt(details::e_addass , details::add_op) + case_stmt(details::e_subass , details::sub_op) + case_stmt(details::e_mulass , details::mul_op) + case_stmt(details::e_divass , details::div_op) + case_stmt(details::e_modass , details::mod_op) + #undef case_stmt + default : return error_node(); + } + } + else if (details::is_vector_elem_node(branch[0])) + { + lodge_assignment(e_st_vecelem,branch[0]); + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + template allocate_rrr > > \ + (operation, branch[0], branch[1]); \ + + case_stmt(details::e_addass , details::add_op) + case_stmt(details::e_subass , details::sub_op) + case_stmt(details::e_mulass , details::mul_op) + case_stmt(details::e_divass , details::div_op) + case_stmt(details::e_modass , details::mod_op) + #undef case_stmt + default : return error_node(); + } + } + else if (details::is_rebasevector_elem_node(branch[0])) + { + lodge_assignment(e_st_vecelem,branch[0]); + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + template allocate_rrr > > \ + (operation, branch[0], branch[1]); \ + + case_stmt(details::e_addass , details::add_op) + case_stmt(details::e_subass , details::sub_op) + case_stmt(details::e_mulass , details::mul_op) + case_stmt(details::e_divass , details::div_op) + case_stmt(details::e_modass , details::mod_op) + #undef case_stmt + default : return error_node(); + } + } + else if (details::is_rebasevector_celem_node(branch[0])) + { + lodge_assignment(e_st_vecelem,branch[0]); + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + template allocate_rrr > > \ + (operation, branch[0], branch[1]); \ + + case_stmt(details::e_addass , details::add_op) + case_stmt(details::e_subass , details::sub_op) + case_stmt(details::e_mulass , details::mul_op) + case_stmt(details::e_divass , details::div_op) + case_stmt(details::e_modass , details::mod_op) + #undef case_stmt + default : return error_node(); + } + } + else if (details::is_vector_node(branch[0])) + { + lodge_assignment(e_st_vector,branch[0]); + + if (details::is_ivector_node(branch[1])) + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + template allocate_rrr > > \ + (operation, branch[0], branch[1]); \ + + case_stmt(details::e_addass , details::add_op) + case_stmt(details::e_subass , details::sub_op) + case_stmt(details::e_mulass , details::mul_op) + case_stmt(details::e_divass , details::div_op) + case_stmt(details::e_modass , details::mod_op) + #undef case_stmt + default : return error_node(); + } + } + else + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + template allocate_rrr > > \ + (operation, branch[0], branch[1]); \ + + case_stmt(details::e_addass , details::add_op) + case_stmt(details::e_subass , details::sub_op) + case_stmt(details::e_mulass , details::mul_op) + case_stmt(details::e_divass , details::div_op) + case_stmt(details::e_modass , details::mod_op) + #undef case_stmt + default : return error_node(); + } + } + } + #ifndef exprtk_disable_string_capabilities + else if ( + (details::e_addass == operation) && + details::is_string_node(branch[0]) + ) + { + typedef details::assignment_string_node addass_t; + + lodge_assignment(e_st_string,branch[0]); + + return synthesize_expression(operation,branch); + } + #endif + else + { + parser_->set_synthesis_error("Invalid assignment operation[2]"); + + return error_node(); + } + } + + inline expression_node_ptr synthesize_veceqineqlogic_operation_expression(const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + const bool is_b0_ivec = details::is_ivector_node(branch[0]); + const bool is_b1_ivec = details::is_ivector_node(branch[1]); + + #define batch_eqineq_logic_case \ + case_stmt(details::e_lt , details::lt_op ) \ + case_stmt(details::e_lte , details::lte_op ) \ + case_stmt(details::e_gt , details::gt_op ) \ + case_stmt(details::e_gte , details::gte_op ) \ + case_stmt(details::e_eq , details::eq_op ) \ + case_stmt(details::e_ne , details::ne_op ) \ + case_stmt(details::e_equal , details::equal_op) \ + case_stmt(details::e_and , details::and_op ) \ + case_stmt(details::e_nand , details::nand_op ) \ + case_stmt(details::e_or , details::or_op ) \ + case_stmt(details::e_nor , details::nor_op ) \ + case_stmt(details::e_xor , details::xor_op ) \ + case_stmt(details::e_xnor , details::xnor_op ) \ + + if (is_b0_ivec && is_b1_ivec) + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + template allocate_rrr > > \ + (operation, branch[0], branch[1]); \ + + batch_eqineq_logic_case + #undef case_stmt + default : return error_node(); + } + } + else if (is_b0_ivec && !is_b1_ivec) + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + template allocate_rrr > > \ + (operation, branch[0], branch[1]); \ + + batch_eqineq_logic_case + #undef case_stmt + default : return error_node(); + } + } + else if (!is_b0_ivec && is_b1_ivec) + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + template allocate_rrr > > \ + (operation, branch[0], branch[1]); \ + + batch_eqineq_logic_case + #undef case_stmt + default : return error_node(); + } + } + else + return error_node(); + + #undef batch_eqineq_logic_case + } + + inline expression_node_ptr synthesize_vecarithmetic_operation_expression(const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + const bool is_b0_ivec = details::is_ivector_node(branch[0]); + const bool is_b1_ivec = details::is_ivector_node(branch[1]); + + #define vector_ops \ + case_stmt(details::e_add , details::add_op) \ + case_stmt(details::e_sub , details::sub_op) \ + case_stmt(details::e_mul , details::mul_op) \ + case_stmt(details::e_div , details::div_op) \ + case_stmt(details::e_mod , details::mod_op) \ + + if (is_b0_ivec && is_b1_ivec) + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + template allocate_rrr > > \ + (operation, branch[0], branch[1]); \ + + vector_ops + case_stmt(details::e_pow,details:: pow_op) + #undef case_stmt + default : return error_node(); + } + } + else if (is_b0_ivec && !is_b1_ivec) + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + template allocate_rrr > > \ + (operation, branch[0], branch[1]); \ + + vector_ops + case_stmt(details::e_pow,details:: pow_op) + #undef case_stmt + default : return error_node(); + } + } + else if (!is_b0_ivec && is_b1_ivec) + { + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + template allocate_rrr > > \ + (operation, branch[0], branch[1]); \ + + vector_ops + #undef case_stmt + default : return error_node(); + } + } + else + return error_node(); + + #undef vector_ops + } + + inline expression_node_ptr synthesize_swap_expression(expression_node_ptr (&branch)[2]) + { + const bool v0_is_ivar = details::is_ivariable_node(branch[0]); + const bool v1_is_ivar = details::is_ivariable_node(branch[1]); + + const bool v0_is_ivec = details::is_ivector_node (branch[0]); + const bool v1_is_ivec = details::is_ivector_node (branch[1]); + + #ifndef exprtk_disable_string_capabilities + const bool v0_is_str = details::is_generally_string_node(branch[0]); + const bool v1_is_str = details::is_generally_string_node(branch[1]); + #endif + + expression_node_ptr result = error_node(); + + if (v0_is_ivar && v1_is_ivar) + { + typedef details::variable_node* variable_node_ptr; + + variable_node_ptr v0 = variable_node_ptr(0); + variable_node_ptr v1 = variable_node_ptr(0); + + if ( + (0 != (v0 = dynamic_cast(branch[0]))) && + (0 != (v1 = dynamic_cast(branch[1]))) + ) + { + result = node_allocator_->allocate >(v0,v1); + } + else + result = node_allocator_->allocate >(branch[0],branch[1]); + } + else if (v0_is_ivec && v1_is_ivec) + { + result = node_allocator_->allocate >(branch[0],branch[1]); + } + #ifndef exprtk_disable_string_capabilities + else if (v0_is_str && v1_is_str) + { + if (is_string_node(branch[0]) && is_string_node(branch[1])) + result = node_allocator_->allocate > + (branch[0], branch[1]); + else + result = node_allocator_->allocate > + (branch[0], branch[1]); + } + #endif + else + { + parser_->set_synthesis_error("Only variables, strings, vectors or vector elements can be swapped"); + + return error_node(); + } + + parser_->state_.activate_side_effect("synthesize_swap_expression()"); + + return result; + } + + #ifndef exprtk_disable_sc_andor + inline expression_node_ptr synthesize_shortcircuit_expression(const details::operator_type& operation, expression_node_ptr (&branch)[2]) + { + expression_node_ptr result = error_node(); + + if (details::is_constant_node(branch[0])) + { + if ( + (details::e_scand == operation) && + std::equal_to()(T(0),branch[0]->value()) + ) + result = node_allocator_->allocate_c(T(0)); + else if ( + (details::e_scor == operation) && + std::not_equal_to()(T(0),branch[0]->value()) + ) + result = node_allocator_->allocate_c(T(1)); + } + + if (details::is_constant_node(branch[1]) && (0 == result)) + { + if ( + (details::e_scand == operation) && + std::equal_to()(T(0),branch[1]->value()) + ) + result = node_allocator_->allocate_c(T(0)); + else if ( + (details::e_scor == operation) && + std::not_equal_to()(T(0),branch[1]->value()) + ) + result = node_allocator_->allocate_c(T(1)); + } + + if (result) + { + details::free_node(*node_allocator_, branch[0]); + details::free_node(*node_allocator_, branch[1]); + + return result; + } + else if (details::e_scand == operation) + { + return synthesize_expression(operation, branch); + } + else if (details::e_scor == operation) + { + return synthesize_expression(operation, branch); + } + else + return error_node(); + } + #else + inline expression_node_ptr synthesize_shortcircuit_expression(const details::operator_type&, expression_node_ptr (&)[2]) + { + return error_node(); + } + #endif + + #define basic_opr_switch_statements \ + case_stmt(details::e_add , details::add_op) \ + case_stmt(details::e_sub , details::sub_op) \ + case_stmt(details::e_mul , details::mul_op) \ + case_stmt(details::e_div , details::div_op) \ + case_stmt(details::e_mod , details::mod_op) \ + case_stmt(details::e_pow , details::pow_op) \ + + #define extended_opr_switch_statements \ + case_stmt(details::e_lt , details::lt_op ) \ + case_stmt(details::e_lte , details::lte_op ) \ + case_stmt(details::e_gt , details::gt_op ) \ + case_stmt(details::e_gte , details::gte_op ) \ + case_stmt(details::e_eq , details::eq_op ) \ + case_stmt(details::e_ne , details::ne_op ) \ + case_stmt(details::e_and , details::and_op ) \ + case_stmt(details::e_nand , details::nand_op) \ + case_stmt(details::e_or , details::or_op ) \ + case_stmt(details::e_nor , details::nor_op ) \ + case_stmt(details::e_xor , details::xor_op ) \ + case_stmt(details::e_xnor , details::xnor_op) \ + + #ifndef exprtk_disable_cardinal_pow_optimisation + template class IPowNode> + inline expression_node_ptr cardinal_pow_optimisation_impl(const TType& v, const unsigned int& p) + { + switch (p) + { + #define case_stmt(cp) \ + case cp : return node_allocator_-> \ + allocate > >(v); \ + + case_stmt( 1) case_stmt( 2) case_stmt( 3) case_stmt( 4) + case_stmt( 5) case_stmt( 6) case_stmt( 7) case_stmt( 8) + case_stmt( 9) case_stmt(10) case_stmt(11) case_stmt(12) + case_stmt(13) case_stmt(14) case_stmt(15) case_stmt(16) + case_stmt(17) case_stmt(18) case_stmt(19) case_stmt(20) + case_stmt(21) case_stmt(22) case_stmt(23) case_stmt(24) + case_stmt(25) case_stmt(26) case_stmt(27) case_stmt(28) + case_stmt(29) case_stmt(30) case_stmt(31) case_stmt(32) + case_stmt(33) case_stmt(34) case_stmt(35) case_stmt(36) + case_stmt(37) case_stmt(38) case_stmt(39) case_stmt(40) + case_stmt(41) case_stmt(42) case_stmt(43) case_stmt(44) + case_stmt(45) case_stmt(46) case_stmt(47) case_stmt(48) + case_stmt(49) case_stmt(50) case_stmt(51) case_stmt(52) + case_stmt(53) case_stmt(54) case_stmt(55) case_stmt(56) + case_stmt(57) case_stmt(58) case_stmt(59) case_stmt(60) + #undef case_stmt + default : return error_node(); + } + } + + inline expression_node_ptr cardinal_pow_optimisation(const T& v, const T& c) + { + const bool not_recipricol = (c >= T(0)); + const unsigned int p = static_cast(details::numeric::to_int32(details::numeric::abs(c))); + + if (0 == p) + return node_allocator_->allocate_c(T(1)); + else if (std::equal_to()(T(2),c)) + { + return node_allocator_-> + template allocate_rr > >(v,v); + } + else + { + if (not_recipricol) + return cardinal_pow_optimisation_impl(v,p); + else + return cardinal_pow_optimisation_impl(v,p); + } + } + + inline bool cardinal_pow_optimisable(const details::operator_type& operation, const T& c) const + { + return (details::e_pow == operation) && (details::numeric::abs(c) <= T(60)) && details::numeric::is_integer(c); + } + + inline expression_node_ptr cardinal_pow_optimisation(expression_node_ptr (&branch)[2]) + { + const Type c = static_cast*>(branch[1])->value(); + const bool not_recipricol = (c >= T(0)); + const unsigned int p = static_cast(details::numeric::to_int32(details::numeric::abs(c))); + + node_allocator_->free(branch[1]); + + if (0 == p) + { + details::free_all_nodes(*node_allocator_, branch); + + return node_allocator_->allocate_c(T(1)); + } + else if (not_recipricol) + return cardinal_pow_optimisation_impl(branch[0],p); + else + return cardinal_pow_optimisation_impl(branch[0],p); + } + #else + inline expression_node_ptr cardinal_pow_optimisation(T&, const T&) + { + return error_node(); + } + + inline bool cardinal_pow_optimisable(const details::operator_type&, const T&) + { + return false; + } + + inline expression_node_ptr cardinal_pow_optimisation(expression_node_ptr(&)[2]) + { + return error_node(); + } + #endif + + struct synthesize_binary_ext_expression + { + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + const bool left_neg = is_neg_unary_node(branch[0]); + const bool right_neg = is_neg_unary_node(branch[1]); + + if (left_neg && right_neg) + { + if ( + (details::e_add == operation) || + (details::e_sub == operation) || + (details::e_mul == operation) || + (details::e_div == operation) + ) + { + if ( + !expr_gen.parser_->simplify_unary_negation_branch(branch[0]) || + !expr_gen.parser_->simplify_unary_negation_branch(branch[1]) + ) + { + details::free_all_nodes(*expr_gen.node_allocator_,branch); + + return error_node(); + } + } + + switch (operation) + { + // -f(x + 1) + -g(y + 1) --> -(f(x + 1) + g(y + 1)) + case details::e_add : return expr_gen(details::e_neg, + expr_gen.node_allocator_-> + template allocate > > + (branch[0],branch[1])); + + // -f(x + 1) - -g(y + 1) --> g(y + 1) - f(x + 1) + case details::e_sub : return expr_gen.node_allocator_-> + template allocate > > + (branch[1],branch[0]); + + default : break; + } + } + else if (left_neg && !right_neg) + { + if ( + (details::e_add == operation) || + (details::e_sub == operation) || + (details::e_mul == operation) || + (details::e_div == operation) + ) + { + if (!expr_gen.parser_->simplify_unary_negation_branch(branch[0])) + { + details::free_all_nodes(*expr_gen.node_allocator_,branch); + + return error_node(); + } + + switch (operation) + { + // -f(x + 1) + g(y + 1) --> g(y + 1) - f(x + 1) + case details::e_add : return expr_gen.node_allocator_-> + template allocate > > + (branch[1], branch[0]); + + // -f(x + 1) - g(y + 1) --> -(f(x + 1) + g(y + 1)) + case details::e_sub : return expr_gen(details::e_neg, + expr_gen.node_allocator_-> + template allocate > > + (branch[0], branch[1])); + + // -f(x + 1) * g(y + 1) --> -(f(x + 1) * g(y + 1)) + case details::e_mul : return expr_gen(details::e_neg, + expr_gen.node_allocator_-> + template allocate > > + (branch[0], branch[1])); + + // -f(x + 1) / g(y + 1) --> -(f(x + 1) / g(y + 1)) + case details::e_div : return expr_gen(details::e_neg, + expr_gen.node_allocator_-> + template allocate > > + (branch[0], branch[1])); + + default : return error_node(); + } + } + } + else if (!left_neg && right_neg) + { + if ( + (details::e_add == operation) || + (details::e_sub == operation) || + (details::e_mul == operation) || + (details::e_div == operation) + ) + { + if (!expr_gen.parser_->simplify_unary_negation_branch(branch[1])) + { + details::free_all_nodes(*expr_gen.node_allocator_,branch); + + return error_node(); + } + + switch (operation) + { + // f(x + 1) + -g(y + 1) --> f(x + 1) - g(y + 1) + case details::e_add : return expr_gen.node_allocator_-> + template allocate > > + (branch[0], branch[1]); + + // f(x + 1) - - g(y + 1) --> f(x + 1) + g(y + 1) + case details::e_sub : return expr_gen.node_allocator_-> + template allocate > > + (branch[0], branch[1]); + + // f(x + 1) * -g(y + 1) --> -(f(x + 1) * g(y + 1)) + case details::e_mul : return expr_gen(details::e_neg, + expr_gen.node_allocator_-> + template allocate > > + (branch[0], branch[1])); + + // f(x + 1) / -g(y + 1) --> -(f(x + 1) / g(y + 1)) + case details::e_div : return expr_gen(details::e_neg, + expr_gen.node_allocator_-> + template allocate > > + (branch[0], branch[1])); + + default : return error_node(); + } + } + } + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return expr_gen.node_allocator_-> \ + template allocate > > \ + (branch[0], branch[1]); \ + + basic_opr_switch_statements + extended_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + }; + + struct synthesize_vob_expression + { + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + const Type& v = static_cast*>(branch[0])->ref(); + + #ifndef exprtk_disable_enhanced_features + if (details::is_sf3ext_node(branch[1])) + { + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile_right + (expr_gen, v, operation, branch[1], result); + + if (synthesis_result) + { + details::free_node(*expr_gen.node_allocator_,branch[1]); + return result; + } + } + #endif + + if ( + (details::e_mul == operation) || + (details::e_div == operation) + ) + { + if (details::is_uv_node(branch[1])) + { + typedef details::uv_base_node* uvbn_ptr_t; + + details::operator_type o = static_cast(branch[1])->operation(); + + if (details::e_neg == o) + { + const Type& v1 = static_cast(branch[1])->v(); + + details::free_node(*expr_gen.node_allocator_,branch[1]); + + switch (operation) + { + case details::e_mul : return expr_gen(details::e_neg, + expr_gen.node_allocator_-> + template allocate_rr > >(v,v1)); + + case details::e_div : return expr_gen(details::e_neg, + expr_gen.node_allocator_-> + template allocate_rr > >(v,v1)); + + default : break; + } + } + } + } + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return expr_gen.node_allocator_-> \ + template allocate_rc > > \ + (v, branch[1]); \ + + basic_opr_switch_statements + extended_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + }; + + struct synthesize_bov_expression + { + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + const Type& v = static_cast*>(branch[1])->ref(); + + #ifndef exprtk_disable_enhanced_features + if (details::is_sf3ext_node(branch[0])) + { + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile_left + (expr_gen, v, operation, branch[0], result); + + if (synthesis_result) + { + details::free_node(*expr_gen.node_allocator_, branch[0]); + + return result; + } + } + #endif + + if ( + (details::e_add == operation) || + (details::e_sub == operation) || + (details::e_mul == operation) || + (details::e_div == operation) + ) + { + if (details::is_uv_node(branch[0])) + { + typedef details::uv_base_node* uvbn_ptr_t; + + details::operator_type o = static_cast(branch[0])->operation(); + + if (details::e_neg == o) + { + const Type& v0 = static_cast(branch[0])->v(); + + details::free_node(*expr_gen.node_allocator_,branch[0]); + + switch (operation) + { + case details::e_add : return expr_gen.node_allocator_-> + template allocate_rr > >(v,v0); + + case details::e_sub : return expr_gen(details::e_neg, + expr_gen.node_allocator_-> + template allocate_rr > >(v0,v)); + + case details::e_mul : return expr_gen(details::e_neg, + expr_gen.node_allocator_-> + template allocate_rr > >(v0,v)); + + case details::e_div : return expr_gen(details::e_neg, + expr_gen.node_allocator_-> + template allocate_rr > >(v0,v)); + default : break; + } + } + } + } + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return expr_gen.node_allocator_-> \ + template allocate_cr > > \ + (branch[0], v); \ + + basic_opr_switch_statements + extended_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + }; + + struct synthesize_cob_expression + { + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + const Type c = static_cast*>(branch[0])->value(); + + details::free_node(*expr_gen.node_allocator_,branch[0]); + + if (std::equal_to()(T(0),c) && (details::e_mul == operation)) + { + details::free_node(*expr_gen.node_allocator_,branch[1]); + + return expr_gen(T(0)); + } + else if (std::equal_to()(T(0),c) && (details::e_div == operation)) + { + details::free_node(*expr_gen.node_allocator_, branch[1]); + + return expr_gen(T(0)); + } + else if (std::equal_to()(T(0),c) && (details::e_add == operation)) + return branch[1]; + else if (std::equal_to()(T(1),c) && (details::e_mul == operation)) + return branch[1]; + + if (details::is_cob_node(branch[1])) + { + // Simplify expressions of the form: + // 1. (1 * (2 * (3 * (4 * (5 * (6 * (7 * (8 * (9 + x))))))))) --> 40320 * (9 + x) + // 2. (1 + (2 + (3 + (4 + (5 + (6 + (7 + (8 + (9 + x))))))))) --> 45 + x + if ( + (details::e_mul == operation) || + (details::e_add == operation) + ) + { + details::cob_base_node* cobnode = static_cast*>(branch[1]); + + if (operation == cobnode->operation()) + { + switch (operation) + { + case details::e_add : cobnode->set_c(c + cobnode->c()); break; + case details::e_mul : cobnode->set_c(c * cobnode->c()); break; + default : return error_node(); + } + + return cobnode; + } + } + + if (operation == details::e_mul) + { + details::cob_base_node* cobnode = static_cast*>(branch[1]); + details::operator_type cob_opr = cobnode->operation(); + + if ( + (details::e_div == cob_opr) || + (details::e_mul == cob_opr) + ) + { + switch (cob_opr) + { + case details::e_div : cobnode->set_c(c * cobnode->c()); break; + case details::e_mul : cobnode->set_c(cobnode->c() / c); break; + default : return error_node(); + } + + return cobnode; + } + } + else if (operation == details::e_div) + { + details::cob_base_node* cobnode = static_cast*>(branch[1]); + details::operator_type cob_opr = cobnode->operation(); + + if ( + (details::e_div == cob_opr) || + (details::e_mul == cob_opr) + ) + { + details::expression_node* new_cobnode = error_node(); + + switch (cob_opr) + { + case details::e_div : new_cobnode = expr_gen.node_allocator_-> + template allocate_tt > > + (c / cobnode->c(), cobnode->move_branch(0)); + break; + + case details::e_mul : new_cobnode = expr_gen.node_allocator_-> + template allocate_tt > > + (c / cobnode->c(), cobnode->move_branch(0)); + break; + + default : return error_node(); + } + + details::free_node(*expr_gen.node_allocator_,branch[1]); + + return new_cobnode; + } + } + } + #ifndef exprtk_disable_enhanced_features + else if (details::is_sf3ext_node(branch[1])) + { + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile_right + (expr_gen, c, operation, branch[1], result); + + if (synthesis_result) + { + details::free_node(*expr_gen.node_allocator_,branch[1]); + + return result; + } + } + #endif + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return expr_gen.node_allocator_-> \ + template allocate_tt > > \ + (c, branch[1]); \ + + basic_opr_switch_statements + extended_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + }; + + struct synthesize_boc_expression + { + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + const Type c = static_cast*>(branch[1])->value(); + + details::free_node(*(expr_gen.node_allocator_), branch[1]); + + if (std::equal_to()(T(0),c) && (details::e_mul == operation)) + { + details::free_node(*expr_gen.node_allocator_, branch[0]); + + return expr_gen(T(0)); + } + else if (std::equal_to()(T(0),c) && (details::e_div == operation)) + { + details::free_node(*expr_gen.node_allocator_, branch[0]); + + return expr_gen(std::numeric_limits::quiet_NaN()); + } + else if (std::equal_to()(T(0),c) && (details::e_add == operation)) + return branch[0]; + else if (std::equal_to()(T(1),c) && (details::e_mul == operation)) + return branch[0]; + + if (details::is_boc_node(branch[0])) + { + // Simplify expressions of the form: + // 1. (((((((((x + 9) * 8) * 7) * 6) * 5) * 4) * 3) * 2) * 1) --> (x + 9) * 40320 + // 2. (((((((((x + 9) + 8) + 7) + 6) + 5) + 4) + 3) + 2) + 1) --> x + 45 + if ( + (details::e_mul == operation) || + (details::e_add == operation) + ) + { + details::boc_base_node* bocnode = static_cast*>(branch[0]); + + if (operation == bocnode->operation()) + { + switch (operation) + { + case details::e_add : bocnode->set_c(c + bocnode->c()); break; + case details::e_mul : bocnode->set_c(c * bocnode->c()); break; + default : return error_node(); + } + + return bocnode; + } + } + else if (operation == details::e_div) + { + details::boc_base_node* bocnode = static_cast*>(branch[0]); + details::operator_type boc_opr = bocnode->operation(); + + if ( + (details::e_div == boc_opr) || + (details::e_mul == boc_opr) + ) + { + switch (boc_opr) + { + case details::e_div : bocnode->set_c(c * bocnode->c()); break; + case details::e_mul : bocnode->set_c(bocnode->c() / c); break; + default : return error_node(); + } + + return bocnode; + } + } + else if (operation == details::e_pow) + { + // (v ^ c0) ^ c1 --> v ^(c0 * c1) + details::boc_base_node* bocnode = static_cast*>(branch[0]); + details::operator_type boc_opr = bocnode->operation(); + + if (details::e_pow == boc_opr) + { + bocnode->set_c(bocnode->c() * c); + + return bocnode; + } + } + } + + #ifndef exprtk_disable_enhanced_features + if (details::is_sf3ext_node(branch[0])) + { + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile_left + (expr_gen, c, operation, branch[0], result); + + if (synthesis_result) + { + free_node(*expr_gen.node_allocator_, branch[0]); + + return result; + } + } + #endif + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return expr_gen.node_allocator_-> \ + template allocate_cr > > \ + (branch[0], c); \ + + basic_opr_switch_statements + extended_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + }; + + struct synthesize_cocob_expression + { + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + expression_node_ptr result = error_node(); + + // (cob) o c --> cob + if (details::is_cob_node(branch[0])) + { + details::cob_base_node* cobnode = static_cast*>(branch[0]); + + const Type c = static_cast*>(branch[1])->value(); + + if (std::equal_to()(T(0),c) && (details::e_mul == operation)) + { + details::free_node(*expr_gen.node_allocator_, branch[0]); + details::free_node(*expr_gen.node_allocator_, branch[1]); + + return expr_gen(T(0)); + } + else if (std::equal_to()(T(0),c) && (details::e_div == operation)) + { + details::free_node(*expr_gen.node_allocator_, branch[0]); + details::free_node(*expr_gen.node_allocator_, branch[1]); + + return expr_gen(T(std::numeric_limits::quiet_NaN())); + } + else if (std::equal_to()(T(0),c) && (details::e_add == operation)) + { + details::free_node(*expr_gen.node_allocator_, branch[1]); + + return branch[0]; + } + else if (std::equal_to()(T(1),c) && (details::e_mul == operation)) + { + details::free_node(*expr_gen.node_allocator_, branch[1]); + + return branch[0]; + } + else if (std::equal_to()(T(1),c) && (details::e_div == operation)) + { + details::free_node(*expr_gen.node_allocator_, branch[1]); + + return branch[0]; + } + + const bool op_addsub = (details::e_add == cobnode->operation()) || + (details::e_sub == cobnode->operation()) ; + + if (op_addsub) + { + switch (operation) + { + case details::e_add : cobnode->set_c(cobnode->c() + c); break; + case details::e_sub : cobnode->set_c(cobnode->c() - c); break; + default : return error_node(); + } + + result = cobnode; + } + else if (details::e_mul == cobnode->operation()) + { + switch (operation) + { + case details::e_mul : cobnode->set_c(cobnode->c() * c); break; + case details::e_div : cobnode->set_c(cobnode->c() / c); break; + default : return error_node(); + } + + result = cobnode; + } + else if (details::e_div == cobnode->operation()) + { + if (details::e_mul == operation) + { + cobnode->set_c(cobnode->c() * c); + result = cobnode; + } + else if (details::e_div == operation) + { + result = expr_gen.node_allocator_-> + template allocate_tt > > + (cobnode->c() / c, cobnode->move_branch(0)); + + details::free_node(*expr_gen.node_allocator_, branch[0]); + } + } + + if (result) + { + details::free_node(*expr_gen.node_allocator_,branch[1]); + } + } + + // c o (cob) --> cob + else if (details::is_cob_node(branch[1])) + { + details::cob_base_node* cobnode = static_cast*>(branch[1]); + + const Type c = static_cast*>(branch[0])->value(); + + if (std::equal_to()(T(0),c) && (details::e_mul == operation)) + { + details::free_node(*expr_gen.node_allocator_, branch[0]); + details::free_node(*expr_gen.node_allocator_, branch[1]); + + return expr_gen(T(0)); + } + else if (std::equal_to()(T(0),c) && (details::e_div == operation)) + { + details::free_node(*expr_gen.node_allocator_, branch[0]); + details::free_node(*expr_gen.node_allocator_, branch[1]); + + return expr_gen(T(0)); + } + else if (std::equal_to()(T(0),c) && (details::e_add == operation)) + { + details::free_node(*expr_gen.node_allocator_, branch[0]); + + return branch[1]; + } + else if (std::equal_to()(T(1),c) && (details::e_mul == operation)) + { + details::free_node(*expr_gen.node_allocator_, branch[0]); + + return branch[1]; + } + + if (details::e_add == cobnode->operation()) + { + if (details::e_add == operation) + { + cobnode->set_c(c + cobnode->c()); + result = cobnode; + } + else if (details::e_sub == operation) + { + result = expr_gen.node_allocator_-> + template allocate_tt > > + (c - cobnode->c(), cobnode->move_branch(0)); + + details::free_node(*expr_gen.node_allocator_,branch[1]); + } + } + else if (details::e_sub == cobnode->operation()) + { + if (details::e_add == operation) + { + cobnode->set_c(c + cobnode->c()); + result = cobnode; + } + else if (details::e_sub == operation) + { + result = expr_gen.node_allocator_-> + template allocate_tt > > + (c - cobnode->c(), cobnode->move_branch(0)); + + details::free_node(*expr_gen.node_allocator_,branch[1]); + } + } + else if (details::e_mul == cobnode->operation()) + { + if (details::e_mul == operation) + { + cobnode->set_c(c * cobnode->c()); + result = cobnode; + } + else if (details::e_div == operation) + { + result = expr_gen.node_allocator_-> + template allocate_tt > > + (c / cobnode->c(), cobnode->move_branch(0)); + + details::free_node(*expr_gen.node_allocator_,branch[1]); + } + } + else if (details::e_div == cobnode->operation()) + { + if (details::e_mul == operation) + { + cobnode->set_c(c * cobnode->c()); + result = cobnode; + } + else if (details::e_div == operation) + { + result = expr_gen.node_allocator_-> + template allocate_tt > > + (c / cobnode->c(), cobnode->move_branch(0)); + + details::free_node(*expr_gen.node_allocator_,branch[1]); + } + } + + if (result) + { + details::free_node(*expr_gen.node_allocator_,branch[0]); + } + } + + return result; + } + }; + + struct synthesize_coboc_expression + { + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + expression_node_ptr result = error_node(); + + // (boc) o c --> boc + if (details::is_boc_node(branch[0])) + { + details::boc_base_node* bocnode = static_cast*>(branch[0]); + + const Type c = static_cast*>(branch[1])->value(); + + if (details::e_add == bocnode->operation()) + { + switch (operation) + { + case details::e_add : bocnode->set_c(bocnode->c() + c); break; + case details::e_sub : bocnode->set_c(bocnode->c() - c); break; + default : return error_node(); + } + + result = bocnode; + } + else if (details::e_mul == bocnode->operation()) + { + switch (operation) + { + case details::e_mul : bocnode->set_c(bocnode->c() * c); break; + case details::e_div : bocnode->set_c(bocnode->c() / c); break; + default : return error_node(); + } + + result = bocnode; + } + else if (details::e_sub == bocnode->operation()) + { + if (details::e_add == operation) + { + result = expr_gen.node_allocator_-> + template allocate_tt > > + (bocnode->move_branch(0), c - bocnode->c()); + + details::free_node(*expr_gen.node_allocator_,branch[0]); + } + else if (details::e_sub == operation) + { + bocnode->set_c(bocnode->c() + c); + result = bocnode; + } + } + else if (details::e_div == bocnode->operation()) + { + switch (operation) + { + case details::e_div : bocnode->set_c(bocnode->c() * c); break; + case details::e_mul : bocnode->set_c(bocnode->c() / c); break; + default : return error_node(); + } + + result = bocnode; + } + + if (result) + { + details::free_node(*expr_gen.node_allocator_, branch[1]); + } + } + + // c o (boc) --> boc + else if (details::is_boc_node(branch[1])) + { + details::boc_base_node* bocnode = static_cast*>(branch[1]); + + const Type c = static_cast*>(branch[0])->value(); + + if (details::e_add == bocnode->operation()) + { + if (details::e_add == operation) + { + bocnode->set_c(c + bocnode->c()); + result = bocnode; + } + else if (details::e_sub == operation) + { + result = expr_gen.node_allocator_-> + template allocate_tt > > + (c - bocnode->c(), bocnode->move_branch(0)); + + details::free_node(*expr_gen.node_allocator_,branch[1]); + } + } + else if (details::e_sub == bocnode->operation()) + { + if (details::e_add == operation) + { + result = expr_gen.node_allocator_-> + template allocate_tt > > + (bocnode->move_branch(0), c - bocnode->c()); + + details::free_node(*expr_gen.node_allocator_,branch[1]); + } + else if (details::e_sub == operation) + { + result = expr_gen.node_allocator_-> + template allocate_tt > > + (c + bocnode->c(), bocnode->move_branch(0)); + + details::free_node(*expr_gen.node_allocator_,branch[1]); + } + } + else if (details::e_mul == bocnode->operation()) + { + if (details::e_mul == operation) + { + bocnode->set_c(c * bocnode->c()); + result = bocnode; + } + else if (details::e_div == operation) + { + result = expr_gen.node_allocator_-> + template allocate_tt > > + (c / bocnode->c(), bocnode->move_branch(0)); + + details::free_node(*expr_gen.node_allocator_,branch[1]); + } + } + else if (details::e_div == bocnode->operation()) + { + if (details::e_mul == operation) + { + bocnode->set_c(bocnode->c() / c); + result = bocnode; + } + else if (details::e_div == operation) + { + result = expr_gen.node_allocator_-> + template allocate_tt > > + (c * bocnode->c(), bocnode->move_branch(0)); + + details::free_node(*expr_gen.node_allocator_,branch[1]); + } + } + + if (result) + { + details::free_node(*expr_gen.node_allocator_,branch[0]); + } + } + + return result; + } + }; + + #ifndef exprtk_disable_enhanced_features + inline bool synthesize_expression(const details::operator_type& operation, + expression_node_ptr (&branch)[2], + expression_node_ptr& result) + { + result = error_node(); + + if (!operation_optimisable(operation)) + return false; + + const std::string node_id = branch_to_id(branch); + + const typename synthesize_map_t::iterator itr = synthesize_map_.find(node_id); + + if (synthesize_map_.end() != itr) + { + result = itr->second((*this), operation, branch); + + return true; + } + else + return false; + } + + struct synthesize_vov_expression + { + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + const Type& v1 = static_cast*>(branch[0])->ref(); + const Type& v2 = static_cast*>(branch[1])->ref(); + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return expr_gen.node_allocator_-> \ + template allocate_rr > > \ + (v1, v2); \ + + basic_opr_switch_statements + extended_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + }; + + struct synthesize_cov_expression + { + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + const Type c = static_cast*> (branch[0])->value(); + const Type& v = static_cast*>(branch[1])->ref (); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + if (std::equal_to()(T(0),c) && (details::e_mul == operation)) + return expr_gen(T(0)); + else if (std::equal_to()(T(0),c) && (details::e_div == operation)) + return expr_gen(T(0)); + else if (std::equal_to()(T(0),c) && (details::e_add == operation)) + return static_cast*>(branch[1]); + else if (std::equal_to()(T(1),c) && (details::e_mul == operation)) + return static_cast*>(branch[1]); + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return expr_gen.node_allocator_-> \ + template allocate_cr > > \ + (c, v); \ + + basic_opr_switch_statements + extended_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + }; + + struct synthesize_voc_expression + { + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + const Type& v = static_cast*>(branch[0])->ref (); + const Type c = static_cast*> (branch[1])->value(); + + details::free_node(*(expr_gen.node_allocator_), branch[1]); + + if (expr_gen.cardinal_pow_optimisable(operation,c)) + { + if (std::equal_to()(T(1),c)) + return branch[0]; + else + return expr_gen.cardinal_pow_optimisation(v,c); + } + else if (std::equal_to()(T(0),c) && (details::e_mul == operation)) + return expr_gen(T(0)); + else if (std::equal_to()(T(0),c) && (details::e_div == operation)) + return expr_gen(std::numeric_limits::quiet_NaN()); + else if (std::equal_to()(T(0),c) && (details::e_add == operation)) + return static_cast*>(branch[0]); + else if (std::equal_to()(T(1),c) && (details::e_mul == operation)) + return static_cast*>(branch[0]); + else if (std::equal_to()(T(1),c) && (details::e_div == operation)) + return static_cast*>(branch[0]); + + switch (operation) + { + #define case_stmt(op0, op1) \ + case op0 : return expr_gen.node_allocator_-> \ + template allocate_rc > > \ + (v, c); \ + + basic_opr_switch_statements + extended_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + }; + + struct synthesize_sf3ext_expression + { + template + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& sf3opr, + T0 t0, T1 t1, T2 t2) + { + switch (sf3opr) + { + #define case_stmt(op) \ + case details::e_sf##op : return details::T0oT1oT2_sf3ext >:: \ + allocate(*(expr_gen.node_allocator_), t0, t1, t2); \ + + case_stmt(00) case_stmt(01) case_stmt(02) case_stmt(03) + case_stmt(04) case_stmt(05) case_stmt(06) case_stmt(07) + case_stmt(08) case_stmt(09) case_stmt(10) case_stmt(11) + case_stmt(12) case_stmt(13) case_stmt(14) case_stmt(15) + case_stmt(16) case_stmt(17) case_stmt(18) case_stmt(19) + case_stmt(20) case_stmt(21) case_stmt(22) case_stmt(23) + case_stmt(24) case_stmt(25) case_stmt(26) case_stmt(27) + case_stmt(28) case_stmt(29) case_stmt(30) + #undef case_stmt + default : return error_node(); + } + } + + template + static inline bool compile(expression_generator& expr_gen, const std::string& id, + T0 t0, T1 t1, T2 t2, + expression_node_ptr& result) + { + details::operator_type sf3opr; + + if (!expr_gen.sf3_optimisable(id,sf3opr)) + return false; + else + result = synthesize_sf3ext_expression::template process + (expr_gen, sf3opr, t0, t1, t2); + + return true; + } + }; + + struct synthesize_sf4ext_expression + { + template + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& sf4opr, + T0 t0, T1 t1, T2 t2, T3 t3) + { + switch (sf4opr) + { + #define case_stmt0(op) \ + case details::e_sf##op : return details::T0oT1oT2oT3_sf4ext >:: \ + allocate(*(expr_gen.node_allocator_), t0, t1, t2, t3); \ + + #define case_stmt1(op) \ + case details::e_sf4ext##op : return details::T0oT1oT2oT3_sf4ext >:: \ + allocate(*(expr_gen.node_allocator_), t0, t1, t2, t3); \ + + case_stmt0(48) case_stmt0(49) case_stmt0(50) case_stmt0(51) + case_stmt0(52) case_stmt0(53) case_stmt0(54) case_stmt0(55) + case_stmt0(56) case_stmt0(57) case_stmt0(58) case_stmt0(59) + case_stmt0(60) case_stmt0(61) case_stmt0(62) case_stmt0(63) + case_stmt0(64) case_stmt0(65) case_stmt0(66) case_stmt0(67) + case_stmt0(68) case_stmt0(69) case_stmt0(70) case_stmt0(71) + case_stmt0(72) case_stmt0(73) case_stmt0(74) case_stmt0(75) + case_stmt0(76) case_stmt0(77) case_stmt0(78) case_stmt0(79) + case_stmt0(80) case_stmt0(81) case_stmt0(82) case_stmt0(83) + + case_stmt1(00) case_stmt1(01) case_stmt1(02) case_stmt1(03) + case_stmt1(04) case_stmt1(05) case_stmt1(06) case_stmt1(07) + case_stmt1(08) case_stmt1(09) case_stmt1(10) case_stmt1(11) + case_stmt1(12) case_stmt1(13) case_stmt1(14) case_stmt1(15) + case_stmt1(16) case_stmt1(17) case_stmt1(18) case_stmt1(19) + case_stmt1(20) case_stmt1(21) case_stmt1(22) case_stmt1(23) + case_stmt1(24) case_stmt1(25) case_stmt1(26) case_stmt1(27) + case_stmt1(28) case_stmt1(29) case_stmt1(30) case_stmt1(31) + case_stmt1(32) case_stmt1(33) case_stmt1(34) case_stmt1(35) + case_stmt1(36) case_stmt1(37) case_stmt1(38) case_stmt1(39) + case_stmt1(40) case_stmt1(41) case_stmt1(42) case_stmt1(43) + case_stmt1(44) case_stmt1(45) case_stmt1(46) case_stmt1(47) + case_stmt1(48) case_stmt1(49) case_stmt1(50) case_stmt1(51) + case_stmt1(52) case_stmt1(53) case_stmt1(54) case_stmt1(55) + case_stmt1(56) case_stmt1(57) case_stmt1(58) case_stmt1(59) + case_stmt1(60) case_stmt1(61) + + #undef case_stmt0 + #undef case_stmt1 + default : return error_node(); + } + } + + template + static inline bool compile(expression_generator& expr_gen, const std::string& id, + T0 t0, T1 t1, T2 t2, T3 t3, + expression_node_ptr& result) + { + details::operator_type sf4opr; + + if (!expr_gen.sf4_optimisable(id,sf4opr)) + return false; + else + result = synthesize_sf4ext_expression::template process + (expr_gen, sf4opr, t0, t1, t2, t3); + + return true; + } + + // T o (sf3ext) + template + static inline bool compile_right(expression_generator& expr_gen, + ExternalType t, + const details::operator_type& operation, + expression_node_ptr& sf3node, + expression_node_ptr& result) + { + if (!details::is_sf3ext_node(sf3node)) + return false; + + typedef details::T0oT1oT2_base_node* sf3ext_base_ptr; + + sf3ext_base_ptr n = static_cast(sf3node); + const std::string id = "t" + expr_gen.to_str(operation) + "(" + n->type_id() + ")"; + + switch (n->type()) + { + case details::expression_node::e_covoc : return compile_right_impl + + (expr_gen, id, t, sf3node, result); + + case details::expression_node::e_covov : return compile_right_impl + + (expr_gen, id, t, sf3node, result); + + case details::expression_node::e_vocov : return compile_right_impl + + (expr_gen, id, t, sf3node, result); + + case details::expression_node::e_vovoc : return compile_right_impl + + (expr_gen, id, t, sf3node, result); + + case details::expression_node::e_vovov : return compile_right_impl + + (expr_gen, id, t, sf3node, result); + + default : return false; + } + } + + // (sf3ext) o T + template + static inline bool compile_left(expression_generator& expr_gen, + ExternalType t, + const details::operator_type& operation, + expression_node_ptr& sf3node, + expression_node_ptr& result) + { + if (!details::is_sf3ext_node(sf3node)) + return false; + + typedef details::T0oT1oT2_base_node* sf3ext_base_ptr; + + sf3ext_base_ptr n = static_cast(sf3node); + + const std::string id = "(" + n->type_id() + ")" + expr_gen.to_str(operation) + "t"; + + switch (n->type()) + { + case details::expression_node::e_covoc : return compile_left_impl + + (expr_gen, id, t, sf3node, result); + + case details::expression_node::e_covov : return compile_left_impl + + (expr_gen, id, t, sf3node, result); + + case details::expression_node::e_vocov : return compile_left_impl + + (expr_gen, id, t, sf3node, result); + + case details::expression_node::e_vovoc : return compile_left_impl + + (expr_gen, id, t, sf3node, result); + + case details::expression_node::e_vovov : return compile_left_impl + + (expr_gen, id, t, sf3node, result); + + default : return false; + } + } + + template + static inline bool compile_right_impl(expression_generator& expr_gen, + const std::string& id, + ExternalType t, + expression_node_ptr& node, + expression_node_ptr& result) + { + SF3TypeNode* n = dynamic_cast(node); + + if (n) + { + T0 t0 = n->t0(); + T1 t1 = n->t1(); + T2 t2 = n->t2(); + + return synthesize_sf4ext_expression::template compile + (expr_gen, id, t, t0, t1, t2, result); + } + else + return false; + } + + template + static inline bool compile_left_impl(expression_generator& expr_gen, + const std::string& id, + ExternalType t, + expression_node_ptr& node, + expression_node_ptr& result) + { + SF3TypeNode* n = dynamic_cast(node); + + if (n) + { + T0 t0 = n->t0(); + T1 t1 = n->t1(); + T2 t2 = n->t2(); + + return synthesize_sf4ext_expression::template compile + (expr_gen, id, t0, t1, t2, t, result); + } + else + return false; + } + }; + + struct synthesize_vovov_expression0 + { + typedef typename vovov_t::type0 node_type; + typedef typename vovov_t::sf3_type sf3_type; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0 o0 v1) o1 (v2) + const details::vov_base_node* vov = static_cast*>(branch[0]); + const Type& v0 = vov->v0(); + const Type& v1 = vov->v1(); + const Type& v2 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = vov->operation(); + const details::operator_type o1 = operation; + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (v0 / v1) / v2 --> (vovov) v0 / (v1 * v2) + if ((details::e_div == o0) && (details::e_div == o1)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t/(t*t)", v0, v1, v2, result); + + exprtk_debug(("(v0 / v1) / v2 --> (vovov) v0 / (v1 * v2)\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf3ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1), v0, v1, v2, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, v2, f0, f1); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t"; + } + }; + + struct synthesize_vovov_expression1 + { + typedef typename vovov_t::type1 node_type; + typedef typename vovov_t::sf3_type sf3_type; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0) o0 (v1 o1 v2) + const details::vov_base_node* vov = static_cast*>(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type& v1 = vov->v0(); + const Type& v2 = vov->v1(); + const details::operator_type o0 = operation; + const details::operator_type o1 = vov->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // v0 / (v1 / v2) --> (vovov) (v0 * v2) / v1 + if ((details::e_div == o0) && (details::e_div == o1)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", v0, v2, v1, result); + + exprtk_debug(("v0 / (v1 / v2) --> (vovov) (v0 * v2) / v1\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf3ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1), v0, v1, v2, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, v2, f0, f1); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)"; + } + }; + + struct synthesize_vovoc_expression0 + { + typedef typename vovoc_t::type0 node_type; + typedef typename vovoc_t::sf3_type sf3_type; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0 o0 v1) o1 (c) + const details::vov_base_node* vov = static_cast*>(branch[0]); + const Type& v0 = vov->v0(); + const Type& v1 = vov->v1(); + const Type c = static_cast*>(branch[1])->value(); + const details::operator_type o0 = vov->operation(); + const details::operator_type o1 = operation; + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (v0 / v1) / c --> (vovoc) v0 / (v1 * c) + if ((details::e_div == o0) && (details::e_div == o1)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t/(t*t)", v0, v1, c, result); + + exprtk_debug(("(v0 / v1) / c --> (vovoc) v0 / (v1 * c)\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf3ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1), v0, v1, c, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, c, f0, f1); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t"; + } + }; + + struct synthesize_vovoc_expression1 + { + typedef typename vovoc_t::type1 node_type; + typedef typename vovoc_t::sf3_type sf3_type; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0) o0 (v1 o1 c) + const details::voc_base_node* voc = static_cast*>(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type& v1 = voc->v(); + const Type c = voc->c(); + const details::operator_type o0 = operation; + const details::operator_type o1 = voc->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // v0 / (v1 / c) --> (vocov) (v0 * c) / v1 + if ((details::e_div == o0) && (details::e_div == o1)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", v0, c, v1, result); + + exprtk_debug(("v0 / (v1 / c) --> (vocov) (v0 * c) / v1\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf3ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1), v0, v1, c, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, c, f0, f1); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)"; + } + }; + + struct synthesize_vocov_expression0 + { + typedef typename vocov_t::type0 node_type; + typedef typename vocov_t::sf3_type sf3_type; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0 o0 c) o1 (v1) + const details::voc_base_node* voc = static_cast*>(branch[0]); + const Type& v0 = voc->v(); + const Type c = voc->c(); + const Type& v1 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = voc->operation(); + const details::operator_type o1 = operation; + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (v0 / c) / v1 --> (vovoc) v0 / (v1 * c) + if ((details::e_div == o0) && (details::e_div == o1)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t/(t*t)", v0, v1, c, result); + + exprtk_debug(("(v0 / c) / v1 --> (vovoc) v0 / (v1 * c)\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf3ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1), v0, c, v1, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v0, c, v1, f0, f1); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t"; + } + }; + + struct synthesize_vocov_expression1 + { + typedef typename vocov_t::type1 node_type; + typedef typename vocov_t::sf3_type sf3_type; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0) o0 (c o1 v1) + const details::cov_base_node* cov = static_cast*>(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type c = cov->c(); + const Type& v1 = cov->v(); + const details::operator_type o0 = operation; + const details::operator_type o1 = cov->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // v0 / (c / v1) --> (vovoc) (v0 * v1) / c + if ((details::e_div == o0) && (details::e_div == o1)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", v0, v1, c, result); + + exprtk_debug(("v0 / (c / v1) --> (vovoc) (v0 * v1) / c\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf3ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1), v0, c, v1, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v0, c, v1, f0, f1); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)"; + } + }; + + struct synthesize_covov_expression0 + { + typedef typename covov_t::type0 node_type; + typedef typename covov_t::sf3_type sf3_type; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (c o0 v0) o1 (v1) + const details::cov_base_node* cov = static_cast*>(branch[0]); + const Type c = cov->c(); + const Type& v0 = cov->v(); + const Type& v1 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = cov->operation(); + const details::operator_type o1 = operation; + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (c / v0) / v1 --> (covov) c / (v0 * v1) + if ((details::e_div == o0) && (details::e_div == o1)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t/(t*t)", c, v0, v1, result); + + exprtk_debug(("(c / v0) / v1 --> (covov) c / (v0 * v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf3ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1), c, v0, v1, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), c, v0, v1, f0, f1); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t"; + } + }; + + struct synthesize_covov_expression1 + { + typedef typename covov_t::type1 node_type; + typedef typename covov_t::sf3_type sf3_type; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (c) o0 (v0 o1 v1) + const details::vov_base_node* vov = static_cast*>(branch[1]); + const Type c = static_cast*>(branch[0])->value(); + const Type& v0 = vov->v0(); + const Type& v1 = vov->v1(); + const details::operator_type o0 = operation; + const details::operator_type o1 = vov->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // c / (v0 / v1) --> (covov) (c * v1) / v0 + if ((details::e_div == o0) && (details::e_div == o1)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", c, v1, v0, result); + + exprtk_debug(("c / (v0 / v1) --> (covov) (c * v1) / v0\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf3ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1), c, v0, v1, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), c, v0, v1, f0, f1); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)"; + } + }; + + struct synthesize_covoc_expression0 + { + typedef typename covoc_t::type0 node_type; + typedef typename covoc_t::sf3_type sf3_type; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (c0 o0 v) o1 (c1) + const details::cov_base_node* cov = static_cast*>(branch[0]); + const Type c0 = cov->c(); + const Type& v = cov->v(); + const Type c1 = static_cast*>(branch[1])->value(); + const details::operator_type o0 = cov->operation(); + const details::operator_type o1 = operation; + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (c0 + v) + c1 --> (cov) (c0 + c1) + v + if ((details::e_add == o0) && (details::e_add == o1)) + { + exprtk_debug(("(c0 + v) + c1 --> (cov) (c0 + c1) + v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 + c1, v); + } + // (c0 + v) - c1 --> (cov) (c0 - c1) + v + else if ((details::e_add == o0) && (details::e_sub == o1)) + { + exprtk_debug(("(c0 + v) - c1 --> (cov) (c0 - c1) + v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 - c1, v); + } + // (c0 - v) + c1 --> (cov) (c0 + c1) - v + else if ((details::e_sub == o0) && (details::e_add == o1)) + { + exprtk_debug(("(c0 - v) + c1 --> (cov) (c0 + c1) - v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 + c1, v); + } + // (c0 - v) - c1 --> (cov) (c0 - c1) - v + else if ((details::e_sub == o0) && (details::e_sub == o1)) + { + exprtk_debug(("(c0 - v) - c1 --> (cov) (c0 - c1) - v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 - c1, v); + } + // (c0 * v) * c1 --> (cov) (c0 * c1) * v + else if ((details::e_mul == o0) && (details::e_mul == o1)) + { + exprtk_debug(("(c0 * v) * c1 --> (cov) (c0 * c1) * v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 * c1, v); + } + // (c0 * v) / c1 --> (cov) (c0 / c1) * v + else if ((details::e_mul == o0) && (details::e_div == o1)) + { + exprtk_debug(("(c0 * v) / c1 --> (cov) (c0 / c1) * v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 / c1, v); + } + // (c0 / v) * c1 --> (cov) (c0 * c1) / v + else if ((details::e_div == o0) && (details::e_mul == o1)) + { + exprtk_debug(("(c0 / v) * c1 --> (cov) (c0 * c1) / v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 * c1, v); + } + // (c0 / v) / c1 --> (cov) (c0 / c1) / v + else if ((details::e_div == o0) && (details::e_div == o1)) + { + exprtk_debug(("(c0 / v) / c1 --> (cov) (c0 / c1) / v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 / c1, v); + } + } + + const bool synthesis_result = + synthesize_sf3ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1), c0, v, c1, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), c0, v, c1, f0, f1); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t"; + } + }; + + struct synthesize_covoc_expression1 + { + typedef typename covoc_t::type1 node_type; + typedef typename covoc_t::sf3_type sf3_type; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (c0) o0 (v o1 c1) + const details::voc_base_node* voc = static_cast*>(branch[1]); + const Type c0 = static_cast*>(branch[0])->value(); + const Type& v = voc->v(); + const Type c1 = voc->c(); + const details::operator_type o0 = operation; + const details::operator_type o1 = voc->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (c0) + (v + c1) --> (cov) (c0 + c1) + v + if ((details::e_add == o0) && (details::e_add == o1)) + { + exprtk_debug(("(c0) + (v + c1) --> (cov) (c0 + c1) + v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 + c1, v); + } + // (c0) + (v - c1) --> (cov) (c0 - c1) + v + else if ((details::e_add == o0) && (details::e_sub == o1)) + { + exprtk_debug(("(c0) + (v - c1) --> (cov) (c0 - c1) + v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 - c1, v); + } + // (c0) - (v + c1) --> (cov) (c0 - c1) - v + else if ((details::e_sub == o0) && (details::e_add == o1)) + { + exprtk_debug(("(c0) - (v + c1) --> (cov) (c0 - c1) - v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 - c1, v); + } + // (c0) - (v - c1) --> (cov) (c0 + c1) - v + else if ((details::e_sub == o0) && (details::e_sub == o1)) + { + exprtk_debug(("(c0) - (v - c1) --> (cov) (c0 + c1) - v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 + c1, v); + } + // (c0) * (v * c1) --> (voc) v * (c0 * c1) + else if ((details::e_mul == o0) && (details::e_mul == o1)) + { + exprtk_debug(("(c0) * (v * c1) --> (voc) v * (c0 * c1)\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 * c1, v); + } + // (c0) * (v / c1) --> (cov) (c0 / c1) * v + else if ((details::e_mul == o0) && (details::e_div == o1)) + { + exprtk_debug(("(c0) * (v / c1) --> (cov) (c0 / c1) * v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 / c1, v); + } + // (c0) / (v * c1) --> (cov) (c0 / c1) / v + else if ((details::e_div == o0) && (details::e_mul == o1)) + { + exprtk_debug(("(c0) / (v * c1) --> (cov) (c0 / c1) / v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 / c1, v); + } + // (c0) / (v / c1) --> (cov) (c0 * c1) / v + else if ((details::e_div == o0) && (details::e_div == o1)) + { + exprtk_debug(("(c0) / (v / c1) --> (cov) (c0 * c1) / v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 * c1, v); + } + } + + const bool synthesis_result = + synthesize_sf3ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1), c0, v, c1, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), c0, v, c1, f0, f1); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)"; + } + }; + + struct synthesize_cocov_expression0 + { + typedef typename cocov_t::type0 node_type; + static inline expression_node_ptr process(expression_generator&, + const details::operator_type&, + expression_node_ptr (&)[2]) + { + // (c0 o0 c1) o1 (v) - Not possible. + return error_node(); + } + }; + + struct synthesize_cocov_expression1 + { + typedef typename cocov_t::type1 node_type; + typedef typename cocov_t::sf3_type sf3_type; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (c0) o0 (c1 o1 v) + const details::cov_base_node* cov = static_cast*>(branch[1]); + const Type c0 = static_cast*>(branch[0])->value(); + const Type c1 = cov->c(); + const Type& v = cov->v(); + const details::operator_type o0 = operation; + const details::operator_type o1 = cov->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (c0) + (c1 + v) --> (cov) (c0 + c1) + v + if ((details::e_add == o0) && (details::e_add == o1)) + { + exprtk_debug(("(c0) + (c1 + v) --> (cov) (c0 + c1) + v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 + c1, v); + } + // (c0) + (c1 - v) --> (cov) (c0 + c1) - v + else if ((details::e_add == o0) && (details::e_sub == o1)) + { + exprtk_debug(("(c0) + (c1 - v) --> (cov) (c0 + c1) - v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 + c1, v); + } + // (c0) - (c1 + v) --> (cov) (c0 - c1) - v + else if ((details::e_sub == o0) && (details::e_add == o1)) + { + exprtk_debug(("(c0) - (c1 + v) --> (cov) (c0 - c1) - v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 - c1, v); + } + // (c0) - (c1 - v) --> (cov) (c0 - c1) + v + else if ((details::e_sub == o0) && (details::e_sub == o1)) + { + exprtk_debug(("(c0) - (c1 - v) --> (cov) (c0 - c1) + v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 - c1, v); + } + // (c0) * (c1 * v) --> (cov) (c0 * c1) * v + else if ((details::e_mul == o0) && (details::e_mul == o1)) + { + exprtk_debug(("(c0) * (c1 * v) --> (cov) (c0 * c1) * v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 * c1, v); + } + // (c0) * (c1 / v) --> (cov) (c0 * c1) / v + else if ((details::e_mul == o0) && (details::e_div == o1)) + { + exprtk_debug(("(c0) * (c1 / v) --> (cov) (c0 * c1) / v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 * c1, v); + } + // (c0) / (c1 * v) --> (cov) (c0 / c1) / v + else if ((details::e_div == o0) && (details::e_mul == o1)) + { + exprtk_debug(("(c0) / (c1 * v) --> (cov) (c0 / c1) / v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 / c1, v); + } + // (c0) / (c1 / v) --> (cov) (c0 / c1) * v + else if ((details::e_div == o0) && (details::e_div == o1)) + { + exprtk_debug(("(c0) / (c1 / v) --> (cov) (c0 / c1) * v\n")); + + return expr_gen.node_allocator_-> + template allocate_cr > >(c0 / c1, v); + } + } + + const bool synthesis_result = + synthesize_sf3ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1), c0, c1, v, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), c0, c1, v, f0, f1); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)"; + } + }; + + struct synthesize_vococ_expression0 + { + typedef typename vococ_t::type0 node_type; + typedef typename vococ_t::sf3_type sf3_type; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v o0 c0) o1 (c1) + const details::voc_base_node* voc = static_cast*>(branch[0]); + const Type& v = voc->v(); + const Type& c0 = voc->c(); + const Type& c1 = static_cast*>(branch[1])->value(); + const details::operator_type o0 = voc->operation(); + const details::operator_type o1 = operation; + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (v + c0) + c1 --> (voc) v + (c0 + c1) + if ((details::e_add == o0) && (details::e_add == o1)) + { + exprtk_debug(("(v + c0) + c1 --> (voc) v + (c0 + c1)\n")); + + return expr_gen.node_allocator_-> + template allocate_rc > >(v, c0 + c1); + } + // (v + c0) - c1 --> (voc) v + (c0 - c1) + else if ((details::e_add == o0) && (details::e_sub == o1)) + { + exprtk_debug(("(v + c0) - c1 --> (voc) v + (c0 - c1)\n")); + + return expr_gen.node_allocator_-> + template allocate_rc > >(v, c0 - c1); + } + // (v - c0) + c1 --> (voc) v - (c0 + c1) + else if ((details::e_sub == o0) && (details::e_add == o1)) + { + exprtk_debug(("(v - c0) + c1 --> (voc) v - (c0 + c1)\n")); + + return expr_gen.node_allocator_-> + template allocate_rc > >(v, c1 - c0); + } + // (v - c0) - c1 --> (voc) v - (c0 + c1) + else if ((details::e_sub == o0) && (details::e_sub == o1)) + { + exprtk_debug(("(v - c0) - c1 --> (voc) v - (c0 + c1)\n")); + + return expr_gen.node_allocator_-> + template allocate_rc > >(v, c0 + c1); + } + // (v * c0) * c1 --> (voc) v * (c0 * c1) + else if ((details::e_mul == o0) && (details::e_mul == o1)) + { + exprtk_debug(("(v * c0) * c1 --> (voc) v * (c0 * c1)\n")); + + return expr_gen.node_allocator_-> + template allocate_rc > >(v, c0 * c1); + } + // (v * c0) / c1 --> (voc) v * (c0 / c1) + else if ((details::e_mul == o0) && (details::e_div == o1)) + { + exprtk_debug(("(v * c0) / c1 --> (voc) v * (c0 / c1)\n")); + + return expr_gen.node_allocator_-> + template allocate_rc > >(v, c0 / c1); + } + // (v / c0) * c1 --> (voc) v * (c1 / c0) + else if ((details::e_div == o0) && (details::e_mul == o1)) + { + exprtk_debug(("(v / c0) * c1 --> (voc) v * (c1 / c0)\n")); + + return expr_gen.node_allocator_-> + template allocate_rc > >(v, c1 / c0); + } + // (v / c0) / c1 --> (voc) v / (c0 * c1) + else if ((details::e_div == o0) && (details::e_div == o1)) + { + exprtk_debug(("(v / c0) / c1 --> (voc) v / (c0 * c1)\n")); + + return expr_gen.node_allocator_-> + template allocate_rc > >(v, c0 * c1); + } + // (v ^ c0) ^ c1 --> (voc) v ^ (c0 * c1) + else if ((details::e_pow == o0) && (details::e_pow == o1)) + { + exprtk_debug(("(v ^ c0) ^ c1 --> (voc) v ^ (c0 * c1)\n")); + + return expr_gen.node_allocator_-> + template allocate_rc > >(v, c0 * c1); + } + } + + const bool synthesis_result = + synthesize_sf3ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1), v, c0, c1, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v, c0, c1, f0, f1); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t"; + } + }; + + struct synthesize_vococ_expression1 + { + typedef typename vococ_t::type0 node_type; + + static inline expression_node_ptr process(expression_generator&, + const details::operator_type&, + expression_node_ptr (&)[2]) + { + // (v) o0 (c0 o1 c1) - Not possible. + exprtk_debug(("(v) o0 (c0 o1 c1) - Not possible.\n")); + return error_node(); + } + }; + + struct synthesize_vovovov_expression0 + { + typedef typename vovovov_t::type0 node_type; + typedef typename vovovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0 o0 v1) o1 (v2 o2 v3) + const details::vov_base_node* vov0 = static_cast*>(branch[0]); + const details::vov_base_node* vov1 = static_cast*>(branch[1]); + const Type& v0 = vov0->v0(); + const Type& v1 = vov0->v1(); + const Type& v2 = vov1->v0(); + const Type& v3 = vov1->v1(); + const details::operator_type o0 = vov0->operation(); + const details::operator_type o1 = operation; + const details::operator_type o2 = vov1->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (v0 / v1) * (v2 / v3) --> (vovovov) (v0 * v2) / (v1 * v3) + if ((details::e_div == o0) && (details::e_mul == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t*t)/(t*t)", v0, v2, v1, v3, result); + + exprtk_debug(("(v0 / v1) * (v2 / v3) --> (vovovov) (v0 * v2) / (v1 * v3)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / v1) / (v2 / v3) --> (vovovov) (v0 * v3) / (v1 * v2) + else if ((details::e_div == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t*t)/(t*t)", v0, v3, v1, v2, result); + + exprtk_debug(("(v0 / v1) / (v2 / v3) --> (vovovov) (v0 * v3) / (v1 * v2)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 + v1) / (v2 / v3) --> (vovovov) (v0 + v1) * (v3 / v2) + else if ((details::e_add == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t+t)*(t/t)", v0, v1, v3, v2, result); + + exprtk_debug(("(v0 + v1) / (v2 / v3) --> (vovovov) (v0 + v1) * (v3 / v2)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 - v1) / (v2 / v3) --> (vovovov) (v0 + v1) * (v3 / v2) + else if ((details::e_sub == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t-t)*(t/t)", v0, v1, v3, v2, result); + + exprtk_debug(("(v0 - v1) / (v2 / v3) --> (vovovov) (v0 - v1) * (v3 / v2)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 * v1) / (v2 / v3) --> (vovovov) ((v0 * v1) * v3) / v2 + else if ((details::e_mul == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "((t*t)*t)/t", v0, v1, v3, v2, result); + + exprtk_debug(("(v0 * v1) / (v2 / v3) --> (vovovov) ((v0 * v1) * v3) / v2\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, v2, v3, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + binary_functor_t f2 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, v2, v3, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_vovovoc_expression0 + { + typedef typename vovovoc_t::type0 node_type; + typedef typename vovovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0 o0 v1) o1 (v2 o2 c) + const details::vov_base_node* vov = static_cast*>(branch[0]); + const details::voc_base_node* voc = static_cast*>(branch[1]); + const Type& v0 = vov->v0(); + const Type& v1 = vov->v1(); + const Type& v2 = voc->v (); + const Type c = voc->c (); + const details::operator_type o0 = vov->operation(); + const details::operator_type o1 = operation; + const details::operator_type o2 = voc->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (v0 / v1) * (v2 / c) --> (vovovoc) (v0 * v2) / (v1 * c) + if ((details::e_div == o0) && (details::e_mul == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t*t)/(t*t)", v0, v2, v1, c, result); + + exprtk_debug(("(v0 / v1) * (v2 / c) --> (vovovoc) (v0 * v2) / (v1 * c)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / v1) / (v2 / c) --> (vocovov) (v0 * c) / (v1 * v2) + if ((details::e_div == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t*t)/(t*t)", v0, c, v1, v2, result); + + exprtk_debug(("(v0 / v1) / (v2 / c) --> (vocovov) (v0 * c) / (v1 * v2)\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, v2, c, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + binary_functor_t f2 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, v2, c, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_vovocov_expression0 + { + typedef typename vovocov_t::type0 node_type; + typedef typename vovocov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0 o0 v1) o1 (c o2 v2) + const details::vov_base_node* vov = static_cast*>(branch[0]); + const details::cov_base_node* cov = static_cast*>(branch[1]); + const Type& v0 = vov->v0(); + const Type& v1 = vov->v1(); + const Type& v2 = cov->v (); + const Type c = cov->c (); + const details::operator_type o0 = vov->operation(); + const details::operator_type o1 = operation; + const details::operator_type o2 = cov->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (v0 / v1) * (c / v2) --> (vocovov) (v0 * c) / (v1 * v2) + if ((details::e_div == o0) && (details::e_mul == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t*t)/(t*t)", v0, c, v1, v2, result); + + exprtk_debug(("(v0 / v1) * (c / v2) --> (vocovov) (v0 * c) / (v1 * v2)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / v1) / (c / v2) --> (vovovoc) (v0 * v2) / (v1 * c) + if ((details::e_div == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t*t)/(t*t)", v0, v2, v1, c, result); + + exprtk_debug(("(v0 / v1) / (c / v2) --> (vovovoc) (v0 * v2) / (v1 * c)\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, c, v2, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + binary_functor_t f2 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, c, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_vocovov_expression0 + { + typedef typename vocovov_t::type0 node_type; + typedef typename vocovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0 o0 c) o1 (v1 o2 v2) + const details::voc_base_node* voc = static_cast*>(branch[0]); + const details::vov_base_node* vov = static_cast*>(branch[1]); + const Type c = voc->c (); + const Type& v0 = voc->v (); + const Type& v1 = vov->v0(); + const Type& v2 = vov->v1(); + const details::operator_type o0 = voc->operation(); + const details::operator_type o1 = operation; + const details::operator_type o2 = vov->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (v0 / c) * (v1 / v2) --> (vovocov) (v0 * v1) / (c * v2) + if ((details::e_div == o0) && (details::e_mul == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t*t)/(t*t)", v0, v1, c, v2, result); + + exprtk_debug(("(v0 / c) * (v1 / v2) --> (vovocov) (v0 * v1) / (c * v2)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / c) / (v1 / v2) --> (vovocov) (v0 * v2) / (c * v1) + if ((details::e_div == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t*t)/(t*t)", v0, v2, c, v1, result); + + exprtk_debug(("(v0 / c) / (v1 / v2) --> (vovocov) (v0 * v2) / (c * v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c, v1, v2, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + binary_functor_t f2 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v0, c, v1, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_covovov_expression0 + { + typedef typename covovov_t::type0 node_type; + typedef typename covovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (c o0 v0) o1 (v1 o2 v2) + const details::cov_base_node* cov = static_cast*>(branch[0]); + const details::vov_base_node* vov = static_cast*>(branch[1]); + const Type c = cov->c (); + const Type& v0 = cov->v (); + const Type& v1 = vov->v0(); + const Type& v2 = vov->v1(); + const details::operator_type o0 = cov->operation(); + const details::operator_type o1 = operation; + const details::operator_type o2 = vov->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (c / v0) * (v1 / v2) --> (covovov) (c * v1) / (v0 * v2) + if ((details::e_div == o0) && (details::e_mul == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t*t)/(t*t)", c, v1, v0, v2, result); + + exprtk_debug(("(c / v0) * (v1 / v2) --> (covovov) (c * v1) / (v0 * v2)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c / v0) / (v1 / v2) --> (covovov) (c * v2) / (v0 * v1) + if ((details::e_div == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t*t)/(t*t)", c, v2, v0, v1, result); + + exprtk_debug(("(c / v0) / (v1 / v2) --> (covovov) (c * v2) / (v0 * v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c, v0, v1, v2, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + binary_functor_t f2 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), c, v0, v1, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_covocov_expression0 + { + typedef typename covocov_t::type0 node_type; + typedef typename covocov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (c0 o0 v0) o1 (c1 o2 v1) + const details::cov_base_node* cov0 = static_cast*>(branch[0]); + const details::cov_base_node* cov1 = static_cast*>(branch[1]); + const Type c0 = cov0->c(); + const Type& v0 = cov0->v(); + const Type c1 = cov1->c(); + const Type& v1 = cov1->v(); + const details::operator_type o0 = cov0->operation(); + const details::operator_type o1 = operation; + const details::operator_type o2 = cov1->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (c0 + v0) + (c1 + v1) --> (covov) (c0 + c1) + v0 + v1 + if ((details::e_add == o0) && (details::e_add == o1) && (details::e_add == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t+t)+t", (c0 + c1), v0, v1, result); + + exprtk_debug(("(c0 + v0) + (c1 + v1) --> (covov) (c0 + c1) + v0 + v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 + v0) - (c1 + v1) --> (covov) (c0 - c1) + v0 - v1 + else if ((details::e_add == o0) && (details::e_sub == o1) && (details::e_add == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t+t)-t", (c0 - c1), v0, v1, result); + + exprtk_debug(("(c0 + v0) - (c1 + v1) --> (covov) (c0 - c1) + v0 - v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 - v0) - (c1 - v1) --> (covov) (c0 - c1) - v0 + v1 + else if ((details::e_sub == o0) && (details::e_sub == o1) && (details::e_sub == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t-t)+t", (c0 - c1), v0, v1, result); + + exprtk_debug(("(c0 - v0) - (c1 - v1) --> (covov) (c0 - c1) - v0 + v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 * v0) * (c1 * v1) --> (covov) (c0 * c1) * v0 * v1 + else if ((details::e_mul == o0) && (details::e_mul == o1) && (details::e_mul == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)*t", (c0 * c1), v0, v1, result); + + exprtk_debug(("(c0 * v0) * (c1 * v1) --> (covov) (c0 * c1) * v0 * v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 * v0) / (c1 * v1) --> (covov) (c0 / c1) * (v0 / v1) + else if ((details::e_mul == o0) && (details::e_div == o1) && (details::e_mul == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", (c0 / c1), v0, v1, result); + + exprtk_debug(("(c0 * v0) / (c1 * v1) --> (covov) (c0 / c1) * (v0 / v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 / v0) * (c1 / v1) --> (covov) (c0 * c1) / (v0 * v1) + else if ((details::e_div == o0) && (details::e_mul == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t/(t*t)", (c0 * c1), v0, v1, result); + + exprtk_debug(("(c0 / v0) * (c1 / v1) --> (covov) (c0 * c1) / (v0 * v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 / v0) / (c1 / v1) --> (covov) ((c0 / c1) * v1) / v0 + else if ((details::e_div == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", (c0 / c1), v1, v0, result); + + exprtk_debug(("(c0 / v0) / (c1 / v1) --> (covov) ((c0 / c1) * v1) / v0\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 * v0) / (c1 / v1) --> (covov) (c0 / c1) * (v0 * v1) + else if ((details::e_mul == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t*(t*t)", (c0 / c1), v0, v1, result); + + exprtk_debug(("(c0 * v0) / (c1 / v1) --> (covov) (c0 / c1) * (v0 * v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 / v0) / (c1 * v1) --> (covov) (c0 / c1) / (v0 * v1) + else if ((details::e_div == o0) && (details::e_div == o1) && (details::e_mul == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t/(t*t)", (c0 / c1), v0, v1, result); + + exprtk_debug(("(c0 / v0) / (c1 * v1) --> (covov) (c0 / c1) / (v0 * v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c * v0) +/- (c * v1) --> (covov) c * (v0 +/- v1) + else if ( + (std::equal_to()(c0,c1)) && + (details::e_mul == o0) && + (details::e_mul == o2) && + ( + (details::e_add == o1) || + (details::e_sub == o1) + ) + ) + { + std::string specfunc; + + switch (o1) + { + case details::e_add : specfunc = "t*(t+t)"; break; + case details::e_sub : specfunc = "t*(t-t)"; break; + default : return error_node(); + } + + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, specfunc, c0, v0, v1, result); + + exprtk_debug(("(c * v0) +/- (c * v1) --> (covov) c * (v0 +/- v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c0, v0, c1, v1, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + binary_functor_t f2 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), c0, v0, c1, v1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_vocovoc_expression0 + { + typedef typename vocovoc_t::type0 node_type; + typedef typename vocovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0 o0 c0) o1 (v1 o2 c1) + const details::voc_base_node* voc0 = static_cast*>(branch[0]); + const details::voc_base_node* voc1 = static_cast*>(branch[1]); + const Type c0 = voc0->c(); + const Type& v0 = voc0->v(); + const Type c1 = voc1->c(); + const Type& v1 = voc1->v(); + const details::operator_type o0 = voc0->operation(); + const details::operator_type o1 = operation; + const details::operator_type o2 = voc1->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (v0 + c0) + (v1 + c1) --> (covov) (c0 + c1) + v0 + v1 + if ((details::e_add == o0) && (details::e_add == o1) && (details::e_add == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t+t)+t", (c0 + c1), v0, v1, result); + + exprtk_debug(("(v0 + c0) + (v1 + c1) --> (covov) (c0 + c1) + v0 + v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 + c0) - (v1 + c1) --> (covov) (c0 - c1) + v0 - v1 + else if ((details::e_add == o0) && (details::e_sub == o1) && (details::e_add == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t+t)-t", (c0 - c1), v0, v1, result); + + exprtk_debug(("(v0 + c0) - (v1 + c1) --> (covov) (c0 - c1) + v0 - v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 - c0) - (v1 - c1) --> (covov) (c1 - c0) + v0 - v1 + else if ((details::e_sub == o0) && (details::e_sub == o1) && (details::e_sub == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t+t)-t", (c1 - c0), v0, v1, result); + + exprtk_debug(("(v0 - c0) - (v1 - c1) --> (covov) (c1 - c0) + v0 - v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 * c0) * (v1 * c1) --> (covov) (c0 * c1) * v0 * v1 + else if ((details::e_mul == o0) && (details::e_mul == o1) && (details::e_mul == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)*t", (c0 * c1), v0, v1, result); + + exprtk_debug(("(v0 * c0) * (v1 * c1) --> (covov) (c0 * c1) * v0 * v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 * c0) / (v1 * c1) --> (covov) (c0 / c1) * (v0 / v1) + else if ((details::e_mul == o0) && (details::e_div == o1) && (details::e_mul == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", (c0 / c1), v0, v1, result); + + exprtk_debug(("(v0 * c0) / (v1 * c1) --> (covov) (c0 / c1) * (v0 / v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / c0) * (v1 / c1) --> (covov) (1 / (c0 * c1)) * v0 * v1 + else if ((details::e_div == o0) && (details::e_mul == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)*t", Type(1) / (c0 * c1), v0, v1, result); + + exprtk_debug(("(v0 / c0) * (v1 / c1) --> (covov) (1 / (c0 * c1)) * v0 * v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / c0) / (v1 / c1) --> (covov) ((c1 / c0) * v0) / v1 + else if ((details::e_div == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", (c1 / c0), v0, v1, result); + + exprtk_debug(("(v0 / c0) / (v1 / c1) --> (covov) ((c1 / c0) * v0) / v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 * c0) / (v1 / c1) --> (covov) (c0 * c1) * (v0 / v1) + else if ((details::e_mul == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t*(t/t)", (c0 * c1), v0, v1, result); + + exprtk_debug(("(v0 * c0) / (v1 / c1) --> (covov) (c0 * c1) * (v0 / v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / c0) / (v1 * c1) --> (covov) (1 / (c0 * c1)) * v0 / v1 + else if ((details::e_div == o0) && (details::e_div == o1) && (details::e_mul == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t*(t/t)", Type(1) / (c0 * c1), v0, v1, result); + + exprtk_debug(("(v0 / c0) / (v1 * c1) --> (covov) (1 / (c0 * c1)) * v0 / v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / c0) * (v1 + c1) --> (vocovoc) (v0 * (1 / c0)) * (v1 + c1) + else if ((details::e_div == o0) && (details::e_mul == o1) && (details::e_add == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t*t)*(t+t)", v0, T(1) / c0, v1, c1, result); + + exprtk_debug(("(v0 / c0) * (v1 + c1) --> (vocovoc) (v0 * (1 / c0)) * (v1 + c1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / c0) * (v1 - c1) --> (vocovoc) (v0 * (1 / c0)) * (v1 - c1) + else if ((details::e_div == o0) && (details::e_mul == o1) && (details::e_sub == o2)) + { + const bool synthesis_result = + synthesize_sf4ext_expression:: + template compile(expr_gen, "(t*t)*(t-t)", v0, T(1) / c0, v1, c1, result); + + exprtk_debug(("(v0 / c0) * (v1 - c1) --> (vocovoc) (v0 * (1 / c0)) * (v1 - c1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 * c) +/- (v1 * c) --> (covov) c * (v0 +/- v1) + else if ( + (std::equal_to()(c0,c1)) && + (details::e_mul == o0) && + (details::e_mul == o2) && + ( + (details::e_add == o1) || + (details::e_sub == o1) + ) + ) + { + std::string specfunc; + + switch (o1) + { + case details::e_add : specfunc = "t*(t+t)"; break; + case details::e_sub : specfunc = "t*(t-t)"; break; + default : return error_node(); + } + + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, specfunc, c0, v0, v1, result); + + exprtk_debug(("(v0 * c) +/- (v1 * c) --> (covov) c * (v0 +/- v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / c) +/- (v1 / c) --> (vovoc) (v0 +/- v1) / c + else if ( + (std::equal_to()(c0,c1)) && + (details::e_div == o0) && + (details::e_div == o2) && + ( + (details::e_add == o1) || + (details::e_sub == o1) + ) + ) + { + std::string specfunc; + + switch (o1) + { + case details::e_add : specfunc = "(t+t)/t"; break; + case details::e_sub : specfunc = "(t-t)/t"; break; + default : return error_node(); + } + + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, specfunc, v0, v1, c0, result); + + exprtk_debug(("(v0 / c) +/- (v1 / c) --> (vovoc) (v0 +/- v1) / c\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c0, v1, c1, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + binary_functor_t f2 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v0, c0, v1, c1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_covovoc_expression0 + { + typedef typename covovoc_t::type0 node_type; + typedef typename covovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (c0 o0 v0) o1 (v1 o2 c1) + const details::cov_base_node* cov = static_cast*>(branch[0]); + const details::voc_base_node* voc = static_cast*>(branch[1]); + const Type c0 = cov->c(); + const Type& v0 = cov->v(); + const Type c1 = voc->c(); + const Type& v1 = voc->v(); + const details::operator_type o0 = cov->operation(); + const details::operator_type o1 = operation; + const details::operator_type o2 = voc->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (c0 + v0) + (v1 + c1) --> (covov) (c0 + c1) + v0 + v1 + if ((details::e_add == o0) && (details::e_add == o1) && (details::e_add == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t+t)+t", (c0 + c1), v0, v1, result); + + exprtk_debug(("(c0 + v0) + (v1 + c1) --> (covov) (c0 + c1) + v0 + v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 + v0) - (v1 + c1) --> (covov) (c0 - c1) + v0 - v1 + else if ((details::e_add == o0) && (details::e_sub == o1) && (details::e_add == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t+t)-t", (c0 - c1), v0, v1, result); + + exprtk_debug(("(c0 + v0) - (v1 + c1) --> (covov) (c0 - c1) + v0 - v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 - v0) - (v1 - c1) --> (covov) (c0 + c1) - v0 - v1 + else if ((details::e_sub == o0) && (details::e_sub == o1) && (details::e_sub == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t-(t+t)", (c0 + c1), v0, v1, result); + + exprtk_debug(("(c0 - v0) - (v1 - c1) --> (covov) (c0 + c1) - v0 - v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 * v0) * (v1 * c1) --> (covov) (c0 * c1) * v0 * v1 + else if ((details::e_mul == o0) && (details::e_mul == o1) && (details::e_mul == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)*t", (c0 * c1), v0, v1, result); + + exprtk_debug(("(c0 * v0) * (v1 * c1) --> (covov) (c0 * c1) * v0 * v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 * v0) / (v1 * c1) --> (covov) (c0 / c1) * (v0 / v1) + else if ((details::e_mul == o0) && (details::e_div == o1) && (details::e_mul == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", (c0 / c1), v0, v1, result); + + exprtk_debug(("(c0 * v0) / (v1 * c1) --> (covov) (c0 / c1) * (v0 / v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 / v0) * (v1 / c1) --> (covov) (c0 / c1) * (v1 / v0) + else if ((details::e_div == o0) && (details::e_mul == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t*(t/t)", (c0 / c1), v1, v0, result); + + exprtk_debug(("(c0 / v0) * (v1 / c1) --> (covov) (c0 / c1) * (v1 / v0)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 / v0) / (v1 / c1) --> (covov) (c0 * c1) / (v0 * v1) + else if ((details::e_div == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t/(t*t)", (c0 * c1), v0, v1, result); + + exprtk_debug(("(c0 / v0) / (v1 / c1) --> (covov) (c0 * c1) / (v0 * v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 * v0) / (v1 / c1) --> (covov) (c0 * c1) * (v0 / v1) + else if ((details::e_mul == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", (c0 * c1), v0, v1, result); + + exprtk_debug(("(c0 * v0) / (v1 / c1) --> (covov) (c0 * c1) * (v0 / v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c0 / v0) / (v1 * c1) --> (covov) (c0 / c1) / (v0 * v1) + else if ((details::e_div == o0) && (details::e_div == o1) && (details::e_mul == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "t/(t*t)", (c0 / c1), v0, v1, result); + + exprtk_debug(("(c0 / v0) / (v1 * c1) --> (covov) (c0 / c1) / (v0 * v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (c * v0) +/- (v1 * c) --> (covov) c * (v0 +/- v1) + else if ( + (std::equal_to()(c0,c1)) && + (details::e_mul == o0) && + (details::e_mul == o2) && + ( + (details::e_add == o1) || + (details::e_sub == o1) + ) + ) + { + std::string specfunc; + + switch (o1) + { + case details::e_add : specfunc = "t*(t+t)"; break; + case details::e_sub : specfunc = "t*(t-t)"; break; + default : return error_node(); + } + + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, specfunc, c0, v0, v1, result); + + exprtk_debug(("(c * v0) +/- (v1 * c) --> (covov) c * (v0 +/- v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c0, v0, v1, c1, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + binary_functor_t f2 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), c0, v0, v1, c1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_vococov_expression0 + { + typedef typename vococov_t::type0 node_type; + typedef typename vococov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0 o0 c0) o1 (c1 o2 v1) + const details::voc_base_node* voc = static_cast*>(branch[0]); + const details::cov_base_node* cov = static_cast*>(branch[1]); + const Type c0 = voc->c(); + const Type& v0 = voc->v(); + const Type c1 = cov->c(); + const Type& v1 = cov->v(); + const details::operator_type o0 = voc->operation(); + const details::operator_type o1 = operation; + const details::operator_type o2 = cov->operation(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + if (expr_gen.parser_->settings_.strength_reduction_enabled()) + { + // (v0 + c0) + (c1 + v1) --> (covov) (c0 + c1) + v0 + v1 + if ((details::e_add == o0) && (details::e_add == o1) && (details::e_add == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t+t)+t", (c0 + c1), v0, v1, result); + + exprtk_debug(("(v0 + c0) + (c1 + v1) --> (covov) (c0 + c1) + v0 + v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 + c0) - (c1 + v1) --> (covov) (c0 - c1) + v0 - v1 + else if ((details::e_add == o0) && (details::e_sub == o1) && (details::e_add == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t+t)-t", (c0 - c1), v0, v1, result); + + exprtk_debug(("(v0 + c0) - (c1 + v1) --> (covov) (c0 - c1) + v0 - v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 - c0) - (c1 - v1) --> (vovoc) v0 + v1 - (c1 + c0) + else if ((details::e_sub == o0) && (details::e_sub == o1) && (details::e_sub == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t+t)-t", v0, v1, (c1 + c0), result); + + exprtk_debug(("(v0 - c0) - (c1 - v1) --> (vovoc) v0 + v1 - (c1 + c0)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 * c0) * (c1 * v1) --> (covov) (c0 * c1) * v0 * v1 + else if ((details::e_mul == o0) && (details::e_mul == o1) && (details::e_mul == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)*t", (c0 * c1), v0, v1, result); + + exprtk_debug(("(v0 * c0) * (c1 * v1) --> (covov) (c0 * c1) * v0 * v1\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 * c0) / (c1 * v1) --> (covov) (c0 / c1) * (v0 * v1) + else if ((details::e_mul == o0) && (details::e_div == o1) && (details::e_mul == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", (c0 / c1), v0, v1, result); + + exprtk_debug(("(v0 * c0) / (c1 * v1) --> (covov) (c0 / c1) * (v0 * v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / c0) * (c1 / v1) --> (covov) (c1 / c0) * (v0 / v1) + else if ((details::e_div == o0) && (details::e_mul == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", (c1 / c0), v0, v1, result); + + exprtk_debug(("(v0 / c0) * (c1 / v1) --> (covov) (c1 / c0) * (v0 / v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 * c0) / (c1 / v1) --> (covov) (c0 / c1) * (v0 * v1) + else if ((details::e_mul == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)*t", (c0 / c1), v0, v1, result); + + exprtk_debug(("(v0 * c0) / (c1 / v1) --> (covov) (c0 / c1) * (v0 * v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / c0) / (c1 * v1) --> (covov) (1 / (c0 * c1)) * (v0 / v1) + else if ((details::e_div == o0) && (details::e_div == o1) && (details::e_mul == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)/t", Type(1) / (c0 * c1), v0, v1, result); + + exprtk_debug(("(v0 / c0) / (c1 * v1) --> (covov) (1 / (c0 * c1)) * (v0 / v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 / c0) / (c1 / v1) --> (vovoc) (v0 * v1) * (1 / (c0 * c1)) + else if ((details::e_div == o0) && (details::e_div == o1) && (details::e_div == o2)) + { + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, "(t*t)*t", v0, v1, Type(1) / (c0 * c1), result); + + exprtk_debug(("(v0 / c0) / (c1 / v1) --> (vovoc) (v0 * v1) * (1 / (c0 * c1))\n")); + + return (synthesis_result) ? result : error_node(); + } + // (v0 * c) +/- (c * v1) --> (covov) c * (v0 +/- v1) + else if ( + (std::equal_to()(c0,c1)) && + (details::e_mul == o0) && + (details::e_mul == o2) && + ( + (details::e_add == o1) || (details::e_sub == o1) + ) + ) + { + std::string specfunc; + + switch (o1) + { + case details::e_add : specfunc = "t*(t+t)"; break; + case details::e_sub : specfunc = "t*(t-t)"; break; + default : return error_node(); + } + + const bool synthesis_result = + synthesize_sf3ext_expression:: + template compile(expr_gen, specfunc, c0, v0, v1, result); + + exprtk_debug(("(v0 * c) +/- (c * v1) --> (covov) c * (v0 +/- v1)\n")); + + return (synthesis_result) ? result : error_node(); + } + } + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c0, c1, v1, result); + + if (synthesis_result) + return result; + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = reinterpret_cast(0); + binary_functor_t f2 = reinterpret_cast(0); + + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + else if (!expr_gen.valid_operator(o1,f1)) + return error_node(); + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + else + return node_type::allocate(*(expr_gen.node_allocator_), v0, c0, c1, v1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_vovovov_expression1 + { + typedef typename vovovov_t::type1 node_type; + typedef typename vovovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // v0 o0 (v1 o1 (v2 o2 v3)) + typedef typename synthesize_vovov_expression1::node_type lcl_vovov_t; + + const lcl_vovov_t* vovov = static_cast(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type& v1 = vovov->t0(); + const Type& v2 = vovov->t1(); + const Type& v3 = vovov->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(vovov->f0()); + const details::operator_type o2 = expr_gen.get_operator(vovov->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = vovov->f0(); + binary_functor_t f2 = vovov->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen,id(expr_gen, o0, o1, o2), v0, v1, v2, v3, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("v0 o0 (v1 o1 (v2 o2 v3))\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, v2, v3, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t))"; + } + }; + + struct synthesize_vovovoc_expression1 + { + typedef typename vovovoc_t::type1 node_type; + typedef typename vovovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // v0 o0 (v1 o1 (v2 o2 c)) + typedef typename synthesize_vovoc_expression1::node_type lcl_vovoc_t; + + const lcl_vovoc_t* vovoc = static_cast(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type& v1 = vovoc->t0(); + const Type& v2 = vovoc->t1(); + const Type c = vovoc->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(vovoc->f0()); + const details::operator_type o2 = expr_gen.get_operator(vovoc->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = vovoc->f0(); + binary_functor_t f2 = vovoc->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, v2, c, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("v0 o0 (v1 o1 (v2 o2 c))\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, v2, c, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t))"; + } + }; + + struct synthesize_vovocov_expression1 + { + typedef typename vovocov_t::type1 node_type; + typedef typename vovocov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // v0 o0 (v1 o1 (c o2 v2)) + typedef typename synthesize_vocov_expression1::node_type lcl_vocov_t; + + const lcl_vocov_t* vocov = static_cast(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type& v1 = vocov->t0(); + const Type c = vocov->t1(); + const Type& v2 = vocov->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(vocov->f0()); + const details::operator_type o2 = expr_gen.get_operator(vocov->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = vocov->f0(); + binary_functor_t f2 = vocov->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, c, v2, result); + + if (synthesis_result) + return result; + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("v0 o0 (v1 o1 (c o2 v2))\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, c, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t))"; + } + }; + + struct synthesize_vocovov_expression1 + { + typedef typename vocovov_t::type1 node_type; + typedef typename vocovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // v0 o0 (c o1 (v1 o2 v2)) + typedef typename synthesize_covov_expression1::node_type lcl_covov_t; + + const lcl_covov_t* covov = static_cast(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type c = covov->t0(); + const Type& v1 = covov->t1(); + const Type& v2 = covov->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(covov->f0()); + const details::operator_type o2 = expr_gen.get_operator(covov->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = covov->f0(); + binary_functor_t f2 = covov->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c, v1, v2, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("v0 o0 (c o1 (v1 o2 v2))\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, c, v1, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t))"; + } + }; + + struct synthesize_covovov_expression1 + { + typedef typename covovov_t::type1 node_type; + typedef typename covovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // c o0 (v0 o1 (v1 o2 v2)) + typedef typename synthesize_vovov_expression1::node_type lcl_vovov_t; + + const lcl_vovov_t* vovov = static_cast(branch[1]); + const Type c = static_cast*>(branch[0])->value(); + const Type& v0 = vovov->t0(); + const Type& v1 = vovov->t1(); + const Type& v2 = vovov->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(vovov->f0()); + const details::operator_type o2 = expr_gen.get_operator(vovov->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = vovov->f0(); + binary_functor_t f2 = vovov->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c, v0, v1, v2, result); + + if (synthesis_result) + return result; + if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("c o0 (v0 o1 (v1 o2 v2))\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), c, v0, v1, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t))"; + } + }; + + struct synthesize_covocov_expression1 + { + typedef typename covocov_t::type1 node_type; + typedef typename covocov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // c0 o0 (v0 o1 (c1 o2 v1)) + typedef typename synthesize_vocov_expression1::node_type lcl_vocov_t; + + const lcl_vocov_t* vocov = static_cast(branch[1]); + const Type c0 = static_cast*>(branch[0])->value(); + const Type& v0 = vocov->t0(); + const Type c1 = vocov->t1(); + const Type& v1 = vocov->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(vocov->f0()); + const details::operator_type o2 = expr_gen.get_operator(vocov->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = vocov->f0(); + binary_functor_t f2 = vocov->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c0, v0, c1, v1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("c0 o0 (v0 o1 (c1 o2 v1))\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), c0, v0, c1, v1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t))"; + } + }; + + struct synthesize_vocovoc_expression1 + { + typedef typename vocovoc_t::type1 node_type; + typedef typename vocovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // v0 o0 (c0 o1 (v1 o2 c2)) + typedef typename synthesize_covoc_expression1::node_type lcl_covoc_t; + + const lcl_covoc_t* covoc = static_cast(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type c0 = covoc->t0(); + const Type& v1 = covoc->t1(); + const Type c1 = covoc->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(covoc->f0()); + const details::operator_type o2 = expr_gen.get_operator(covoc->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = covoc->f0(); + binary_functor_t f2 = covoc->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c0, v1, c1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("v0 o0 (c0 o1 (v1 o2 c2))\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, c0, v1, c1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t))"; + } + }; + + struct synthesize_covovoc_expression1 + { + typedef typename covovoc_t::type1 node_type; + typedef typename covovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // c0 o0 (v0 o1 (v1 o2 c1)) + typedef typename synthesize_vovoc_expression1::node_type lcl_vovoc_t; + + const lcl_vovoc_t* vovoc = static_cast(branch[1]); + const Type c0 = static_cast*>(branch[0])->value(); + const Type& v0 = vovoc->t0(); + const Type& v1 = vovoc->t1(); + const Type c1 = vovoc->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(vovoc->f0()); + const details::operator_type o2 = expr_gen.get_operator(vovoc->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = vovoc->f0(); + binary_functor_t f2 = vovoc->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c0, v0, v1, c1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("c0 o0 (v0 o1 (v1 o2 c1))\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), c0, v0, v1, c1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t))"; + } + }; + + struct synthesize_vococov_expression1 + { + typedef typename vococov_t::type1 node_type; + typedef typename vococov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // v0 o0 (c0 o1 (c1 o2 v1)) + typedef typename synthesize_cocov_expression1::node_type lcl_cocov_t; + + const lcl_cocov_t* cocov = static_cast(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type c0 = cocov->t0(); + const Type c1 = cocov->t1(); + const Type& v1 = cocov->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(cocov->f0()); + const details::operator_type o2 = expr_gen.get_operator(cocov->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = cocov->f0(); + binary_functor_t f2 = cocov->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c0, c1, v1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("v0 o0 (c0 o1 (c1 o2 v1))\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, c0, c1, v1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "(t" << expr_gen.to_str(o2) + << "t))"; + } + }; + + struct synthesize_vovovov_expression2 + { + typedef typename vovovov_t::type2 node_type; + typedef typename vovovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // v0 o0 ((v1 o1 v2) o2 v3) + typedef typename synthesize_vovov_expression0::node_type lcl_vovov_t; + + const lcl_vovov_t* vovov = static_cast(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type& v1 = vovov->t0(); + const Type& v2 = vovov->t1(); + const Type& v3 = vovov->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(vovov->f0()); + const details::operator_type o2 = expr_gen.get_operator(vovov->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = vovov->f0(); + binary_functor_t f2 = vovov->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, v2, v3, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("v0 o0 ((v1 o1 v2) o2 v3)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, v2, v3, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "((t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_vovovoc_expression2 + { + typedef typename vovovoc_t::type2 node_type; + typedef typename vovovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // v0 o0 ((v1 o1 v2) o2 c) + typedef typename synthesize_vovoc_expression0::node_type lcl_vovoc_t; + + const lcl_vovoc_t* vovoc = static_cast(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type& v1 = vovoc->t0(); + const Type& v2 = vovoc->t1(); + const Type c = vovoc->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(vovoc->f0()); + const details::operator_type o2 = expr_gen.get_operator(vovoc->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = vovoc->f0(); + binary_functor_t f2 = vovoc->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, v2, c, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("v0 o0 ((v1 o1 v2) o2 c)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, v2, c, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "((t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_vovocov_expression2 + { + typedef typename vovocov_t::type2 node_type; + typedef typename vovocov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // v0 o0 ((v1 o1 c) o2 v2) + typedef typename synthesize_vocov_expression0::node_type lcl_vocov_t; + + const lcl_vocov_t* vocov = static_cast(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type& v1 = vocov->t0(); + const Type c = vocov->t1(); + const Type& v2 = vocov->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(vocov->f0()); + const details::operator_type o2 = expr_gen.get_operator(vocov->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = vocov->f0(); + binary_functor_t f2 = vocov->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, c, v2, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("v0 o0 ((v1 o1 c) o2 v2)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, c, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "((t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_vocovov_expression2 + { + typedef typename vocovov_t::type2 node_type; + typedef typename vocovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // v0 o0 ((c o1 v1) o2 v2) + typedef typename synthesize_covov_expression0::node_type lcl_covov_t; + + const lcl_covov_t* covov = static_cast(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type c = covov->t0(); + const Type& v1 = covov->t1(); + const Type& v2 = covov->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(covov->f0()); + const details::operator_type o2 = expr_gen.get_operator(covov->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = covov->f0(); + binary_functor_t f2 = covov->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c, v1, v2, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("v0 o0 ((c o1 v1) o2 v2)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, c, v1, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "((t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_covovov_expression2 + { + typedef typename covovov_t::type2 node_type; + typedef typename covovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // c o0 ((v1 o1 v2) o2 v3) + typedef typename synthesize_vovov_expression0::node_type lcl_vovov_t; + + const lcl_vovov_t* vovov = static_cast(branch[1]); + const Type c = static_cast*>(branch[0])->value(); + const Type& v0 = vovov->t0(); + const Type& v1 = vovov->t1(); + const Type& v2 = vovov->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(vovov->f0()); + const details::operator_type o2 = expr_gen.get_operator(vovov->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = vovov->f0(); + binary_functor_t f2 = vovov->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c, v0, v1, v2, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("c o0 ((v1 o1 v2) o2 v3)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), c, v0, v1, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "((t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_covocov_expression2 + { + typedef typename covocov_t::type2 node_type; + typedef typename covocov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // c0 o0 ((v0 o1 c1) o2 v1) + typedef typename synthesize_vocov_expression0::node_type lcl_vocov_t; + + const lcl_vocov_t* vocov = static_cast(branch[1]); + const Type c0 = static_cast*>(branch[0])->value(); + const Type& v0 = vocov->t0(); + const Type c1 = vocov->t1(); + const Type& v1 = vocov->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(vocov->f0()); + const details::operator_type o2 = expr_gen.get_operator(vocov->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = vocov->f0(); + binary_functor_t f2 = vocov->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c0, v0, c1, v1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("c0 o0 ((v0 o1 c1) o2 v1)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), c0, v0, c1, v1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "((t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_vocovoc_expression2 + { + typedef typename vocovoc_t::type2 node_type; + typedef typename vocovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // v0 o0 ((c0 o1 v1) o2 c1) + typedef typename synthesize_covoc_expression0::node_type lcl_covoc_t; + + const lcl_covoc_t* covoc = static_cast(branch[1]); + const Type& v0 = static_cast*>(branch[0])->ref(); + const Type c0 = covoc->t0(); + const Type& v1 = covoc->t1(); + const Type c1 = covoc->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(covoc->f0()); + const details::operator_type o2 = expr_gen.get_operator(covoc->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = covoc->f0(); + binary_functor_t f2 = covoc->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c0, v1, c1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("v0 o0 ((c0 o1 v1) o2 c1)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, c0, v1, c1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "((t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_covovoc_expression2 + { + typedef typename covovoc_t::type2 node_type; + typedef typename covovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // c0 o0 ((v0 o1 v1) o2 c1) + typedef typename synthesize_vovoc_expression0::node_type lcl_vovoc_t; + + const lcl_vovoc_t* vovoc = static_cast(branch[1]); + const Type c0 = static_cast*>(branch[0])->value(); + const Type& v0 = vovoc->t0(); + const Type& v1 = vovoc->t1(); + const Type c1 = vovoc->t2(); + const details::operator_type o0 = operation; + const details::operator_type o1 = expr_gen.get_operator(vovoc->f0()); + const details::operator_type o2 = expr_gen.get_operator(vovoc->f1()); + + binary_functor_t f0 = reinterpret_cast(0); + binary_functor_t f1 = vovoc->f0(); + binary_functor_t f2 = vovoc->f1(); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c0, v0, v1, c1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o0,f0)) + return error_node(); + + exprtk_debug(("c0 o0 ((v0 o1 v1) o2 c1)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), c0, v0, v1, c1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "t" << expr_gen.to_str(o0) + << "((t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t)"; + } + }; + + struct synthesize_vococov_expression2 + { + typedef typename vococov_t::type2 node_type; + static inline expression_node_ptr process(expression_generator&, + const details::operator_type&, + expression_node_ptr (&)[2]) + { + // v0 o0 ((c0 o1 c1) o2 v1) - Not possible + exprtk_debug(("v0 o0 ((c0 o1 c1) o2 v1) - Not possible\n")); + return error_node(); + } + + static inline std::string id(expression_generator&, + const details::operator_type, + const details::operator_type, + const details::operator_type) + { + return "INVALID"; + } + }; + + struct synthesize_vovovov_expression3 + { + typedef typename vovovov_t::type3 node_type; + typedef typename vovovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((v0 o0 v1) o1 v2) o2 v3 + typedef typename synthesize_vovov_expression0::node_type lcl_vovov_t; + + const lcl_vovov_t* vovov = static_cast(branch[0]); + const Type& v0 = vovov->t0(); + const Type& v1 = vovov->t1(); + const Type& v2 = vovov->t2(); + const Type& v3 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = expr_gen.get_operator(vovov->f0()); + const details::operator_type o1 = expr_gen.get_operator(vovov->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = vovov->f0(); + binary_functor_t f1 = vovov->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, v2, v3, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((v0 o0 v1) o1 v2) o2 v3\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, v2, v3, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "((t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_vovovoc_expression3 + { + typedef typename vovovoc_t::type3 node_type; + typedef typename vovovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((v0 o0 v1) o1 v2) o2 c + typedef typename synthesize_vovov_expression0::node_type lcl_vovov_t; + + const lcl_vovov_t* vovov = static_cast(branch[0]); + const Type& v0 = vovov->t0(); + const Type& v1 = vovov->t1(); + const Type& v2 = vovov->t2(); + const Type c = static_cast*>(branch[1])->value(); + const details::operator_type o0 = expr_gen.get_operator(vovov->f0()); + const details::operator_type o1 = expr_gen.get_operator(vovov->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = vovov->f0(); + binary_functor_t f1 = vovov->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, v2, c, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((v0 o0 v1) o1 v2) o2 c\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, v2, c, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "((t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_vovocov_expression3 + { + typedef typename vovocov_t::type3 node_type; + typedef typename vovocov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((v0 o0 v1) o1 c) o2 v2 + typedef typename synthesize_vovoc_expression0::node_type lcl_vovoc_t; + + const lcl_vovoc_t* vovoc = static_cast(branch[0]); + const Type& v0 = vovoc->t0(); + const Type& v1 = vovoc->t1(); + const Type c = vovoc->t2(); + const Type& v2 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = expr_gen.get_operator(vovoc->f0()); + const details::operator_type o1 = expr_gen.get_operator(vovoc->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = vovoc->f0(); + binary_functor_t f1 = vovoc->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, c, v2, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((v0 o0 v1) o1 c) o2 v2\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, c, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "((t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_vocovov_expression3 + { + typedef typename vocovov_t::type3 node_type; + typedef typename vocovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((v0 o0 c) o1 v1) o2 v2 + typedef typename synthesize_vocov_expression0::node_type lcl_vocov_t; + + const lcl_vocov_t* vocov = static_cast(branch[0]); + const Type& v0 = vocov->t0(); + const Type c = vocov->t1(); + const Type& v1 = vocov->t2(); + const Type& v2 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = expr_gen.get_operator(vocov->f0()); + const details::operator_type o1 = expr_gen.get_operator(vocov->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = vocov->f0(); + binary_functor_t f1 = vocov->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c, v1, v2, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((v0 o0 c) o1 v1) o2 v2\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, c, v1, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "((t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_covovov_expression3 + { + typedef typename covovov_t::type3 node_type; + typedef typename covovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((c o0 v0) o1 v1) o2 v2 + typedef typename synthesize_covov_expression0::node_type lcl_covov_t; + + const lcl_covov_t* covov = static_cast(branch[0]); + const Type c = covov->t0(); + const Type& v0 = covov->t1(); + const Type& v1 = covov->t2(); + const Type& v2 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = expr_gen.get_operator(covov->f0()); + const details::operator_type o1 = expr_gen.get_operator(covov->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = covov->f0(); + binary_functor_t f1 = covov->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c, v0, v1, v2, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((c o0 v0) o1 v1) o2 v2\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), c, v0, v1, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "((t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_covocov_expression3 + { + typedef typename covocov_t::type3 node_type; + typedef typename covocov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((c0 o0 v0) o1 c1) o2 v1 + typedef typename synthesize_covoc_expression0::node_type lcl_covoc_t; + + const lcl_covoc_t* covoc = static_cast(branch[0]); + const Type c0 = covoc->t0(); + const Type& v0 = covoc->t1(); + const Type c1 = covoc->t2(); + const Type& v1 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = expr_gen.get_operator(covoc->f0()); + const details::operator_type o1 = expr_gen.get_operator(covoc->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = covoc->f0(); + binary_functor_t f1 = covoc->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c0, v0, c1, v1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((c0 o0 v0) o1 c1) o2 v1\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), c0, v0, c1, v1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "((t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_vocovoc_expression3 + { + typedef typename vocovoc_t::type3 node_type; + typedef typename vocovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((v0 o0 c0) o1 v1) o2 c1 + typedef typename synthesize_vocov_expression0::node_type lcl_vocov_t; + + const lcl_vocov_t* vocov = static_cast(branch[0]); + const Type& v0 = vocov->t0(); + const Type c0 = vocov->t1(); + const Type& v1 = vocov->t2(); + const Type c1 = static_cast*>(branch[1])->value(); + const details::operator_type o0 = expr_gen.get_operator(vocov->f0()); + const details::operator_type o1 = expr_gen.get_operator(vocov->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = vocov->f0(); + binary_functor_t f1 = vocov->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c0, v1, c1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((v0 o0 c0) o1 v1) o2 c1\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, c0, v1, c1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "((t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_covovoc_expression3 + { + typedef typename covovoc_t::type3 node_type; + typedef typename covovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((c0 o0 v0) o1 v1) o2 c1 + typedef typename synthesize_covov_expression0::node_type lcl_covov_t; + + const lcl_covov_t* covov = static_cast(branch[0]); + const Type c0 = covov->t0(); + const Type& v0 = covov->t1(); + const Type& v1 = covov->t2(); + const Type c1 = static_cast*>(branch[1])->value(); + const details::operator_type o0 = expr_gen.get_operator(covov->f0()); + const details::operator_type o1 = expr_gen.get_operator(covov->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = covov->f0(); + binary_functor_t f1 = covov->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c0, v0, v1, c1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((c0 o0 v0) o1 v1) o2 c1\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), c0, v0, v1, c1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "((t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_vococov_expression3 + { + typedef typename vococov_t::type3 node_type; + typedef typename vococov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((v0 o0 c0) o1 c1) o2 v1 + typedef typename synthesize_vococ_expression0::node_type lcl_vococ_t; + + const lcl_vococ_t* vococ = static_cast(branch[0]); + const Type& v0 = vococ->t0(); + const Type c0 = vococ->t1(); + const Type c1 = vococ->t2(); + const Type& v1 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = expr_gen.get_operator(vococ->f0()); + const details::operator_type o1 = expr_gen.get_operator(vococ->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = vococ->f0(); + binary_functor_t f1 = vococ->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c0, c1, v1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((v0 o0 c0) o1 c1) o2 v1\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, c0, c1, v1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "((t" << expr_gen.to_str(o0) + << "t)" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_vovovov_expression4 + { + typedef typename vovovov_t::type4 node_type; + typedef typename vovovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // (v0 o0 (v1 o1 v2)) o2 v3 + typedef typename synthesize_vovov_expression1::node_type lcl_vovov_t; + + const lcl_vovov_t* vovov = static_cast(branch[0]); + const Type& v0 = vovov->t0(); + const Type& v1 = vovov->t1(); + const Type& v2 = vovov->t2(); + const Type& v3 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = expr_gen.get_operator(vovov->f0()); + const details::operator_type o1 = expr_gen.get_operator(vovov->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = vovov->f0(); + binary_functor_t f1 = vovov->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, v2, v3, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("(v0 o0 (v1 o1 v2)) o2 v3\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, v2, v3, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_vovovoc_expression4 + { + typedef typename vovovoc_t::type4 node_type; + typedef typename vovovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((v0 o0 (v1 o1 v2)) o2 c) + typedef typename synthesize_vovov_expression1::node_type lcl_vovov_t; + + const lcl_vovov_t* vovov = static_cast(branch[0]); + const Type& v0 = vovov->t0(); + const Type& v1 = vovov->t1(); + const Type& v2 = vovov->t2(); + const Type c = static_cast*>(branch[1])->value(); + const details::operator_type o0 = expr_gen.get_operator(vovov->f0()); + const details::operator_type o1 = expr_gen.get_operator(vovov->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = vovov->f0(); + binary_functor_t f1 = vovov->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, v2, c, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((v0 o0 (v1 o1 v2)) o2 c)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, v2, c, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_vovocov_expression4 + { + typedef typename vovocov_t::type4 node_type; + typedef typename vovocov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((v0 o0 (v1 o1 c)) o2 v1) + typedef typename synthesize_vovoc_expression1::node_type lcl_vovoc_t; + + const lcl_vovoc_t* vovoc = static_cast(branch[0]); + const Type& v0 = vovoc->t0(); + const Type& v1 = vovoc->t1(); + const Type c = vovoc->t2(); + const Type& v2 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = expr_gen.get_operator(vovoc->f0()); + const details::operator_type o1 = expr_gen.get_operator(vovoc->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = vovoc->f0(); + binary_functor_t f1 = vovoc->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, v1, c, v2, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((v0 o0 (v1 o1 c)) o2 v1)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, v1, c, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_vocovov_expression4 + { + typedef typename vocovov_t::type4 node_type; + typedef typename vocovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((v0 o0 (c o1 v1)) o2 v2) + typedef typename synthesize_vocov_expression1::node_type lcl_vocov_t; + + const lcl_vocov_t* vocov = static_cast(branch[0]); + const Type& v0 = vocov->t0(); + const Type c = vocov->t1(); + const Type& v1 = vocov->t2(); + const Type& v2 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = expr_gen.get_operator(vocov->f0()); + const details::operator_type o1 = expr_gen.get_operator(vocov->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = vocov->f0(); + binary_functor_t f1 = vocov->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c, v1, v2, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((v0 o0 (c o1 v1)) o2 v2)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, c, v1, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_covovov_expression4 + { + typedef typename covovov_t::type4 node_type; + typedef typename covovov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((c o0 (v0 o1 v1)) o2 v2) + typedef typename synthesize_covov_expression1::node_type lcl_covov_t; + + const lcl_covov_t* covov = static_cast(branch[0]); + const Type c = covov->t0(); + const Type& v0 = covov->t1(); + const Type& v1 = covov->t2(); + const Type& v2 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = expr_gen.get_operator(covov->f0()); + const details::operator_type o1 = expr_gen.get_operator(covov->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = covov->f0(); + binary_functor_t f1 = covov->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c, v0, v1, v2, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((c o0 (v0 o1 v1)) o2 v2)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), c, v0, v1, v2, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_covocov_expression4 + { + typedef typename covocov_t::type4 node_type; + typedef typename covocov_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((c0 o0 (v0 o1 c1)) o2 v1) + typedef typename synthesize_covoc_expression1::node_type lcl_covoc_t; + + const lcl_covoc_t* covoc = static_cast(branch[0]); + const Type c0 = covoc->t0(); + const Type& v0 = covoc->t1(); + const Type c1 = covoc->t2(); + const Type& v1 = static_cast*>(branch[1])->ref(); + const details::operator_type o0 = expr_gen.get_operator(covoc->f0()); + const details::operator_type o1 = expr_gen.get_operator(covoc->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = covoc->f0(); + binary_functor_t f1 = covoc->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c0, v0, c1, v1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((c0 o0 (v0 o1 c1)) o2 v1)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), c0, v0, c1, v1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_vocovoc_expression4 + { + typedef typename vocovoc_t::type4 node_type; + typedef typename vocovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((v0 o0 (c0 o1 v1)) o2 c1) + typedef typename synthesize_vocov_expression1::node_type lcl_vocov_t; + + const lcl_vocov_t* vocov = static_cast(branch[0]); + const Type& v0 = vocov->t0(); + const Type c0 = vocov->t1(); + const Type& v1 = vocov->t2(); + const Type c1 = static_cast*>(branch[1])->value(); + const details::operator_type o0 = expr_gen.get_operator(vocov->f0()); + const details::operator_type o1 = expr_gen.get_operator(vocov->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = vocov->f0(); + binary_functor_t f1 = vocov->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), v0, c0, v1, c1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((v0 o0 (c0 o1 v1)) o2 c1)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), v0, c0, v1, c1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_covovoc_expression4 + { + typedef typename covovoc_t::type4 node_type; + typedef typename covovoc_t::sf4_type sf4_type; + typedef typename node_type::T0 T0; + typedef typename node_type::T1 T1; + typedef typename node_type::T2 T2; + typedef typename node_type::T3 T3; + + static inline expression_node_ptr process(expression_generator& expr_gen, + const details::operator_type& operation, + expression_node_ptr (&branch)[2]) + { + // ((c0 o0 (v0 o1 v1)) o2 c1) + typedef typename synthesize_covov_expression1::node_type lcl_covov_t; + + const lcl_covov_t* covov = static_cast(branch[0]); + const Type c0 = covov->t0(); + const Type& v0 = covov->t1(); + const Type& v1 = covov->t2(); + const Type c1 = static_cast*>(branch[1])->value(); + const details::operator_type o0 = expr_gen.get_operator(covov->f0()); + const details::operator_type o1 = expr_gen.get_operator(covov->f1()); + const details::operator_type o2 = operation; + + binary_functor_t f0 = covov->f0(); + binary_functor_t f1 = covov->f1(); + binary_functor_t f2 = reinterpret_cast(0); + + details::free_node(*(expr_gen.node_allocator_),branch[0]); + details::free_node(*(expr_gen.node_allocator_),branch[1]); + + expression_node_ptr result = error_node(); + + const bool synthesis_result = + synthesize_sf4ext_expression::template compile + (expr_gen, id(expr_gen, o0, o1, o2), c0, v0, v1, c1, result); + + if (synthesis_result) + return result; + else if (!expr_gen.valid_operator(o2,f2)) + return error_node(); + + exprtk_debug(("((c0 o0 (v0 o1 v1)) o2 c1)\n")); + + return node_type::allocate(*(expr_gen.node_allocator_), c0, v0, v1, c1, f0, f1, f2); + } + + static inline std::string id(expression_generator& expr_gen, + const details::operator_type o0, + const details::operator_type o1, + const details::operator_type o2) + { + return details::build_string() + << "(t" << expr_gen.to_str(o0) + << "(t" << expr_gen.to_str(o1) + << "t)" << expr_gen.to_str(o2) + << "t"; + } + }; + + struct synthesize_vococov_expression4 + { + typedef typename vococov_t::type4 node_type; + static inline expression_node_ptr process(expression_generator&, + const details::operator_type&, + expression_node_ptr (&)[2]) + { + // ((v0 o0 (c0 o1 c1)) o2 v1) - Not possible + exprtk_debug(("((v0 o0 (c0 o1 c1)) o2 v1) - Not possible\n")); + return error_node(); + } + + static inline std::string id(expression_generator&, + const details::operator_type, + const details::operator_type, + const details::operator_type) + { + return "INVALID"; + } + }; + #endif + + inline expression_node_ptr synthesize_uvouv_expression(const details::operator_type& operation, expression_node_ptr (&branch)[2]) + { + // Definition: uv o uv + details::operator_type o0 = static_cast*>(branch[0])->operation(); + details::operator_type o1 = static_cast*>(branch[1])->operation(); + const Type& v0 = static_cast*>(branch[0])->v(); + const Type& v1 = static_cast*>(branch[1])->v(); + unary_functor_t u0 = reinterpret_cast (0); + unary_functor_t u1 = reinterpret_cast (0); + binary_functor_t f = reinterpret_cast(0); + + if (!valid_operator(o0,u0)) + return error_node(); + else if (!valid_operator(o1,u1)) + return error_node(); + else if (!valid_operator(operation,f)) + return error_node(); + + expression_node_ptr result = error_node(); + + if ( + (details::e_neg == o0) && + (details::e_neg == o1) + ) + { + switch (operation) + { + // (-v0 + -v1) --> -(v0 + v1) + case details::e_add : result = (*this)(details::e_neg, + node_allocator_-> + allocate_rr > >(v0, v1)); + exprtk_debug(("(-v0 + -v1) --> -(v0 + v1)\n")); + break; + + // (-v0 - -v1) --> (v1 - v0) + case details::e_sub : result = node_allocator_-> + allocate_rr > >(v1, v0); + exprtk_debug(("(-v0 - -v1) --> (v1 - v0)\n")); + break; + + // (-v0 * -v1) --> (v0 * v1) + case details::e_mul : result = node_allocator_-> + allocate_rr > >(v0, v1); + exprtk_debug(("(-v0 * -v1) --> (v0 * v1)\n")); + break; + + // (-v0 / -v1) --> (v0 / v1) + case details::e_div : result = node_allocator_-> + allocate_rr > >(v0, v1); + exprtk_debug(("(-v0 / -v1) --> (v0 / v1)\n")); + break; + + default : break; + } + } + + if (0 == result) + { + result = node_allocator_-> + allocate_rrrrr >(v0, v1, u0, u1, f); + } + + details::free_all_nodes(*node_allocator_,branch); + return result; + } + + #undef basic_opr_switch_statements + #undef extended_opr_switch_statements + #undef unary_opr_switch_statements + + #ifndef exprtk_disable_string_capabilities + + #define string_opr_switch_statements \ + case_stmt(details::e_lt , details::lt_op ) \ + case_stmt(details::e_lte , details::lte_op ) \ + case_stmt(details::e_gt , details::gt_op ) \ + case_stmt(details::e_gte , details::gte_op ) \ + case_stmt(details::e_eq , details::eq_op ) \ + case_stmt(details::e_ne , details::ne_op ) \ + case_stmt(details::e_in , details::in_op ) \ + case_stmt(details::e_like , details::like_op ) \ + case_stmt(details::e_ilike , details::ilike_op) \ + + template + inline expression_node_ptr synthesize_str_xrox_expression_impl(const details::operator_type& opr, + T0 s0, T1 s1, + range_t rp0) + { + switch (opr) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + allocate_ttt >,T0,T1> \ + (s0, s1, rp0); \ + + string_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + + template + inline expression_node_ptr synthesize_str_xoxr_expression_impl(const details::operator_type& opr, + T0 s0, T1 s1, + range_t rp1) + { + switch (opr) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + allocate_ttt >,T0,T1> \ + (s0, s1, rp1); \ + + string_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + + template + inline expression_node_ptr synthesize_str_xroxr_expression_impl(const details::operator_type& opr, + T0 s0, T1 s1, + range_t rp0, range_t rp1) + { + switch (opr) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + allocate_tttt >,T0,T1> \ + (s0, s1, rp0, rp1); \ + + string_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + + template + inline expression_node_ptr synthesize_sos_expression_impl(const details::operator_type& opr, T0 s0, T1 s1) + { + switch (opr) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + allocate_tt >,T0,T1>(s0, s1); \ + + string_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + + inline expression_node_ptr synthesize_sos_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + std::string& s0 = static_cast*>(branch[0])->ref(); + std::string& s1 = static_cast*>(branch[1])->ref(); + + return synthesize_sos_expression_impl(opr, s0, s1); + } + + inline expression_node_ptr synthesize_sros_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + std::string& s0 = static_cast*>(branch[0])->ref (); + std::string& s1 = static_cast*> (branch[1])->ref (); + range_t rp0 = static_cast*>(branch[0])->range(); + + static_cast*>(branch[0])->range_ref().clear(); + + details::free_node(*node_allocator_,branch[0]); + + return synthesize_str_xrox_expression_impl(opr, s0, s1, rp0); + } + + inline expression_node_ptr synthesize_sosr_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + std::string& s0 = static_cast*> (branch[0])->ref (); + std::string& s1 = static_cast*>(branch[1])->ref (); + range_t rp1 = static_cast*>(branch[1])->range(); + + static_cast*>(branch[1])->range_ref().clear(); + + details::free_node(*node_allocator_,branch[1]); + + return synthesize_str_xoxr_expression_impl(opr, s0, s1, rp1); + } + + inline expression_node_ptr synthesize_socsr_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + std::string& s0 = static_cast*> (branch[0])->ref (); + std::string s1 = static_cast*>(branch[1])->str (); + range_t rp1 = static_cast*>(branch[1])->range(); + + static_cast*>(branch[1])->range_ref().clear(); + + details::free_node(*node_allocator_,branch[1]); + + return synthesize_str_xoxr_expression_impl(opr, s0, s1, rp1); + } + + inline expression_node_ptr synthesize_srosr_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + std::string& s0 = static_cast*>(branch[0])->ref (); + std::string& s1 = static_cast*>(branch[1])->ref (); + range_t rp0 = static_cast*>(branch[0])->range(); + range_t rp1 = static_cast*>(branch[1])->range(); + + static_cast*>(branch[0])->range_ref().clear(); + static_cast*>(branch[1])->range_ref().clear(); + + details::free_node(*node_allocator_,branch[0]); + details::free_node(*node_allocator_,branch[1]); + + return synthesize_str_xroxr_expression_impl(opr, s0, s1, rp0, rp1); + } + + inline expression_node_ptr synthesize_socs_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + std::string& s0 = static_cast< details::stringvar_node*>(branch[0])->ref(); + std::string s1 = static_cast*>(branch[1])->str(); + + details::free_node(*node_allocator_,branch[1]); + + return synthesize_sos_expression_impl(opr, s0, s1); + } + + inline expression_node_ptr synthesize_csos_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + std::string s0 = static_cast*>(branch[0])->str(); + std::string& s1 = static_cast* >(branch[1])->ref(); + + details::free_node(*node_allocator_,branch[0]); + + return synthesize_sos_expression_impl(opr, s0, s1); + } + + inline expression_node_ptr synthesize_csosr_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + std::string s0 = static_cast*>(branch[0])->str (); + std::string& s1 = static_cast* >(branch[1])->ref (); + range_t rp1 = static_cast* >(branch[1])->range(); + + static_cast*>(branch[1])->range_ref().clear(); + + details::free_node(*node_allocator_,branch[0]); + details::free_node(*node_allocator_,branch[1]); + + return synthesize_str_xoxr_expression_impl(opr, s0, s1, rp1); + } + + inline expression_node_ptr synthesize_srocs_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + std::string& s0 = static_cast* >(branch[0])->ref (); + std::string s1 = static_cast*>(branch[1])->str (); + range_t rp0 = static_cast* >(branch[0])->range(); + + static_cast*>(branch[0])->range_ref().clear(); + + details::free_node(*node_allocator_,branch[0]); + details::free_node(*node_allocator_,branch[1]); + + return synthesize_str_xrox_expression_impl(opr, s0, s1, rp0); + } + + inline expression_node_ptr synthesize_srocsr_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + std::string& s0 = static_cast* >(branch[0])->ref (); + std::string s1 = static_cast*>(branch[1])->str (); + range_t rp0 = static_cast* >(branch[0])->range(); + range_t rp1 = static_cast*>(branch[1])->range(); + + static_cast*> (branch[0])->range_ref().clear(); + static_cast*>(branch[1])->range_ref().clear(); + + details::free_node(*node_allocator_,branch[0]); + details::free_node(*node_allocator_,branch[1]); + + return synthesize_str_xroxr_expression_impl(opr, s0, s1, rp0, rp1); + } + + inline expression_node_ptr synthesize_csocs_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + const std::string s0 = static_cast*>(branch[0])->str(); + const std::string s1 = static_cast*>(branch[1])->str(); + + expression_node_ptr result = error_node(); + + if (details::e_add == opr) + result = node_allocator_->allocate_c >(s0 + s1); + else if (details::e_in == opr) + result = node_allocator_->allocate_c >(details::in_op ::process(s0,s1)); + else if (details::e_like == opr) + result = node_allocator_->allocate_c >(details::like_op ::process(s0,s1)); + else if (details::e_ilike == opr) + result = node_allocator_->allocate_c >(details::ilike_op::process(s0,s1)); + else + { + expression_node_ptr temp = synthesize_sos_expression_impl(opr, s0, s1); + + const Type v = temp->value(); + + details::free_node(*node_allocator_,temp); + + result = node_allocator_->allocate(v); + } + + details::free_all_nodes(*node_allocator_,branch); + + return result; + } + + inline expression_node_ptr synthesize_csocsr_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + const std::string s0 = static_cast* >(branch[0])->str (); + std::string s1 = static_cast*>(branch[1])->str (); + range_t rp1 = static_cast*>(branch[1])->range(); + + static_cast*>(branch[1])->range_ref().clear(); + + details::free_node(*node_allocator_,branch[0]); + details::free_node(*node_allocator_,branch[1]); + + return synthesize_str_xoxr_expression_impl(opr, s0, s1, rp1); + } + + inline expression_node_ptr synthesize_csros_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + std::string s0 = static_cast*>(branch[0])->str (); + std::string& s1 = static_cast* >(branch[1])->ref (); + range_t rp0 = static_cast*>(branch[0])->range(); + + static_cast*>(branch[0])->range_ref().clear(); + + details::free_node(*node_allocator_,branch[0]); + + return synthesize_str_xrox_expression_impl(opr, s0, s1, rp0); + } + + inline expression_node_ptr synthesize_csrosr_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + const std::string s0 = static_cast*>(branch[0])->str (); + std::string& s1 = static_cast* >(branch[1])->ref (); + const range_t rp0 = static_cast*>(branch[0])->range(); + const range_t rp1 = static_cast* >(branch[1])->range(); + + static_cast*>(branch[0])->range_ref().clear(); + static_cast*> (branch[1])->range_ref().clear(); + + details::free_node(*node_allocator_,branch[0]); + details::free_node(*node_allocator_,branch[1]); + + return synthesize_str_xroxr_expression_impl(opr, s0, s1, rp0, rp1); + } + + inline expression_node_ptr synthesize_csrocs_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + const std::string s0 = static_cast*>(branch[0])->str (); + const std::string s1 = static_cast* >(branch[1])->str (); + const range_t rp0 = static_cast*>(branch[0])->range(); + + static_cast*>(branch[0])->range_ref().clear(); + + details::free_all_nodes(*node_allocator_,branch); + + return synthesize_str_xrox_expression_impl(opr, s0, s1, rp0); + } + + inline expression_node_ptr synthesize_csrocsr_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + const std::string s0 = static_cast*>(branch[0])->str (); + const std::string s1 = static_cast*>(branch[1])->str (); + const range_t rp0 = static_cast*>(branch[0])->range(); + const range_t rp1 = static_cast*>(branch[1])->range(); + + static_cast*>(branch[0])->range_ref().clear(); + static_cast*>(branch[1])->range_ref().clear(); + + details::free_all_nodes(*node_allocator_,branch); + + return synthesize_str_xroxr_expression_impl(opr, s0, s1, rp0, rp1); + } + + inline expression_node_ptr synthesize_strogen_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + switch (opr) + { + #define case_stmt(op0, op1) \ + case op0 : return node_allocator_-> \ + allocate_ttt > > \ + (opr, branch[0], branch[1]); \ + + string_opr_switch_statements + #undef case_stmt + default : return error_node(); + } + } + #endif + + #ifndef exprtk_disable_string_capabilities + inline expression_node_ptr synthesize_string_expression(const details::operator_type& opr, expression_node_ptr (&branch)[2]) + { + if ((0 == branch[0]) || (0 == branch[1])) + { + details::free_all_nodes(*node_allocator_,branch); + + return error_node(); + } + + const bool b0_is_s = details::is_string_node (branch[0]); + const bool b0_is_cs = details::is_const_string_node (branch[0]); + const bool b0_is_sr = details::is_string_range_node (branch[0]); + const bool b0_is_csr = details::is_const_string_range_node(branch[0]); + + const bool b1_is_s = details::is_string_node (branch[1]); + const bool b1_is_cs = details::is_const_string_node (branch[1]); + const bool b1_is_sr = details::is_string_range_node (branch[1]); + const bool b1_is_csr = details::is_const_string_range_node(branch[1]); + + const bool b0_is_gen = details::is_string_assignment_node (branch[0]) || + details::is_genricstring_range_node(branch[0]) || + details::is_string_concat_node (branch[0]) || + details::is_string_function_node (branch[0]) || + details::is_string_condition_node (branch[0]) || + details::is_string_ccondition_node (branch[0]) || + details::is_string_vararg_node (branch[0]) ; + + const bool b1_is_gen = details::is_string_assignment_node (branch[1]) || + details::is_genricstring_range_node(branch[1]) || + details::is_string_concat_node (branch[1]) || + details::is_string_function_node (branch[1]) || + details::is_string_condition_node (branch[1]) || + details::is_string_ccondition_node (branch[1]) || + details::is_string_vararg_node (branch[1]) ; + + if (details::e_add == opr) + { + if (!b0_is_cs || !b1_is_cs) + { + return synthesize_expression(opr,branch); + } + } + + if (b0_is_gen || b1_is_gen) + { + return synthesize_strogen_expression(opr,branch); + } + else if (b0_is_s) + { + if (b1_is_s ) return synthesize_sos_expression (opr,branch); + else if (b1_is_cs ) return synthesize_socs_expression (opr,branch); + else if (b1_is_sr ) return synthesize_sosr_expression (opr,branch); + else if (b1_is_csr) return synthesize_socsr_expression (opr,branch); + } + else if (b0_is_cs) + { + if (b1_is_s ) return synthesize_csos_expression (opr,branch); + else if (b1_is_cs ) return synthesize_csocs_expression (opr,branch); + else if (b1_is_sr ) return synthesize_csosr_expression (opr,branch); + else if (b1_is_csr) return synthesize_csocsr_expression(opr,branch); + } + else if (b0_is_sr) + { + if (b1_is_s ) return synthesize_sros_expression (opr,branch); + else if (b1_is_sr ) return synthesize_srosr_expression (opr,branch); + else if (b1_is_cs ) return synthesize_srocs_expression (opr,branch); + else if (b1_is_csr) return synthesize_srocsr_expression(opr,branch); + } + else if (b0_is_csr) + { + if (b1_is_s ) return synthesize_csros_expression (opr,branch); + else if (b1_is_sr ) return synthesize_csrosr_expression (opr,branch); + else if (b1_is_cs ) return synthesize_csrocs_expression (opr,branch); + else if (b1_is_csr) return synthesize_csrocsr_expression(opr,branch); + } + + return error_node(); + } + #else + inline expression_node_ptr synthesize_string_expression(const details::operator_type&, expression_node_ptr (&branch)[2]) + { + details::free_all_nodes(*node_allocator_,branch); + return error_node(); + } + #endif + + #ifndef exprtk_disable_string_capabilities + inline expression_node_ptr synthesize_string_expression(const details::operator_type& opr, expression_node_ptr (&branch)[3]) + { + if (details::e_inrange != opr) + return error_node(); + else if ((0 == branch[0]) || (0 == branch[1]) || (0 == branch[2])) + { + details::free_all_nodes(*node_allocator_,branch); + + return error_node(); + } + else if ( + details::is_const_string_node(branch[0]) && + details::is_const_string_node(branch[1]) && + details::is_const_string_node(branch[2]) + ) + { + const std::string s0 = static_cast*>(branch[0])->str(); + const std::string s1 = static_cast*>(branch[1])->str(); + const std::string s2 = static_cast*>(branch[2])->str(); + + const Type v = (((s0 <= s1) && (s1 <= s2)) ? Type(1) : Type(0)); + + details::free_all_nodes(*node_allocator_,branch); + + return node_allocator_->allocate_c >(v); + } + else if ( + details::is_string_node(branch[0]) && + details::is_string_node(branch[1]) && + details::is_string_node(branch[2]) + ) + { + std::string& s0 = static_cast*>(branch[0])->ref(); + std::string& s1 = static_cast*>(branch[1])->ref(); + std::string& s2 = static_cast*>(branch[2])->ref(); + + typedef typename details::sosos_node > inrange_t; + + return node_allocator_->allocate_type(s0, s1, s2); + } + else if ( + details::is_const_string_node(branch[0]) && + details::is_string_node(branch[1]) && + details::is_const_string_node(branch[2]) + ) + { + std::string s0 = static_cast*>(branch[0])->str(); + std::string& s1 = static_cast* >(branch[1])->ref(); + std::string s2 = static_cast*>(branch[2])->str(); + + typedef typename details::sosos_node > inrange_t; + + details::free_node(*node_allocator_,branch[0]); + details::free_node(*node_allocator_,branch[2]); + + return node_allocator_->allocate_type(s0, s1, s2); + } + else if ( + details::is_string_node(branch[0]) && + details::is_const_string_node(branch[1]) && + details::is_string_node(branch[2]) + ) + { + std::string& s0 = static_cast* >(branch[0])->ref(); + std::string s1 = static_cast*>(branch[1])->str(); + std::string& s2 = static_cast* >(branch[2])->ref(); + + typedef typename details::sosos_node > inrange_t; + + details::free_node(*node_allocator_,branch[1]); + + return node_allocator_->allocate_type(s0, s1, s2); + } + else if ( + details::is_string_node(branch[0]) && + details::is_string_node(branch[1]) && + details::is_const_string_node(branch[2]) + ) + { + std::string& s0 = static_cast* >(branch[0])->ref(); + std::string& s1 = static_cast* >(branch[1])->ref(); + std::string s2 = static_cast*>(branch[2])->str(); + + typedef typename details::sosos_node > inrange_t; + + details::free_node(*node_allocator_,branch[2]); + + return node_allocator_->allocate_type(s0, s1, s2); + } + else if ( + details::is_const_string_node(branch[0]) && + details:: is_string_node(branch[1]) && + details:: is_string_node(branch[2]) + ) + { + std::string s0 = static_cast*>(branch[0])->str(); + std::string& s1 = static_cast* >(branch[1])->ref(); + std::string& s2 = static_cast* >(branch[2])->ref(); + + typedef typename details::sosos_node > inrange_t; + + details::free_node(*node_allocator_,branch[0]); + + return node_allocator_->allocate_type(s0, s1, s2); + } + else + return error_node(); + } + #else + inline expression_node_ptr synthesize_string_expression(const details::operator_type&, expression_node_ptr (&branch)[3]) + { + details::free_all_nodes(*node_allocator_,branch); + return error_node(); + } + #endif + + inline expression_node_ptr synthesize_null_expression(const details::operator_type& operation, expression_node_ptr (&branch)[2]) + { + /* + Note: The following are the type promotion rules + that relate to operations that include 'null': + 0. null ==/!= null --> true false + 1. null operation null --> null + 2. x ==/!= null --> true/false + 3. null ==/!= x --> true/false + 4. x operation null --> x + 5. null operation x --> x + */ + + typedef typename details::null_eq_node nulleq_node_t; + + const bool b0_null = details::is_null_node(branch[0]); + const bool b1_null = details::is_null_node(branch[1]); + + if (b0_null && b1_null) + { + expression_node_ptr result = error_node(); + + if (details::e_eq == operation) + result = node_allocator_->allocate_c(T(1)); + else if (details::e_ne == operation) + result = node_allocator_->allocate_c(T(0)); + + if (result) + { + details::free_node(*node_allocator_,branch[0]); + details::free_node(*node_allocator_,branch[1]); + + return result; + } + + details::free_node(*node_allocator_,branch[1]); + + return branch[0]; + } + else if (details::e_eq == operation) + { + expression_node_ptr result = node_allocator_-> + allocate_rc(branch[b0_null ? 0 : 1],true); + + details::free_node(*node_allocator_,branch[b0_null ? 1 : 0]); + + return result; + } + else if (details::e_ne == operation) + { + expression_node_ptr result = node_allocator_-> + allocate_rc(branch[b0_null ? 0 : 1],false); + + details::free_node(*node_allocator_,branch[b0_null ? 1 : 0]); + + return result; + } + else if (b0_null) + { + details::free_node(*node_allocator_,branch[0]); + branch[0] = branch[1]; + branch[1] = error_node(); + } + else if (b1_null) + { + details::free_node(*node_allocator_,branch[1]); + branch[1] = error_node(); + } + + if ( + (details::e_add == operation) || (details::e_sub == operation) || + (details::e_mul == operation) || (details::e_div == operation) || + (details::e_mod == operation) || (details::e_pow == operation) + ) + { + return branch[0]; + } + + details::free_node(*node_allocator_, branch[0]); + + if ( + (details::e_lt == operation) || (details::e_lte == operation) || + (details::e_gt == operation) || (details::e_gte == operation) || + (details::e_and == operation) || (details::e_nand == operation) || + (details::e_or == operation) || (details::e_nor == operation) || + (details::e_xor == operation) || (details::e_xnor == operation) || + (details::e_in == operation) || (details::e_like == operation) || + (details::e_ilike == operation) + ) + { + return node_allocator_->allocate_c(T(0)); + } + + return node_allocator_->allocate >(); + } + + template + inline expression_node_ptr synthesize_expression(const details::operator_type& operation, expression_node_ptr (&branch)[N]) + { + if ( + (details::e_in == operation) || + (details::e_like == operation) || + (details::e_ilike == operation) + ) + { + free_all_nodes(*node_allocator_,branch); + + return error_node(); + } + else if (!details::all_nodes_valid(branch)) + { + free_all_nodes(*node_allocator_,branch); + + return error_node(); + } + else if ((details::e_default != operation)) + { + // Attempt simple constant folding optimisation. + expression_node_ptr expression_point = node_allocator_->allocate(operation,branch); + + if (is_constant_foldable(branch)) + { + const Type v = expression_point->value(); + details::free_node(*node_allocator_,expression_point); + + return node_allocator_->allocate(v); + } + else + return expression_point; + } + else + return error_node(); + } + + template + inline expression_node_ptr synthesize_expression(F* f, expression_node_ptr (&branch)[N]) + { + if (!details::all_nodes_valid(branch)) + { + free_all_nodes(*node_allocator_,branch); + + return error_node(); + } + + typedef typename details::function_N_node function_N_node_t; + + // Attempt simple constant folding optimisation. + + expression_node_ptr expression_point = node_allocator_->allocate(f); + function_N_node_t* func_node_ptr = dynamic_cast(expression_point); + + if (0 == func_node_ptr) + { + free_all_nodes(*node_allocator_,branch); + + return error_node(); + } + else + func_node_ptr->init_branches(branch); + + if (is_constant_foldable(branch) && !f->has_side_effects()) + { + Type v = expression_point->value(); + details::free_node(*node_allocator_,expression_point); + + return node_allocator_->allocate(v); + } + + parser_->state_.activate_side_effect("synthesize_expression(function)"); + + return expression_point; + } + + bool strength_reduction_enabled_; + details::node_allocator* node_allocator_; + synthesize_map_t synthesize_map_; + unary_op_map_t* unary_op_map_; + binary_op_map_t* binary_op_map_; + inv_binary_op_map_t* inv_binary_op_map_; + sf3_map_t* sf3_map_; + sf4_map_t* sf4_map_; + parser_t* parser_; + }; // class expression_generator + + inline void set_error(const parser_error::type& error_type) + { + error_list_.push_back(error_type); + } + + inline void remove_last_error() + { + if (!error_list_.empty()) + { + error_list_.pop_back(); + } + } + + inline void set_synthesis_error(const std::string& synthesis_error_message) + { + if (synthesis_error_.empty()) + { + synthesis_error_ = synthesis_error_message; + } + } + + inline void register_local_vars(expression& e) + { + for (std::size_t i = 0; i < sem_.size(); ++i) + { + scope_element& se = sem_.get_element(i); + + if ( + (scope_element::e_variable == se.type) || + (scope_element::e_vecelem == se.type) + ) + { + if (se.var_node) + { + e.register_local_var(se.var_node); + } + + if (se.data) + { + e.register_local_data(se.data, 1, 0); + } + } + else if (scope_element::e_vector == se.type) + { + if (se.vec_node) + { + e.register_local_var(se.vec_node); + } + + if (se.data) + { + e.register_local_data(se.data, se.size, 1); + } + } + #ifndef exprtk_disable_string_capabilities + else if (scope_element::e_string == se.type) + { + if (se.str_node) + { + e.register_local_var(se.str_node); + } + + if (se.data) + { + e.register_local_data(se.data, se.size, 2); + } + } + #endif + + se.var_node = 0; + se.vec_node = 0; + #ifndef exprtk_disable_string_capabilities + se.str_node = 0; + #endif + se.data = 0; + se.ref_count = 0; + se.active = false; + } + } + + inline void register_return_results(expression& e) + { + e.register_return_results(results_context_); + results_context_ = 0; + } + + inline void load_unary_operations_map(unary_op_map_t& m) + { + #define register_unary_op(Op, UnaryFunctor) \ + m.insert(std::make_pair(Op,UnaryFunctor::process)); \ + + register_unary_op(details::e_abs , details::abs_op ) + register_unary_op(details::e_acos , details::acos_op ) + register_unary_op(details::e_acosh , details::acosh_op) + register_unary_op(details::e_asin , details::asin_op ) + register_unary_op(details::e_asinh , details::asinh_op) + register_unary_op(details::e_atanh , details::atanh_op) + register_unary_op(details::e_ceil , details::ceil_op ) + register_unary_op(details::e_cos , details::cos_op ) + register_unary_op(details::e_cosh , details::cosh_op ) + register_unary_op(details::e_exp , details::exp_op ) + register_unary_op(details::e_expm1 , details::expm1_op) + register_unary_op(details::e_floor , details::floor_op) + register_unary_op(details::e_log , details::log_op ) + register_unary_op(details::e_log10 , details::log10_op) + register_unary_op(details::e_log2 , details::log2_op ) + register_unary_op(details::e_log1p , details::log1p_op) + register_unary_op(details::e_neg , details::neg_op ) + register_unary_op(details::e_pos , details::pos_op ) + register_unary_op(details::e_round , details::round_op) + register_unary_op(details::e_sin , details::sin_op ) + register_unary_op(details::e_sinc , details::sinc_op ) + register_unary_op(details::e_sinh , details::sinh_op ) + register_unary_op(details::e_sqrt , details::sqrt_op ) + register_unary_op(details::e_tan , details::tan_op ) + register_unary_op(details::e_tanh , details::tanh_op ) + register_unary_op(details::e_cot , details::cot_op ) + register_unary_op(details::e_sec , details::sec_op ) + register_unary_op(details::e_csc , details::csc_op ) + register_unary_op(details::e_r2d , details::r2d_op ) + register_unary_op(details::e_d2r , details::d2r_op ) + register_unary_op(details::e_d2g , details::d2g_op ) + register_unary_op(details::e_g2d , details::g2d_op ) + register_unary_op(details::e_notl , details::notl_op ) + register_unary_op(details::e_sgn , details::sgn_op ) + register_unary_op(details::e_erf , details::erf_op ) + register_unary_op(details::e_erfc , details::erfc_op ) + register_unary_op(details::e_ncdf , details::ncdf_op ) + register_unary_op(details::e_frac , details::frac_op ) + register_unary_op(details::e_trunc , details::trunc_op) + #undef register_unary_op + } + + inline void load_binary_operations_map(binary_op_map_t& m) + { + typedef typename binary_op_map_t::value_type value_type; + + #define register_binary_op(Op, BinaryFunctor) \ + m.insert(value_type(Op,BinaryFunctor::process)); \ + + register_binary_op(details::e_add , details::add_op ) + register_binary_op(details::e_sub , details::sub_op ) + register_binary_op(details::e_mul , details::mul_op ) + register_binary_op(details::e_div , details::div_op ) + register_binary_op(details::e_mod , details::mod_op ) + register_binary_op(details::e_pow , details::pow_op ) + register_binary_op(details::e_lt , details::lt_op ) + register_binary_op(details::e_lte , details::lte_op ) + register_binary_op(details::e_gt , details::gt_op ) + register_binary_op(details::e_gte , details::gte_op ) + register_binary_op(details::e_eq , details::eq_op ) + register_binary_op(details::e_ne , details::ne_op ) + register_binary_op(details::e_and , details::and_op ) + register_binary_op(details::e_nand , details::nand_op) + register_binary_op(details::e_or , details::or_op ) + register_binary_op(details::e_nor , details::nor_op ) + register_binary_op(details::e_xor , details::xor_op ) + register_binary_op(details::e_xnor , details::xnor_op) + #undef register_binary_op + } + + inline void load_inv_binary_operations_map(inv_binary_op_map_t& m) + { + typedef typename inv_binary_op_map_t::value_type value_type; + + #define register_binary_op(Op, BinaryFunctor) \ + m.insert(value_type(BinaryFunctor::process,Op)); \ + + register_binary_op(details::e_add , details::add_op ) + register_binary_op(details::e_sub , details::sub_op ) + register_binary_op(details::e_mul , details::mul_op ) + register_binary_op(details::e_div , details::div_op ) + register_binary_op(details::e_mod , details::mod_op ) + register_binary_op(details::e_pow , details::pow_op ) + register_binary_op(details::e_lt , details::lt_op ) + register_binary_op(details::e_lte , details::lte_op ) + register_binary_op(details::e_gt , details::gt_op ) + register_binary_op(details::e_gte , details::gte_op ) + register_binary_op(details::e_eq , details::eq_op ) + register_binary_op(details::e_ne , details::ne_op ) + register_binary_op(details::e_and , details::and_op ) + register_binary_op(details::e_nand , details::nand_op) + register_binary_op(details::e_or , details::or_op ) + register_binary_op(details::e_nor , details::nor_op ) + register_binary_op(details::e_xor , details::xor_op ) + register_binary_op(details::e_xnor , details::xnor_op) + #undef register_binary_op + } + + inline void load_sf3_map(sf3_map_t& sf3_map) + { + typedef std::pair pair_t; + + #define register_sf3(Op) \ + sf3_map[details::sf##Op##_op::id()] = pair_t(details::sf##Op##_op::process,details::e_sf##Op); \ + + register_sf3(00) register_sf3(01) register_sf3(02) register_sf3(03) + register_sf3(04) register_sf3(05) register_sf3(06) register_sf3(07) + register_sf3(08) register_sf3(09) register_sf3(10) register_sf3(11) + register_sf3(12) register_sf3(13) register_sf3(14) register_sf3(15) + register_sf3(16) register_sf3(17) register_sf3(18) register_sf3(19) + register_sf3(20) register_sf3(21) register_sf3(22) register_sf3(23) + register_sf3(24) register_sf3(25) register_sf3(26) register_sf3(27) + register_sf3(28) register_sf3(29) register_sf3(30) + #undef register_sf3 + + #define register_sf3_extid(Id, Op) \ + sf3_map[Id] = pair_t(details::sf##Op##_op::process,details::e_sf##Op); \ + + register_sf3_extid("(t-t)-t",23) // (t-t)-t --> t-(t+t) + #undef register_sf3_extid + } + + inline void load_sf4_map(sf4_map_t& sf4_map) + { + typedef std::pair pair_t; + + #define register_sf4(Op) \ + sf4_map[details::sf##Op##_op::id()] = pair_t(details::sf##Op##_op::process,details::e_sf##Op); \ + + register_sf4(48) register_sf4(49) register_sf4(50) register_sf4(51) + register_sf4(52) register_sf4(53) register_sf4(54) register_sf4(55) + register_sf4(56) register_sf4(57) register_sf4(58) register_sf4(59) + register_sf4(60) register_sf4(61) register_sf4(62) register_sf4(63) + register_sf4(64) register_sf4(65) register_sf4(66) register_sf4(67) + register_sf4(68) register_sf4(69) register_sf4(70) register_sf4(71) + register_sf4(72) register_sf4(73) register_sf4(74) register_sf4(75) + register_sf4(76) register_sf4(77) register_sf4(78) register_sf4(79) + register_sf4(80) register_sf4(81) register_sf4(82) register_sf4(83) + #undef register_sf4 + + #define register_sf4ext(Op) \ + sf4_map[details::sfext##Op##_op::id()] = pair_t(details::sfext##Op##_op::process,details::e_sf4ext##Op); \ + + register_sf4ext(00) register_sf4ext(01) register_sf4ext(02) register_sf4ext(03) + register_sf4ext(04) register_sf4ext(05) register_sf4ext(06) register_sf4ext(07) + register_sf4ext(08) register_sf4ext(09) register_sf4ext(10) register_sf4ext(11) + register_sf4ext(12) register_sf4ext(13) register_sf4ext(14) register_sf4ext(15) + register_sf4ext(16) register_sf4ext(17) register_sf4ext(18) register_sf4ext(19) + register_sf4ext(20) register_sf4ext(21) register_sf4ext(22) register_sf4ext(23) + register_sf4ext(24) register_sf4ext(25) register_sf4ext(26) register_sf4ext(27) + register_sf4ext(28) register_sf4ext(29) register_sf4ext(30) register_sf4ext(31) + register_sf4ext(32) register_sf4ext(33) register_sf4ext(34) register_sf4ext(35) + register_sf4ext(36) register_sf4ext(36) register_sf4ext(38) register_sf4ext(39) + register_sf4ext(40) register_sf4ext(41) register_sf4ext(42) register_sf4ext(43) + register_sf4ext(44) register_sf4ext(45) register_sf4ext(46) register_sf4ext(47) + register_sf4ext(48) register_sf4ext(49) register_sf4ext(50) register_sf4ext(51) + register_sf4ext(52) register_sf4ext(53) register_sf4ext(54) register_sf4ext(55) + register_sf4ext(56) register_sf4ext(57) register_sf4ext(58) register_sf4ext(59) + register_sf4ext(60) register_sf4ext(61) + #undef register_sf4ext + } + + inline results_context_t& results_ctx() + { + if (0 == results_context_) + { + results_context_ = new results_context_t(); + } + + return (*results_context_); + } + + inline void return_cleanup() + { + #ifndef exprtk_disable_return_statement + if (results_context_) + { + delete results_context_; + results_context_ = 0; + } + + state_.return_stmt_present = false; + #endif + } + + private: + + parser(const parser&) exprtk_delete; + parser& operator=(const parser&) exprtk_delete; + + settings_store settings_; + expression_generator expression_generator_; + details::node_allocator node_allocator_; + symtab_store symtab_store_; + dependent_entity_collector dec_; + std::deque error_list_; + std::deque brkcnt_list_; + parser_state state_; + bool resolve_unknown_symbol_; + results_context_t* results_context_; + unknown_symbol_resolver* unknown_symbol_resolver_; + unknown_symbol_resolver default_usr_; + base_ops_map_t base_ops_map_; + unary_op_map_t unary_op_map_; + binary_op_map_t binary_op_map_; + inv_binary_op_map_t inv_binary_op_map_; + sf3_map_t sf3_map_; + sf4_map_t sf4_map_; + std::string synthesis_error_; + scope_element_manager sem_; + + immutable_memory_map_t immutable_memory_map_; + immutable_symtok_map_t immutable_symtok_map_; + + lexer::helper::helper_assembly helper_assembly_; + + lexer::helper::commutative_inserter commutative_inserter_; + lexer::helper::operator_joiner operator_joiner_2_; + lexer::helper::operator_joiner operator_joiner_3_; + lexer::helper::symbol_replacer symbol_replacer_; + lexer::helper::bracket_checker bracket_checker_; + lexer::helper::numeric_checker numeric_checker_; + lexer::helper::sequence_validator sequence_validator_; + lexer::helper::sequence_validator_3tokens sequence_validator_3tkns_; + + loop_runtime_check_ptr loop_runtime_check_; + + template + friend void details::disable_type_checking(ParserType& p); + }; // class parser + + namespace details + { + template + struct collector_helper + { + typedef exprtk::symbol_table symbol_table_t; + typedef exprtk::expression expression_t; + typedef exprtk::parser parser_t; + typedef typename parser_t::dependent_entity_collector::symbol_t symbol_t; + typedef typename parser_t::unknown_symbol_resolver usr_t; + + struct resolve_as_vector : public parser_t::unknown_symbol_resolver + { + typedef exprtk::parser parser_t; + + resolve_as_vector() + : usr_t(usr_t::e_usrmode_extended) + {} + + virtual bool process(const std::string& unknown_symbol, + symbol_table_t& symbol_table, + std::string&) + { + static T v[1]; + symbol_table.add_vector(unknown_symbol,v); + return true; + } + }; + + static inline bool collection_pass(const std::string& expression_string, + std::set& symbol_set, + const bool collect_variables, + const bool collect_functions, + const bool vector_pass, + symbol_table_t& ext_symbol_table) + { + symbol_table_t symbol_table; + expression_t expression; + parser_t parser; + + resolve_as_vector vect_resolver; + + expression.register_symbol_table(symbol_table ); + expression.register_symbol_table(ext_symbol_table); + + if (vector_pass) + parser.enable_unknown_symbol_resolver(&vect_resolver); + else + parser.enable_unknown_symbol_resolver(); + + if (collect_variables) + parser.dec().collect_variables() = true; + + if (collect_functions) + parser.dec().collect_functions() = true; + + bool pass_result = false; + + details::disable_type_checking(parser); + + if (parser.compile(expression_string, expression)) + { + pass_result = true; + + std::deque symb_list; + parser.dec().symbols(symb_list); + + for (std::size_t i = 0; i < symb_list.size(); ++i) + { + symbol_set.insert(symb_list[i].first); + } + } + + return pass_result; + } + }; + } + + template class Sequence> + inline bool collect_variables(const std::string& expression, + Sequence& symbol_list) + { + typedef double T; + typedef details::collector_helper collect_t; + + collect_t::symbol_table_t null_symbol_table; + + std::set symbol_set; + + const bool variable_pass = collect_t::collection_pass + (expression, symbol_set, true, false, false, null_symbol_table); + const bool vector_pass = collect_t::collection_pass + (expression, symbol_set, true, false, true, null_symbol_table); + + if (!variable_pass && !vector_pass) + return false; + + std::set::iterator itr = symbol_set.begin(); + + while (symbol_set.end() != itr) + { + symbol_list.push_back(*itr); + ++itr; + } + + return true; + } + + template class Sequence> + inline bool collect_variables(const std::string& expression, + exprtk::symbol_table& extrnl_symbol_table, + Sequence& symbol_list) + { + typedef details::collector_helper collect_t; + + std::set symbol_set; + + const bool variable_pass = collect_t::collection_pass + (expression, symbol_set, true, false, false, extrnl_symbol_table); + const bool vector_pass = collect_t::collection_pass + (expression, symbol_set, true, false, true, extrnl_symbol_table); + + if (!variable_pass && !vector_pass) + return false; + + std::set::iterator itr = symbol_set.begin(); + + while (symbol_set.end() != itr) + { + symbol_list.push_back(*itr); + ++itr; + } + + return true; + } + + template class Sequence> + inline bool collect_functions(const std::string& expression, + Sequence& symbol_list) + { + typedef double T; + typedef details::collector_helper collect_t; + + collect_t::symbol_table_t null_symbol_table; + + std::set symbol_set; + + const bool variable_pass = collect_t::collection_pass + (expression, symbol_set, false, true, false, null_symbol_table); + const bool vector_pass = collect_t::collection_pass + (expression, symbol_set, false, true, true, null_symbol_table); + + if (!variable_pass && !vector_pass) + return false; + + std::set::iterator itr = symbol_set.begin(); + + while (symbol_set.end() != itr) + { + symbol_list.push_back(*itr); + ++itr; + } + + return true; + } + + template class Sequence> + inline bool collect_functions(const std::string& expression, + exprtk::symbol_table& extrnl_symbol_table, + Sequence& symbol_list) + { + typedef details::collector_helper collect_t; + + std::set symbol_set; + + const bool variable_pass = collect_t::collection_pass + (expression, symbol_set, false, true, false, extrnl_symbol_table); + const bool vector_pass = collect_t::collection_pass + (expression, symbol_set, false, true, true, extrnl_symbol_table); + + if (!variable_pass && !vector_pass) + return false; + + std::set::iterator itr = symbol_set.begin(); + + while (symbol_set.end() != itr) + { + symbol_list.push_back(*itr); + ++itr; + } + + return true; + } + + template + inline T integrate(const expression& e, + T& x, + const T& r0, const T& r1, + const std::size_t number_of_intervals = 1000000) + { + if (r0 > r1) + return T(0); + + const T h = (r1 - r0) / (T(2) * number_of_intervals); + T total_area = T(0); + + for (std::size_t i = 0; i < number_of_intervals; ++i) + { + x = r0 + T(2) * i * h; + const T y0 = e.value(); x += h; + const T y1 = e.value(); x += h; + const T y2 = e.value(); x += h; + total_area += h * (y0 + T(4) * y1 + y2) / T(3); + } + + return total_area; + } + + template + inline T integrate(const expression& e, + const std::string& variable_name, + const T& r0, const T& r1, + const std::size_t number_of_intervals = 1000000) + { + const symbol_table& sym_table = e.get_symbol_table(); + + if (!sym_table.valid()) + return std::numeric_limits::quiet_NaN(); + + details::variable_node* var = sym_table.get_variable(variable_name); + + if (var) + { + T& x = var->ref(); + const T x_original = x; + const T result = integrate(e, x, r0, r1, number_of_intervals); + x = x_original; + + return result; + } + else + return std::numeric_limits::quiet_NaN(); + } + + template + inline T derivative(const expression& e, + T& x, + const T& h = T(0.00000001)) + { + const T x_init = x; + const T _2h = T(2) * h; + + x = x_init + _2h; + const T y0 = e.value(); + x = x_init + h; + const T y1 = e.value(); + x = x_init - h; + const T y2 = e.value(); + x = x_init - _2h; + const T y3 = e.value(); + x = x_init; + + return (-y0 + T(8) * (y1 - y2) + y3) / (T(12) * h); + } + + template + inline T second_derivative(const expression& e, + T& x, + const T& h = T(0.00001)) + { + const T x_init = x; + const T _2h = T(2) * h; + + const T y = e.value(); + x = x_init + _2h; + const T y0 = e.value(); + x = x_init + h; + const T y1 = e.value(); + x = x_init - h; + const T y2 = e.value(); + x = x_init - _2h; + const T y3 = e.value(); + x = x_init; + + return (-y0 + T(16) * (y1 + y2) - T(30) * y - y3) / (T(12) * h * h); + } + + template + inline T third_derivative(const expression& e, + T& x, + const T& h = T(0.0001)) + { + const T x_init = x; + const T _2h = T(2) * h; + + x = x_init + _2h; + const T y0 = e.value(); + x = x_init + h; + const T y1 = e.value(); + x = x_init - h; + const T y2 = e.value(); + x = x_init - _2h; + const T y3 = e.value(); + x = x_init; + + return (y0 + T(2) * (y2 - y1) - y3) / (T(2) * h * h * h); + } + + template + inline T derivative(const expression& e, + const std::string& variable_name, + const T& h = T(0.00000001)) + { + const symbol_table& sym_table = e.get_symbol_table(); + + if (!sym_table.valid()) + { + return std::numeric_limits::quiet_NaN(); + } + + details::variable_node* var = sym_table.get_variable(variable_name); + + if (var) + { + T& x = var->ref(); + const T x_original = x; + const T result = derivative(e, x, h); + x = x_original; + + return result; + } + else + return std::numeric_limits::quiet_NaN(); + } + + template + inline T second_derivative(const expression& e, + const std::string& variable_name, + const T& h = T(0.00001)) + { + const symbol_table& sym_table = e.get_symbol_table(); + + if (!sym_table.valid()) + { + return std::numeric_limits::quiet_NaN(); + } + + details::variable_node* var = sym_table.get_variable(variable_name); + + if (var) + { + T& x = var->ref(); + const T x_original = x; + const T result = second_derivative(e, x, h); + x = x_original; + + return result; + } + else + return std::numeric_limits::quiet_NaN(); + } + + template + inline T third_derivative(const expression& e, + const std::string& variable_name, + const T& h = T(0.0001)) + { + const symbol_table& sym_table = e.get_symbol_table(); + + if (!sym_table.valid()) + { + return std::numeric_limits::quiet_NaN(); + } + + details::variable_node* var = sym_table.get_variable(variable_name); + + if (var) + { + T& x = var->ref(); + const T x_original = x; + const T result = third_derivative(e, x, h); + x = x_original; + + return result; + } + else + return std::numeric_limits::quiet_NaN(); + } + + /* + Note: The following 'compute' routines are simple helpers, + for quickly setting up the required pieces of code in order + to evaluate an expression. By virtue of how they operate + there will be an overhead with regards to their setup and + teardown and hence should not be used in time critical + sections of code. + Furthermore they only assume a small sub set of variables, + no string variables or user defined functions. + */ + template + inline bool compute(const std::string& expression_string, T& result) + { + // No variables + symbol_table symbol_table; + symbol_table.add_constants(); + + expression expression; + expression.register_symbol_table(symbol_table); + + parser parser; + + if (parser.compile(expression_string,expression)) + { + result = expression.value(); + + return true; + } + else + return false; + } + + template + inline bool compute(const std::string& expression_string, + const T& x, + T& result) + { + // Only 'x' + static const std::string x_var("x"); + + symbol_table symbol_table; + symbol_table.add_constants(); + symbol_table.add_constant(x_var,x); + + expression expression; + expression.register_symbol_table(symbol_table); + + parser parser; + + if (parser.compile(expression_string,expression)) + { + result = expression.value(); + + return true; + } + else + return false; + } + + template + inline bool compute(const std::string& expression_string, + const T&x, const T& y, + T& result) + { + // Only 'x' and 'y' + static const std::string x_var("x"); + static const std::string y_var("y"); + + symbol_table symbol_table; + symbol_table.add_constants(); + symbol_table.add_constant(x_var,x); + symbol_table.add_constant(y_var,y); + + expression expression; + expression.register_symbol_table(symbol_table); + + parser parser; + + if (parser.compile(expression_string,expression)) + { + result = expression.value(); + + return true; + } + else + return false; + } + + template + inline bool compute(const std::string& expression_string, + const T& x, const T& y, const T& z, + T& result) + { + // Only 'x', 'y' or 'z' + static const std::string x_var("x"); + static const std::string y_var("y"); + static const std::string z_var("z"); + + symbol_table symbol_table; + symbol_table.add_constants(); + symbol_table.add_constant(x_var,x); + symbol_table.add_constant(y_var,y); + symbol_table.add_constant(z_var,z); + + expression expression; + expression.register_symbol_table(symbol_table); + + parser parser; + + if (parser.compile(expression_string,expression)) + { + result = expression.value(); + + return true; + } + else + return false; + } + + template + class polynomial : public ifunction + { + private: + + template + struct poly_impl { }; + + template + struct poly_impl + { + static inline T evaluate(const Type x, + const Type c12, const Type c11, const Type c10, const Type c9, const Type c8, + const Type c7, const Type c6, const Type c5, const Type c4, const Type c3, + const Type c2, const Type c1, const Type c0) + { + // p(x) = c_12x^12 + c_11x^11 + c_10x^10 + c_9x^9 + c_8x^8 + c_7x^7 + c_6x^6 + c_5x^5 + c_4x^4 + c_3x^3 + c_2x^2 + c_1x^1 + c_0x^0 + return ((((((((((((c12 * x + c11) * x + c10) * x + c9) * x + c8) * x + c7) * x + c6) * x + c5) * x + c4) * x + c3) * x + c2) * x + c1) * x + c0); + } + }; + + template + struct poly_impl + { + static inline T evaluate(const Type x, + const Type c11, const Type c10, const Type c9, const Type c8, const Type c7, + const Type c6, const Type c5, const Type c4, const Type c3, const Type c2, + const Type c1, const Type c0) + { + // p(x) = c_11x^11 + c_10x^10 + c_9x^9 + c_8x^8 + c_7x^7 + c_6x^6 + c_5x^5 + c_4x^4 + c_3x^3 + c_2x^2 + c_1x^1 + c_0x^0 + return (((((((((((c11 * x + c10) * x + c9) * x + c8) * x + c7) * x + c6) * x + c5) * x + c4) * x + c3) * x + c2) * x + c1) * x + c0); + } + }; + + template + struct poly_impl + { + static inline T evaluate(const Type x, + const Type c10, const Type c9, const Type c8, const Type c7, const Type c6, + const Type c5, const Type c4, const Type c3, const Type c2, const Type c1, + const Type c0) + { + // p(x) = c_10x^10 + c_9x^9 + c_8x^8 + c_7x^7 + c_6x^6 + c_5x^5 + c_4x^4 + c_3x^3 + c_2x^2 + c_1x^1 + c_0x^0 + return ((((((((((c10 * x + c9) * x + c8) * x + c7) * x + c6) * x + c5) * x + c4) * x + c3) * x + c2) * x + c1) * x + c0); + } + }; + + template + struct poly_impl + { + static inline T evaluate(const Type x, + const Type c9, const Type c8, const Type c7, const Type c6, const Type c5, + const Type c4, const Type c3, const Type c2, const Type c1, const Type c0) + { + // p(x) = c_9x^9 + c_8x^8 + c_7x^7 + c_6x^6 + c_5x^5 + c_4x^4 + c_3x^3 + c_2x^2 + c_1x^1 + c_0x^0 + return (((((((((c9 * x + c8) * x + c7) * x + c6) * x + c5) * x + c4) * x + c3) * x + c2) * x + c1) * x + c0); + } + }; + + template + struct poly_impl + { + static inline T evaluate(const Type x, + const Type c8, const Type c7, const Type c6, const Type c5, const Type c4, + const Type c3, const Type c2, const Type c1, const Type c0) + { + // p(x) = c_8x^8 + c_7x^7 + c_6x^6 + c_5x^5 + c_4x^4 + c_3x^3 + c_2x^2 + c_1x^1 + c_0x^0 + return ((((((((c8 * x + c7) * x + c6) * x + c5) * x + c4) * x + c3) * x + c2) * x + c1) * x + c0); + } + }; + + template + struct poly_impl + { + static inline T evaluate(const Type x, + const Type c7, const Type c6, const Type c5, const Type c4, const Type c3, + const Type c2, const Type c1, const Type c0) + { + // p(x) = c_7x^7 + c_6x^6 + c_5x^5 + c_4x^4 + c_3x^3 + c_2x^2 + c_1x^1 + c_0x^0 + return (((((((c7 * x + c6) * x + c5) * x + c4) * x + c3) * x + c2) * x + c1) * x + c0); + } + }; + + template + struct poly_impl + { + static inline T evaluate(const Type x, + const Type c6, const Type c5, const Type c4, const Type c3, const Type c2, + const Type c1, const Type c0) + { + // p(x) = c_6x^6 + c_5x^5 + c_4x^4 + c_3x^3 + c_2x^2 + c_1x^1 + c_0x^0 + return ((((((c6 * x + c5) * x + c4) * x + c3) * x + c2) * x + c1) * x + c0); + } + }; + + template + struct poly_impl + { + static inline T evaluate(const Type x, + const Type c5, const Type c4, const Type c3, const Type c2, + const Type c1, const Type c0) + { + // p(x) = c_5x^5 + c_4x^4 + c_3x^3 + c_2x^2 + c_1x^1 + c_0x^0 + return (((((c5 * x + c4) * x + c3) * x + c2) * x + c1) * x + c0); + } + }; + + template + struct poly_impl + { + static inline T evaluate(const Type x, const Type c4, const Type c3, const Type c2, const Type c1, const Type c0) + { + // p(x) = c_4x^4 + c_3x^3 + c_2x^2 + c_1x^1 + c_0x^0 + return ((((c4 * x + c3) * x + c2) * x + c1) * x + c0); + } + }; + + template + struct poly_impl + { + static inline T evaluate(const Type x, const Type c3, const Type c2, const Type c1, const Type c0) + { + // p(x) = c_3x^3 + c_2x^2 + c_1x^1 + c_0x^0 + return (((c3 * x + c2) * x + c1) * x + c0); + } + }; + + template + struct poly_impl + { + static inline T evaluate(const Type x, const Type c2, const Type c1, const Type c0) + { + // p(x) = c_2x^2 + c_1x^1 + c_0x^0 + return ((c2 * x + c1) * x + c0); + } + }; + + template + struct poly_impl + { + static inline T evaluate(const Type x, const Type c1, const Type c0) + { + // p(x) = c_1x^1 + c_0x^0 + return (c1 * x + c0); + } + }; + + public: + + using ifunction::operator(); + + polynomial() + : ifunction((N+2 <= 20) ? (N + 2) : std::numeric_limits::max()) + { + disable_has_side_effects(*this); + } + + virtual ~polynomial() {} + + #define poly_rtrn(NN) \ + return (NN != N) ? std::numeric_limits::quiet_NaN() : + + inline virtual T operator() (const T& x, const T& c1, const T& c0) + { + poly_rtrn(1) (poly_impl::evaluate(x, c1, c0)); + } + + inline virtual T operator() (const T& x, const T& c2, const T& c1, const T& c0) + { + poly_rtrn(2) (poly_impl::evaluate(x, c2, c1, c0)); + } + + inline virtual T operator() (const T& x, const T& c3, const T& c2, const T& c1, const T& c0) + { + poly_rtrn(3) (poly_impl::evaluate(x, c3, c2, c1, c0)); + } + + inline virtual T operator() (const T& x, const T& c4, const T& c3, const T& c2, const T& c1, + const T& c0) + { + poly_rtrn(4) (poly_impl::evaluate(x, c4, c3, c2, c1, c0)); + } + + inline virtual T operator() (const T& x, const T& c5, const T& c4, const T& c3, const T& c2, + const T& c1, const T& c0) + { + poly_rtrn(5) (poly_impl::evaluate(x, c5, c4, c3, c2, c1, c0)); + } + + inline virtual T operator() (const T& x, const T& c6, const T& c5, const T& c4, const T& c3, + const T& c2, const T& c1, const T& c0) + { + poly_rtrn(6) (poly_impl::evaluate(x, c6, c5, c4, c3, c2, c1, c0)); + } + + inline virtual T operator() (const T& x, const T& c7, const T& c6, const T& c5, const T& c4, + const T& c3, const T& c2, const T& c1, const T& c0) + { + poly_rtrn(7) (poly_impl::evaluate(x, c7, c6, c5, c4, c3, c2, c1, c0)); + } + + inline virtual T operator() (const T& x, const T& c8, const T& c7, const T& c6, const T& c5, + const T& c4, const T& c3, const T& c2, const T& c1, const T& c0) + { + poly_rtrn(8) (poly_impl::evaluate(x, c8, c7, c6, c5, c4, c3, c2, c1, c0)); + } + + inline virtual T operator() (const T& x, const T& c9, const T& c8, const T& c7, const T& c6, + const T& c5, const T& c4, const T& c3, const T& c2, const T& c1, + const T& c0) + { + poly_rtrn(9) (poly_impl::evaluate(x, c9, c8, c7, c6, c5, c4, c3, c2, c1, c0)); + } + + inline virtual T operator() (const T& x, const T& c10, const T& c9, const T& c8, const T& c7, + const T& c6, const T& c5, const T& c4, const T& c3, const T& c2, + const T& c1, const T& c0) + { + poly_rtrn(10) (poly_impl::evaluate(x, c10, c9, c8, c7, c6, c5, c4, c3, c2, c1, c0)); + } + + inline virtual T operator() (const T& x, const T& c11, const T& c10, const T& c9, const T& c8, + const T& c7, const T& c6, const T& c5, const T& c4, const T& c3, + const T& c2, const T& c1, const T& c0) + { + poly_rtrn(11) (poly_impl::evaluate(x, c11, c10, c9, c8, c7, c6, c5, c4, c3, c2, c1, c0)); + } + + inline virtual T operator() (const T& x, const T& c12, const T& c11, const T& c10, const T& c9, + const T& c8, const T& c7, const T& c6, const T& c5, const T& c4, + const T& c3, const T& c2, const T& c1, const T& c0) + { + poly_rtrn(12) (poly_impl::evaluate(x, c12, c11, c10, c9, c8, c7, c6, c5, c4, c3, c2, c1, c0)); + } + + #undef poly_rtrn + + inline virtual T operator() () + { + return std::numeric_limits::quiet_NaN(); + } + + inline virtual T operator() (const T&) + { + return std::numeric_limits::quiet_NaN(); + } + + inline virtual T operator() (const T&, const T&) + { + return std::numeric_limits::quiet_NaN(); + } + }; + + template + class function_compositor + { + public: + + typedef exprtk::expression expression_t; + typedef exprtk::symbol_table symbol_table_t; + typedef exprtk::parser parser_t; + typedef typename parser_t::settings_store settings_t; + + struct function + { + function() + {} + + function(const std::string& n) + : name_(n) + {} + + function(const std::string& name, + const std::string& expression) + : name_(name) + , expression_(expression) + {} + + function(const std::string& name, + const std::string& expression, + const std::string& v0) + : name_(name) + , expression_(expression) + { + v_.push_back(v0); + } + + function(const std::string& name, + const std::string& expression, + const std::string& v0, const std::string& v1) + : name_(name) + , expression_(expression) + { + v_.push_back(v0); v_.push_back(v1); + } + + function(const std::string& name, + const std::string& expression, + const std::string& v0, const std::string& v1, + const std::string& v2) + : name_(name) + , expression_(expression) + { + v_.push_back(v0); v_.push_back(v1); + v_.push_back(v2); + } + + function(const std::string& name, + const std::string& expression, + const std::string& v0, const std::string& v1, + const std::string& v2, const std::string& v3) + : name_(name) + , expression_(expression) + { + v_.push_back(v0); v_.push_back(v1); + v_.push_back(v2); v_.push_back(v3); + } + + function(const std::string& name, + const std::string& expression, + const std::string& v0, const std::string& v1, + const std::string& v2, const std::string& v3, + const std::string& v4) + : name_(name) + , expression_(expression) + { + v_.push_back(v0); v_.push_back(v1); + v_.push_back(v2); v_.push_back(v3); + v_.push_back(v4); + } + + inline function& name(const std::string& n) + { + name_ = n; + return (*this); + } + + inline function& expression(const std::string& e) + { + expression_ = e; + return (*this); + } + + inline function& var(const std::string& v) + { + v_.push_back(v); + return (*this); + } + + std::string name_; + std::string expression_; + std::deque v_; + }; + + private: + + struct base_func : public exprtk::ifunction + { + typedef const T& type; + typedef exprtk::ifunction function_t; + typedef std::vector varref_t; + typedef std::vector var_t; + typedef std::pair lvarref_t; + typedef std::vector lvr_vec_t; + + using exprtk::ifunction::operator(); + + base_func(const std::size_t& pc = 0) + : exprtk::ifunction(pc) + , local_var_stack_size(0) + , stack_depth(0) + { + v.resize(pc); + } + + virtual ~base_func() {} + + #define exprtk_assign(Index) \ + (*v[Index]) = v##Index; \ + + inline void update(const T& v0) + { + exprtk_assign(0) + } + + inline void update(const T& v0, const T& v1) + { + exprtk_assign(0) exprtk_assign(1) + } + + inline void update(const T& v0, const T& v1, const T& v2) + { + exprtk_assign(0) exprtk_assign(1) + exprtk_assign(2) + } + + inline void update(const T& v0, const T& v1, const T& v2, const T& v3) + { + exprtk_assign(0) exprtk_assign(1) + exprtk_assign(2) exprtk_assign(3) + } + + inline void update(const T& v0, const T& v1, const T& v2, const T& v3, const T& v4) + { + exprtk_assign(0) exprtk_assign(1) + exprtk_assign(2) exprtk_assign(3) + exprtk_assign(4) + } + + inline void update(const T& v0, const T& v1, const T& v2, const T& v3, const T& v4, const T& v5) + { + exprtk_assign(0) exprtk_assign(1) + exprtk_assign(2) exprtk_assign(3) + exprtk_assign(4) exprtk_assign(5) + } + + #ifdef exprtk_assign + #undef exprtk_assign + #endif + + inline function_t& setup(expression_t& expr) + { + expression = expr; + + typedef typename expression_t::control_block::local_data_list_t ldl_t; + + const ldl_t ldl = expr.local_data_list(); + + std::vector index_list; + + for (std::size_t i = 0; i < ldl.size(); ++i) + { + if (ldl[i].size) + { + index_list.push_back(i); + } + } + + std::size_t input_param_count = 0; + + for (std::size_t i = 0; i < index_list.size(); ++i) + { + const std::size_t index = index_list[i]; + + if (i < (index_list.size() - v.size())) + { + lv.push_back( + std::make_pair( + reinterpret_cast(ldl[index].pointer), + ldl[index].size)); + + local_var_stack_size += ldl[index].size; + } + else + v[input_param_count++] = reinterpret_cast(ldl[index].pointer); + } + + clear_stack(); + + return (*this); + } + + inline void pre() + { + if (stack_depth++) + { + if (!v.empty()) + { + var_t var_stack(v.size(),T(0)); + copy(v,var_stack); + param_stack.push_back(var_stack); + } + + if (!lv.empty()) + { + var_t local_var_stack(local_var_stack_size,T(0)); + copy(lv,local_var_stack); + local_stack.push_back(local_var_stack); + } + } + } + + inline void post() + { + if (--stack_depth) + { + if (!v.empty()) + { + copy(param_stack.back(),v); + param_stack.pop_back(); + } + + if (!lv.empty()) + { + copy(local_stack.back(),lv); + local_stack.pop_back(); + } + } + } + + void copy(const varref_t& src_v, var_t& dest_v) + { + for (std::size_t i = 0; i < src_v.size(); ++i) + { + dest_v[i] = (*src_v[i]); + } + } + + void copy(const var_t& src_v, varref_t& dest_v) + { + for (std::size_t i = 0; i < src_v.size(); ++i) + { + (*dest_v[i]) = src_v[i]; + } + } + + void copy(const lvr_vec_t& src_v, var_t& dest_v) + { + typename var_t::iterator itr = dest_v.begin(); + typedef typename std::iterator_traits::difference_type diff_t; + + for (std::size_t i = 0; i < src_v.size(); ++i) + { + lvarref_t vr = src_v[i]; + + if (1 == vr.second) + *itr++ = (*vr.first); + else + { + std::copy(vr.first, vr.first + vr.second, itr); + itr += static_cast(vr.second); + } + } + } + + void copy(const var_t& src_v, lvr_vec_t& dest_v) + { + typename var_t::const_iterator itr = src_v.begin(); + typedef typename std::iterator_traits::difference_type diff_t; + + for (std::size_t i = 0; i < src_v.size(); ++i) + { + lvarref_t vr = dest_v[i]; + + if (1 == vr.second) + (*vr.first) = *itr++; + else + { + std::copy(itr, itr + static_cast(vr.second), vr.first); + itr += static_cast(vr.second); + } + } + } + + inline void clear_stack() + { + for (std::size_t i = 0; i < v.size(); ++i) + { + (*v[i]) = 0; + } + } + + inline virtual T value(expression_t& e) + { + return e.value(); + } + + expression_t expression; + varref_t v; + lvr_vec_t lv; + std::size_t local_var_stack_size; + std::size_t stack_depth; + std::deque param_stack; + std::deque local_stack; + }; + + typedef std::map funcparam_t; + + struct func_0param : public base_func + { + using exprtk::ifunction::operator(); + + func_0param() : base_func(0) {} + + inline T operator() () + { + return this->value(base_func::expression); + } + }; + + typedef const T& type; + + template + struct scoped_bft + { + explicit scoped_bft(BaseFuncType& bft) + : bft_(bft) + { + bft_.pre (); + } + + ~scoped_bft() + { + bft_.post(); + } + + BaseFuncType& bft_; + + private: + + scoped_bft(const scoped_bft&) exprtk_delete; + scoped_bft& operator=(const scoped_bft&) exprtk_delete; + }; + + struct func_1param : public base_func + { + using exprtk::ifunction::operator(); + + func_1param() : base_func(1) {} + + inline T operator() (type v0) + { + scoped_bft sb(*this); + base_func::update(v0); + return this->value(base_func::expression); + } + }; + + struct func_2param : public base_func + { + using exprtk::ifunction::operator(); + + func_2param() : base_func(2) {} + + inline T operator() (type v0, type v1) + { + scoped_bft sb(*this); + base_func::update(v0, v1); + return this->value(base_func::expression); + } + }; + + struct func_3param : public base_func + { + using exprtk::ifunction::operator(); + + func_3param() : base_func(3) {} + + inline T operator() (type v0, type v1, type v2) + { + scoped_bft sb(*this); + base_func::update(v0, v1, v2); + return this->value(base_func::expression); + } + }; + + struct func_4param : public base_func + { + using exprtk::ifunction::operator(); + + func_4param() : base_func(4) {} + + inline T operator() (type v0, type v1, type v2, type v3) + { + scoped_bft sb(*this); + base_func::update(v0, v1, v2, v3); + return this->value(base_func::expression); + } + }; + + struct func_5param : public base_func + { + using exprtk::ifunction::operator(); + + func_5param() : base_func(5) {} + + inline T operator() (type v0, type v1, type v2, type v3, type v4) + { + scoped_bft sb(*this); + base_func::update(v0, v1, v2, v3, v4); + return this->value(base_func::expression); + } + }; + + struct func_6param : public base_func + { + using exprtk::ifunction::operator(); + + func_6param() : base_func(6) {} + + inline T operator() (type v0, type v1, type v2, type v3, type v4, type v5) + { + scoped_bft sb(*this); + base_func::update(v0, v1, v2, v3, v4, v5); + return this->value(base_func::expression); + } + }; + + static T return_value(expression_t& e) + { + typedef exprtk::results_context results_context_t; + typedef typename results_context_t::type_store_t type_t; + typedef typename type_t::scalar_view scalar_t; + + const T result = e.value(); + + if (e.return_invoked()) + { + // Due to the post compilation checks, it can be safely + // assumed that there will be at least one parameter + // and that the first parameter will always be scalar. + return scalar_t(e.results()[0])(); + } + + return result; + } + + #define def_fp_retval(N) \ + struct func_##N##param_retval : public func_##N##param \ + { \ + inline T value(expression_t& e) \ + { \ + return return_value(e); \ + } \ + }; \ + + def_fp_retval(0) + def_fp_retval(1) + def_fp_retval(2) + def_fp_retval(3) + def_fp_retval(4) + def_fp_retval(5) + def_fp_retval(6) + + template class Sequence> + inline bool add(const std::string& name, + const std::string& expression, + const Sequence& var_list, + const bool override = false) + { + const typename std::map::iterator itr = expr_map_.find(name); + + if (expr_map_.end() != itr) + { + if (!override) + { + exprtk_debug(("Compositor error(add): function '%s' already defined\n", + name.c_str())); + + return false; + } + + remove(name, var_list.size()); + } + + if (compile_expression(name, expression, var_list)) + { + const std::size_t n = var_list.size(); + + fp_map_[n][name]->setup(expr_map_[name]); + + return true; + } + else + { + exprtk_debug(("Compositor error(add): Failed to compile function '%s'\n", + name.c_str())); + + return false; + } + } + + public: + + function_compositor() + : parser_(settings_t::compile_all_opts + + settings_t::e_disable_zero_return) + , fp_map_(7) + {} + + function_compositor(const symbol_table_t& st) + : symbol_table_(st) + , parser_(settings_t::compile_all_opts + + settings_t::e_disable_zero_return) + , fp_map_(7) + {} + + ~function_compositor() + { + clear(); + } + + inline symbol_table_t& symbol_table() + { + return symbol_table_; + } + + inline const symbol_table_t& symbol_table() const + { + return symbol_table_; + } + + inline void add_auxiliary_symtab(symbol_table_t& symtab) + { + auxiliary_symtab_list_.push_back(&symtab); + } + + void clear() + { + symbol_table_.clear(); + expr_map_ .clear(); + + for (std::size_t i = 0; i < fp_map_.size(); ++i) + { + typename funcparam_t::iterator itr = fp_map_[i].begin(); + typename funcparam_t::iterator end = fp_map_[i].end (); + + while (itr != end) + { + delete itr->second; + ++itr; + } + + fp_map_[i].clear(); + } + } + + inline bool add(const function& f, const bool override = false) + { + return add(f.name_, f.expression_, f.v_,override); + } + + private: + + template class Sequence> + bool compile_expression(const std::string& name, + const std::string& expression, + const Sequence& input_var_list, + bool return_present = false) + { + expression_t compiled_expression; + symbol_table_t local_symbol_table; + + local_symbol_table.load_from(symbol_table_); + local_symbol_table.add_constants(); + + if (!valid(name,input_var_list.size())) + return false; + + if (!forward(name, + input_var_list.size(), + local_symbol_table, + return_present)) + return false; + + compiled_expression.register_symbol_table(local_symbol_table); + + for (std::size_t i = 0; i < auxiliary_symtab_list_.size(); ++i) + { + compiled_expression.register_symbol_table((*auxiliary_symtab_list_[i])); + } + + std::string mod_expression; + + for (std::size_t i = 0; i < input_var_list.size(); ++i) + { + mod_expression += " var " + input_var_list[i] + "{};\n"; + } + + if ( + ('{' == details::front(expression)) && + ('}' == details::back (expression)) + ) + mod_expression += "~" + expression + ";"; + else + mod_expression += "~{" + expression + "};"; + + if (!parser_.compile(mod_expression,compiled_expression)) + { + exprtk_debug(("Compositor Error: %s\n",parser_.error().c_str())); + exprtk_debug(("Compositor modified expression: \n%s\n",mod_expression.c_str())); + + remove(name,input_var_list.size()); + + return false; + } + + if (!return_present && parser_.dec().return_present()) + { + remove(name,input_var_list.size()); + + return compile_expression(name, expression, input_var_list, true); + } + + // Make sure every return point has a scalar as its first parameter + if (parser_.dec().return_present()) + { + typedef std::vector str_list_t; + + str_list_t ret_param_list = parser_.dec().return_param_type_list(); + + for (std::size_t i = 0; i < ret_param_list.size(); ++i) + { + const std::string& params = ret_param_list[i]; + + if (params.empty() || ('T' != params[0])) + { + exprtk_debug(("Compositor Error: Return statement in function '%s' is invalid\n", + name.c_str())); + + remove(name,input_var_list.size()); + + return false; + } + } + } + + expr_map_[name] = compiled_expression; + + exprtk::ifunction& ifunc = (*(fp_map_[input_var_list.size()])[name]); + + if (symbol_table_.add_function(name,ifunc)) + return true; + else + { + exprtk_debug(("Compositor Error: Failed to add function '%s' to symbol table\n", + name.c_str())); + return false; + } + } + + inline bool symbol_used(const std::string& symbol) const + { + return ( + symbol_table_.is_variable (symbol) || + symbol_table_.is_stringvar (symbol) || + symbol_table_.is_function (symbol) || + symbol_table_.is_vector (symbol) || + symbol_table_.is_vararg_function(symbol) + ); + } + + inline bool valid(const std::string& name, + const std::size_t& arg_count) const + { + if (arg_count > 6) + return false; + else if (symbol_used(name)) + return false; + else if (fp_map_[arg_count].end() != fp_map_[arg_count].find(name)) + return false; + else + return true; + } + + inline bool forward(const std::string& name, + const std::size_t& arg_count, + symbol_table_t& sym_table, + const bool ret_present = false) + { + switch (arg_count) + { + #define case_stmt(N) \ + case N : (fp_map_[arg_count])[name] = \ + (!ret_present) ? static_cast \ + (new func_##N##param) : \ + static_cast \ + (new func_##N##param_retval) ; \ + break; \ + + case_stmt(0) case_stmt(1) case_stmt(2) + case_stmt(3) case_stmt(4) case_stmt(5) + case_stmt(6) + #undef case_stmt + } + + exprtk::ifunction& ifunc = (*(fp_map_[arg_count])[name]); + + return sym_table.add_function(name,ifunc); + } + + inline void remove(const std::string& name, const std::size_t& arg_count) + { + if (arg_count > 6) + return; + + const typename std::map::iterator em_itr = expr_map_.find(name); + + if (expr_map_.end() != em_itr) + { + expr_map_.erase(em_itr); + } + + const typename funcparam_t::iterator fp_itr = fp_map_[arg_count].find(name); + + if (fp_map_[arg_count].end() != fp_itr) + { + delete fp_itr->second; + fp_map_[arg_count].erase(fp_itr); + } + + symbol_table_.remove_function(name); + } + + private: + + symbol_table_t symbol_table_; + parser_t parser_; + std::map expr_map_; + std::vector fp_map_; + std::vector auxiliary_symtab_list_; + }; // class function_compositor + +} // namespace exprtk + +#if defined(_WIN32) || defined(__WIN32__) || defined(WIN32) +# ifndef NOMINMAX +# define NOMINMAX +# endif +# ifndef WIN32_LEAN_AND_MEAN +# define WIN32_LEAN_AND_MEAN +# endif +# include +# include +#else +# include +# include +# include +#endif + +namespace exprtk +{ + class timer + { + public: + + #if defined(_WIN32) || defined(__WIN32__) || defined(WIN32) + timer() + : in_use_(false) + { + QueryPerformanceFrequency(&clock_frequency_); + } + + inline void start() + { + in_use_ = true; + QueryPerformanceCounter(&start_time_); + } + + inline void stop() + { + QueryPerformanceCounter(&stop_time_); + in_use_ = false; + } + + inline double time() const + { + return (1.0 * (stop_time_.QuadPart - start_time_.QuadPart)) / (1.0 * clock_frequency_.QuadPart); + } + + #else + + timer() + : in_use_(false) + { + start_time_.tv_sec = 0; + start_time_.tv_usec = 0; + + stop_time_.tv_sec = 0; + stop_time_.tv_usec = 0; + } + + inline void start() + { + in_use_ = true; + gettimeofday(&start_time_,0); + } + + inline void stop() + { + gettimeofday(&stop_time_, 0); + in_use_ = false; + } + + inline unsigned long long int usec_time() const + { + if (!in_use_) + { + if (stop_time_.tv_sec >= start_time_.tv_sec) + { + return 1000000LLU * static_cast(stop_time_.tv_sec - start_time_.tv_sec ) + + static_cast(stop_time_.tv_usec - start_time_.tv_usec) ; + } + else + return std::numeric_limits::max(); + } + else + return std::numeric_limits::max(); + } + + inline double time() const + { + return usec_time() * 0.000001; + } + + #endif + + inline bool in_use() const + { + return in_use_; + } + + private: + + bool in_use_; + + #if defined(_WIN32) || defined(__WIN32__) || defined(WIN32) + LARGE_INTEGER start_time_; + LARGE_INTEGER stop_time_; + LARGE_INTEGER clock_frequency_; + #else + struct timeval start_time_; + struct timeval stop_time_; + #endif + }; + + template + struct type_defs + { + typedef symbol_table symbol_table_t; + typedef expression expression_t; + typedef parser parser_t; + typedef parser_error::type error_t; + typedef function_compositor compositor_t; + typedef typename compositor_t::function function_t; + }; + +} // namespace exprtk + +#ifndef exprtk_disable_rtl_io +namespace exprtk +{ + namespace rtl { namespace io { namespace details + { + template + inline void print_type(const std::string& fmt, + const T v, + exprtk::details::numeric::details::real_type_tag) + { + printf(fmt.c_str(),v); + } + + template + struct print_impl + { + typedef typename igeneric_function::generic_type generic_type; + typedef typename igeneric_function::parameter_list_t parameter_list_t; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + typedef typename generic_type::string_view string_t; + typedef typename exprtk::details::numeric::details::number_type::type num_type; + + static void process(const std::string& scalar_format, parameter_list_t parameters) + { + for (std::size_t i = 0; i < parameters.size(); ++i) + { + generic_type& gt = parameters[i]; + + switch (gt.type) + { + case generic_type::e_scalar : print(scalar_format,scalar_t(gt)); + break; + + case generic_type::e_vector : print(scalar_format,vector_t(gt)); + break; + + case generic_type::e_string : print(string_t(gt)); + break; + + default : continue; + } + } + } + + static inline void print(const std::string& scalar_format, const scalar_t& s) + { + print_type(scalar_format,s(),num_type()); + } + + static inline void print(const std::string& scalar_format, const vector_t& v) + { + for (std::size_t i = 0; i < v.size(); ++i) + { + print_type(scalar_format,v[i],num_type()); + + if ((i + 1) < v.size()) + printf(" "); + } + } + + static inline void print(const string_t& s) + { + printf("%s",to_str(s).c_str()); + } + }; + + } // namespace exprtk::rtl::io::details + + template + struct print : public exprtk::igeneric_function + { + typedef typename igeneric_function::parameter_list_t parameter_list_t; + + using exprtk::igeneric_function::operator(); + + print(const std::string& scalar_format = "%10.5f") + : scalar_format_(scalar_format) + { + exprtk::enable_zero_parameters(*this); + } + + inline T operator() (parameter_list_t parameters) + { + details::print_impl::process(scalar_format_,parameters); + return T(0); + } + + std::string scalar_format_; + }; + + template + struct println : public exprtk::igeneric_function + { + typedef typename igeneric_function::parameter_list_t parameter_list_t; + + using exprtk::igeneric_function::operator(); + + println(const std::string& scalar_format = "%10.5f") + : scalar_format_(scalar_format) + { + exprtk::enable_zero_parameters(*this); + } + + inline T operator() (parameter_list_t parameters) + { + details::print_impl::process(scalar_format_,parameters); + printf("\n"); + return T(0); + } + + std::string scalar_format_; + }; + + template + struct package + { + print p; + println pl; + + bool register_package(exprtk::symbol_table& symtab) + { + #define exprtk_register_function(FunctionName, FunctionType) \ + if (!symtab.add_function(FunctionName,FunctionType)) \ + { \ + exprtk_debug(( \ + "exprtk::rtl::io::register_package - Failed to add function: %s\n", \ + FunctionName)); \ + return false; \ + } \ + + exprtk_register_function("print" , p ) + exprtk_register_function("println", pl) + #undef exprtk_register_function + + return true; + } + }; + + } // namespace exprtk::rtl::io + } // namespace exprtk::rtl +} // namespace exprtk +#endif + +#ifndef exprtk_disable_rtl_io_file +#include +namespace exprtk +{ + namespace rtl { namespace io { namespace file { namespace details + { + using ::exprtk::details::char_ptr; + using ::exprtk::details::char_cptr; + + enum file_mode + { + e_error = 0, + e_read = 1, + e_write = 2, + e_rdwrt = 4 + }; + + struct file_descriptor + { + file_descriptor(const std::string& fname, const std::string& access) + : stream_ptr(0) + , mode(get_file_mode(access)) + , file_name(fname) + {} + + void* stream_ptr; + file_mode mode; + std::string file_name; + + bool open() + { + if (e_read == mode) + { + std::ifstream* stream = new std::ifstream(file_name.c_str(),std::ios::binary); + + if (!(*stream)) + { + file_name.clear(); + delete stream; + + return false; + } + else + stream_ptr = stream; + + return true; + } + else if (e_write == mode) + { + std::ofstream* stream = new std::ofstream(file_name.c_str(),std::ios::binary); + + if (!(*stream)) + { + file_name.clear(); + delete stream; + + return false; + } + else + stream_ptr = stream; + + return true; + } + else if (e_rdwrt == mode) + { + std::fstream* stream = new std::fstream(file_name.c_str(),std::ios::binary); + + if (!(*stream)) + { + file_name.clear(); + delete stream; + + return false; + } + else + stream_ptr = stream; + + return true; + } + else + return false; + } + + template + void close(Ptr& p) + { + Stream* stream = reinterpret_cast(p); + stream->close(); + delete stream; + p = reinterpret_cast(0); + } + + bool close() + { + switch (mode) + { + case e_read : close(stream_ptr); + break; + + case e_write : close(stream_ptr); + break; + + case e_rdwrt : close (stream_ptr); + break; + + default : return false; + } + + return true; + } + + template + bool write(const View& view, const std::size_t amount, const std::size_t offset = 0) + { + switch (mode) + { + case e_write : reinterpret_cast(stream_ptr)-> + write(reinterpret_cast(view.begin() + offset), amount * sizeof(typename View::value_t)); + break; + + case e_rdwrt : reinterpret_cast(stream_ptr)-> + write(reinterpret_cast(view.begin() + offset) , amount * sizeof(typename View::value_t)); + break; + + default : return false; + } + + return true; + } + + template + bool read(View& view, const std::size_t amount, const std::size_t offset = 0) + { + switch (mode) + { + case e_read : reinterpret_cast(stream_ptr)-> + read(reinterpret_cast(view.begin() + offset), amount * sizeof(typename View::value_t)); + break; + + case e_rdwrt : reinterpret_cast(stream_ptr)-> + read(reinterpret_cast(view.begin() + offset) , amount * sizeof(typename View::value_t)); + break; + + default : return false; + } + + return true; + } + + bool getline(std::string& s) + { + switch (mode) + { + case e_read : return (!!std::getline(*reinterpret_cast(stream_ptr),s)); + case e_rdwrt : return (!!std::getline(*reinterpret_cast(stream_ptr),s)); + default : return false; + } + } + + bool eof() const + { + switch (mode) + { + case e_read : return reinterpret_cast(stream_ptr)->eof(); + case e_write : return reinterpret_cast(stream_ptr)->eof(); + case e_rdwrt : return reinterpret_cast(stream_ptr)->eof(); + default : return true; + } + } + + file_mode get_file_mode(const std::string& access) const + { + if (access.empty() || access.size() > 2) + return e_error; + + std::size_t w_cnt = 0; + std::size_t r_cnt = 0; + + for (std::size_t i = 0; i < access.size(); ++i) + { + switch (std::tolower(access[i])) + { + case 'r' : r_cnt++; break; + case 'w' : w_cnt++; break; + default : return e_error; + } + } + + if ((0 == r_cnt) && (0 == w_cnt)) + return e_error; + else if ((r_cnt > 1) || (w_cnt > 1)) + return e_error; + else if ((1 == r_cnt) && (1 == w_cnt)) + return e_rdwrt; + else if (1 == r_cnt) + return e_read; + else + return e_write; + } + }; + + template + file_descriptor* make_handle(T v) + { + const std::size_t fd_size = sizeof(details::file_descriptor*); + details::file_descriptor* fd = reinterpret_cast(0); + + std::memcpy(reinterpret_cast(&fd), + reinterpret_cast(&v ), + fd_size); + return fd; + } + + template + void perform_check() + { + #ifdef _MSC_VER + #pragma warning(push) + #pragma warning(disable: 4127) + #endif + if (sizeof(T) < sizeof(void*)) + { + throw std::runtime_error("exprtk::rtl::io::file - Error - pointer size larger than holder."); + } + #ifdef _MSC_VER + #pragma warning(pop) + #endif + } + + } // namespace exprtk::rtl::io::file::details + + template + class open : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::string_view string_t; + + using exprtk::igeneric_function::operator(); + + open() + : exprtk::igeneric_function("S|SS") + { details::perform_check(); } + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const std::string file_name = to_str(string_t(parameters[0])); + + if (file_name.empty()) + return T(0); + + if ((1 == ps_index) && (0 == string_t(parameters[1]).size())) + { + return T(0); + } + + const std::string access = + (0 == ps_index) ? "r" : to_str(string_t(parameters[1])); + + details::file_descriptor* fd = new details::file_descriptor(file_name,access); + + if (fd->open()) + { + T t = T(0); + + const std::size_t fd_size = sizeof(details::file_descriptor*); + + std::memcpy(reinterpret_cast(&t ), + reinterpret_cast(&fd), + fd_size); + return t; + } + else + { + delete fd; + return T(0); + } + } + }; + + template + struct close : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + close() + : exprtk::ifunction(1) + { details::perform_check(); } + + inline T operator() (const T& v) + { + details::file_descriptor* fd = details::make_handle(v); + + if (!fd->close()) + return T(0); + + delete fd; + + return T(1); + } + }; + + template + class write : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::string_view string_t; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + write() + : igfun_t("TS|TST|TV|TVT") + { details::perform_check(); } + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + details::file_descriptor* fd = details::make_handle(scalar_t(parameters[0])()); + + switch (ps_index) + { + case 0 : { + const string_t buffer(parameters[1]); + const std::size_t amount = buffer.size(); + return T(fd->write(buffer, amount) ? 1 : 0); + } + + case 1 : { + const string_t buffer(parameters[1]); + const std::size_t amount = + std::min(buffer.size(), + static_cast(scalar_t(parameters[2])())); + return T(fd->write(buffer, amount) ? 1 : 0); + } + + case 2 : { + const vector_t vec(parameters[1]); + const std::size_t amount = vec.size(); + return T(fd->write(vec, amount) ? 1 : 0); + } + + case 3 : { + const vector_t vec(parameters[1]); + const std::size_t amount = + std::min(vec.size(), + static_cast(scalar_t(parameters[2])())); + return T(fd->write(vec, amount) ? 1 : 0); + } + } + + return T(0); + } + }; + + template + class read : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::string_view string_t; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + read() + : igfun_t("TS|TST|TV|TVT") + { details::perform_check(); } + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + details::file_descriptor* fd = details::make_handle(scalar_t(parameters[0])()); + + switch (ps_index) + { + case 0 : { + string_t buffer(parameters[1]); + const std::size_t amount = buffer.size(); + return T(fd->read(buffer,amount) ? 1 : 0); + } + + case 1 : { + string_t buffer(parameters[1]); + const std::size_t amount = + std::min(buffer.size(), + static_cast(scalar_t(parameters[2])())); + return T(fd->read(buffer,amount) ? 1 : 0); + } + + case 2 : { + vector_t vec(parameters[1]); + const std::size_t amount = vec.size(); + return T(fd->read(vec,amount) ? 1 : 0); + } + + case 3 : { + vector_t vec(parameters[1]); + const std::size_t amount = + std::min(vec.size(), + static_cast(scalar_t(parameters[2])())); + return T(fd->read(vec,amount) ? 1 : 0); + } + } + + return T(0); + } + }; + + template + class getline : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::string_view string_t; + typedef typename generic_type::scalar_view scalar_t; + + using exprtk::igeneric_function::operator(); + + getline() + : igfun_t("T",igfun_t::e_rtrn_string) + { details::perform_check(); } + + inline T operator() (std::string& result, + parameter_list_t parameters) + { + details::file_descriptor* fd = details::make_handle(scalar_t(parameters[0])()); + return T(fd->getline(result) ? 1 : 0); + } + }; + + template + struct eof : public exprtk::ifunction + { + using exprtk::ifunction::operator(); + + eof() + : exprtk::ifunction(1) + { details::perform_check(); } + + inline T operator() (const T& v) + { + details::file_descriptor* fd = details::make_handle(v); + + return (fd->eof() ? T(1) : T(0)); + } + }; + + template + struct package + { + open o; + close c; + write w; + read r; + getline g; + eof e; + + bool register_package(exprtk::symbol_table& symtab) + { + #define exprtk_register_function(FunctionName, FunctionType) \ + if (!symtab.add_function(FunctionName,FunctionType)) \ + { \ + exprtk_debug(( \ + "exprtk::rtl::io::file::register_package - Failed to add function: %s\n", \ + FunctionName)); \ + return false; \ + } \ + + exprtk_register_function("open" , o) + exprtk_register_function("close" , c) + exprtk_register_function("write" , w) + exprtk_register_function("read" , r) + exprtk_register_function("getline" , g) + exprtk_register_function("eof" , e) + #undef exprtk_register_function + + return true; + } + }; + + } // namespace exprtk::rtl::io::file + } // namespace exprtk::rtl::io + } // namespace exprtk::rtl +} // namespace exprtk +#endif + +#ifndef exprtk_disable_rtl_vecops +namespace exprtk +{ + namespace rtl { namespace vecops { + + namespace helper + { + template + inline bool invalid_range(const Vector& v, const std::size_t r0, const std::size_t r1) + { + if (r0 > (v.size() - 1)) + return true; + else if (r1 > (v.size() - 1)) + return true; + else if (r1 < r0) + return true; + else + return false; + } + + template + struct load_vector_range + { + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + static inline bool process(parameter_list_t& parameters, + std::size_t& r0, std::size_t& r1, + const std::size_t& r0_prmidx, + const std::size_t& r1_prmidx, + const std::size_t vec_idx = 0) + { + if (r0_prmidx >= parameters.size()) + return false; + + if (r1_prmidx >= parameters.size()) + return false; + + if (!scalar_t(parameters[r0_prmidx]).to_uint(r0)) + return false; + + if (!scalar_t(parameters[r1_prmidx]).to_uint(r1)) + return false; + + return !invalid_range(vector_t(parameters[vec_idx]), r0, r1); + } + }; + } + + namespace details + { + template + inline void kahan_sum(T& sum, T& error, const T v) + { + const T x = v - error; + const T y = sum + x; + error = (y - sum) - x; + sum = y; + } + + } // namespace exprtk::rtl::details + + template + class all_true : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + all_true() + : exprtk::igeneric_function("V|VTT") + /* + Overloads: + 0. V - vector + 1. VTT - vector, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t vec(parameters[0]); + + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if ( + (1 == ps_index) && + !helper::load_vector_range::process(parameters, r0, r1, 1, 2, 0) + ) + return std::numeric_limits::quiet_NaN(); + + for (std::size_t i = r0; i <= r1; ++i) + { + if (vec[i] == T(0)) + { + return T(0); + } + } + + return T(1); + } + }; + + template + class all_false : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + all_false() + : exprtk::igeneric_function("V|VTT") + /* + Overloads: + 0. V - vector + 1. VTT - vector, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t vec(parameters[0]); + + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if ( + (1 == ps_index) && + !helper::load_vector_range::process(parameters, r0, r1, 1, 2, 0) + ) + return std::numeric_limits::quiet_NaN(); + + for (std::size_t i = r0; i <= r1; ++i) + { + if (vec[i] != T(0)) + { + return T(0); + } + } + + return T(1); + } + }; + + template + class any_true : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + any_true() + : exprtk::igeneric_function("V|VTT") + /* + Overloads: + 0. V - vector + 1. VTT - vector, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t vec(parameters[0]); + + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if ( + (1 == ps_index) && + !helper::load_vector_range::process(parameters, r0, r1, 1, 2, 0) + ) + return std::numeric_limits::quiet_NaN(); + + for (std::size_t i = r0; i <= r1; ++i) + { + if (vec[i] != T(0)) + { + return T(1); + } + } + + return T(0); + } + }; + + template + class any_false : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + any_false() + : exprtk::igeneric_function("V|VTT") + /* + Overloads: + 0. V - vector + 1. VTT - vector, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t vec(parameters[0]); + + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if ( + (1 == ps_index) && + !helper::load_vector_range::process(parameters, r0, r1, 1, 2, 0) + ) + return std::numeric_limits::quiet_NaN(); + + for (std::size_t i = r0; i <= r1; ++i) + { + if (vec[i] == T(0)) + { + return T(1); + } + } + + return T(0); + } + }; + + template + class count : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + count() + : exprtk::igeneric_function("V|VTT") + /* + Overloads: + 0. V - vector + 1. VTT - vector, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t vec(parameters[0]); + + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if ( + (1 == ps_index) && + !helper::load_vector_range::process(parameters, r0, r1, 1, 2, 0) + ) + return std::numeric_limits::quiet_NaN(); + + std::size_t cnt = 0; + + for (std::size_t i = r0; i <= r1; ++i) + { + if (vec[i] != T(0)) ++cnt; + } + + return T(cnt); + } + }; + + template + class copy : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + copy() + : exprtk::igeneric_function("VV|VTTVTT") + /* + Overloads: + 0. VV - x(vector), y(vector) + 1. VTTVTT - x(vector), xr0, xr1, y(vector), yr0, yr1, + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t x(parameters[0]); + vector_t y(parameters[(0 == ps_index) ? 1 : 3]); + + std::size_t xr0 = 0; + std::size_t xr1 = x.size() - 1; + + std::size_t yr0 = 0; + std::size_t yr1 = y.size() - 1; + + if (1 == ps_index) + { + if ( + !helper::load_vector_range::process(parameters, xr0, xr1, 1, 2, 0) || + !helper::load_vector_range::process(parameters, yr0, yr1, 4, 5, 3) + ) + return T(0); + } + + const std::size_t n = std::min(xr1 - xr0 + 1, yr1 - yr0 + 1); + + std::copy( + x.begin() + xr0, + x.begin() + xr0 + n, + y.begin() + yr0); + + return T(n); + } + }; + + template + class rol : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + rol() + : exprtk::igeneric_function("VT|VTTT") + /* + Overloads: + 0. VT - vector, N + 1. VTTT - vector, N, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + vector_t vec(parameters[0]); + + std::size_t n = 0; + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if (!scalar_t(parameters[1]).to_uint(n)) + return T(0); + + if ( + (1 == ps_index) && + !helper::load_vector_range::process(parameters, r0, r1, 2, 3, 0) + ) + return T(0); + + const std::size_t dist = r1 - r0 + 1; + const std::size_t shift = n % dist; + + std::rotate( + vec.begin() + r0, + vec.begin() + r0 + shift, + vec.begin() + r1 + 1); + + return T(1); + } + }; + + template + class ror : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + ror() + : exprtk::igeneric_function("VT|VTTT") + /* + Overloads: + 0. VT - vector, N + 1. VTTT - vector, N, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + vector_t vec(parameters[0]); + + std::size_t n = 0; + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if (!scalar_t(parameters[1]).to_uint(n)) + return T(0); + + if ( + (1 == ps_index) && + !helper::load_vector_range::process(parameters, r0, r1, 2, 3, 0) + ) + return T(0); + + std::size_t dist = r1 - r0 + 1; + std::size_t shift = (dist - (n % dist)) % dist; + + std::rotate( + vec.begin() + r0, + vec.begin() + r0 + shift, + vec.begin() + r1 + 1); + + return T(1); + } + }; + + template + class shift_left : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + shift_left() + : exprtk::igeneric_function("VT|VTTT") + /* + Overloads: + 0. VT - vector, N + 1. VTTT - vector, N, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + vector_t vec(parameters[0]); + + std::size_t n = 0; + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if (!scalar_t(parameters[1]).to_uint(n)) + return T(0); + + if ( + (1 == ps_index) && + !helper::load_vector_range::process(parameters, r0, r1, 2, 3, 0) + ) + return T(0); + + const std::size_t dist = r1 - r0 + 1; + + if (n > dist) + return T(0); + + std::rotate( + vec.begin() + r0, + vec.begin() + r0 + n, + vec.begin() + r1 + 1); + + for (std::size_t i = r1 - n + 1; i <= r1; ++i) + { + vec[i] = T(0); + } + + return T(1); + } + }; + + template + class shift_right : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + shift_right() + : exprtk::igeneric_function("VT|VTTT") + /* + Overloads: + 0. VT - vector, N + 1. VTTT - vector, N, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + vector_t vec(parameters[0]); + + std::size_t n = 0; + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if (!scalar_t(parameters[1]).to_uint(n)) + return T(0); + + if ( + (1 == ps_index) && + !helper::load_vector_range::process(parameters, r0, r1, 2, 3, 0) + ) + return T(0); + + const std::size_t dist = r1 - r0 + 1; + + if (n > dist) + return T(0); + + const std::size_t shift = (dist - (n % dist)) % dist; + + std::rotate( + vec.begin() + r0, + vec.begin() + r0 + shift, + vec.begin() + r1 + 1); + + for (std::size_t i = r0; i < r0 + n; ++i) + { + vec[i] = T(0); + } + + return T(1); + } + }; + + template + class sort : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::string_view string_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + sort() + : exprtk::igeneric_function("V|VTT|VS|VSTT") + /* + Overloads: + 0. V - vector + 1. VTT - vector, r0, r1 + 2. VS - vector, string + 3. VSTT - vector, string, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + vector_t vec(parameters[0]); + + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if ((1 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 1, 2, 0)) + return T(0); + if ((3 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 2, 3, 0)) + return T(0); + + bool ascending = true; + + if ((2 == ps_index) || (3 == ps_index)) + { + if (exprtk::details::imatch(to_str(string_t(parameters[1])),"ascending")) + ascending = true; + else if (exprtk::details::imatch(to_str(string_t(parameters[1])),"descending")) + ascending = false; + else + return T(0); + } + + if (ascending) + std::sort( + vec.begin() + r0, + vec.begin() + r1 + 1, + std::less()); + else + std::sort( + vec.begin() + r0, + vec.begin() + r1 + 1, + std::greater()); + + return T(1); + } + }; + + template + class nthelement : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + nthelement() + : exprtk::igeneric_function("VT|VTTT") + /* + Overloads: + 0. VT - vector, nth-element + 1. VTTT - vector, nth-element, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + vector_t vec(parameters[0]); + + std::size_t n = 0; + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if (!scalar_t(parameters[1]).to_uint(n)) + return T(0); + + if ((1 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 2, 3, 0)) + return std::numeric_limits::quiet_NaN(); + + std::nth_element( + vec.begin() + r0, + vec.begin() + r0 + n , + vec.begin() + r1 + 1); + + return T(1); + } + }; + + template + class iota : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + iota() + : exprtk::igeneric_function("VT|VTT|VTTT|VTTTT") + /* + Overloads: + 0. VT - vector, increment + 1. VTT - vector, increment, base + 2. VTTTT - vector, increment, r0, r1 + 3. VTTTT - vector, increment, base, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + vector_t vec(parameters[0]); + + T increment = scalar_t(parameters[1])(); + T base = ((1 == ps_index) || (3 == ps_index)) ? scalar_t(parameters[2])() : T(0); + + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if ((2 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 2, 3, 0)) + return std::numeric_limits::quiet_NaN(); + else if ((3 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 3, 4, 0)) + return std::numeric_limits::quiet_NaN(); + else + { + long long j = 0; + + for (std::size_t i = r0; i <= r1; ++i, ++j) + { + vec[i] = base + (increment * j); + } + } + + return T(1); + } + }; + + template + class sumk : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + sumk() + : exprtk::igeneric_function("V|VTT") + /* + Overloads: + 0. V - vector + 1. VTT - vector, r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t vec(parameters[0]); + + std::size_t r0 = 0; + std::size_t r1 = vec.size() - 1; + + if ((1 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 1, 2, 0)) + return std::numeric_limits::quiet_NaN(); + + T result = T(0); + T error = T(0); + + for (std::size_t i = r0; i <= r1; ++i) + { + details::kahan_sum(result, error, vec[i]); + } + + return result; + } + }; + + template + class axpy : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + axpy() + : exprtk::igeneric_function("TVV|TVVTT") + /* + y <- ax + y + Overloads: + 0. TVV - a, x(vector), y(vector) + 1. TVVTT - a, x(vector), y(vector), r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t x(parameters[1]); + vector_t y(parameters[2]); + + std::size_t r0 = 0; + std::size_t r1 = std::min(x.size(),y.size()) - 1; + + if ((1 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 3, 4, 1)) + return std::numeric_limits::quiet_NaN(); + else if (helper::invalid_range(y, r0, r1)) + return std::numeric_limits::quiet_NaN(); + + const T a = scalar_t(parameters[0])(); + + for (std::size_t i = r0; i <= r1; ++i) + { + y[i] = (a * x[i]) + y[i]; + } + + return T(1); + } + }; + + template + class axpby : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + axpby() + : exprtk::igeneric_function("TVTV|TVTVTT") + /* + y <- ax + by + Overloads: + 0. TVTV - a, x(vector), b, y(vector) + 1. TVTVTT - a, x(vector), b, y(vector), r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t x(parameters[1]); + vector_t y(parameters[3]); + + std::size_t r0 = 0; + std::size_t r1 = std::min(x.size(),y.size()) - 1; + + if ((1 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 4, 5, 1)) + return std::numeric_limits::quiet_NaN(); + else if (helper::invalid_range(y, r0, r1)) + return std::numeric_limits::quiet_NaN(); + + const T a = scalar_t(parameters[0])(); + const T b = scalar_t(parameters[2])(); + + for (std::size_t i = r0; i <= r1; ++i) + { + y[i] = (a * x[i]) + (b * y[i]); + } + + return T(1); + } + }; + + template + class axpyz : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + axpyz() + : exprtk::igeneric_function("TVVV|TVVVTT") + /* + z <- ax + y + Overloads: + 0. TVVV - a, x(vector), y(vector), z(vector) + 1. TVVVTT - a, x(vector), y(vector), z(vector), r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t x(parameters[1]); + const vector_t y(parameters[2]); + vector_t z(parameters[3]); + + std::size_t r0 = 0; + std::size_t r1 = std::min(x.size(),y.size()) - 1; + + if ((1 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 3, 4, 1)) + return std::numeric_limits::quiet_NaN(); + else if (helper::invalid_range(y, r0, r1)) + return std::numeric_limits::quiet_NaN(); + else if (helper::invalid_range(z, r0, r1)) + return std::numeric_limits::quiet_NaN(); + + const T a = scalar_t(parameters[0])(); + + for (std::size_t i = r0; i <= r1; ++i) + { + z[i] = (a * x[i]) + y[i]; + } + + return T(1); + } + }; + + template + class axpbyz : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + axpbyz() + : exprtk::igeneric_function("TVTVV|TVTVVTT") + /* + z <- ax + by + Overloads: + 0. TVTVV - a, x(vector), b, y(vector), z(vector) + 1. TVTVVTT - a, x(vector), b, y(vector), z(vector), r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t x(parameters[1]); + const vector_t y(parameters[3]); + vector_t z(parameters[4]); + + std::size_t r0 = 0; + std::size_t r1 = std::min(x.size(),y.size()) - 1; + + if ((1 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 4, 5, 1)) + return std::numeric_limits::quiet_NaN(); + else if (helper::invalid_range(y, r0, r1)) + return std::numeric_limits::quiet_NaN(); + else if (helper::invalid_range(z, r0, r1)) + return std::numeric_limits::quiet_NaN(); + + const T a = scalar_t(parameters[0])(); + const T b = scalar_t(parameters[2])(); + + for (std::size_t i = r0; i <= r1; ++i) + { + z[i] = (a * x[i]) + (b * y[i]); + } + + return T(1); + } + }; + + template + class axpbz : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + axpbz() + : exprtk::igeneric_function("TVTV|TVTVTT") + /* + z <- ax + b + Overloads: + 0. TVTV - a, x(vector), b, z(vector) + 1. TVTVTT - a, x(vector), b, z(vector), r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t x(parameters[1]); + vector_t z(parameters[3]); + + std::size_t r0 = 0; + std::size_t r1 = x.size() - 1; + + if ((1 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 4, 5, 1)) + return std::numeric_limits::quiet_NaN(); + else if (helper::invalid_range(z, r0, r1)) + return std::numeric_limits::quiet_NaN(); + + const T a = scalar_t(parameters[0])(); + const T b = scalar_t(parameters[2])(); + + for (std::size_t i = r0; i <= r1; ++i) + { + z[i] = (a * x[i]) + b; + } + + return T(1); + } + }; + + template + class dot : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + dot() + : exprtk::igeneric_function("VV|VVTT") + /* + Overloads: + 0. VV - x(vector), y(vector) + 1. VVTT - x(vector), y(vector), r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t x(parameters[0]); + const vector_t y(parameters[1]); + + std::size_t r0 = 0; + std::size_t r1 = std::min(x.size(),y.size()) - 1; + + if ((1 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 2, 3, 0)) + return std::numeric_limits::quiet_NaN(); + else if (helper::invalid_range(y, r0, r1)) + return std::numeric_limits::quiet_NaN(); + + T result = T(0); + + for (std::size_t i = r0; i <= r1; ++i) + { + result += (x[i] * y[i]); + } + + return result; + } + }; + + template + class dotk : public exprtk::igeneric_function + { + public: + + typedef typename exprtk::igeneric_function igfun_t; + typedef typename igfun_t::parameter_list_t parameter_list_t; + typedef typename igfun_t::generic_type generic_type; + typedef typename generic_type::scalar_view scalar_t; + typedef typename generic_type::vector_view vector_t; + + using exprtk::igeneric_function::operator(); + + dotk() + : exprtk::igeneric_function("VV|VVTT") + /* + Overloads: + 0. VV - x(vector), y(vector) + 1. VVTT - x(vector), y(vector), r0, r1 + */ + {} + + inline T operator() (const std::size_t& ps_index, parameter_list_t parameters) + { + const vector_t x(parameters[0]); + const vector_t y(parameters[1]); + + std::size_t r0 = 0; + std::size_t r1 = std::min(x.size(),y.size()) - 1; + + if ((1 == ps_index) && !helper::load_vector_range::process(parameters, r0, r1, 2, 3, 0)) + return std::numeric_limits::quiet_NaN(); + else if (helper::invalid_range(y, r0, r1)) + return std::numeric_limits::quiet_NaN(); + + T result = T(0); + T error = T(0); + + for (std::size_t i = r0; i <= r1; ++i) + { + details::kahan_sum(result, error, (x[i] * y[i])); + } + + return result; + } + }; + + template + struct package + { + all_true at; + all_false af; + any_true nt; + any_false nf; + count c; + copy cp; + rol rl; + ror rr; + shift_left sl; + shift_right sr; + sort st; + nthelement ne; + iota ia; + sumk sk; + axpy b1_axpy; + axpby b1_axpby; + axpyz b1_axpyz; + axpbyz b1_axpbyz; + axpbz b1_axpbz; + dot dt; + dotk dtk; + + bool register_package(exprtk::symbol_table& symtab) + { + #define exprtk_register_function(FunctionName, FunctionType) \ + if (!symtab.add_function(FunctionName,FunctionType)) \ + { \ + exprtk_debug(( \ + "exprtk::rtl::vecops::register_package - Failed to add function: %s\n", \ + FunctionName)); \ + return false; \ + } \ + + exprtk_register_function("all_true" , at ) + exprtk_register_function("all_false" , af ) + exprtk_register_function("any_true" , nt ) + exprtk_register_function("any_false" , nf ) + exprtk_register_function("count" , c ) + exprtk_register_function("copy" , cp ) + exprtk_register_function("rotate_left" , rl ) + exprtk_register_function("rol" , rl ) + exprtk_register_function("rotate_right" , rr ) + exprtk_register_function("ror" , rr ) + exprtk_register_function("shftl" , sl ) + exprtk_register_function("shftr" , sr ) + exprtk_register_function("sort" , st ) + exprtk_register_function("nth_element" , ne ) + exprtk_register_function("iota" , ia ) + exprtk_register_function("sumk" , sk ) + exprtk_register_function("axpy" , b1_axpy ) + exprtk_register_function("axpby" , b1_axpby ) + exprtk_register_function("axpyz" , b1_axpyz ) + exprtk_register_function("axpbyz" , b1_axpbyz) + exprtk_register_function("axpbz" , b1_axpbz ) + exprtk_register_function("dot" , dt ) + exprtk_register_function("dotk" , dtk ) + #undef exprtk_register_function + + return true; + } + }; + + } // namespace exprtk::rtl::vecops + } // namespace exprtk::rtl +} // namespace exprtk +#endif + +namespace exprtk +{ + namespace information + { + using ::exprtk::details::char_cptr; + + static char_cptr library = "Mathematical Expression Toolkit"; + static char_cptr version = "2.71828182845904523536028747135266" + "2497757247093699959574966967627724" + "0766303535475945713821785251664274" + "2746639193200305992181741359662904"; + static char_cptr date = "20230101"; + static char_cptr min_cpp = "199711L"; + + static inline std::string data() + { + static const std::string info_str = std::string(library) + + std::string(" v") + std::string(version) + + std::string(" (") + date + std::string(")") + + std::string(" (") + min_cpp + std::string(")"); + return info_str; + } + + } // namespace information + + #ifdef exprtk_debug + #undef exprtk_debug + #endif + + #ifdef exprtk_error_location + #undef exprtk_error_location + #endif + + #ifdef exprtk_disable_fallthrough_begin + #undef exprtk_disable_fallthrough_begin + #endif + + #ifdef exprtk_disable_fallthrough_end + #undef exprtk_disable_fallthrough_end + #endif + + #ifdef exprtk_override + #undef exprtk_override + #endif + + #ifdef exprtk_final + #undef exprtk_final + #endif + + #ifdef exprtk_delete + #undef exprtk_delete + #endif + +} // namespace exprtk + +#endif diff --git a/server/src/main.cpp b/server/src/main.cpp index 9939f95b..936b13fb 100644 --- a/server/src/main.cpp +++ b/server/src/main.cpp @@ -7,6 +7,8 @@ #include #include "server.h" #include "main.h" +#include "exprtk.hpp" +#include "curl/curl.h" #if defined(CONF_FAMILY_UNIX) #include @@ -90,6 +92,18 @@ void CMain::OnNewClient(int ClientNetID, int ClientID) Client(ClientID)->m_Stats.m_Online4 = true; else if(Client(ClientID)->m_ClientNetType == NETTYPE_IPV6) Client(ClientID)->m_Stats.m_Online6 = true; + + // Send monitor to client + // support by cpp.la + int ID = 0; + char monitorBuffer[2048]; + while (strcmp(Monitors(ID)->m_aName, "NULL")) + { + memset(monitorBuffer, 0, sizeof(monitorBuffer)); + sprintf(monitorBuffer, "{\"name\":\"%s\",\"host\":\"%s\",\"interval\":%d,\"type\":\"%s\",\"monitor\":%d}", Monitors(ID)->m_aName, Monitors(ID)->m_aHost, Monitors(ID)->m_aInterval, Monitors(ID)->m_aType, ID); + m_Server.Network()->Send(ClientNetID, monitorBuffer); + ID++; + } } void CMain::OnDelClient(int ClientNetID) @@ -103,6 +117,10 @@ void CMain::OnDelClient(int ClientNetID) Client(ClientID)->m_ClientNetType = NETTYPE_INVALID; mem_zero(&Client(ClientID)->m_Stats, sizeof(CClient::CStats)); } + m_OfflineAlarmThreadData.pClients = m_aClients; + m_OfflineAlarmThreadData.pWatchDogs = m_aCWatchDogs; + m_OfflineAlarmThreadData.m_ReloadRequired = ClientID; + thread_create(offlineAlarmThread, &m_OfflineAlarmThreadData); } int CMain::HandleMessage(int ClientNetID, char *pMessage) @@ -178,36 +196,49 @@ int CMain::HandleMessage(int ClientNetID, char *pMessage) pClient->m_Stats.m_HDDTotal = rStart["hdd_total"].u.integer; if(rStart["hdd_used"].type) pClient->m_Stats.m_HDDUsed = rStart["hdd_used"].u.integer; + if(rStart["io_read"].type) + pClient->m_Stats.m_IORead = rStart["io_read"].u.integer; + if(rStart["io_write"].type) + pClient->m_Stats.m_IOWrite = rStart["io_write"].u.integer; if(rStart["cpu"].type) pClient->m_Stats.m_CPU = rStart["cpu"].u.dbl; if(rStart["online4"].type && pClient->m_ClientNetType == NETTYPE_IPV6) pClient->m_Stats.m_Online4 = rStart["online4"].u.boolean; if(rStart["online6"].type && pClient->m_ClientNetType == NETTYPE_IPV4) pClient->m_Stats.m_Online6 = rStart["online6"].u.boolean; - if(rStart["ip_status"].type) - pClient->m_Stats.m_IpStatus = rStart["ip_status"].u.boolean; if(rStart["custom"].type == json_string) str_copy(pClient->m_Stats.m_aCustom, rStart["custom"].u.string.ptr, sizeof(pClient->m_Stats.m_aCustom)); + //copy message for watchdog to analysis + WatchdogMessage(ClientNetID, + pClient->m_Stats.m_Load_1, pClient->m_Stats.m_Load_5, pClient->m_Stats.m_Load_15, + pClient->m_Stats.m_ping_10010, pClient->m_Stats.m_ping_189, pClient->m_Stats.m_ping_10086, + pClient->m_Stats.m_time_10010, pClient->m_Stats.m_time_189, pClient->m_Stats.m_time_10086, + pClient->m_Stats.m_tcpCount, pClient->m_Stats.m_udpCount, pClient->m_Stats.m_processCount, + pClient->m_Stats.m_threadCount, pClient->m_Stats.m_NetworkRx, pClient->m_Stats.m_NetworkTx, + pClient->m_Stats.m_NetworkIN, pClient->m_Stats.m_NetworkOUT, + pClient->m_LastNetworkIN, pClient->m_LastNetworkOUT, pClient->m_Stats.m_MemTotal, + pClient->m_Stats.m_MemUsed, pClient->m_Stats.m_SwapTotal, pClient->m_Stats.m_SwapUsed, + pClient->m_Stats.m_HDDTotal, pClient->m_Stats.m_HDDUsed, pClient->m_Stats.m_IORead, + pClient->m_Stats.m_IOWrite, pClient->m_Stats.m_CPU, pClient->m_Stats.m_Online4, + pClient->m_Stats.m_Online6); + if(m_Config.m_Verbose) { if(rStart["online4"].type) - dbg_msg("main", "Online4: %s\nUptime: %" PRId64 "\nIpStatus: %s\nLoad_1: %f\nLoad_5: %f\nLoad_15: %f\nPing_10010: %f\nPing_189: %f\nPing_10086: %f\nTime_10010: %" PRId64 "\nTime_189: %" PRId64 "\nTime_10086: %" PRId64 "\nTcp_count: %" PRId64 "\nUdp_count: %" PRId64 "\nprocess_count: %" PRId64 "\nthread_count: %" PRId64 "\nNetworkRx: %" PRId64 "\nNetworkTx: %" PRId64 "\nNetworkIN: %" PRId64 "\nNetworkOUT: %" PRId64 "\nMemTotal: %" PRId64 "\nMemUsed: %" PRId64 "\nSwapTotal: %" PRId64 "\nSwapUsed: %" PRId64 "\nHDDTotal: %" PRId64 "\nHDDUsed: %" PRId64 "\nCPU: %f\n", + dbg_msg("main", "Online4: %s\nUptime: %" PRId64 "\nLoad_1: %f\nLoad_5: %f\nLoad_15: %f\nPing_10010: %f\nPing_189: %f\nPing_10086: %f\nTime_10010: %" PRId64 "\nTime_189: %" PRId64 "\nTime_10086: %" PRId64 "\nTcp_count: %" PRId64 "\nUdp_count: %" PRId64 "\nprocess_count: %" PRId64 "\nthread_count: %" PRId64 "\nNetworkRx: %" PRId64 "\nNetworkTx: %" PRId64 "\nNetworkIN: %" PRId64 "\nNetworkOUT: %" PRId64 "\nMemTotal: %" PRId64 "\nMemUsed: %" PRId64 "\nSwapTotal: %" PRId64 "\nSwapUsed: %" PRId64 "\nHDDTotal: %" PRId64 "\nHDDUsed: %" PRId64 "\nCPU: %f\nIORead: %" PRId64 "\nIOWrite: %" PRId64 "\n", rStart["online4"].u.boolean ? "true" : "false", pClient->m_Stats.m_Uptime, - pClient->m_Stats.m_IpStatus ? "true" : "false", - pClient->m_Stats.m_Load_1, pClient->m_Stats.m_Load_5, pClient->m_Stats.m_Load_15, pClient->m_Stats.m_ping_10010, pClient->m_Stats.m_ping_189, pClient->m_Stats.m_ping_10086, pClient->m_Stats.m_time_10010, pClient->m_Stats.m_time_189, pClient->m_Stats.m_time_10086,pClient->m_Stats.m_tcpCount,pClient->m_Stats.m_udpCount,pClient->m_Stats.m_processCount,pClient->m_Stats.m_threadCount,pClient->m_Stats.m_NetworkRx, pClient->m_Stats.m_NetworkTx, pClient->m_Stats.m_NetworkIN, pClient->m_Stats.m_NetworkOUT, pClient->m_Stats.m_MemTotal, pClient->m_Stats.m_MemUsed, pClient->m_Stats.m_SwapTotal, pClient->m_Stats.m_SwapUsed, pClient->m_Stats.m_HDDTotal, pClient->m_Stats.m_HDDUsed, pClient->m_Stats.m_CPU); + pClient->m_Stats.m_Load_1, pClient->m_Stats.m_Load_5, pClient->m_Stats.m_Load_15, pClient->m_Stats.m_ping_10010, pClient->m_Stats.m_ping_189, pClient->m_Stats.m_ping_10086, pClient->m_Stats.m_time_10010, pClient->m_Stats.m_time_189, pClient->m_Stats.m_time_10086,pClient->m_Stats.m_tcpCount,pClient->m_Stats.m_udpCount,pClient->m_Stats.m_processCount,pClient->m_Stats.m_threadCount,pClient->m_Stats.m_NetworkRx, pClient->m_Stats.m_NetworkTx, pClient->m_Stats.m_NetworkIN, pClient->m_Stats.m_NetworkOUT, pClient->m_Stats.m_MemTotal, pClient->m_Stats.m_MemUsed, pClient->m_Stats.m_SwapTotal, pClient->m_Stats.m_SwapUsed, pClient->m_Stats.m_HDDTotal, pClient->m_Stats.m_HDDUsed, pClient->m_Stats.m_CPU, pClient->m_Stats.m_IORead, pClient->m_Stats.m_IOWrite); else if(rStart["online6"].type) - dbg_msg("main", "Online6: %s\nUptime: %" PRId64 "\nIpStatus: %s\nLoad_1: %f\nLoad_5: %f\nLoad_15: %f\nPing_10010: %f\nPing_189: %f\nPing_10086: %f\nTime_10010: %" PRId64 "\nTime_189: %" PRId64 "\nTime_10086: %" PRId64 "\nTcp_count: %" PRId64 "\nUdp_count: %" PRId64 "\nprocess_count: %" PRId64 "\nthread_count: %" PRId64 "\nNetworkRx: %" PRId64 "\nNetworkTx: %" PRId64 "\nNetworkIN: %" PRId64 "\nNetworkOUT: %" PRId64 "\nMemTotal: %" PRId64 "\nMemUsed: %" PRId64 "\nSwapTotal: %" PRId64 "\nSwapUsed: %" PRId64 "\nHDDTotal: %" PRId64 "\nHDDUsed: %" PRId64 "\nCPU: %f\n", + dbg_msg("main", "Online6: %s\nUptime: %" PRId64 "\nLoad_1: %f\nLoad_5: %f\nLoad_15: %f\nPing_10010: %f\nPing_189: %f\nPing_10086: %f\nTime_10010: %" PRId64 "\nTime_189: %" PRId64 "\nTime_10086: %" PRId64 "\nTcp_count: %" PRId64 "\nUdp_count: %" PRId64 "\nprocess_count: %" PRId64 "\nthread_count: %" PRId64 "\nNetworkRx: %" PRId64 "\nNetworkTx: %" PRId64 "\nNetworkIN: %" PRId64 "\nNetworkOUT: %" PRId64 "\nMemTotal: %" PRId64 "\nMemUsed: %" PRId64 "\nSwapTotal: %" PRId64 "\nSwapUsed: %" PRId64 "\nHDDTotal: %" PRId64 "\nHDDUsed: %" PRId64 "\nCPU: %f\nIORead: %" PRId64 "\nIOWrite: %" PRId64 "\n", rStart["online6"].u.boolean ? "true" : "false", pClient->m_Stats.m_Uptime, - pClient->m_Stats.m_IpStatus ? "true" : "false", - pClient->m_Stats.m_Load_1, pClient->m_Stats.m_Load_5, pClient->m_Stats.m_Load_15, pClient->m_Stats.m_ping_10010, pClient->m_Stats.m_ping_189, pClient->m_Stats.m_ping_10086, pClient->m_Stats.m_time_10010, pClient->m_Stats.m_time_189, pClient->m_Stats.m_time_10086,pClient->m_Stats.m_tcpCount,pClient->m_Stats.m_udpCount,pClient->m_Stats.m_processCount,pClient->m_Stats.m_threadCount,pClient->m_Stats.m_NetworkRx, pClient->m_Stats.m_NetworkTx, pClient->m_Stats.m_NetworkIN, pClient->m_Stats.m_NetworkOUT, pClient->m_Stats.m_MemTotal, pClient->m_Stats.m_MemUsed, pClient->m_Stats.m_SwapTotal, pClient->m_Stats.m_SwapUsed, pClient->m_Stats.m_HDDTotal, pClient->m_Stats.m_HDDUsed, pClient->m_Stats.m_CPU); + pClient->m_Stats.m_Load_1, pClient->m_Stats.m_Load_5, pClient->m_Stats.m_Load_15, pClient->m_Stats.m_ping_10010, pClient->m_Stats.m_ping_189, pClient->m_Stats.m_ping_10086, pClient->m_Stats.m_time_10010, pClient->m_Stats.m_time_189, pClient->m_Stats.m_time_10086,pClient->m_Stats.m_tcpCount,pClient->m_Stats.m_udpCount,pClient->m_Stats.m_processCount,pClient->m_Stats.m_threadCount,pClient->m_Stats.m_NetworkRx, pClient->m_Stats.m_NetworkTx, pClient->m_Stats.m_NetworkIN, pClient->m_Stats.m_NetworkOUT, pClient->m_Stats.m_MemTotal, pClient->m_Stats.m_MemUsed, pClient->m_Stats.m_SwapTotal, pClient->m_Stats.m_SwapUsed, pClient->m_Stats.m_HDDTotal, pClient->m_Stats.m_HDDUsed, pClient->m_Stats.m_CPU, pClient->m_Stats.m_IORead, pClient->m_Stats.m_IOWrite); else - dbg_msg("main", "Uptime: %" PRId64 "\nIpStatus: %s\nLoad_1: %f\nLoad_5: %f\nLoad_15: %f\nPing_10010: %f\nPing_189: %f\nPing_10086: %f\nTime_10010: %" PRId64 "\nTime_189: %" PRId64 "\nTime_10086: %" PRId64 "\nTcp_count: %" PRId64 "\nUdp_count: %" PRId64 "\nprocess_count: %" PRId64 "\nthread_count: %" PRId64 "\nNetworkRx: %" PRId64 "\nNetworkTx: %" PRId64 "\nNetworkIN: %" PRId64 "\nNetworkOUT: %" PRId64 "\nMemTotal: %" PRId64 "\nMemUsed: %" PRId64 "\nSwapTotal: %" PRId64 "\nSwapUsed: %" PRId64 "\nHDDTotal: %" PRId64 "\nHDDUsed: %" PRId64 "\nCPU: %f\n", + dbg_msg("main", "Uptime: %" PRId64 "\nLoad_1: %f\nLoad_5: %f\nLoad_15: %f\nPing_10010: %f\nPing_189: %f\nPing_10086: %f\nTime_10010: %" PRId64 "\nTime_189: %" PRId64 "\nTime_10086: %" PRId64 "\nTcp_count: %" PRId64 "\nUdp_count: %" PRId64 "\nprocess_count: %" PRId64 "\nthread_count: %" PRId64 "\nNetworkRx: %" PRId64 "\nNetworkTx: %" PRId64 "\nNetworkIN: %" PRId64 "\nNetworkOUT: %" PRId64 "\nMemTotal: %" PRId64 "\nMemUsed: %" PRId64 "\nSwapTotal: %" PRId64 "\nSwapUsed: %" PRId64 "\nHDDTotal: %" PRId64 "\nHDDUsed: %" PRId64 "\nCPU: %f\nIORead: %" PRId64 "\nIOWrite: %" PRId64 "\n", pClient->m_Stats.m_Uptime, - pClient->m_Stats.m_IpStatus ? "true" : "false", - pClient->m_Stats.m_Load_1, pClient->m_Stats.m_Load_5, pClient->m_Stats.m_Load_15, pClient->m_Stats.m_ping_10010, pClient->m_Stats.m_ping_189, pClient->m_Stats.m_ping_10086, pClient->m_Stats.m_time_10010, pClient->m_Stats.m_time_189, pClient->m_Stats.m_time_10086,pClient->m_Stats.m_tcpCount,pClient->m_Stats.m_udpCount,pClient->m_Stats.m_processCount,pClient->m_Stats.m_threadCount,pClient->m_Stats.m_NetworkRx, pClient->m_Stats.m_NetworkTx, pClient->m_Stats.m_NetworkIN, pClient->m_Stats.m_NetworkOUT, pClient->m_Stats.m_MemTotal, pClient->m_Stats.m_MemUsed, pClient->m_Stats.m_SwapTotal, pClient->m_Stats.m_SwapUsed, pClient->m_Stats.m_HDDTotal, pClient->m_Stats.m_HDDUsed, pClient->m_Stats.m_CPU); + pClient->m_Stats.m_Load_1, pClient->m_Stats.m_Load_5, pClient->m_Stats.m_Load_15, pClient->m_Stats.m_ping_10010, pClient->m_Stats.m_ping_189, pClient->m_Stats.m_ping_10086, pClient->m_Stats.m_time_10010, pClient->m_Stats.m_time_189, pClient->m_Stats.m_time_10086,pClient->m_Stats.m_tcpCount,pClient->m_Stats.m_udpCount,pClient->m_Stats.m_processCount,pClient->m_Stats.m_threadCount,pClient->m_Stats.m_NetworkRx, pClient->m_Stats.m_NetworkTx, pClient->m_Stats.m_NetworkIN, pClient->m_Stats.m_NetworkOUT, pClient->m_Stats.m_MemTotal, pClient->m_Stats.m_MemUsed, pClient->m_Stats.m_SwapTotal, pClient->m_Stats.m_SwapUsed, pClient->m_Stats.m_HDDTotal, pClient->m_Stats.m_HDDUsed, pClient->m_Stats.m_CPU, pClient->m_Stats.m_IORead, pClient->m_Stats.m_IOWrite); } // clean up @@ -235,6 +266,147 @@ int CMain::HandleMessage(int ClientNetID, char *pMessage) return 1; } + +void CMain::WatchdogMessage(int ClientNetID, double load_1, double load_5, double load_15, double ping_10010, double ping_189, double ping_10086, + double time_10010, double time_189, double time_10086, double tcp_count, double udp_count, double process_count, double thread_count, + double network_rx, double network_tx, double network_in, double network_out, double last_network_in, double last_network_out, double memory_total, double memory_used, + double swap_total, double swap_used, double hdd_total, double hdd_used, double io_read, double io_write, double cpu, + double online4, double online6) +{ + int ID = 0; + while (strcmp(Watchdog(ID)->m_aName, "NULL")) + { +// Exprtk库默认使用窄字符类型，但可能会出现中文等Unicode字符无法正确解析的问题。 +// todo: 为解决此问题，可以使用宽字符类型替换Exprtk库中默认的窄字符类型。 +// #include +// #include +// #include +// typedef exprtk::expression expression_type; +// typedef exprtk::parser parser_type; +// int main() +// { +// std::wstring expression_string = L"sin(x)"; +// expression_type expression; +// parser_type parser; +// parser.compile(expression_string, expression); +// double x = 3.14; +// double result = expression.value(); +// return 0; +// } + typedef exprtk::symbol_table symbol_table_t; + typedef exprtk::expression expression_t; + typedef exprtk::parser parser_t; + const std::string expression_string = Watchdog(ID)->m_aRule; + int ClientID = ClientNetToClient(ClientNetID); + std::string username = Client(ClientID)->m_aUsername; + std::string name = Client(ClientID)->m_aName; + std::string type = Client(ClientID)->m_aType; + std::string host = Client(ClientID)->m_aHost; + std::string location = Client(ClientID)->m_aLocation; + + symbol_table_t symbol_table; + symbol_table.add_stringvar("username", username); + symbol_table.add_stringvar("name", name); + symbol_table.add_stringvar("type", type); + symbol_table.add_stringvar("host", host); + symbol_table.add_stringvar("location", location); + symbol_table.add_variable("load_1",load_1); + symbol_table.add_variable("load_5",load_5); + symbol_table.add_variable("load_15",load_15); + symbol_table.add_variable("ping_10010",ping_10010); + symbol_table.add_variable("ping_189",ping_189); + symbol_table.add_variable("ping_10086",ping_10086); + symbol_table.add_variable("time_10010",time_10010); + symbol_table.add_variable("time_189",time_189); + symbol_table.add_variable("time_10086",time_10086); + symbol_table.add_variable("tcp_count",tcp_count); + symbol_table.add_variable("udp_count",udp_count); + symbol_table.add_variable("process_count",process_count); + symbol_table.add_variable("thread_count",thread_count); + symbol_table.add_variable("network_rx",network_rx); + symbol_table.add_variable("network_tx",network_tx); + symbol_table.add_variable("network_in",network_in); + symbol_table.add_variable("network_out",network_out); + symbol_table.add_variable("last_network_in",last_network_in); + symbol_table.add_variable("last_network_out",last_network_out); + symbol_table.add_variable("memory_total",memory_total); + symbol_table.add_variable("memory_used",memory_used); + symbol_table.add_variable("swap_total",swap_total); + symbol_table.add_variable("swap_used",swap_used); + symbol_table.add_variable("hdd_total",hdd_total); + symbol_table.add_variable("hdd_used",hdd_used); + symbol_table.add_variable("io_read",io_read); + symbol_table.add_variable("io_write",io_write); + symbol_table.add_variable("cpu",cpu); + symbol_table.add_variable("online4",online4); + symbol_table.add_variable("online6",online6); + symbol_table.add_constants(); + + expression_t expression; + expression.register_symbol_table(symbol_table); + + parser_t parser; + parser.compile(expression_string,expression); + + if (expression.value() > 0) + { + time_t currentStamp = (long long)time(/*ago*/0); + if ((currentStamp-Client(ClientID)->m_AlarmLastTime) > Watchdog(ID)->m_aInterval) + { + if (!Client(ClientID)->m_Stats.m_Online4 && !Client(ClientID)->m_Stats.m_Online6) + { + //休眠5分钟如果5分钟后状态发生了变更，消息不发出。 + printf("download\n"); + } + Client(ClientID)->m_AlarmLastTime = currentStamp; + CURL *curl; + CURLcode res; + curl_global_init(CURL_GLOBAL_ALL); + + curl = curl_easy_init(); + if(curl) { + //standard time + char standardTime[32]= { 0 }; + strftime(standardTime, sizeof(standardTime), "%Y-%m-%d %H:%M:%S",localtime(¤tStamp)); + + //url encode, Rules conflict with url special characters，eg：&, del rules, by https://cpp.la, 2023-10-09 + char encodeBuffer[2048] = { 0 }; + sprintf(encodeBuffer, "【告警名称】 %s \n\n【告警时间】 %s \n\n【用户名】 %s \n\n【节点名】 %s \n\n【虚拟化】 %s \n\n【主机名】 %s \n\n【位 置】 %s", + Watchdog(ID)->m_aName, + standardTime, + username.c_str(), + name.c_str(), + type.c_str(), + host.c_str(), + location.c_str()); + char *encodeUrl = curl_easy_escape(curl, encodeBuffer, strlen(encodeBuffer)); + + //standard url + char urlBuffer[2048] = { 0 }; + sprintf(urlBuffer, "%s%s",Watchdog(ID)->m_aCallback, encodeUrl); + + + curl_easy_setopt(curl, CURLOPT_POST, 1L); + curl_easy_setopt(curl, CURLOPT_URL, urlBuffer); + curl_easy_setopt(curl, CURLOPT_POSTFIELDS,"signature=ServerStatus"); + curl_easy_setopt(curl, CURLOPT_SSL_VERIFYPEER, 0); + curl_easy_setopt(curl, CURLOPT_SSL_VERIFYHOST, 0); + curl_easy_setopt(curl, CURLOPT_CONNECTTIMEOUT, 3L); + curl_easy_setopt(curl, CURLOPT_TIMEOUT, 6L); + res = curl_easy_perform(curl); + if(res != CURLE_OK) + fprintf(stderr, "watchdog failed: %s\n", curl_easy_strerror(res)); + if(encodeUrl) + curl_free(encodeUrl); + curl_easy_cleanup(curl); + } + curl_global_cleanup(); + } + } + ID++; + } +} + void CMain::JSONUpdateThread(void *pUser) { CJSONUpdateThreadData *m_pJSONUpdateThreadData = (CJSONUpdateThreadData *)pUser; @@ -269,17 +441,35 @@ void CMain::JSONUpdateThread(void *pUser) else str_format(aUptime, sizeof(aUptime), "%02d:%02d:%02d", (int)(pClients[i].m_Stats.m_Uptime/60.0/60.0), (int)((pClients[i].m_Stats.m_Uptime/60)%60), (int)((pClients[i].m_Stats.m_Uptime)%60)); + // track month network traffic, diff: 2021-10-01 00:05, 5minutes + // last_network_in/out is last record flag. + time_t currentStamp = (long long)time(/*ago*/0); + if(0 == pClients[i].m_LastNetworkIN || (0 != pClients[i].m_Stats.m_NetworkIN && pClients[i].m_LastNetworkIN > pClients[i].m_Stats.m_NetworkIN) || (localtime(¤tStamp)->tm_mday == pClients[i].m_aMonthStart && localtime(¤tStamp)->tm_hour == 0 && localtime(¤tStamp)->tm_min < 5)) + { + pClients[i].m_LastNetworkIN = pClients[i].m_Stats.m_NetworkIN; + pClients[i].m_LastNetworkOUT = pClients[i].m_Stats.m_NetworkOUT; + } + str_format(pBuf, sizeof(aFileBuf) - (pBuf - aFileBuf), - "{ \"name\": \"%s\",\"type\": \"%s\",\"host\": \"%s\",\"location\": \"%s\",\"online4\": %s, \"online6\": %s,\"ip_status\": %s,\"uptime\": \"%s\",\"load_1\": %.2f, \"load_5\": %.2f, \"load_15\": %.2f,\"ping_10010\": %.2f, \"ping_189\": %.2f, \"ping_10086\": %.2f,\"time_10010\": %" PRId64 ", \"time_189\": %" PRId64 ", \"time_10086\": %" PRId64 ", \"tcp_count\": %" PRId64 ", \"udp_count\": %" PRId64 ", \"process_count\": %" PRId64 ", \"thread_count\": %" PRId64 ", \"network_rx\": %" PRId64 ", \"network_tx\": %" PRId64 ", \"network_in\": %" PRId64 ", \"network_out\": %" PRId64 ", \"cpu\": %d, \"memory_total\": %" PRId64 ", \"memory_used\": %" PRId64 ", \"swap_total\": %" PRId64 ", \"swap_used\": %" PRId64 ", \"hdd_total\": %" PRId64 ", \"hdd_used\": %" PRId64 ", \"custom\": \"%s\" },\n", + "{ \"name\": \"%s\",\"type\": \"%s\",\"host\": \"%s\",\"location\": \"%s\",\"online4\": %s, \"online6\": %s, \"uptime\": \"%s\",\"load_1\": %.2f, \"load_5\": %.2f, \"load_15\": %.2f,\"ping_10010\": %.2f, \"ping_189\": %.2f, \"ping_10086\": %.2f,\"time_10010\": %" PRId64 ", \"time_189\": %" PRId64 ", \"time_10086\": %" PRId64 ", \"tcp_count\": %" PRId64 ", \"udp_count\": %" PRId64 ", \"process_count\": %" PRId64 ", \"thread_count\": %" PRId64 ", \"network_rx\": %" PRId64 ", \"network_tx\": %" PRId64 ", \"network_in\": %" PRId64 ", \"network_out\": %" PRId64 ", \"cpu\": %d, \"memory_total\": %" PRId64 ", \"memory_used\": %" PRId64 ", \"swap_total\": %" PRId64 ", \"swap_used\": %" PRId64 ", \"hdd_total\": %" PRId64 ", \"hdd_used\": %" PRId64 ", \"last_network_in\": %" PRId64 ", \"last_network_out\": %" PRId64 ",\"io_read\": %" PRId64 ", \"io_write\": %" PRId64 ",\"custom\": \"%s\" },\n", pClients[i].m_aName,pClients[i].m_aType,pClients[i].m_aHost,pClients[i].m_aLocation, - pClients[i].m_Stats.m_Online4 ? "true" : "false",pClients[i].m_Stats.m_Online6 ? "true" : "false",pClients[i].m_Stats.m_IpStatus ? "true": "false", - aUptime, pClients[i].m_Stats.m_Load_1, pClients[i].m_Stats.m_Load_5, pClients[i].m_Stats.m_Load_15, pClients[i].m_Stats.m_ping_10010, pClients[i].m_Stats.m_ping_189, pClients[i].m_Stats.m_ping_10086, pClients[i].m_Stats.m_time_10010, pClients[i].m_Stats.m_time_189, pClients[i].m_Stats.m_time_10086,pClients[i].m_Stats.m_tcpCount,pClients[i].m_Stats.m_udpCount,pClients[i].m_Stats.m_processCount,pClients[i].m_Stats.m_threadCount,pClients[i].m_Stats.m_NetworkRx, pClients[i].m_Stats.m_NetworkTx, pClients[i].m_Stats.m_NetworkIN, pClients[i].m_Stats.m_NetworkOUT, (int)pClients[i].m_Stats.m_CPU, pClients[i].m_Stats.m_MemTotal, pClients[i].m_Stats.m_MemUsed, pClients[i].m_Stats.m_SwapTotal, pClients[i].m_Stats.m_SwapUsed, pClients[i].m_Stats.m_HDDTotal, pClients[i].m_Stats.m_HDDUsed, pClients[i].m_Stats.m_aCustom); + pClients[i].m_Stats.m_Online4 ? "true" : "false",pClients[i].m_Stats.m_Online6 ? "true" : "false", + aUptime, pClients[i].m_Stats.m_Load_1, pClients[i].m_Stats.m_Load_5, pClients[i].m_Stats.m_Load_15, pClients[i].m_Stats.m_ping_10010, pClients[i].m_Stats.m_ping_189, pClients[i].m_Stats.m_ping_10086, + pClients[i].m_Stats.m_time_10010, pClients[i].m_Stats.m_time_189, pClients[i].m_Stats.m_time_10086,pClients[i].m_Stats.m_tcpCount,pClients[i].m_Stats.m_udpCount,pClients[i].m_Stats.m_processCount,pClients[i].m_Stats.m_threadCount, + pClients[i].m_Stats.m_NetworkRx, pClients[i].m_Stats.m_NetworkTx, pClients[i].m_Stats.m_NetworkIN, pClients[i].m_Stats.m_NetworkOUT, (int)pClients[i].m_Stats.m_CPU, pClients[i].m_Stats.m_MemTotal, pClients[i].m_Stats.m_MemUsed, + pClients[i].m_Stats.m_SwapTotal, pClients[i].m_Stats.m_SwapUsed, pClients[i].m_Stats.m_HDDTotal, pClients[i].m_Stats.m_HDDUsed, + pClients[i].m_Stats.m_NetworkIN == 0 || pClients[i].m_LastNetworkIN == 0 ? pClients[i].m_Stats.m_NetworkIN : pClients[i].m_LastNetworkIN, + pClients[i].m_Stats.m_NetworkOUT == 0 || pClients[i].m_LastNetworkOUT == 0 ? pClients[i].m_Stats.m_NetworkOUT : pClients[i].m_LastNetworkOUT, + pClients[i].m_Stats.m_IORead, pClients[i].m_Stats.m_IOWrite, + pClients[i].m_Stats.m_aCustom); pBuf += strlen(pBuf); } else { - str_format(pBuf, sizeof(aFileBuf) - (pBuf - aFileBuf), "{ \"name\": \"%s\", \"type\": \"%s\", \"host\": \"%s\", \"location\": \"%s\", \"online4\": false, \"online6\": false },\n", - pClients[i].m_aName, pClients[i].m_aType, pClients[i].m_aHost, pClients[i].m_aLocation); + // sava network traffic record to json when close client + // last_network_in == last network in record, last_network_out == last network out record + str_format(pBuf, sizeof(aFileBuf) - (pBuf - aFileBuf), "{ \"name\": \"%s\", \"type\": \"%s\", \"host\": \"%s\", \"location\": \"%s\", \"online4\": false, \"online6\": false, \"last_network_in\": %" PRId64 ", \"last_network_out\": %" PRId64 " },\n", + pClients[i].m_aName, pClients[i].m_aType, pClients[i].m_aHost, pClients[i].m_aLocation, pClients[i].m_LastNetworkIN, pClients[i].m_LastNetworkOUT); pBuf += strlen(pBuf); } } @@ -306,7 +496,114 @@ void CMain::JSONUpdateThread(void *pUser) fs_rename(aJSONFileTmp, pConfig->m_aJSONFile); thread_sleep(1000); } - fs_remove(pConfig->m_aJSONFile); + // support by: https://cpp.la. don't remove month traffic record, storage as "stats.json~", remark: 2021-10-18 + // fs_remove(pConfig->m_aJSONFile); + char aJSONFileTmp[1024]; + str_format(aJSONFileTmp, sizeof(aJSONFileTmp), "%s~", pConfig->m_aJSONFile); + fs_rename(pConfig->m_aJSONFile, aJSONFileTmp); +} + +void CMain::offlineAlarmThread(void *pUser) +{ + CJSONUpdateThreadData *m_OfflineAlarmThreadData = (CJSONUpdateThreadData *)pUser; + CClient *pClients = m_OfflineAlarmThreadData->pClients; + CWatchDog *pWatchDogs = m_OfflineAlarmThreadData->pWatchDogs; + volatile short ClientID = m_OfflineAlarmThreadData->m_ReloadRequired; + thread_sleep(25000); + if(!pClients[ClientID].m_Connected) + { + int ID = 0; + while (strcmp(pWatchDogs[ID].m_aName, "NULL")) + { + typedef exprtk::symbol_table symbol_table_t; + typedef exprtk::expression expression_t; + typedef exprtk::parser parser_t; + const std::string expression_string = pWatchDogs[ID].m_aRule; + std::string username = pClients[ClientID].m_aUsername; + std::string name = pClients[ClientID].m_aName; + std::string type = pClients[ClientID].m_aType; + std::string host = pClients[ClientID].m_aHost; + std::string location = pClients[ClientID].m_aLocation; + std::double_t online4 = pClients[ClientID].m_Stats.m_Online4; + std::double_t online6 = pClients[ClientID].m_Stats.m_Online6; + + symbol_table_t symbol_table; + symbol_table.add_stringvar("username", username); + symbol_table.add_stringvar("name", name); + symbol_table.add_stringvar("type", type); + symbol_table.add_stringvar("host", host); + symbol_table.add_stringvar("location", location); + symbol_table.add_variable("online4",online4); + symbol_table.add_variable("online6",online6); + symbol_table.add_constants(); + + expression_t expression; + expression.register_symbol_table(symbol_table); + + parser_t parser; + parser.compile(expression_string,expression); + + if (expression.value() > 0) + { + time_t currentStamp = (long long)time(/*ago*/0); + if ((currentStamp-pClients[ClientID].m_AlarmLastTime) > pWatchDogs[ID].m_aInterval) + { + printf("客户端下线且超过阈值, Client disconnects and sends alert information\n"); + pClients[ClientID].m_AlarmLastTime = currentStamp; + CURL *curl; + CURLcode res; + curl_global_init(CURL_GLOBAL_ALL); + + curl = curl_easy_init(); + if(curl) { + //standard time + char standardTime[32]= { 0 }; + strftime(standardTime, sizeof(standardTime), "%Y-%m-%d %H:%M:%S",localtime(¤tStamp)); + + //url encode, Rules conflict with url special characters，eg：&, del rules, by https://cpp.la, 2023-10-09 + char encodeBuffer[2048] = { 0 }; + sprintf(encodeBuffer, "【告警名称】 %s \n\n【告警时间】 %s \n\n【用户名】 %s \n\n【节点名】 %s \n\n【虚拟化】 %s \n\n【主机名】 %s \n\n【位 置】 %s", + pWatchDogs[ID].m_aName, + standardTime, + pClients[ClientID].m_aUsername, + pClients[ClientID].m_aName, + pClients[ClientID].m_aType, + pClients[ClientID].m_aHost, + pClients[ClientID].m_aLocation); + char *encodeUrl = curl_easy_escape(curl, encodeBuffer, strlen(encodeBuffer)); + + //standard url + char urlBuffer[2048] = { 0 }; + sprintf(urlBuffer, "%s%s",pWatchDogs[ID].m_aCallback, encodeUrl); + + + curl_easy_setopt(curl, CURLOPT_POST, 1L); + curl_easy_setopt(curl, CURLOPT_URL, urlBuffer); + curl_easy_setopt(curl, CURLOPT_POSTFIELDS,"signature=ServerStatus"); + curl_easy_setopt(curl, CURLOPT_SSL_VERIFYPEER, 0); + curl_easy_setopt(curl, CURLOPT_SSL_VERIFYHOST, 0); + curl_easy_setopt(curl, CURLOPT_CONNECTTIMEOUT, 3L); + curl_easy_setopt(curl, CURLOPT_TIMEOUT, 6L); + res = curl_easy_perform(curl); + if(res != CURLE_OK) + fprintf(stderr, "watchdog failed: %s\n", curl_easy_strerror(res)); + if(encodeUrl) + curl_free(encodeUrl); + curl_easy_cleanup(curl); + } + curl_global_cleanup(); + } + else + printf("客户端下线但未超过阈值，No alarm if the threshold is not exceeded\n"); + } + ID++; + } + } + else + { + printf("网络波动，No alarm information is sent due to network fluctuations\n"); + } + fflush(stdout); } int CMain::ReadConfig() @@ -367,21 +664,124 @@ int CMain::ReadConfig() str_copy(Client(ID)->m_aHost, rStart[i]["host"].u.string.ptr, sizeof(Client(ID)->m_aHost)); str_copy(Client(ID)->m_aLocation, rStart[i]["location"].u.string.ptr, sizeof(Client(ID)->m_aLocation)); str_copy(Client(ID)->m_aPassword, rStart[i]["password"].u.string.ptr, sizeof(Client(ID)->m_aPassword)); + //if month start day > 28, diff: 3days(29,30,31) + Client(ID)->m_aMonthStart = rStart[i]["monthstart"].u.integer; + if(Client(ID)->m_aMonthStart > 28) + { + Client(ID)->m_aMonthStart = 28; + } + Client(ID)->m_LastNetworkIN = 0; + Client(ID)->m_LastNetworkOUT = 0; if(m_Config.m_Verbose) { if(Client(ID)->m_Disabled) - dbg_msg("main", "[#%d: Name: \"%s\", Username: \"%s\", Type: \"%s\", Host: \"%s\", Location: \"%s\", Password: \"%s\"]", - ID, Client(ID)->m_aName, Client(ID)->m_aUsername, Client(ID)->m_aType, Client(ID)->m_aHost, Client(ID)->m_aLocation, Client(ID)->m_aPassword); + dbg_msg("main", "[#%d: Name: \"%s\", Username: \"%s\", Type: \"%s\", Host: \"%s\", Location: \"%s\", Password: \"%s\", MonthStart: %\" PRId64 \"]", + ID, Client(ID)->m_aName, Client(ID)->m_aUsername, Client(ID)->m_aType, Client(ID)->m_aHost, Client(ID)->m_aLocation, Client(ID)->m_aPassword, Client(ID)->m_aMonthStart); else - dbg_msg("main", "#%d: Name: \"%s\", Username: \"%s\", Type: \"%s\", Host: \"%s\", Location: \"%s\", Password: \"%s\"", - ID, Client(ID)->m_aName, Client(ID)->m_aUsername, Client(ID)->m_aType, Client(ID)->m_aHost, Client(ID)->m_aLocation, Client(ID)->m_aPassword); + dbg_msg("main", "#%d: Name: \"%s\", Username: \"%s\", Type: \"%s\", Host: \"%s\", Location: \"%s\", Password: \"%s\", MonthStart: %\" PRId64 \"", + ID, Client(ID)->m_aName, Client(ID)->m_aUsername, Client(ID)->m_aType, Client(ID)->m_aHost, Client(ID)->m_aLocation, Client(ID)->m_aPassword, Client(ID)->m_aMonthStart); } ID++; } } + // watch dog + // support by: https://cpp.la + ID = 0; + const json_value &jStart = (*pJsonData)["watchdog"]; + if(jStart.type == json_array) + { + for(unsigned i = 0; i < jStart.u.array.length; i++) + { + if(ID < 0 || ID >= NET_MAX_CLIENTS) + continue; + + str_copy(Watchdog(ID)->m_aName, jStart[i]["name"].u.string.ptr, sizeof(Watchdog(ID)->m_aName)); + str_copy(Watchdog(ID)->m_aRule, jStart[i]["rule"].u.string.ptr, sizeof(Watchdog(ID)->m_aRule)); + Watchdog(ID)->m_aInterval = jStart[i]["interval"].u.integer; + str_copy(Watchdog(ID)->m_aCallback, jStart[i]["callback"].u.string.ptr, sizeof(Watchdog(ID)->m_aCallback)); + + ID++; + } + str_copy(Watchdog(ID)->m_aName, "NULL", sizeof(Watchdog(ID)->m_aName)); + } else + str_copy(Watchdog(ID)->m_aName, "NULL", sizeof(Watchdog(ID)->m_aName)); + + // monitor + // support by: https://cpp.la + ID = 0; + const json_value &mStart = (*pJsonData)["monitors"]; + if(mStart.type == json_array) + { + for(unsigned i = 0; i < mStart.u.array.length; i++) + { + if(ID < 0 || ID >= NET_MAX_CLIENTS) + continue; + + str_copy(Monitors(ID)->m_aName, mStart[i]["name"].u.string.ptr, sizeof(Monitors(ID)->m_aName)); + str_copy(Monitors(ID)->m_aHost, mStart[i]["host"].u.string.ptr, sizeof(Monitors(ID)->m_aHost)); + Monitors(ID)->m_aInterval = mStart[i]["interval"].u.integer; + str_copy(Monitors(ID)->m_aType, mStart[i]["type"].u.string.ptr, sizeof(Monitors(ID)->m_aType)); + + ID++; + } + str_copy(Monitors(ID)->m_aName, "NULL", sizeof(Monitors(ID)->m_aName)); + } else + str_copy(Monitors(ID)->m_aName, "NULL", sizeof(Monitors(ID)->m_aName)); + + // if file exists, read last network traffic record，reset m_LastNetworkIN and m_LastNetworkOUT + // support by: https://cpp.la + IOHANDLE nFile = io_open(m_Config.m_aJSONFile, IOFLAG_READ); + if(!nFile) + { + char aJSONFileTmp[1024]; + str_format(aJSONFileTmp, sizeof(aJSONFileTmp), "%s~", m_Config.m_aJSONFile); + nFile = io_open(aJSONFileTmp, IOFLAG_READ); + } + if(nFile) + { + int nFileSize = (int)io_length(nFile); + char *pNFileData = (char *)mem_alloc(nFileSize + 1, 1); + + io_read(nFile, pNFileData, nFileSize); + pNFileData[nFileSize] = 0; + io_close(nFile); + + json_settings nJsonSettings; + mem_zero(&nJsonSettings, sizeof(nJsonSettings)); + json_value *pNJsonData = json_parse_ex(&nJsonSettings, pNFileData, strlen(pNFileData), aError); + if(pNJsonData) + { + const json_value &cStart = (*pNJsonData)["servers"]; + if(rStart.type == json_array) + { + int ID = 0; + for(unsigned i = 0; i < rStart.u.array.length; i++) + { + if(ID < 0 || ID >= NET_MAX_CLIENTS) + continue; + for(unsigned j = 0; j < cStart.u.array.length; j++) + { + if(strcmp(Client(ID)->m_aName, cStart[j]["name"].u.string.ptr)==0 && + strcmp(Client(ID)->m_aType, cStart[j]["type"].u.string.ptr)==0 && + strcmp(Client(ID)->m_aHost, cStart[j]["host"].u.string.ptr)==0 && + strcmp(Client(ID)->m_aLocation, cStart[j]["location"].u.string.ptr)==0) + { + Client(ID)->m_LastNetworkIN = cStart[j]["last_network_in"].u.integer; + Client(ID)->m_LastNetworkOUT = cStart[j]["last_network_out"].u.integer; + break; + } + } + ID++; + } + } + json_value_free(pNJsonData); + } + mem_free(pNFileData); + } + // clean up json_value_free(pJsonData); mem_free(pFileData); @@ -404,6 +804,7 @@ int CMain::Run() m_JSONUpdateThreadData.m_ReloadRequired = 2; m_JSONUpdateThreadData.pClients = m_aClients; m_JSONUpdateThreadData.pConfig = &m_Config; + m_JSONUpdateThreadData.pWatchDogs = m_aCWatchDogs; void *LoadThread = thread_create(JSONUpdateThread, &m_JSONUpdateThreadData); //thread_detach(LoadThread); @@ -486,3 +887,4 @@ int main(int argc, const char *argv[]) return RetVal; } + diff --git a/server/src/main.h b/server/src/main.h index c1c9c65e..cc6e518d 100644 --- a/server/src/main.h +++ b/server/src/main.h @@ -36,15 +36,20 @@ class CMain char m_aHost[128]; char m_aLocation[128]; char m_aPassword[128]; + int m_aMonthStart; //track month network traffic. by: https://cpp.la - int64 m_TimeConnected; - int64 m_LastUpdate; + int64_t m_LastNetworkIN; //restore month traffic info. + int64_t m_LastNetworkOUT; //restore month traffic info. + int64_t m_TimeConnected; + int64_t m_LastUpdate; + int64_t m_AlarmLastTime; //record last alarm time. struct CStats { bool m_Online4; bool m_Online6; - bool m_IpStatus; //mh361 or mh370, mourn mh370, 2014-03-08 01:20　lost from all over the world. by:cpp.la + // bool m_IpStatus， delete ip_status check, Duplicate packet loss rate detection + // mh361 or mh370, mourn mh370, 2014-03-08 01:20　lost from all over the world. by:https://cpp.la int64_t m_Uptime; double m_Load_1; double m_Load_5; @@ -69,21 +74,39 @@ class CMain int64_t m_udpCount; int64_t m_processCount; int64_t m_threadCount; + int64_t m_IORead; + int64_t m_IOWrite; double m_CPU; - char m_aCustom[512]; + char m_aCustom[1024]; // Options bool m_Pong; } m_Stats; } m_aClients[NET_MAX_CLIENTS]; + struct CWatchDog{ + char m_aName[128]; + char m_aRule[128]; + int m_aInterval; + char m_aCallback[1024]; + } m_aCWatchDogs[NET_MAX_CLIENTS]; + + struct CMonitors{ + char m_aName[128]; + char m_aHost[128]; + int m_aInterval; + char m_aType[128]; + } m_aCMonitors[NET_MAX_CLIENTS]; + struct CJSONUpdateThreadData { CClient *pClients; CConfig *pConfig; + CWatchDog *pWatchDogs; volatile short m_ReloadRequired; - } m_JSONUpdateThreadData; + } m_JSONUpdateThreadData, m_OfflineAlarmThreadData; static void JSONUpdateThread(void *pUser); + static void offlineAlarmThread(void *pUser); public: CMain(CConfig Config); @@ -93,6 +116,16 @@ class CMain int ReadConfig(); int Run(); + CWatchDog *Watchdog(int ruleID) { return &m_aCWatchDogs[ruleID]; } + CMonitors *Monitors(int ruleID) { return &m_aCMonitors[ruleID]; } + + void WatchdogMessage(int ClientNetID, + double load_1, double load_5, double load_15, double ping_10010, double ping_189, double ping_10086, + double time_10010, double time_189, double time_10086, double tcp_count, double udp_count, double process_count, double thread_count, + double network_rx, double network_tx, double network_in, double network_out, double last_network_in, double last_network_out, + double memory_total, double memory_used,double swap_total, double swap_used, double hdd_total, + double hdd_used, double io_read, double io_write, double cpu,double online4, double online6); + CClient *Client(int ClientID) { return &m_aClients[ClientID]; } CClient *ClientNet(int ClientNetID); const CConfig *Config() const { return &m_Config; } diff --git a/server/src/network.h b/server/src/network.h index 5dc23962..49187f85 100644 --- a/server/src/network.h +++ b/server/src/network.h @@ -10,7 +10,7 @@ enum NET_CONNSTATE_ERROR=4, NET_MAX_PACKETSIZE = 1400, - NET_MAX_CLIENTS = 128 + NET_MAX_CLIENTS = 512 }; typedef int (*NETFUNC_DELCLIENT)(int ClientID, const char* pReason, void *pUser); diff --git a/service/status-client.service b/service/status-client.service new file mode 100644 index 00000000..350a96ec --- /dev/null +++ b/service/status-client.service @@ -0,0 +1,9 @@ +[Unit] +Description=ServerStatus-Client +After=network.target +[Service] +ExecStart=/usr/bin/python3 /usr/local/ServerStatus/clients/client-linux.py +ExecReload=/bin/kill -HUP $MAINPID +Restart=on-failure +[Install] +WantedBy=multi-user.target diff --git a/service/status-server.service b/service/status-server.service new file mode 100644 index 00000000..64d48aef --- /dev/null +++ b/service/status-server.service @@ -0,0 +1,9 @@ +[Unit] +Description=ServerStatus-Server +After=network.target +[Service] +ExecStart=/usr/local/ServerStatus/server/sergate --config=/usr/local/ServerStatus/server/config.json --web-dir=/usr/local/ServerStatus/web +ExecReload=/bin/kill -HUP $MAINPID +Restart=on-failure +[Install] +WantedBy=multi-user.target diff --git a/status.sh b/status.sh new file mode 100644 index 00000000..ba640460 --- /dev/null +++ b/status.sh @@ -0,0 +1,1041 @@ +#!/usr/bin/env bash +PATH=/bin:/sbin:/usr/bin:/usr/sbin:/usr/local/bin:/usr/local/sbin:~/bin +export PATH + +sh_ver="1.0.0" + +filepath=$( + cd "$(dirname "$0")" || exit + pwd +) +file_1=$(echo -e "${filepath}" | awk -F "$0" '{print $1}') +file="/usr/local/ServerStatus" +web_file="/usr/local/ServerStatus/web" +server_file="/usr/local/ServerStatus/server" +server_conf="/usr/local/ServerStatus/server/config.json" +server_conf_1="/usr/local/ServerStatus/server/config.conf" +plugin_file="/usr/local/ServerStatus/plugin" +client_file="/usr/local/ServerStatus/clients" +service="/usr/lib/systemd/system" +jq_file="${file}/jq" +[[ ! -e ${jq_file} ]] && jq_file="/usr/bin/jq" + +github_prefix="https://raw.githubusercontent.com/cppla/ServerStatus/master" + +NAME="ServerStatus" +Green_font_prefix="\033[32m" && Red_font_prefix="\033[31m" && Red_background_prefix="\033[41;37m" && Font_color_suffix="\033[0m" +Info="${Green_font_prefix}[信息]${Font_color_suffix}" +Error="${Red_font_prefix}[错误]${Font_color_suffix}" +Tip="${Green_font_prefix}[注意]${Font_color_suffix}" + +#检查系统 +check_sys() { + if [[ -f /etc/redhat-release ]]; then + release="centos" + elif grep -q -E -i "debian|ubuntu" /etc/issue; then + release="debian" + elif grep -q -E -i "centonetstat -tunlps|red hat|redhat" /etc/issue; then + release="centos" + elif grep -q -E -i "Arch|Manjaro" /etc/issue; then + release="archlinux" + elif grep -q -E -i "debian|ubuntu" /proc/version; then + release="debian" + elif grep -q -E -i "centos|red hat|redhat" /proc/version; then + release="centos" + else + echo -e "ServerStatus 暂不支持该Linux发行版" + fi + bit=$(uname -m) +} + +check_installed_server_status() { + [[ ! -e "${server_file}/sergate" ]] && echo -e "${Error} $NAME 服务端没有安装，请检查 !" && exit 1 +} + +check_installed_client_status() { + [[ ! -e "${client_file}/client-linux.py" ]] && echo -e "${Error} $NAME 客户端没有安装，请检查 !" && exit 1 +} + +Download_Server_Status_server() { + cd "/tmp" || exit 1 + wget -N --no-check-certificate https://github.com/cppla/ServerStatus/archive/refs/heads/master.zip + [[ ! -e "master.zip" ]] && echo -e "${Error} ServerStatus 服务端下载失败 !" && exit 1 + unzip master.zip + rm -rf master.zip + [[ ! -d "/tmp/ServerStatus-master" ]] && echo -e "${Error} ServerStatus 服务端解压失败 !" && exit 1 + cd "/tmp/ServerStatus-master/server" || exit 1 + make + [[ ! -e "sergate" ]] && echo -e "${Error} ServerStatus 服务端编译失败 !" && cd "${file_1}" && rm -rf "/tmp//ServerStatus-master" && exit 1 + cd "${file_1}" || exit 1 + mkdir -p "${server_file}" + mv "/tmp/ServerStatus-master/server" "${file}" + mv "/tmp/ServerStatus-master/web" "${file}" + mv "/tmp/ServerStatus-master/plugin" "${file}" + rm -rf "/tmp/ServerStatus-master" + if [[ ! -e "${server_file}/sergate" ]]; then + echo -e "${Error} ServerStatus 服务端移动重命名失败 !" + [[ -e "${server_file}/sergate1" ]] && mv "${server_file}/sergate1" "${server_file}/sergate" + exit 1 + else + [[ -e "${server_file}/sergate1" ]] && rm -rf "${server_file}/sergate1" + fi +} + +Download_Server_Status_client() { +mkdir -p "${client_file}" +wget -N --no-check-certificate "${github_prefix}/clients/client-linux.py" -P "${client_file}" +} + +Download_Server_Status_Service() { + mode=$1 + [[ -z ${mode} ]] && mode="server" + local service_note="服务端" + [[ ${mode} == "client" ]] && service_note="客户端" + wget --no-check-certificate "${github_prefix}/service/status-${mode}.service" -O "${service}/status-${mode}.service" || + { + echo -e "${Error} $NAME ${service_note}服务管理脚本下载失败 !" + exit 1 + } + systemctl enable "status-${mode}.service" + echo -e "${Info} $NAME ${service_note}服务管理脚本下载完成 !" +} + +Service_Server_Status_server() { + Download_Server_Status_Service "server" +} + +Service_Server_Status_client() { + Download_Server_Status_Service "client" +} + +Installation_dependency() { + mode=$1 + if [[ ${release} == "centos" ]]; then + yum makecache + yum -y install unzip + yum -y install python3 >/dev/null 2>&1 || yum -y install python + [[ ${mode} == "server" ]] && yum -y groupinstall "Development Tools" + elif [[ ${release} == "debian" ]]; then + apt -y update + apt -y install unzip + apt -y install python3 >/dev/null 2>&1 || apt -y install python + [[ ${mode} == "server" ]] && apt -y install build-essential + elif [[ ${release} == "archlinux" ]]; then + pacman -Sy python python-pip unzip --noconfirm + [[ ${mode} == "server" ]] && pacman -Sy base-devel --noconfirm + fi + [[ ! -e /usr/bin/python ]] && ln -s /usr/bin/python3 /usr/bin/python +} + +Write_server_config() { + cat >${server_conf} <<-EOF +{ + "servers": [ + { + "username": "s01", + "password": "password", + "name": "vps-1", + "type": "KVM", + "host": "azure", + "location": "Hong Kong", + "monthstart": 1 + } + ] +} +EOF +} + +Write_server_config_conf() { + cat >${server_conf_1} <<-EOF +PORT = ${server_port_s} +EOF +} + +Read_config_client() { + client_text="$(sed 's/\"//g;s/,//g;s/ //g' "${client_file}/client-linux.py") " + client_server="$(echo -e "${client_text}" | grep "SERVER=" | awk -F "=" '{print $2;exit}')" + client_port="$(echo -e "${client_text}" | grep "PORT=" | awk -F "=" '{print $2;exit}')" + client_user="$(echo -e "${client_text}" | grep "USER=" | awk -F "=" '{print $2;exit}')" + client_password="$(echo -e "${client_text}" | grep "PASSWORD=" | awk -F "=" '{print $2;exit}')" +} + +Read_config_server() { + if [[ ! -e "${server_conf_1}" ]]; then + server_port_s="35601" + Write_server_config_conf + server_port="35601" + else + server_port="$(grep "PORT = " ${server_conf_1} | awk '{print $3}')" + fi +} + +Set_server() { + mode=$1 + [[ -z ${mode} ]] && mode="server" + if [[ ${mode} == "server" ]]; then + echo -e "请输入 $NAME 服务端中网站要设置的 域名[server] +默认为本机IP为域名，例如输入: toyoo.pw ，如果要使用本机IP，请留空直接回车" + read -erp "(默认: 本机IP):" server_s + [[ -z "$server_s" ]] && server_s="" + else + echo -e "请输入 $NAME 服务端的 IP/域名[server]，请注意，如果你的域名使用了CDN，请直接填写IP" + read -erp "(默认: 127.0.0.1):" server_s + [[ -z "$server_s" ]] && server_s="127.0.0.1" + fi + + echo && echo " ================================================" + echo -e " IP/域名[server]: ${Red_background_prefix} ${server_s} ${Font_color_suffix}" + echo " ================================================" && echo +} + +Set_server_http_port() { + while true; do + echo -e "请输入 $NAME 服务端中网站要设置的 域名/IP的端口[1-65535]（如果是域名的话，一般用 80 端口）" + read -erp "(默认: 8888):" server_http_port_s + [[ -z "$server_http_port_s" ]] && server_http_port_s="8888" + if [[ "$server_http_port_s" =~ ^[0-9]*$ ]]; then + if [[ ${server_http_port_s} -ge 1 ]] && [[ ${server_http_port_s} -le 65535 ]]; then + echo && echo " ================================================" + echo -e " 端口: ${Red_background_prefix} ${server_http_port_s} ${Font_color_suffix}" + echo " ================================================" && echo + break + else + echo "输入错误, 请输入正确的端口。" + fi + else + echo "输入错误, 请输入正确的端口。" + fi + done +} + +Set_server_port() { + while true; do + echo -e "请输入 $NAME 服务端监听的端口[1-65535]（用于服务端接收客户端消息的端口，客户端要填写这个端口）" + read -erp "(默认: 35601):" server_port_s + [[ -z "$server_port_s" ]] && server_port_s="35601" + if [[ "$server_port_s" =~ ^[0-9]*$ ]]; then + if [[ ${server_port_s} -ge 1 ]] && [[ ${server_port_s} -le 65535 ]]; then + echo && echo " ================================================" + echo -e " 端口: ${Red_background_prefix} ${server_port_s} ${Font_color_suffix}" + echo " ================================================" && echo + break + else + echo "输入错误, 请输入正确的端口。" + fi + else + echo "输入错误, 请输入正确的端口。" + fi + done +} + +Set_username() { + mode=$1 + [[ -z ${mode} ]] && mode="server" + if [[ ${mode} == "server" ]]; then + echo -e "请输入 $NAME 服务端要设置的用户名[username]（字母/数字，不可与其他账号重复）" + else + echo -e "请输入 $NAME 服务端中对应配置的用户名[username]（字母/数字，不可与其他账号重复）" + fi + read -erp "(默认: 取消):" username_s + [[ -z "$username_s" ]] && echo "已取消..." && exit 0 + echo && echo " ================================================" + echo -e " 账号[username]: ${Red_background_prefix} ${username_s} ${Font_color_suffix}" + echo " ================================================" && echo +} + +Set_password() { + mode=$1 + [[ -z ${mode} ]] && mode="server" + if [[ ${mode} == "server" ]]; then + echo -e "请输入 $NAME 服务端要设置的密码[password]（字母/数字，可重复）" + else + echo -e "请输入 $NAME 服务端中对应配置的密码[password]（字母/数字）" + fi + read -erp "(默认: serverstatus):" password_s + [[ -z "$password_s" ]] && password_s="serverstatus" + echo && echo " ================================================" + echo -e " 密码[password]: ${Red_background_prefix} ${password_s} ${Font_color_suffix}" + echo " ================================================" && echo +} + +Set_name() { + echo -e "请输入 $NAME 服务端要设置的节点名称[name]（支持中文，前提是你的系统和SSH工具支持中文输入，仅仅是个名字）" + read -erp "(默认: Server 01):" name_s + [[ -z "$name_s" ]] && name_s="Server 01" + echo && echo " ================================================" + echo -e " 节点名称[name]: ${Red_background_prefix} ${name_s} ${Font_color_suffix}" + echo " ================================================" && echo +} + +Set_type() { + echo -e "请输入 $NAME 服务端要设置的节点虚拟化类型[type]（例如 OpenVZ / KVM）" + read -erp "(默认: KVM):" type_s + [[ -z "$type_s" ]] && type_s="KVM" + echo && echo " ================================================" + echo -e " 虚拟化类型[type]: ${Red_background_prefix} ${type_s} ${Font_color_suffix}" + echo " ================================================" && echo +} + +Set_location() { + echo -e "请输入 $NAME 服务端要设置的节点位置[location]（支持中文，前提是你的系统和SSH工具支持中文输入）" + read -erp "(默认: Hong Kong):" location_s + [[ -z "$location_s" ]] && location_s="Hong Kong" + echo && echo " ================================================" + echo -e " 节点位置[location]: ${Red_background_prefix} ${location_s} ${Font_color_suffix}" + echo " ================================================" && echo +} + +Set_monthstart() { + echo -e "请输入 $NAME 服务端要设置的节点月重置流量日[monthstart]（每月流量归零的日期（1~28），默认为1（即每月1日））" + read -erp "(默认: 1):" monthstart_s + [[ -z "$monthstart_s" ]] && monthstart_s="1" + echo && echo " ================================================" + echo -e " 月流量重置日[monthstart]: ${Red_background_prefix} ${monthstart_s} ${Font_color_suffix}" + echo " ================================================" && echo +} + +Set_config_server() { + Set_username "server" + Set_password "server" + Set_name + Set_type + Set_location + Set_monthstart +} + +Set_config_client() { + Set_server "client" + Set_server_port + Set_username "client" + Set_password "client" +} + +Set_ServerStatus_server() { + check_installed_server_status + echo && echo -e " 你要做什么？ + + ${Green_font_prefix} 1.${Font_color_suffix} 添加 节点配置 + ${Green_font_prefix} 2.${Font_color_suffix} 删除 节点配置 +———————— + ${Green_font_prefix} 3.${Font_color_suffix} 修改 节点配置 - 节点用户名 + ${Green_font_prefix} 4.${Font_color_suffix} 修改 节点配置 - 节点密码 + ${Green_font_prefix} 5.${Font_color_suffix} 修改 节点配置 - 节点名称 + ${Green_font_prefix} 6.${Font_color_suffix} 修改 节点配置 - 节点虚拟化 + ${Green_font_prefix} 7.${Font_color_suffix} 修改 节点配置 - 节点位置 + ${Green_font_prefix} 8.${Font_color_suffix} 修改 节点配置 - 月流量重置日 + ${Green_font_prefix} 9.${Font_color_suffix} 修改 节点配置 - 全部参数 +———————— + ${Green_font_prefix}10.${Font_color_suffix} 修改 服务端监听端口" && echo + read -erp "(默认: 取消):" server_num + [[ -z "${server_num}" ]] && echo "已取消..." && exit 1 + if [[ ${server_num} == "1" ]]; then + Add_ServerStatus_server + elif [[ ${server_num} == "2" ]]; then + Del_ServerStatus_server + elif [[ ${server_num} == "3" ]]; then + Modify_ServerStatus_server_username + elif [[ ${server_num} == "4" ]]; then + Modify_ServerStatus_server_password + elif [[ ${server_num} == "5" ]]; then + Modify_ServerStatus_server_name + elif [[ ${server_num} == "6" ]]; then + Modify_ServerStatus_server_type + elif [[ ${server_num} == "7" ]]; then + Modify_ServerStatus_server_location + elif [[ ${server_num} == "8" ]]; then + Modify_ServerStatus_server_monthstart + elif [[ ${server_num} == "9" ]]; then + Modify_ServerStatus_server_all + elif [[ ${server_num} == "10" ]]; then + Read_config_server + Set_server_port + Write_server_config_conf + else + echo -e "${Error} 请输入正确的数字[1-10]" && exit 1 + fi + Restart_ServerStatus_server +} + +List_ServerStatus_server() { + conf_text=$(${jq_file} '.servers' ${server_conf} | ${jq_file} ".[]|.username" | sed 's/\"//g') + conf_text_total=$(echo -e "${conf_text}" | wc -l) + [[ ${conf_text_total} == "0" ]] && echo -e "${Error} 没有发现 一个节点配置，请检查 !" && exit 1 + conf_text_total_a=$((conf_text_total - 1)) + conf_list_all="" + for ((integer = 0; integer <= conf_text_total_a; integer++)); do + now_text=$(${jq_file} '.servers' ${server_conf} | ${jq_file} ".[${integer}]" | sed 's/\"//g;s/,$//g' | sed '$d;1d') + now_text_username=$(echo -e "${now_text}" | grep "username" | awk -F ": " '{print $2}') + now_text_password=$(echo -e "${now_text}" | grep "password" | awk -F ": " '{print $2}') + now_text_name=$(echo -e "${now_text}" | grep "name" | grep -v "username" | awk -F ": " '{print $2}') + now_text_type=$(echo -e "${now_text}" | grep "type" | awk -F ": " '{print $2}') + now_text_location=$(echo -e "${now_text}" | grep "location" | awk -F ": " '{print $2}') + now_text_monthstart=$(echo -e "${now_text}" | grep "monthstart" | awk -F ": " '{print $2}') + if [[ ${now_text_disabled} == "false" ]]; then + now_text_disabled_status="${Green_font_prefix}启用${Font_color_suffix}" + else + now_text_disabled_status="${Red_font_prefix}禁用${Font_color_suffix}" + fi + conf_list_all=${conf_list_all}"用户名: ${Green_font_prefix}${now_text_username}${Font_color_suffix} 密码: ${Green_font_prefix}${now_text_password}${Font_color_suffix} 节点名: ${Green_font_prefix}${now_text_name}${Font_color_suffix} 虚拟化: ${Green_font_prefix}${now_text_type}${Font_color_suffix} 位置: ${Green_font_prefix}${now_text_location}${Font_color_suffix} 月流量重置日: ${Green_font_prefix}${now_text_monthstart}${Font_color_suffix}\n" + done + echo && echo -e "节点总数 ${Green_font_prefix}${conf_text_total}${Font_color_suffix}" + echo -e "${conf_list_all}" +} + +Add_ServerStatus_server() { + Set_config_server + Set_username_ch=$(grep '"username": "'"${username_s}"'"' ${server_conf}) + [[ -n "${Set_username_ch}" ]] && echo -e "${Error} 用户名已被使用 !" && exit 1 + sed -i '3i\ },' ${server_conf} + sed -i '3i\ "monthstart": '"${monthstart_s}"'' ${server_conf} + sed -i '3i\ "location": "'"${location_s}"'",' ${server_conf} + sed -i '3i\ "host": "'"None"'",' ${server_conf} + sed -i '3i\ "type": "'"${type_s}"'",' ${server_conf} + sed -i '3i\ "name": "'"${name_s}"'",' ${server_conf} + sed -i '3i\ "password": "'"${password_s}"'",' ${server_conf} + sed -i '3i\ "username": "'"${username_s}"'",' ${server_conf} + sed -i '3i\ {' ${server_conf} + echo -e "${Info} 添加节点成功 ${Green_font_prefix}[ 节点名称: ${name_s}, 节点用户名: ${username_s}, 节点密码: ${password_s} ]${Font_color_suffix} !" +} + +Del_ServerStatus_server() { + List_ServerStatus_server + [[ "${conf_text_total}" == "1" ]] && echo -e "${Error} 节点配置仅剩 1个，不能删除 !" && exit 1 + echo -e "请输入要删除的节点用户名" + read -erp "(默认: 取消):" del_server_username + [[ -z "${del_server_username}" ]] && echo -e "已取消..." && exit 1 + del_username=$(cat -n ${server_conf} | grep '"username": "'"${del_server_username}"'"' | awk '{print $1}') + if [[ -n ${del_username} ]]; then + del_username_min=$((del_username - 1)) + del_username_max=$((del_username + 7)) + del_username_max_text=$(sed -n "${del_username_max}p" ${server_conf}) + del_username_max_text_last=${del_username_max_text:((${#del_username_max_text} - 1))} + if [[ ${del_username_max_text_last} != "," ]]; then + del_list_num=$((del_username_min - 1)) + sed -i "${del_list_num}s/,$//g" ${server_conf} + fi + sed -i "${del_username_min},${del_username_max}d" ${server_conf} + echo -e "${Info} 节点删除成功 ${Green_font_prefix}[ 节点用户名: ${del_server_username} ]${Font_color_suffix} " + else + echo -e "${Error} 请输入正确的节点用户名 !" && exit 1 + fi +} + +Modify_ServerStatus_server_username() { + List_ServerStatus_server + echo -e "请输入要修改的节点用户名" + read -erp "(默认: 取消):" manually_username + [[ -z "${manually_username}" ]] && echo -e "已取消..." && exit 1 + Set_username_num=$(cat -n ${server_conf} | grep '"username": "'"${manually_username}"'"' | awk '{print $1}') + if [[ -n ${Set_username_num} ]]; then + Set_username + Set_username_ch=$(grep '"username": "'"${username_s}"'"' ${server_conf}) + [[ -n "${Set_username_ch}" ]] && echo -e "${Error} 用户名已被使用 !" && exit 1 + sed -i "${Set_username_num}"'s/"username": "'"${manually_username}"'"/"username": "'"${username_s}"'"/g' ${server_conf} + echo -e "${Info} 修改成功 [ 原节点用户名: ${manually_username}, 新节点用户名: ${username_s} ]" + else + echo -e "${Error} 请输入正确的节点用户名 !" && exit 1 + fi +} + +Modify_ServerStatus_server_password() { + List_ServerStatus_server + echo -e "请输入要修改的节点用户名" + read -erp "(默认: 取消):" manually_username + [[ -z "${manually_username}" ]] && echo -e "已取消..." && exit 1 + Set_username_num=$(cat -n ${server_conf} | grep '"username": "'"${manually_username}"'"' | awk '{print $1}') + if [[ -n ${Set_username_num} ]]; then + Set_password + Set_password_num_a=$((Set_username_num + 1)) + Set_password_num_text=$(sed -n "${Set_password_num_a}p" ${server_conf} | sed 's/\"//g;s/,$//g' | awk -F ": " '{print $2}') + sed -i "${Set_password_num_a}"'s/"password": "'"${Set_password_num_text}"'"/"password": "'"${password_s}"'"/g' ${server_conf} + echo -e "${Info} 修改成功 [ 原节点密码: ${Set_password_num_text}, 新节点密码: ${password_s} ]" + else + echo -e "${Error} 请输入正确的节点用户名 !" && exit 1 + fi +} + +Modify_ServerStatus_server_name() { + List_ServerStatus_server + echo -e "请输入要修改的节点用户名" + read -erp "(默认: 取消):" manually_username + [[ -z "${manually_username}" ]] && echo -e "已取消..." && exit 1 + Set_username_num=$(cat -n ${server_conf} | grep '"username": "'"${manually_username}"'"' | awk '{print $1}') + if [[ -n ${Set_username_num} ]]; then + Set_name + Set_name_num_a=$((Set_username_num + 2)) + Set_name_num_a_text=$(sed -n "${Set_name_num_a}p" ${server_conf} | sed 's/\"//g;s/,$//g' | awk -F ": " '{print $2}') + sed -i "${Set_name_num_a}"'s/"name": "'"${Set_name_num_a_text}"'"/"name": "'"${name_s}"'"/g' ${server_conf} + echo -e "${Info} 修改成功 [ 原节点名称: ${Set_name_num_a_text}, 新节点名称: ${name_s} ]" + else + echo -e "${Error} 请输入正确的节点用户名 !" && exit 1 + fi +} + +Modify_ServerStatus_server_type() { + List_ServerStatus_server + echo -e "请输入要修改的节点用户名" + read -erp "(默认: 取消):" manually_username + [[ -z "${manually_username}" ]] && echo -e "已取消..." && exit 1 + Set_username_num=$(cat -n ${server_conf} | grep '"username": "'"${manually_username}"'"' | awk '{print $1}') + if [[ -n ${Set_username_num} ]]; then + Set_type + Set_type_num_a=$((Set_username_num + 3)) + Set_type_num_a_text=$(sed -n "${Set_type_num_a}p" ${server_conf} | sed 's/\"//g;s/,$//g' | awk -F ": " '{print $2}') + sed -i "${Set_type_num_a}"'s/"type": "'"${Set_type_num_a_text}"'"/"type": "'"${type_s}"'"/g' ${server_conf} + echo -e "${Info} 修改成功 [ 原节点虚拟化: ${Set_type_num_a_text}, 新节点虚拟化: ${type_s} ]" + else + echo -e "${Error} 请输入正确的节点用户名 !" && exit 1 + fi +} + +Modify_ServerStatus_server_location() { + List_ServerStatus_server + echo -e "请输入要修改的节点用户名" + read -erp "(默认: 取消):" manually_username + [[ -z "${manually_username}" ]] && echo -e "已取消..." && exit 1 + Set_username_num=$(cat -n ${server_conf} | grep '"username": "'"${manually_username}"'"' | awk '{print $1}') + if [[ -n ${Set_username_num} ]]; then + Set_location + Set_location_num_a=$((Set_username_num + 5)) + Set_location_num_a_text=$(sed -n "${Set_location_num_a}p" ${server_conf} | sed 's/\"//g;s/,$//g' | awk -F ": " '{print $2}') + sed -i "${Set_location_num_a}"'s/"location": "'"${Set_location_num_a_text}"'"/"location": "'"${location_s}"'"/g' ${server_conf} + echo -e "${Info} 修改成功 [ 原节点位置: ${Set_location_num_a_text}, 新节点位置: ${location_s} ]" + else + echo -e "${Error} 请输入正确的节点用户名 !" && exit 1 + fi +} + +Modify_ServerStatus_server_monthstart() { + List_ServerStatus_server + echo -e "请输入要修改的节点用户名" + read -erp "(默认: 取消):" manually_username + [[ -z "${manually_username}" ]] && echo -e "已取消..." && exit 1 + Set_username_num=$(cat -n ${server_conf} | grep '"username": "'"${manually_username}"'"' | awk '{print $1}') + if [[ -n ${Set_username_num} ]]; then + Set_monthstart + Set_monthstart_num_a=$((Set_username_num + 6)) + Set_monthstart_num_text=$(sed -n "${Set_monthstart_num_a}p" ${server_conf} | sed 's/\"//g;s/,$//g' | awk -F ": " '{print $2}') + sed -i "${Set_monthstart_num_a}"'s/"monthstart": '"${Set_monthstart_num_text}"'/"monthstart": '"${monthstart_s}"'/g' ${server_conf} + echo -e "${Info} 修改成功 [ 原月流量重置日: ${Set_monthstart_num_text}, 新月流量重置日: ${monthstart_s} ]" + else + echo -e "${Error} 请输入正确的节点用户名 !" && exit 1 + fi +} + +Modify_ServerStatus_server_all() { + List_ServerStatus_server + echo -e "请输入要修改的节点用户名" + read -erp "(默认: 取消):" manually_username + [[ -z "${manually_username}" ]] && echo -e "已取消..." && exit 1 + Set_username_num=$(cat -n ${server_conf} | grep '"username": "'"${manually_username}"'"' | awk '{print $1}') + if [[ -n ${Set_username_num} ]]; then + Set_username + Set_password + Set_name + Set_type + Set_location + Set_monthstart + sed -i "${Set_username_num}"'s/"username": "'"${manually_username}"'"/"username": "'"${username_s}"'"/g' ${server_conf} + Set_password_num_a=$((Set_username_num + 1)) + Set_password_num_text=$(sed -n "${Set_password_num_a}p" ${server_conf} | sed 's/\"//g;s/,$//g' | awk -F ": " '{print $2}') + sed -i "${Set_password_num_a}"'s/"password": "'"${Set_password_num_text}"'"/"password": "'"${password_s}"'"/g' ${server_conf} + Set_name_num_a=$((Set_username_num + 2)) + Set_name_num_a_text=$(sed -n "${Set_name_num_a}p" ${server_conf} | sed 's/\"//g;s/,$//g' | awk -F ": " '{print $2}') + sed -i "${Set_name_num_a}"'s/"name": "'"${Set_name_num_a_text}"'"/"name": "'"${name_s}"'"/g' ${server_conf} + Set_type_num_a=$((Set_username_num + 3)) + Set_type_num_a_text=$(sed -n "${Set_type_num_a}p" ${server_conf} | sed 's/\"//g;s/,$//g' | awk -F ": " '{print $2}') + sed -i "${Set_type_num_a}"'s/"type": "'"${Set_type_num_a_text}"'"/"type": "'"${type_s}"'"/g' ${server_conf} + Set_location_num_a=$((Set_username_num + 5)) + Set_location_num_a_text=$(sed -n "${Set_location_num_a}p" ${server_conf} | sed 's/\"//g;s/,$//g' | awk -F ": " '{print $2}') + sed -i "${Set_location_num_a}"'s/"location": "'"${Set_location_num_a_text}"'"/"location": "'"${location_s}"'"/g' ${server_conf} + Set_monthstart_num_a=$((Set_username_num + 6)) + Set_monthstart_num_a_text=$(sed -n "${Set_monthstart_num_a}p" ${server_conf} | sed 's/\"//g;s/,$//g' | awk -F ": " '{print $2}') + sed -i "${Set_monthstart_num_a}"'s/"monthstart": '"${Set_monthstart_num_a_text}"'/"monthstart": '"${monthstart_s}"'/g' ${server_conf} + echo -e "${Info} 修改成功。" + else + echo -e "${Error} 请输入正确的节点用户名 !" && exit 1 + fi +} + +Modify_ServerStatus_server_disabled() { + List_ServerStatus_server + echo -e "请输入要修改的节点用户名" + read -erp "(默认: 取消):" manually_username + [[ -z "${manually_username}" ]] && echo -e "已取消..." && exit 1 + Set_username_num=$(cat -n ${server_conf} | grep '"username": "'"${manually_username}"'"' | awk '{print $1}') + if [[ -n ${Set_username_num} ]]; then + Set_disabled_num_a=$((Set_username_num + 6)) + Set_disabled_num_a_text=$(sed -n "${Set_disabled_num_a}p" ${server_conf} | sed 's/\"//g;s/,$//g' | awk -F ": " '{print $2}') + if [[ ${Set_disabled_num_a_text} == "false" ]]; then + disabled_s="true" + else + disabled_s="false" + fi + sed -i "${Set_disabled_num_a}"'s/"disabled": '"${Set_disabled_num_a_text}"'/"disabled": '"${disabled_s}"'/g' ${server_conf} + echo -e "${Info} 修改成功 [ 原禁用状态: ${Set_disabled_num_a_text}, 新禁用状态: ${disabled_s} ]" + else + echo -e "${Error} 请输入正确的节点用户名 !" && exit 1 + fi +} + +Set_ServerStatus_client() { + check_installed_client_status + Set_config_client + Read_config_client + Modify_config_client + Restart_ServerStatus_client +} + +Modify_config_client() { + sed -i '0,/SERVER = "'"${client_server}"'"/s//SERVER = "'"${server_s}"'"/' "${client_file}/client-linux.py" + sed -i '0,/PORT = ${client_port}/s//PORT = ${server_port_s}/' "${client_file}/client-linux.py" + sed -i '0,/USER = "'"${client_user}"'"/s//USER = "'"${username_s}"'"/' "${client_file}/client-linux.py" + sed -i '0,/PASSWORD = "'"${client_password}"'"/s//PASSWORD = "'"${password_s}"'"/' "${client_file}/client-linux.py" +} + +Install_jq() { + [[ ${mirror_num} == 2 ]] && { + github_link="https://hub.fastgit.org" + raw_link="https://raw.fastgit.org" + } || { + github_link="https://github.com" + raw_link="https://raw.githubusercontent.com" + } + if [[ ! -e ${jq_file} ]]; then + if [[ ${bit} == "x86_64" ]]; then + jq_file="${file}/jq" + wget --no-check-certificate "${github_link}/stedolan/jq/releases/download/jq-1.5/jq-linux64" -O ${jq_file} + elif [[ ${bit} == "i386" ]]; then + jq_file="${file}/jq" + wget --no-check-certificate "${github_link}/stedolan/jq/releases/download/jq-1.5/jq-linux32" -O ${jq_file} + else + # ARM fallback to package manager + [[ ${release} == "archlinux" ]] && pacman -Sy jq --noconfirm + [[ ${release} == "centos" ]] && yum -y install jq + [[ ${release} == "debian" ]] && apt -y install jq + jq_file="/usr/bin/jq" + fi + [[ ! -e ${jq_file} ]] && echo -e "${Error} JQ解析器 下载失败，请检查 !" && exit 1 + chmod +x ${jq_file} + echo -e "${Info} JQ解析器 安装完成，继续..." + else + echo -e "${Info} JQ解析器 已安装，继续..." + fi +} + +Install_caddy() { + echo + echo -e "${Info} 是否由脚本自动配置HTTP服务(服务端的在线监控网站)，如果选择 N，则请在其他HTTP服务中配置网站根目录为：${Green_font_prefix}${web_file}${Font_color_suffix} [Y/n]" + read -erp "(默认: Y 自动部署):" caddy_yn + [[ -z "$caddy_yn" ]] && caddy_yn="y" + if [[ "${caddy_yn}" == [Yy] ]]; then + caddy_file="/etc/caddy/Caddyfile" # Where is the default Caddyfile specified in Archlinux? + [[ ! -e /usr/bin/caddy ]] && { + if [[ ${release} == "debian" ]]; then + apt install -y debian-keyring debian-archive-keyring apt-transport-https curl + curl -1sLf "https://dl.cloudsmith.io/public/caddy/stable/gpg.key" | tee /etc/apt/trusted.gpg.d/caddy-stable.asc + curl -1sLf "https://dl.cloudsmith.io/public/caddy/stable/debian.deb.txt" | tee /etc/apt/sources.list.d/caddy-stable.list + apt update && apt install caddy + elif [[ ${release} == "centos" ]]; then + yum install yum-plugin-copr -y + yum copr enable @caddy/caddy -y + yum install caddy -y + elif [[ ${release} == "archlinux" ]]; then + pacman -Sy caddy --noconfirm + fi + [[ ! -e "/usr/bin/caddy" ]] && echo -e "${Error} Caddy安装失败，请手动部署，Web网页文件位置：${web_file}" && exit 1 + systemctl enable caddy + echo "" >${caddy_file} + } + Set_server "server" + Set_server_http_port + cat >>${caddy_file} <<-EOF +http://${server_s}:${server_http_port_s} { + root * ${web_file} + encode gzip + file_server +} +EOF + systemctl restart caddy + else + echo -e "${Info} 跳过 HTTP服务部署，请手动部署，Web网页文件位置：${web_file} ，如果位置改变，请注意修改服务脚本文件 /etc/init.d/status-server 中的 WEB_BIN 变量 !" + fi +} + +Install_ServerStatus_server() { + [[ -e "${server_file}/sergate" ]] && echo -e "${Error} 检测到 $NAME 服务端已安装 !" && exit 1 + Set_server_port + echo -e "${Info} 开始安装/配置 依赖..." + Installation_dependency "server" + Install_caddy + echo -e "${Info} 开始下载/安装..." + Download_Server_Status_server +Install_jq + echo -e "${Info} 开始下载/安装 服务脚本..." + Service_Server_Status_server + echo -e "${Info} 开始写入 配置文件..." + Write_server_config + Write_server_config_conf + echo -e "${Info} 所有步骤 安装完毕，开始启动..." + Start_ServerStatus_server +} + +Install_ServerStatus_client() { + [[ -e "${client_file}/client-linux.py" ]] && echo -e "${Error} 检测到 $NAME 客户端已安装 !" && exit 1 + check_sys + echo -e "${Info} 开始设置 用户配置..." + Set_config_client + echo -e "${Info} 开始安装/配置 依赖..." + Installation_dependency "client" + echo -e "${Info} 开始下载/安装..." + Download_Server_Status_client + echo -e "${Info} 开始下载/安装 服务脚本..." + Service_Server_Status_client + echo -e "${Info} 开始写入 配置..." + Read_config_client + Modify_config_client + echo -e "${Info} 所有步骤 安装完毕，开始启动..." + Start_ServerStatus_client +} + +Update_ServerStatus_server() { + check_installed_server_status + Download_Server_Status_server + rm -rf /etc/init.d/status-server + Service_Server_Status_server + Start_ServerStatus_server +} + +Update_ServerStatus_client() { + check_installed_client_status + systemctl stop status-client + client_text="$(sed 's/\"//g;s/,//g;s/ //g' "${client_file}/client-linux.py")" + server_s="$(echo -e "${client_text}" | grep "SERVER=" | awk -F "=" '{print $2;exit}')" + server_port_s="$(echo -e "${client_text}" | grep "PORT=" | awk -F "=" '{print $2;exit}')" + username_s="$(echo -e "${client_text}" | grep "USER=" | awk -F "=" '{print $2;exit}')" + password_s="$(echo -e "${client_text}" | grep "PASSWORD=" | awk -F "=" '{print $2;exit}')" + Download_Server_Status_client + Read_config_client + Modify_config_client + rm -rf ${service}/status-client.service + Service_Server_Status_client + Start_ServerStatus_client +} + +Start_ServerStatus_server() { + port="$(grep "m_Port = " ${server_file}/src/main.cpp | awk '{print $3}' | sed '{s/;$//}')" + check_installed_server_status + systemctl -q is-active status-server && echo -e "${Error} $NAME 正在运行，请检查 !" && exit 1 + systemctl start status-server + if (systemctl -q is-active status-server) then + echo -e "${Info} $NAME 服务端启动成功[监听端口：${port}] !" + else + echo -e "${Error} $NAME 服务端启动失败 !" + fi +} + +Stop_ServerStatus_server() { + check_installed_server_status +if (systemctl -q is-active status-server) + then + systemctl stop status-server + else + echo -e "${Error} $NAME 没有运行，请检查 !" && exit 1 +fi + if (systemctl -q is-active status-server) then + echo -e "${Error} $NAME 服务端停止失败 !" + else + echo -e "${Info} $NAME 服务端停止成功 !" + fi +} + +Restart_ServerStatus_server() { + check_installed_server_status + systemctl restart status-server +if (systemctl -q is-active status-server) + then + echo -e "${Info} $NAME 服务端重启成功 !" +else + echo -e "${Error} $NAME 服务端重启失败 !" && exit 1 +fi +} + +Uninstall_ServerStatus_server() { + check_installed_server_status + echo "确定要卸载 $NAME 服务端(如果同时安装了客户端，则只会删除服务端) ? [y/N]" + echo + read -erp "(默认: n):" unyn + [[ -z ${unyn} ]] && unyn="n" + if [[ ${unyn} == [Yy] ]]; then + systemctl stop status-server + systemctl disable status-server + rm ${service}/status-server.service -f + if [[ -e "${client_file}/client-linux.py" ]]; then + rm -rf "${server_file}" + rm -rf "${web_file}" + rm -rf "${plugin_file}" + else + rm -rf "${file}" + fi + if [[ -e "/usr/bin/caddy" ]]; then + systemctl stop caddy + systemctl disable caddy + [[ ${release} == "debian" ]] && apt purge -y caddy + [[ ${release} == "centos" ]] && yum -y remove caddy + [[ ${release} == "archlinux" ]] && pacman -R caddy --noconfirm + fi + systemctl daemon-reload + systemctl reset-failed + echo && echo "ServerStatus 卸载完成 !" && echo + else + echo && echo "卸载已取消..." && echo + fi +} + +Start_ServerStatus_client() { + check_installed_client_status +if (systemctl -q is-active status-client) then + echo -e "${Error} $NAME 客户端正在运行，请检查 !" && exit 1 +fi + systemctl start status-client + if (systemctl -q is-active status-client) + then + echo -e "${Info} $NAME 客户端启动成功 !" + else + echo -e "${Error} $NAME 客户端启动失败 !" + fi +} + +Stop_ServerStatus_client() { + check_installed_client_status +if (systemctl -q is-active status-client) then + systemctl stop status-client + if (systemctl -q is-active status-client) then + echo -e "${Error}} $NAME 停止失败 !" + else + echo -e "${Info} $NAME 停止成功 !" + fi +else + echo -e "${Error} $NAME 没有运行，请检查 !" && exit 1 +fi +} + +Restart_ServerStatus_client() { + systemctl restart status-client +if (systemctl -q is-active status-client) then + echo -e "${Info} $NAME 重启成功 !" +else + echo -e "${Error} $NAME 重启失败 !" && exit 1 +fi +} + +Uninstall_ServerStatus_client() { + check_installed_client_status + echo "确定要卸载 $NAME 客户端(如果同时安装了服务端，则只会删除客户端) ? [y/N]" + echo + read -erp "(默认: n):" unyn + [[ -z ${unyn} ]] && unyn="n" + if [[ ${unyn} == [Yy] ]]; then + systemctl stop status-client + systemctl disable status-client + rm ${service}/status-client.service -f + systemctl daemon-reload + systemctl reset-failed + rm -rf "${client_file}" + echo && echo "ServerStatus 卸载完成 !" && echo + else + echo && echo "卸载已取消..." && echo + fi +} + +View_ServerStatus_client() { + check_installed_client_status + Read_config_client + clear && echo "————————————————————" && echo + echo -e " $NAME 客户端配置信息： + + IP \t: ${Green_font_prefix}${client_server}${Font_color_suffix} + 端口 \t: ${Green_font_prefix}${client_port}${Font_color_suffix} + 账号 \t: ${Green_font_prefix}${client_user}${Font_color_suffix} + 密码 \t: ${Green_font_prefix}${client_password}${Font_color_suffix} + +————————————————————" +} + +View_client_Log() { + journalctl -u status-client.service --no-pager -f + if [[ $# == 0 ]]; then + before_show_menu + fi +} + +View_server_Log() { + journalctl -u status-server.service --no-pager -f + if [[ $# == 0 ]]; then + before_show_menu + fi +} + +Update_Shell() { + sh_new_ver=$(wget --no-check-certificate -qO- -t1 -T3 "${github_prefix}/status.sh" | grep 'sh_ver="' | awk -F "=" '{print $NF}' | sed 's/\"//g' | head -1) + [[ -z ${sh_new_ver} ]] && echo -e "${Error} 无法链接到 Github !" && exit 0 + if [[ -e "${service}/status-client.service" ]]; then + rm -rf ${service}/status-client.service + Service_Server_Status_client + fi + if [[ -e "${service}/status-server.service" ]]; then + rm -rf ${service}/status-server.service + Service_Server_Status_server + fi + wget -N --no-check-certificate "${github_prefix}/status.sh" + echo -e "脚本已更新为最新版本[ ${sh_new_ver} ] !(注意：因为更新方式为直接覆盖当前运行的脚本，所以可能下面会提示一些报错，无视即可)" && exit 0 +} + +menu_client() { + echo && echo -e " $NAME 一键安装管理脚本 ${Red_font_prefix}[v${sh_ver}]${Font_color_suffix} + + ${Green_font_prefix} 0.${Font_color_suffix} 升级脚本 + ———————————— + ${Green_font_prefix} 1.${Font_color_suffix} 安装 客户端 + ${Green_font_prefix} 2.${Font_color_suffix} 更新 客户端 + ${Green_font_prefix} 3.${Font_color_suffix} 卸载 客户端 +———————————— + ${Green_font_prefix} 4.${Font_color_suffix} 启动 客户端 + ${Green_font_prefix} 5.${Font_color_suffix} 停止 客户端 + ${Green_font_prefix} 6.${Font_color_suffix} 重启 客户端 +———————————— + ${Green_font_prefix} 7.${Font_color_suffix} 设置 客户端配置 + ${Green_font_prefix} 8.${Font_color_suffix} 查看 客户端信息 + ${Green_font_prefix} 9.${Font_color_suffix} 查看 客户端日志 +———————————— + ${Green_font_prefix}10.${Font_color_suffix} 切换为 服务端菜单" && echo + if [[ -e "${client_file}/client-linux.py" ]]; then + if (systemctl -q is-active status-client); then + echo -e " 当前状态: 客户端 ${Green_font_prefix}已安装${Font_color_suffix} 并 ${Green_font_prefix}已启动${Font_color_suffix}" + else + echo -e " 当前状态: 客户端 ${Green_font_prefix}已安装${Font_color_suffix} 但 ${Red_font_prefix}未启动${Font_color_suffix}" + fi + else + echo -e " 当前状态: 客户端 ${Red_font_prefix}未安装${Font_color_suffix}" + fi + echo + read -erp " 请输入数字 [0-10]:" num + case "$num" in + 0) + Update_Shell + ;; + 1) + Install_ServerStatus_client + ;; + 2) + Update_ServerStatus_client + ;; + 3) + Uninstall_ServerStatus_client + ;; + 4) + Start_ServerStatus_client + ;; + 5) + Stop_ServerStatus_client + ;; + 6) + Restart_ServerStatus_client + ;; + 7) + Set_ServerStatus_client + ;; + 8) + View_ServerStatus_client + ;; + 9) + View_client_Log + ;; + 10) + menu_server + ;; + *) + echo "请输入正确数字 [0-10]" + ;; + esac +} +menu_server() { + echo && echo -e " $NAME 一键安装管理脚本 ${Red_font_prefix}[v${sh_ver}]${Font_color_suffix} + + ${Green_font_prefix} 0.${Font_color_suffix} 升级脚本 + ———————————— + ${Green_font_prefix} 1.${Font_color_suffix} 安装 服务端 + ${Green_font_prefix} 2.${Font_color_suffix} 更新 服务端 + ${Green_font_prefix} 3.${Font_color_suffix} 卸载 服务端 +———————————— + ${Green_font_prefix} 4.${Font_color_suffix} 启动 服务端 + ${Green_font_prefix} 5.${Font_color_suffix} 停止 服务端 + ${Green_font_prefix} 6.${Font_color_suffix} 重启 服务端 +———————————— + ${Green_font_prefix} 7.${Font_color_suffix} 设置 服务端配置 + ${Green_font_prefix} 8.${Font_color_suffix} 查看 服务端信息 + ${Green_font_prefix} 9.${Font_color_suffix} 查看 服务端日志 +———————————— + ${Green_font_prefix}10.${Font_color_suffix} 切换为 客户端菜单" && echo + if [[ -e "${server_file}/sergate" ]]; then + if (systemctl -q is-active status-server) then + echo -e " 当前状态: 服务端 ${Green_font_prefix}已安装${Font_color_suffix} 并 ${Green_font_prefix}已启动${Font_color_suffix}" + else + echo -e " 当前状态: 服务端 ${Green_font_prefix}已安装${Font_color_suffix} 但 ${Red_font_prefix}未启动${Font_color_suffix}" + fi + else + echo -e " 当前状态: 服务端 ${Red_font_prefix}未安装${Font_color_suffix}" + fi + echo + read -erp " 请输入数字 [0-10]:" num + case "$num" in + 0) + Update_Shell + ;; + 1) + Install_ServerStatus_server + ;; + 2) + Update_ServerStatus_server + ;; + 3) + Uninstall_ServerStatus_server + ;; + 4) + Start_ServerStatus_server + ;; + 5) + Stop_ServerStatus_server + ;; + 6) + Restart_ServerStatus_server + ;; + 7) + Set_ServerStatus_server + ;; + 8) + List_ServerStatus_server + ;; + 9) + View_server_Log + ;; + 10) + menu_client + ;; + *) + echo "请输入正确数字 [0-10]" + ;; + esac +} + +check_sys +action=$1 +if [[ -n $action ]]; then + if [[ $action == "s" ]]; then + menu_server + elif [[ $action == "c" ]]; then + menu_client + fi +else + menu_client +fi diff --git a/web/assets/favicon-65bd9f8a.png b/web/assets/favicon-65bd9f8a.png new file mode 100644 index 00000000..bee2a55e Binary files /dev/null and b/web/assets/favicon-65bd9f8a.png differ diff --git a/web/assets/index-282247e3.css b/web/assets/index-282247e3.css new file mode 100644 index 00000000..a09a9f0b --- /dev/null +++ b/web/assets/index-282247e3.css @@ -0,0 +1 @@ +*,:before,:after{box-sizing:border-box;border-width:0;border-style:solid;border-color:#e5e7eb}:before,:after{--tw-content: ""}html{line-height:1.5;-webkit-text-size-adjust:100%;-moz-tab-size:4;-o-tab-size:4;tab-size:4;font-family:ui-sans-serif,system-ui,-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,Noto Sans,sans-serif,"Apple Color Emoji","Segoe UI Emoji",Segoe UI Symbol,"Noto Color Emoji";font-feature-settings:normal;font-variation-settings:normal}body{margin:0;line-height:inherit}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,Liberation Mono,Courier New,monospace;font-size:1em}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}button,input,optgroup,select,textarea{font-family:inherit;font-feature-settings:inherit;font-variation-settings:inherit;font-size:100%;font-weight:inherit;line-height:inherit;color:inherit;margin:0;padding:0}button,select{text-transform:none}button,[type=button],[type=reset],[type=submit]{-webkit-appearance:button;background-color:transparent;background-image:none}:-moz-focusring{outline:auto}:-moz-ui-invalid{box-shadow:none}progress{vertical-align:baseline}::-webkit-inner-spin-button,::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}summary{display:list-item}blockquote,dl,dd,h1,h2,h3,h4,h5,h6,hr,figure,p,pre{margin:0}fieldset{margin:0;padding:0}legend{padding:0}ol,ul,menu{list-style:none;margin:0;padding:0}dialog{padding:0}textarea{resize:vertical}input::-moz-placeholder,textarea::-moz-placeholder{opacity:1;color:#9ca3af}input::placeholder,textarea::placeholder{opacity:1;color:#9ca3af}button,[role=button]{cursor:pointer}:disabled{cursor:default}img,svg,video,canvas,audio,iframe,embed,object{display:block;vertical-align:middle}img,video{max-width:100%;height:auto}[hidden]{display:none}*,:before,:after{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: }::backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: }.absolute{position:absolute}.relative{position:relative}.bottom-0{bottom:0}.left-0{left:0}.right-4{right:1rem}.top-4{top:1rem}.z-\[9999\]{z-index:9999}.mx-auto{margin-left:auto;margin-right:auto}.my-2{margin-top:.5rem;margin-bottom:.5rem}.mt-1{margin-top:.25rem}.inline-block{display:inline-block}.flex{display:flex}.hidden{display:none}.h-16{height:4rem}.h-2{height:.5rem}.h-3{height:.75rem}.h-4{height:1rem}.min-h-screen{min-height:100vh}.w-2{width:.5rem}.w-3{width:.75rem}.w-4{width:1rem}.w-fit{width:-moz-fit-content;width:fit-content}.w-full{width:100%}.min-w-\[300px\]{min-width:300px}.flex-1{flex:1 1 0%}.flex-col{flex-direction:column}.flex-wrap{flex-wrap:wrap}.items-end{align-items:flex-end}.items-center{align-items:center}.gap-1{gap:.25rem}.gap-2{gap:.5rem}.gap-x-4{-moz-column-gap:1rem;column-gap:1rem}.gap-y-3{row-gap:.75rem}.overflow-hidden{overflow:hidden}.whitespace-nowrap{white-space:nowrap}.rounded-full{border-radius:9999px}.rounded-sm{border-radius:.125rem}.rounded-xl{border-radius:.75rem}.border{border-width:1px}.border-gray-400{--tw-border-opacity: 1;border-color:rgb(156 163 175 / var(--tw-border-opacity))}.border-transparent{border-color:transparent}.bg-gray-100{--tw-bg-opacity: 1;background-color:rgb(243 244 246 / var(--tw-bg-opacity))}.bg-gray-200{--tw-bg-opacity: 1;background-color:rgb(229 231 235 / var(--tw-bg-opacity))}.bg-gray-400\/50{background-color:#9ca3af80}.bg-green-400{--tw-bg-opacity: 1;background-color:rgb(74 222 128 / var(--tw-bg-opacity))}.bg-orange-300{--tw-bg-opacity: 1;background-color:rgb(253 186 116 / var(--tw-bg-opacity))}.bg-red-300{--tw-bg-opacity: 1;background-color:rgb(252 165 165 / var(--tw-bg-opacity))}.bg-red-500{--tw-bg-opacity: 1;background-color:rgb(239 68 68 / var(--tw-bg-opacity))}.bg-white{--tw-bg-opacity: 1;background-color:rgb(255 255 255 / var(--tw-bg-opacity))}.p-2{padding:.5rem}.px-2{padding-left:.5rem;padding-right:.5rem}.px-3{padding-left:.75rem;padding-right:.75rem}.px-4{padding-left:1rem;padding-right:1rem}.py-3{padding-top:.75rem;padding-bottom:.75rem}.py-4{padding-top:1rem;padding-bottom:1rem}.text-center{text-align:center}.text-4xl{font-size:2.25rem;line-height:2.5rem}.text-lg{font-size:1.125rem;line-height:1.75rem}.text-sm{font-size:.875rem;line-height:1.25rem}.font-bold{font-weight:700}.text-blue-500{--tw-text-opacity: 1;color:rgb(59 130 246 / var(--tw-text-opacity))}.text-red-500{--tw-text-opacity: 1;color:rgb(239 68 68 / var(--tw-text-opacity))}.transition-\[width\]{transition-property:width;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}.transition-all{transition-property:all;transition-timing-function:cubic-bezier(.4,0,.2,1);transition-duration:.15s}.duration-300{transition-duration:.3s}.duration-500{transition-duration:.5s}.hover\:border-gray-400:hover{--tw-border-opacity: 1;border-color:rgb(156 163 175 / var(--tw-border-opacity))}.hover\:bg-white:hover{--tw-bg-opacity: 1;background-color:rgb(255 255 255 / var(--tw-bg-opacity))}.hover\:shadow-md:hover{--tw-shadow: 0 4px 6px -1px rgb(0 0 0 / .1), 0 2px 4px -2px rgb(0 0 0 / .1);--tw-shadow-colored: 0 4px 6px -1px var(--tw-shadow-color), 0 2px 4px -2px var(--tw-shadow-color);box-shadow:var(--tw-ring-offset-shadow, 0 0 #0000),var(--tw-ring-shadow, 0 0 #0000),var(--tw-shadow)}.group:hover .group-hover\:block{display:block}@media (min-width: 640px){.sm\:px-6{padding-left:1.5rem;padding-right:1.5rem}} diff --git a/web/assets/index-e069a4f0.js b/web/assets/index-e069a4f0.js new file mode 100644 index 00000000..e46b9844 --- /dev/null +++ b/web/assets/index-e069a4f0.js @@ -0,0 +1 @@ +(function(){const t=document.createElement("link").relList;if(t&&t.supports&&t.supports("modulepreload"))return;for(const r of document.querySelectorAll('link[rel="modulepreload"]'))s(r);new MutationObserver(r=>{for(const o of r)if(o.type==="childList")for(const l of o.addedNodes)l.tagName==="LINK"&&l.rel==="modulepreload"&&s(l)}).observe(document,{childList:!0,subtree:!0});function n(r){const o={};return r.integrity&&(o.integrity=r.integrity),r.referrerPolicy&&(o.referrerPolicy=r.referrerPolicy),r.crossOrigin==="use-credentials"?o.credentials="include":r.crossOrigin==="anonymous"?o.credentials="omit":o.credentials="same-origin",o}function s(r){if(r.ep)return;r.ep=!0;const o=n(r);fetch(r.href,o)}})();function Pn(e,t){const n=Object.create(null),s=e.split(",");for(let r=0;r!!n[r.toLowerCase()]:r=>!!n[r]}const L={},Ve=[],me=()=>{},Fr=()=>!1,Ar=/^on[^a-z]/,Wt=e=>Ar.test(e),In=e=>e.startsWith("onUpdate:"),X=Object.assign,Mn=(e,t)=>{const n=e.indexOf(t);n>-1&&e.splice(n,1)},$r=Object.prototype.hasOwnProperty,R=(e,t)=>$r.call(e,t),P=Array.isArray,Xe=e=>zt(e)==="[object Map]",As=e=>zt(e)==="[object Set]",M=e=>typeof e=="function",J=e=>typeof e=="string",Fn=e=>typeof e=="symbol",W=e=>e!==null&&typeof e=="object",$s=e=>W(e)&&M(e.then)&&M(e.catch),Rs=Object.prototype.toString,zt=e=>Rs.call(e),Rr=e=>zt(e).slice(8,-1),Ss=e=>zt(e)==="[object Object]",An=e=>J(e)&&e!=="NaN"&&e[0]!=="-"&&""+parseInt(e,10)===e,jt=Pn(",key,ref,ref_for,ref_key,onVnodeBeforeMount,onVnodeMounted,onVnodeBeforeUpdate,onVnodeUpdated,onVnodeBeforeUnmount,onVnodeUnmounted"),kt=e=>{const t=Object.create(null);return n=>t[n]||(t[n]=e(n))},Sr=/-(\w)/g,et=kt(e=>e.replace(Sr,(t,n)=>n?n.toUpperCase():"")),jr=/\B([A-Z])/g,rt=kt(e=>e.replace(jr,"-$1").toLowerCase()),js=kt(e=>e.charAt(0).toUpperCase()+e.slice(1)),rn=kt(e=>e?`on${js(e)}`:""),bt=(e,t)=>!Object.is(e,t),on=(e,t)=>{for(let n=0;n{Object.defineProperty(e,t,{configurable:!0,enumerable:!1,value:n})},Nr=e=>{const t=parseFloat(e);return isNaN(t)?e:t};let ts;const gn=()=>ts||(ts=typeof globalThis<"u"?globalThis:typeof self<"u"?self:typeof window<"u"?window:typeof global<"u"?global:{});function qt(e){if(P(e)){const t={};for(let n=0;n{if(n){const s=n.split(Dr);s.length>1&&(t[s[0].trim()]=s[1].trim())}}),t}function ot(e){let t="";if(J(e))t=e;else if(P(e))for(let n=0;nJ(e)?e:e==null?"":P(e)||W(e)&&(e.toString===Rs||!M(e.toString))?JSON.stringify(e,Bs,2):String(e),Bs=(e,t)=>t&&t.__v_isRef?Bs(e,t.value):Xe(t)?{[`Map(${t.size})`]:[...t.entries()].reduce((n,[s,r])=>(n[`${s} =>`]=r,n),{})}:As(t)?{[`Set(${t.size})`]:[...t.values()]}:W(t)&&!P(t)&&!Ss(t)?String(t):t;let pe;class Wr{constructor(t=!1){this.detached=t,this._active=!0,this.effects=[],this.cleanups=[],this.parent=pe,!t&&pe&&(this.index=(pe.scopes||(pe.scopes=[])).push(this)-1)}get active(){return this._active}run(t){if(this._active){const n=pe;try{return pe=this,t()}finally{pe=n}}}on(){pe=this}off(){pe=this.parent}stop(t){if(this._active){let n,s;for(n=0,s=this.effects.length;n{const t=new Set(e);return t.w=0,t.n=0,t},Ds=e=>(e.w&Se)>0,Hs=e=>(e.n&Se)>0,qr=({deps:e})=>{if(e.length)for(let t=0;t{const{deps:t}=e;if(t.length){let n=0;for(let s=0;s{(_==="length"||_>=u)&&c.push(a)})}else switch(n!==void 0&&c.push(l.get(n)),t){case"add":P(e)?An(n)&&c.push(l.get("length")):(c.push(l.get(ze)),Xe(e)&&c.push(l.get(bn)));break;case"delete":P(e)||(c.push(l.get(ze)),Xe(e)&&c.push(l.get(bn)));break;case"set":Xe(e)&&c.push(l.get(ze));break}if(c.length===1)c[0]&&vn(c[0]);else{const u=[];for(const a of c)a&&u.push(...a);vn($n(u))}}function vn(e,t){const n=P(e)?e:[...e];for(const s of n)s.computed&&ss(s);for(const s of n)s.computed||ss(s)}function ss(e,t){(e!==ge||e.allowRecurse)&&(e.scheduler?e.scheduler():e.run())}const Jr=Pn("__proto__,__v_isRef,__isVue"),Ks=new Set(Object.getOwnPropertyNames(Symbol).filter(e=>e!=="arguments"&&e!=="caller").map(e=>Symbol[e]).filter(Fn)),Zr=Sn(),Vr=Sn(!1,!0),Xr=Sn(!0),rs=Qr();function Qr(){const e={};return["includes","indexOf","lastIndexOf"].forEach(t=>{e[t]=function(...n){const s=j(this);for(let o=0,l=this.length;o{e[t]=function(...n){lt();const s=j(this)[t].apply(this,n);return it(),s}}),e}function Gr(e){const t=j(this);return ue(t,"has",e),t.hasOwnProperty(e)}function Sn(e=!1,t=!1){return function(s,r,o){if(r==="__v_isReactive")return!e;if(r==="__v_isReadonly")return e;if(r==="__v_isShallow")return t;if(r==="__v_raw"&&o===(e?t?_o:Ys:t?qs:ks).get(s))return s;const l=P(s);if(!e){if(l&&R(rs,r))return Reflect.get(rs,r,o);if(r==="hasOwnProperty")return Gr}const c=Reflect.get(s,r,o);return(Fn(r)?Ks.has(r):Jr(r))||(e||ue(s,"get",r),t)?c:re(c)?l&&An(r)?c:c.value:W(c)?e?Js(c):Bn(c):c}}const eo=Ws(),to=Ws(!0);function Ws(e=!1){return function(n,s,r,o){let l=n[s];if(tt(l)&&re(l)&&!re(r))return!1;if(!e&&(!Ht(r)&&!tt(r)&&(l=j(l),r=j(r)),!P(n)&&re(l)&&!re(r)))return l.value=r,!0;const c=P(n)&&An(s)?Number(s)e,Yt=e=>Reflect.getPrototypeOf(e);function Mt(e,t,n=!1,s=!1){e=e.__v_raw;const r=j(e),o=j(t);n||(t!==o&&ue(r,"get",t),ue(r,"get",o));const{has:l}=Yt(r),c=s?jn:n?Hn:vt;if(l.call(r,t))return c(e.get(t));if(l.call(r,o))return c(e.get(o));e!==r&&e.get(t)}function Ft(e,t=!1){const n=this.__v_raw,s=j(n),r=j(e);return t||(e!==r&&ue(s,"has",e),ue(s,"has",r)),e===r?n.has(e):n.has(e)||n.has(r)}function At(e,t=!1){return e=e.__v_raw,!t&&ue(j(e),"iterate",ze),Reflect.get(e,"size",e)}function os(e){e=j(e);const t=j(this);return Yt(t).has.call(t,e)||(t.add(e),Pe(t,"add",e,e)),this}function ls(e,t){t=j(t);const n=j(this),{has:s,get:r}=Yt(n);let o=s.call(n,e);o||(e=j(e),o=s.call(n,e));const l=r.call(n,e);return n.set(e,t),o?bt(t,l)&&Pe(n,"set",e,t):Pe(n,"add",e,t),this}function is(e){const t=j(this),{has:n,get:s}=Yt(t);let r=n.call(t,e);r||(e=j(e),r=n.call(t,e)),s&&s.call(t,e);const o=t.delete(e);return r&&Pe(t,"delete",e,void 0),o}function cs(){const e=j(this),t=e.size!==0,n=e.clear();return t&&Pe(e,"clear",void 0,void 0),n}function $t(e,t){return function(s,r){const o=this,l=o.__v_raw,c=j(l),u=t?jn:e?Hn:vt;return!e&&ue(c,"iterate",ze),l.forEach((a,_)=>s.call(r,u(a),u(_),o))}}function Rt(e,t,n){return function(...s){const r=this.__v_raw,o=j(r),l=Xe(o),c=e==="entries"||e===Symbol.iterator&&l,u=e==="keys"&&l,a=r[e](...s),_=n?jn:t?Hn:vt;return!t&&ue(o,"iterate",u?bn:ze),{next(){const{value:y,done:E}=a.next();return E?{value:y,done:E}:{value:c?[_(y[0]),_(y[1])]:_(y),done:E}},[Symbol.iterator](){return this}}}}function Fe(e){return function(...t){return e==="delete"?!1:this}}function io(){const e={get(o){return Mt(this,o)},get size(){return At(this)},has:Ft,add:os,set:ls,delete:is,clear:cs,forEach:$t(!1,!1)},t={get(o){return Mt(this,o,!1,!0)},get size(){return At(this)},has:Ft,add:os,set:ls,delete:is,clear:cs,forEach:$t(!1,!0)},n={get(o){return Mt(this,o,!0)},get size(){return At(this,!0)},has(o){return Ft.call(this,o,!0)},add:Fe("add"),set:Fe("set"),delete:Fe("delete"),clear:Fe("clear"),forEach:$t(!0,!1)},s={get(o){return Mt(this,o,!0,!0)},get size(){return At(this,!0)},has(o){return Ft.call(this,o,!0)},add:Fe("add"),set:Fe("set"),delete:Fe("delete"),clear:Fe("clear"),forEach:$t(!0,!0)};return["keys","values","entries",Symbol.iterator].forEach(o=>{e[o]=Rt(o,!1,!1),n[o]=Rt(o,!0,!1),t[o]=Rt(o,!1,!0),s[o]=Rt(o,!0,!0)}),[e,n,t,s]}const[co,fo,uo,ao]=io();function Nn(e,t){const n=t?e?ao:uo:e?fo:co;return(s,r,o)=>r==="__v_isReactive"?!e:r==="__v_isReadonly"?e:r==="__v_raw"?s:Reflect.get(R(n,r)&&r in s?n:s,r,o)}const ho={get:Nn(!1,!1)},po={get:Nn(!1,!0)},go={get:Nn(!0,!1)},ks=new WeakMap,qs=new WeakMap,Ys=new WeakMap,_o=new WeakMap;function mo(e){switch(e){case"Object":case"Array":return 1;case"Map":case"Set":case"WeakMap":case"WeakSet":return 2;default:return 0}}function bo(e){return e.__v_skip||!Object.isExtensible(e)?0:mo(Rr(e))}function Bn(e){return tt(e)?e:Dn(e,!1,zs,ho,ks)}function vo(e){return Dn(e,!1,lo,po,qs)}function Js(e){return Dn(e,!0,oo,go,Ys)}function Dn(e,t,n,s,r){if(!W(e)||e.__v_raw&&!(t&&e.__v_isReactive))return e;const o=r.get(e);if(o)return o;const l=bo(e);if(l===0)return e;const c=new Proxy(e,l===2?s:n);return r.set(e,c),c}function Qe(e){return tt(e)?Qe(e.__v_raw):!!(e&&e.__v_isReactive)}function tt(e){return!!(e&&e.__v_isReadonly)}function Ht(e){return!!(e&&e.__v_isShallow)}function Zs(e){return Qe(e)||tt(e)}function j(e){const t=e&&e.__v_raw;return t?j(t):e}function Vs(e){return Dt(e,"__v_skip",!0),e}const vt=e=>W(e)?Bn(e):e,Hn=e=>W(e)?Js(e):e;function Xs(e){$e&&ge&&(e=j(e),Us(e.dep||(e.dep=$n())))}function Qs(e,t){e=j(e);const n=e.dep;n&&vn(n)}function re(e){return!!(e&&e.__v_isRef===!0)}function ln(e){return xo(e,!1)}function xo(e,t){return re(e)?e:new yo(e,t)}class yo{constructor(t,n){this.__v_isShallow=n,this.dep=void 0,this.__v_isRef=!0,this._rawValue=n?t:j(t),this._value=n?t:vt(t)}get value(){return Xs(this),this._value}set value(t){const n=this.__v_isShallow||Ht(t)||tt(t);t=n?t:j(t),bt(t,this._rawValue)&&(this._rawValue=t,this._value=n?t:vt(t),Qs(this))}}function U(e){return re(e)?e.value:e}const wo={get:(e,t,n)=>U(Reflect.get(e,t,n)),set:(e,t,n,s)=>{const r=e[t];return re(r)&&!re(n)?(r.value=n,!0):Reflect.set(e,t,n,s)}};function Gs(e){return Qe(e)?e:new Proxy(e,wo)}class Eo{constructor(t,n,s,r){this._setter=n,this.dep=void 0,this.__v_isRef=!0,this.__v_isReadonly=!1,this._dirty=!0,this.effect=new Rn(t,()=>{this._dirty||(this._dirty=!0,Qs(this))}),this.effect.computed=this,this.effect.active=this._cacheable=!r,this.__v_isReadonly=s}get value(){const t=j(this);return Xs(t),(t._dirty||!t._cacheable)&&(t._dirty=!1,t._value=t.effect.run()),t._value}set value(t){this._setter(t)}}function Co(e,t,n=!1){let s,r;const o=M(e);return o?(s=e,r=me):(s=e.get,r=e.set),new Eo(s,r,o||!r,n)}function Re(e,t,n,s){let r;try{r=s?e(...s):e()}catch(o){Jt(o,t,n)}return r}function be(e,t,n,s){if(M(e)){const o=Re(e,t,n,s);return o&&$s(o)&&o.catch(l=>{Jt(l,t,n)}),o}const r=[];for(let o=0;o>>1;yt(ne[s])Ce&&ne.splice(t,1)}function Mo(e){P(e)?Ge.push(...e):(!Te||!Te.includes(e,e.allowRecurse?Ke+1:Ke))&&Ge.push(e),tr()}function fs(e,t=xt?Ce+1:0){for(;tyt(n)-yt(s)),Ke=0;Kee.id==null?1/0:e.id,Fo=(e,t)=>{const n=yt(e)-yt(t);if(n===0){if(e.pre&&!t.pre)return-1;if(t.pre&&!e.pre)return 1}return n};function sr(e){xn=!1,xt=!0,ne.sort(Fo);const t=me;try{for(Ce=0;CeJ(I)?I.trim():I)),y&&(r=n.map(Nr))}let c,u=s[c=rn(t)]||s[c=rn(et(t))];!u&&o&&(u=s[c=rn(rt(t))]),u&&be(u,e,6,r);const a=s[c+"Once"];if(a){if(!e.emitted)e.emitted={};else if(e.emitted[c])return;e.emitted[c]=!0,be(a,e,6,r)}}function rr(e,t,n=!1){const s=t.emitsCache,r=s.get(e);if(r!==void 0)return r;const o=e.emits;let l={},c=!1;if(!M(e)){const u=a=>{const _=rr(a,t,!0);_&&(c=!0,X(l,_))};!n&&t.mixins.length&&t.mixins.forEach(u),e.extends&&u(e.extends),e.mixins&&e.mixins.forEach(u)}return!o&&!c?(W(e)&&s.set(e,null),null):(P(o)?o.forEach(u=>l[u]=null):X(l,o),W(e)&&s.set(e,l),l)}function Zt(e,t){return!e||!Wt(t)?!1:(t=t.slice(2).replace(/Once$/,""),R(e,t[0].toLowerCase()+t.slice(1))||R(e,rt(t))||R(e,t))}let fe=null,or=null;function Lt(e){const t=fe;return fe=e,or=e&&e.type.__scopeId||null,t}function te(e,t=fe,n){if(!t||e._n)return e;const s=(...r)=>{s._d&&vs(-1);const o=Lt(t);let l;try{l=e(...r)}finally{Lt(o),s._d&&vs(1)}return l};return s._n=!0,s._c=!0,s._d=!0,s}function cn(e){const{type:t,vnode:n,proxy:s,withProxy:r,props:o,propsOptions:[l],slots:c,attrs:u,emit:a,render:_,renderCache:y,data:E,setupState:I,ctx:q,inheritAttrs:$}=e;let Z,Q;const G=Lt(e);try{if(n.shapeFlag&4){const F=r||s;Z=Ee(_.call(F,F,y,o,I,E,q)),Q=u}else{const F=t;Z=Ee(F.length>1?F(o,{attrs:u,slots:c,emit:a}):F(o,null)),Q=t.props?u:$o(u)}}catch(F){_t.length=0,Jt(F,e,1),Z=S(je)}let ee=Z;if(Q&&$!==!1){const F=Object.keys(Q),{shapeFlag:Me}=ee;F.length&&Me&7&&(l&&F.some(In)&&(Q=Ro(Q,l)),ee=nt(ee,Q))}return n.dirs&&(ee=nt(ee),ee.dirs=ee.dirs?ee.dirs.concat(n.dirs):n.dirs),n.transition&&(ee.transition=n.transition),Z=ee,Lt(G),Z}const $o=e=>{let t;for(const n in e)(n==="class"||n==="style"||Wt(n))&&((t||(t={}))[n]=e[n]);return t},Ro=(e,t)=>{const n={};for(const s in e)(!In(s)||!(s.slice(9)in t))&&(n[s]=e[s]);return n};function So(e,t,n){const{props:s,children:r,component:o}=e,{props:l,children:c,patchFlag:u}=t,a=o.emitsOptions;if(t.dirs||t.transition)return!0;if(n&&u>=0){if(u&1024)return!0;if(u&16)return s?us(s,l,a):!!l;if(u&8){const _=t.dynamicProps;for(let y=0;y<_.length;y++){const E=_[y];if(l[E]!==s[E]&&!Zt(a,E))return!0}}}else return(r||c)&&(!c||!c.$stable)?!0:s===l?!1:s?l?us(s,l,a):!0:!!l;return!1}function us(e,t,n){const s=Object.keys(t);if(s.length!==Object.keys(e).length)return!0;for(let r=0;re.__isSuspense;function Bo(e,t){t&&t.pendingBranch?P(e)?t.effects.push(...e):t.effects.push(e):Mo(e)}const St={};function fn(e,t,n){return lr(e,t,n)}function lr(e,t,{immediate:n,deep:s,flush:r,onTrack:o,onTrigger:l}=L){var c;const u=kr()===((c=se)==null?void 0:c.scope)?se:null;let a,_=!1,y=!1;if(re(e)?(a=()=>e.value,_=Ht(e)):Qe(e)?(a=()=>e,s=!0):P(e)?(y=!0,_=e.some(F=>Qe(F)||Ht(F)),a=()=>e.map(F=>{if(re(F))return F.value;if(Qe(F))return Ze(F);if(M(F))return Re(F,u,2)})):M(e)?t?a=()=>Re(e,u,2):a=()=>{if(!(u&&u.isUnmounted))return E&&E(),be(e,u,3,[I])}:a=me,t&&s){const F=a;a=()=>Ze(F())}let E,I=F=>{E=G.onStop=()=>{Re(F,u,4)}},q;if(Et)if(I=me,t?n&&be(t,u,3,[a(),y?[]:void 0,I]):a(),r==="sync"){const F=Ml();q=F.__watcherHandles||(F.__watcherHandles=[])}else return me;let $=y?new Array(e.length).fill(St):St;const Z=()=>{if(G.active)if(t){const F=G.run();(s||_||(y?F.some((Me,ct)=>bt(Me,$[ct])):bt(F,$)))&&(E&&E(),be(t,u,3,[F,$===St?void 0:y&&$[0]===St?[]:$,I]),$=F)}else G.run()};Z.allowRecurse=!!t;let Q;r==="sync"?Q=Z:r==="post"?Q=()=>ce(Z,u&&u.suspense):(Z.pre=!0,u&&(Z.id=u.uid),Q=()=>Un(Z));const G=new Rn(a,Q);t?n?Z():$=G.run():r==="post"?ce(G.run.bind(G),u&&u.suspense):G.run();const ee=()=>{G.stop(),u&&u.scope&&Mn(u.scope.effects,G)};return q&&q.push(ee),ee}function Do(e,t,n){const s=this.proxy,r=J(e)?e.includes(".")?ir(s,e):()=>s[e]:e.bind(s,s);let o;M(t)?o=t:(o=t.handler,n=t);const l=se;st(this);const c=lr(r,o.bind(s),n);return l?st(l):ke(),c}function ir(e,t){const n=t.split(".");return()=>{let s=e;for(let r=0;r{Ze(n,t)});else if(Ss(e))for(const n in e)Ze(e[n],t);return e}function Le(e,t,n,s){const r=e.dirs,o=t&&t.dirs;for(let l=0;lX({name:e.name},t,{setup:e}))():e}const pt=e=>!!e.type.__asyncLoader,cr=e=>e.type.__isKeepAlive;function Ho(e,t){fr(e,"a",t)}function Lo(e,t){fr(e,"da",t)}function fr(e,t,n=se){const s=e.__wdc||(e.__wdc=()=>{let r=n;for(;r;){if(r.isDeactivated)return;r=r.parent}return e()});if(Xt(t,s,n),n){let r=n.parent;for(;r&&r.parent;)cr(r.parent.vnode)&&Uo(s,t,n,r),r=r.parent}}function Uo(e,t,n,s){const r=Xt(t,e,s,!0);ar(()=>{Mn(s[t],r)},n)}function Xt(e,t,n=se,s=!1){if(n){const r=n[e]||(n[e]=[]),o=t.__weh||(t.__weh=(...l)=>{if(n.isUnmounted)return;lt(),st(n);const c=be(t,n,e,l);return ke(),it(),c});return s?r.unshift(o):r.push(o),o}}const Ie=e=>(t,n=se)=>(!Et||e==="sp")&&Xt(e,(...s)=>t(...s),n),Ko=Ie("bm"),ur=Ie("m"),Wo=Ie("bu"),zo=Ie("u"),ko=Ie("bum"),ar=Ie("um"),qo=Ie("sp"),Yo=Ie("rtg"),Jo=Ie("rtc");function Zo(e,t=se){Xt("ec",e,t)}const Vo=Symbol.for("v-ndc");function Xo(e,t,n,s){let r;const o=n&&n[s];if(P(e)||J(e)){r=new Array(e.length);for(let l=0,c=e.length;lt(l,c,void 0,o&&o[c]));else{const l=Object.keys(e);r=new Array(l.length);for(let c=0,u=l.length;cEr(t)?!(t.type===je||t.type===de&&!hr(t.children)):!0)?e:null}const yn=e=>e?Or(e)?Yn(e)||e.proxy:yn(e.parent):null,gt=X(Object.create(null),{$:e=>e,$el:e=>e.vnode.el,$data:e=>e.data,$props:e=>e.props,$attrs:e=>e.attrs,$slots:e=>e.slots,$refs:e=>e.refs,$parent:e=>yn(e.parent),$root:e=>yn(e.root),$emit:e=>e.emit,$options:e=>Kn(e),$forceUpdate:e=>e.f||(e.f=()=>Un(e.update)),$nextTick:e=>e.n||(e.n=To.bind(e.proxy)),$watch:e=>Do.bind(e)}),un=(e,t)=>e!==L&&!e.__isScriptSetup&&R(e,t),Qo={get({_:e},t){const{ctx:n,setupState:s,data:r,props:o,accessCache:l,type:c,appContext:u}=e;let a;if(t[0]!=="$"){const I=l[t];if(I!==void 0)switch(I){case 1:return s[t];case 2:return r[t];case 4:return n[t];case 3:return o[t]}else{if(un(s,t))return l[t]=1,s[t];if(r!==L&&R(r,t))return l[t]=2,r[t];if((a=e.propsOptions[0])&&R(a,t))return l[t]=3,o[t];if(n!==L&&R(n,t))return l[t]=4,n[t];wn&&(l[t]=0)}}const _=gt[t];let y,E;if(_)return t==="$attrs"&&ue(e,"get",t),_(e);if((y=c.__cssModules)&&(y=y[t]))return y;if(n!==L&&R(n,t))return l[t]=4,n[t];if(E=u.config.globalProperties,R(E,t))return E[t]},set({_:e},t,n){const{data:s,setupState:r,ctx:o}=e;return un(r,t)?(r[t]=n,!0):s!==L&&R(s,t)?(s[t]=n,!0):R(e.props,t)||t[0]==="$"&&t.slice(1)in e?!1:(o[t]=n,!0)},has({_:{data:e,setupState:t,accessCache:n,ctx:s,appContext:r,propsOptions:o}},l){let c;return!!n[l]||e!==L&&R(e,l)||un(t,l)||(c=o[0])&&R(c,l)||R(s,l)||R(gt,l)||R(r.config.globalProperties,l)},defineProperty(e,t,n){return n.get!=null?e._.accessCache[t]=0:R(n,"value")&&this.set(e,t,n.value,null),Reflect.defineProperty(e,t,n)}};function as(e){return P(e)?e.reduce((t,n)=>(t[n]=null,t),{}):e}let wn=!0;function Go(e){const t=Kn(e),n=e.proxy,s=e.ctx;wn=!1,t.beforeCreate&&ds(t.beforeCreate,e,"bc");const{data:r,computed:o,methods:l,watch:c,provide:u,inject:a,created:_,beforeMount:y,mounted:E,beforeUpdate:I,updated:q,activated:$,deactivated:Z,beforeDestroy:Q,beforeUnmount:G,destroyed:ee,unmounted:F,render:Me,renderTracked:ct,renderTriggered:Ct,errorCaptured:Ne,serverPrefetch:en,expose:Be,inheritAttrs:ft,components:Ot,directives:Tt,filters:tn}=t;if(a&&el(a,s,null),l)for(const z in l){const D=l[z];M(D)&&(s[z]=D.bind(n))}if(r){const z=r.call(n,n);W(z)&&(e.data=Bn(z))}if(wn=!0,o)for(const z in o){const D=o[z],De=M(D)?D.bind(n,n):M(D.get)?D.get.bind(n,n):me,Pt=!M(D)&&M(D.set)?D.set.bind(n):me,He=Pr({get:De,set:Pt});Object.defineProperty(s,z,{enumerable:!0,configurable:!0,get:()=>He.value,set:ve=>He.value=ve})}if(c)for(const z in c)pr(c[z],s,n,z);if(u){const z=M(u)?u.call(n):u;Reflect.ownKeys(z).forEach(D=>{ll(D,z[D])})}_&&ds(_,e,"c");function oe(z,D){P(D)?D.forEach(De=>z(De.bind(n))):D&&z(D.bind(n))}if(oe(Ko,y),oe(ur,E),oe(Wo,I),oe(zo,q),oe(Ho,$),oe(Lo,Z),oe(Zo,Ne),oe(Jo,ct),oe(Yo,Ct),oe(ko,G),oe(ar,F),oe(qo,en),P(Be))if(Be.length){const z=e.exposed||(e.exposed={});Be.forEach(D=>{Object.defineProperty(z,D,{get:()=>n[D],set:De=>n[D]=De})})}else e.exposed||(e.exposed={});Me&&e.render===me&&(e.render=Me),ft!=null&&(e.inheritAttrs=ft),Ot&&(e.components=Ot),Tt&&(e.directives=Tt)}function el(e,t,n=me){P(e)&&(e=En(e));for(const s in e){const r=e[s];let o;W(r)?"default"in r?o=Nt(r.from||s,r.default,!0):o=Nt(r.from||s):o=Nt(r),re(o)?Object.defineProperty(t,s,{enumerable:!0,configurable:!0,get:()=>o.value,set:l=>o.value=l}):t[s]=o}}function ds(e,t,n){be(P(e)?e.map(s=>s.bind(t.proxy)):e.bind(t.proxy),t,n)}function pr(e,t,n,s){const r=s.includes(".")?ir(n,s):()=>n[s];if(J(e)){const o=t[e];M(o)&&fn(r,o)}else if(M(e))fn(r,e.bind(n));else if(W(e))if(P(e))e.forEach(o=>pr(o,t,n,s));else{const o=M(e.handler)?e.handler.bind(n):t[e.handler];M(o)&&fn(r,o,e)}}function Kn(e){const t=e.type,{mixins:n,extends:s}=t,{mixins:r,optionsCache:o,config:{optionMergeStrategies:l}}=e.appContext,c=o.get(t);let u;return c?u=c:!r.length&&!n&&!s?u=t:(u={},r.length&&r.forEach(a=>Ut(u,a,l,!0)),Ut(u,t,l)),W(t)&&o.set(t,u),u}function Ut(e,t,n,s=!1){const{mixins:r,extends:o}=t;o&&Ut(e,o,n,!0),r&&r.forEach(l=>Ut(e,l,n,!0));for(const l in t)if(!(s&&l==="expose")){const c=tl[l]||n&&n[l];e[l]=c?c(e[l],t[l]):t[l]}return e}const tl={data:hs,props:ps,emits:ps,methods:ht,computed:ht,beforeCreate:le,created:le,beforeMount:le,mounted:le,beforeUpdate:le,updated:le,beforeDestroy:le,beforeUnmount:le,destroyed:le,unmounted:le,activated:le,deactivated:le,errorCaptured:le,serverPrefetch:le,components:ht,directives:ht,watch:sl,provide:hs,inject:nl};function hs(e,t){return t?e?function(){return X(M(e)?e.call(this,this):e,M(t)?t.call(this,this):t)}:t:e}function nl(e,t){return ht(En(e),En(t))}function En(e){if(P(e)){const t={};for(let n=0;n1)return n&&M(t)?t.call(s&&s.proxy):t}}function il(e,t,n,s=!1){const r={},o={};Dt(o,Gt,1),e.propsDefaults=Object.create(null),_r(e,t,r,o);for(const l in e.propsOptions[0])l in r||(r[l]=void 0);n?e.props=s?r:vo(r):e.type.props?e.props=r:e.props=o,e.attrs=o}function cl(e,t,n,s){const{props:r,attrs:o,vnode:{patchFlag:l}}=e,c=j(r),[u]=e.propsOptions;let a=!1;if((s||l>0)&&!(l&16)){if(l&8){const _=e.vnode.dynamicProps;for(let y=0;y<_.length;y++){let E=_[y];if(Zt(e.emitsOptions,E))continue;const I=t[E];if(u)if(R(o,E))I!==o[E]&&(o[E]=I,a=!0);else{const q=et(E);r[q]=Cn(u,c,q,I,e,!1)}else I!==o[E]&&(o[E]=I,a=!0)}}}else{_r(e,t,r,o)&&(a=!0);let _;for(const y in c)(!t||!R(t,y)&&((_=rt(y))===y||!R(t,_)))&&(u?n&&(n[y]!==void 0||n[_]!==void 0)&&(r[y]=Cn(u,c,y,void 0,e,!0)):delete r[y]);if(o!==c)for(const y in o)(!t||!R(t,y))&&(delete o[y],a=!0)}a&&Pe(e,"set","$attrs")}function _r(e,t,n,s){const[r,o]=e.propsOptions;let l=!1,c;if(t)for(let u in t){if(jt(u))continue;const a=t[u];let _;r&&R(r,_=et(u))?!o||!o.includes(_)?n[_]=a:(c||(c={}))[_]=a:Zt(e.emitsOptions,u)||(!(u in s)||a!==s[u])&&(s[u]=a,l=!0)}if(o){const u=j(n),a=c||L;for(let _=0;_{u=!0;const[E,I]=mr(y,t,!0);X(l,E),I&&c.push(...I)};!n&&t.mixins.length&&t.mixins.forEach(_),e.extends&&_(e.extends),e.mixins&&e.mixins.forEach(_)}if(!o&&!u)return W(e)&&s.set(e,Ve),Ve;if(P(o))for(let _=0;_-1,I[1]=$<0||q<$,(q>-1||R(I,"default"))&&c.push(y)}}}const a=[l,c];return W(e)&&s.set(e,a),a}function gs(e){return e[0]!=="$"}function _s(e){const t=e&&e.toString().match(/^\s*(function|class) (\w+)/);return t?t[2]:e===null?"null":""}function ms(e,t){return _s(e)===_s(t)}function bs(e,t){return P(t)?t.findIndex(n=>ms(n,e)):M(t)&&ms(t,e)?0:-1}const br=e=>e[0]==="_"||e==="$stable",Wn=e=>P(e)?e.map(Ee):[Ee(e)],fl=(e,t,n)=>{if(t._n)return t;const s=te((...r)=>Wn(t(...r)),n);return s._c=!1,s},vr=(e,t,n)=>{const s=e._ctx;for(const r in e){if(br(r))continue;const o=e[r];if(M(o))t[r]=fl(r,o,s);else if(o!=null){const l=Wn(o);t[r]=()=>l}}},xr=(e,t)=>{const n=Wn(t);e.slots.default=()=>n},ul=(e,t)=>{if(e.vnode.shapeFlag&32){const n=t._;n?(e.slots=j(t),Dt(t,"_",n)):vr(t,e.slots={})}else e.slots={},t&&xr(e,t);Dt(e.slots,Gt,1)},al=(e,t,n)=>{const{vnode:s,slots:r}=e;let o=!0,l=L;if(s.shapeFlag&32){const c=t._;c?n&&c===1?o=!1:(X(r,t),!n&&c===1&&delete r._):(o=!t.$stable,vr(t,r)),l=t}else t&&(xr(e,t),l={default:1});if(o)for(const c in r)!br(c)&&!(c in l)&&delete r[c]};function On(e,t,n,s,r=!1){if(P(e)){e.forEach((E,I)=>On(E,t&&(P(t)?t[I]:t),n,s,r));return}if(pt(s)&&!r)return;const o=s.shapeFlag&4?Yn(s.component)||s.component.proxy:s.el,l=r?null:o,{i:c,r:u}=e,a=t&&t.r,_=c.refs===L?c.refs={}:c.refs,y=c.setupState;if(a!=null&&a!==u&&(J(a)?(_[a]=null,R(y,a)&&(y[a]=null)):re(a)&&(a.value=null)),M(u))Re(u,c,12,[l,_]);else{const E=J(u),I=re(u);if(E||I){const q=()=>{if(e.f){const $=E?R(y,u)?y[u]:_[u]:u.value;r?P($)&&Mn($,o):P($)?$.includes(o)||$.push(o):E?(_[u]=[o],R(y,u)&&(y[u]=_[u])):(u.value=[o],e.k&&(_[e.k]=u.value))}else E?(_[u]=l,R(y,u)&&(y[u]=l)):I&&(u.value=l,e.k&&(_[e.k]=l))};l?(q.id=-1,ce(q,n)):q()}}}const ce=Bo;function dl(e){return hl(e)}function hl(e,t){const n=gn();n.__VUE__=!0;const{insert:s,remove:r,patchProp:o,createElement:l,createText:c,createComment:u,setText:a,setElementText:_,parentNode:y,nextSibling:E,setScopeId:I=me,insertStaticContent:q}=e,$=(i,f,d,p=null,h=null,b=null,x=!1,m=null,v=!!f.dynamicChildren)=>{if(i===f)return;i&&!at(i,f)&&(p=It(i),ve(i,h,b,!0),i=null),f.patchFlag===-2&&(v=!1,f.dynamicChildren=null);const{type:g,ref:C,shapeFlag:w}=f;switch(g){case Qt:Z(i,f,d,p);break;case je:Q(i,f,d,p);break;case an:i==null&&G(f,d,p,x);break;case de:Ot(i,f,d,p,h,b,x,m,v);break;default:w&1?Me(i,f,d,p,h,b,x,m,v):w&6?Tt(i,f,d,p,h,b,x,m,v):(w&64||w&128)&&g.process(i,f,d,p,h,b,x,m,v,qe)}C!=null&&h&&On(C,i&&i.ref,b,f||i,!f)},Z=(i,f,d,p)=>{if(i==null)s(f.el=c(f.children),d,p);else{const h=f.el=i.el;f.children!==i.children&&a(h,f.children)}},Q=(i,f,d,p)=>{i==null?s(f.el=u(f.children||""),d,p):f.el=i.el},G=(i,f,d,p)=>{[i.el,i.anchor]=q(i.children,f,d,p,i.el,i.anchor)},ee=({el:i,anchor:f},d,p)=>{let h;for(;i&&i!==f;)h=E(i),s(i,d,p),i=h;s(f,d,p)},F=({el:i,anchor:f})=>{let d;for(;i&&i!==f;)d=E(i),r(i),i=d;r(f)},Me=(i,f,d,p,h,b,x,m,v)=>{x=x||f.type==="svg",i==null?ct(f,d,p,h,b,x,m,v):en(i,f,h,b,x,m,v)},ct=(i,f,d,p,h,b,x,m)=>{let v,g;const{type:C,props:w,shapeFlag:O,transition:T,dirs:A}=i;if(v=i.el=l(i.type,b,w&&w.is,w),O&8?_(v,i.children):O&16&&Ne(i.children,v,null,p,h,b&&C!=="foreignObject",x,m),A&&Le(i,null,p,"created"),Ct(v,i,i.scopeId,x,p),w){for(const B in w)B!=="value"&&!jt(B)&&o(v,B,null,w[B],b,i.children,p,h,Oe);"value"in w&&o(v,"value",null,w.value),(g=w.onVnodeBeforeMount)&&ye(g,p,i)}A&&Le(i,null,p,"beforeMount");const H=(!h||h&&!h.pendingBranch)&&T&&!T.persisted;H&&T.beforeEnter(v),s(v,f,d),((g=w&&w.onVnodeMounted)||H||A)&&ce(()=>{g&&ye(g,p,i),H&&T.enter(v),A&&Le(i,null,p,"mounted")},h)},Ct=(i,f,d,p,h)=>{if(d&&I(i,d),p)for(let b=0;b{for(let g=v;g{const m=f.el=i.el;let{patchFlag:v,dynamicChildren:g,dirs:C}=f;v|=i.patchFlag&16;const w=i.props||L,O=f.props||L;let T;d&&Ue(d,!1),(T=O.onVnodeBeforeUpdate)&&ye(T,d,f,i),C&&Le(f,i,d,"beforeUpdate"),d&&Ue(d,!0);const A=h&&f.type!=="foreignObject";if(g?Be(i.dynamicChildren,g,m,d,p,A,b):x||D(i,f,m,null,d,p,A,b,!1),v>0){if(v&16)ft(m,f,w,O,d,p,h);else if(v&2&&w.class!==O.class&&o(m,"class",null,O.class,h),v&4&&o(m,"style",w.style,O.style,h),v&8){const H=f.dynamicProps;for(let B=0;B{T&&ye(T,d,f,i),C&&Le(f,i,d,"updated")},p)},Be=(i,f,d,p,h,b,x)=>{for(let m=0;m{if(d!==p){if(d!==L)for(const m in d)!jt(m)&&!(m in p)&&o(i,m,d[m],null,x,f.children,h,b,Oe);for(const m in p){if(jt(m))continue;const v=p[m],g=d[m];v!==g&&m!=="value"&&o(i,m,g,v,x,f.children,h,b,Oe)}"value"in p&&o(i,"value",d.value,p.value)}},Ot=(i,f,d,p,h,b,x,m,v)=>{const g=f.el=i?i.el:c(""),C=f.anchor=i?i.anchor:c("");let{patchFlag:w,dynamicChildren:O,slotScopeIds:T}=f;T&&(m=m?m.concat(T):T),i==null?(s(g,d,p),s(C,d,p),Ne(f.children,d,C,h,b,x,m,v)):w>0&&w&64&&O&&i.dynamicChildren?(Be(i.dynamicChildren,O,d,h,b,x,m),(f.key!=null||h&&f===h.subTree)&&yr(i,f,!0)):D(i,f,d,C,h,b,x,m,v)},Tt=(i,f,d,p,h,b,x,m,v)=>{f.slotScopeIds=m,i==null?f.shapeFlag&512?h.ctx.activate(f,d,p,x,v):tn(f,d,p,h,b,x,v):Zn(i,f,v)},tn=(i,f,d,p,h,b,x)=>{const m=i.component=wl(i,p,h);if(cr(i)&&(m.ctx.renderer=qe),El(m),m.asyncDep){if(h&&h.registerDep(m,oe),!i.el){const v=m.subTree=S(je);Q(null,v,f,d)}return}oe(m,i,f,d,h,b,x)},Zn=(i,f,d)=>{const p=f.component=i.component;if(So(i,f,d))if(p.asyncDep&&!p.asyncResolved){z(p,f,d);return}else p.next=f,Io(p.update),p.update();else f.el=i.el,p.vnode=f},oe=(i,f,d,p,h,b,x)=>{const m=()=>{if(i.isMounted){let{next:C,bu:w,u:O,parent:T,vnode:A}=i,H=C,B;Ue(i,!1),C?(C.el=A.el,z(i,C,x)):C=A,w&&on(w),(B=C.props&&C.props.onVnodeBeforeUpdate)&&ye(B,T,C,A),Ue(i,!0);const Y=cn(i),he=i.subTree;i.subTree=Y,$(he,Y,y(he.el),It(he),i,h,b),C.el=Y.el,H===null&&jo(i,Y.el),O&&ce(O,h),(B=C.props&&C.props.onVnodeUpdated)&&ce(()=>ye(B,T,C,A),h)}else{let C;const{el:w,props:O}=f,{bm:T,m:A,parent:H}=i,B=pt(f);if(Ue(i,!1),T&&on(T),!B&&(C=O&&O.onVnodeBeforeMount)&&ye(C,H,f),Ue(i,!0),w&&sn){const Y=()=>{i.subTree=cn(i),sn(w,i.subTree,i,h,null)};B?f.type.__asyncLoader().then(()=>!i.isUnmounted&&Y()):Y()}else{const Y=i.subTree=cn(i);$(null,Y,d,p,i,h,b),f.el=Y.el}if(A&&ce(A,h),!B&&(C=O&&O.onVnodeMounted)){const Y=f;ce(()=>ye(C,H,Y),h)}(f.shapeFlag&256||H&&pt(H.vnode)&&H.vnode.shapeFlag&256)&&i.a&&ce(i.a,h),i.isMounted=!0,f=d=p=null}},v=i.effect=new Rn(m,()=>Un(g),i.scope),g=i.update=()=>v.run();g.id=i.uid,Ue(i,!0),g()},z=(i,f,d)=>{f.component=i;const p=i.vnode.props;i.vnode=f,i.next=null,cl(i,f.props,p,d),al(i,f.children,d),lt(),fs(),it()},D=(i,f,d,p,h,b,x,m,v=!1)=>{const g=i&&i.children,C=i?i.shapeFlag:0,w=f.children,{patchFlag:O,shapeFlag:T}=f;if(O>0){if(O&128){Pt(g,w,d,p,h,b,x,m,v);return}else if(O&256){De(g,w,d,p,h,b,x,m,v);return}}T&8?(C&16&&Oe(g,h,b),w!==g&&_(d,w)):C&16?T&16?Pt(g,w,d,p,h,b,x,m,v):Oe(g,h,b,!0):(C&8&&_(d,""),T&16&&Ne(w,d,p,h,b,x,m,v))},De=(i,f,d,p,h,b,x,m,v)=>{i=i||Ve,f=f||Ve;const g=i.length,C=f.length,w=Math.min(g,C);let O;for(O=0;OC?Oe(i,h,b,!0,!1,w):Ne(f,d,p,h,b,x,m,v,w)},Pt=(i,f,d,p,h,b,x,m,v)=>{let g=0;const C=f.length;let w=i.length-1,O=C-1;for(;g<=w&&g<=O;){const T=i[g],A=f[g]=v?Ae(f[g]):Ee(f[g]);if(at(T,A))$(T,A,d,null,h,b,x,m,v);else break;g++}for(;g<=w&&g<=O;){const T=i[w],A=f[O]=v?Ae(f[O]):Ee(f[O]);if(at(T,A))$(T,A,d,null,h,b,x,m,v);else break;w--,O--}if(g>w){if(g<=O){const T=O+1,A=TO)for(;g<=w;)ve(i[g],h,b,!0),g++;else{const T=g,A=g,H=new Map;for(g=A;g<=O;g++){const ae=f[g]=v?Ae(f[g]):Ee(f[g]);ae.key!=null&&H.set(ae.key,g)}let B,Y=0;const he=O-A+1;let Ye=!1,Qn=0;const ut=new Array(he);for(g=0;g=he){ve(ae,h,b,!0);continue}let xe;if(ae.key!=null)xe=H.get(ae.key);else for(B=A;B<=O;B++)if(ut[B-A]===0&&at(ae,f[B])){xe=B;break}xe===void 0?ve(ae,h,b,!0):(ut[xe-A]=g+1,xe>=Qn?Qn=xe:Ye=!0,$(ae,f[xe],d,null,h,b,x,m,v),Y++)}const Gn=Ye?pl(ut):Ve;for(B=Gn.length-1,g=he-1;g>=0;g--){const ae=A+g,xe=f[ae],es=ae+1{const{el:b,type:x,transition:m,children:v,shapeFlag:g}=i;if(g&6){He(i.component.subTree,f,d,p);return}if(g&128){i.suspense.move(f,d,p);return}if(g&64){x.move(i,f,d,qe);return}if(x===de){s(b,f,d);for(let w=0;wm.enter(b),h);else{const{leave:w,delayLeave:O,afterLeave:T}=m,A=()=>s(b,f,d),H=()=>{w(b,()=>{A(),T&&T()})};O?O(b,A,H):H()}else s(b,f,d)},ve=(i,f,d,p=!1,h=!1)=>{const{type:b,props:x,ref:m,children:v,dynamicChildren:g,shapeFlag:C,patchFlag:w,dirs:O}=i;if(m!=null&&On(m,null,d,i,!0),C&256){f.ctx.deactivate(i);return}const T=C&1&&O,A=!pt(i);let H;if(A&&(H=x&&x.onVnodeBeforeUnmount)&&ye(H,f,i),C&6)Mr(i.component,d,p);else{if(C&128){i.suspense.unmount(d,p);return}T&&Le(i,null,f,"beforeUnmount"),C&64?i.type.remove(i,f,d,h,qe,p):g&&(b!==de||w>0&&w&64)?Oe(g,f,d,!1,!0):(b===de&&w&384||!h&&C&16)&&Oe(v,f,d),p&&Vn(i)}(A&&(H=x&&x.onVnodeUnmounted)||T)&&ce(()=>{H&&ye(H,f,i),T&&Le(i,null,f,"unmounted")},d)},Vn=i=>{const{type:f,el:d,anchor:p,transition:h}=i;if(f===de){Ir(d,p);return}if(f===an){F(i);return}const b=()=>{r(d),h&&!h.persisted&&h.afterLeave&&h.afterLeave()};if(i.shapeFlag&1&&h&&!h.persisted){const{leave:x,delayLeave:m}=h,v=()=>x(d,b);m?m(i.el,b,v):v()}else b()},Ir=(i,f)=>{let d;for(;i!==f;)d=E(i),r(i),i=d;r(f)},Mr=(i,f,d)=>{const{bum:p,scope:h,update:b,subTree:x,um:m}=i;p&&on(p),h.stop(),b&&(b.active=!1,ve(x,i,f,d)),m&&ce(m,f),ce(()=>{i.isUnmounted=!0},f),f&&f.pendingBranch&&!f.isUnmounted&&i.asyncDep&&!i.asyncResolved&&i.suspenseId===f.pendingId&&(f.deps--,f.deps===0&&f.resolve())},Oe=(i,f,d,p=!1,h=!1,b=0)=>{for(let x=b;xi.shapeFlag&6?It(i.component.subTree):i.shapeFlag&128?i.suspense.next():E(i.anchor||i.el),Xn=(i,f,d)=>{i==null?f._vnode&&ve(f._vnode,null,null,!0):$(f._vnode||null,i,f,null,null,null,d),fs(),nr(),f._vnode=i},qe={p:$,um:ve,m:He,r:Vn,mt:tn,mc:Ne,pc:D,pbc:Be,n:It,o:e};let nn,sn;return t&&([nn,sn]=t(qe)),{render:Xn,hydrate:nn,createApp:ol(Xn,nn)}}function Ue({effect:e,update:t},n){e.allowRecurse=t.allowRecurse=n}function yr(e,t,n=!1){const s=e.children,r=t.children;if(P(s)&&P(r))for(let o=0;o>1,e[n[c]]0&&(t[s]=n[o-1]),n[o]=s)}}for(o=n.length,l=n[o-1];o-- >0;)n[o]=l,l=t[l];return n}const gl=e=>e.__isTeleport,de=Symbol.for("v-fgt"),Qt=Symbol.for("v-txt"),je=Symbol.for("v-cmt"),an=Symbol.for("v-stc"),_t=[];let _e=null;function V(e=!1){_t.push(_e=e?null:[])}function _l(){_t.pop(),_e=_t[_t.length-1]||null}let wt=1;function vs(e){wt+=e}function wr(e){return e.dynamicChildren=wt>0?_e||Ve:null,_l(),wt>0&&_e&&_e.push(e),e}function ie(e,t,n,s,r,o){return wr(K(e,t,n,s,r,o,!0))}function zn(e,t,n,s,r){return wr(S(e,t,n,s,r,!0))}function Er(e){return e?e.__v_isVNode===!0:!1}function at(e,t){return e.type===t.type&&e.key===t.key}const Gt="__vInternal",Cr=({key:e})=>e??null,Bt=({ref:e,ref_key:t,ref_for:n})=>(typeof e=="number"&&(e=""+e),e!=null?J(e)||re(e)||M(e)?{i:fe,r:e,k:t,f:!!n}:e:null);function K(e,t=null,n=null,s=0,r=null,o=e===de?0:1,l=!1,c=!1){const u={__v_isVNode:!0,__v_skip:!0,type:e,props:t,key:t&&Cr(t),ref:t&&Bt(t),scopeId:or,slotScopeIds:null,children:n,component:null,suspense:null,ssContent:null,ssFallback:null,dirs:null,transition:null,el:null,anchor:null,target:null,targetAnchor:null,staticCount:0,shapeFlag:o,patchFlag:s,dynamicProps:r,dynamicChildren:null,appContext:null,ctx:fe};return c?(kn(u,n),o&128&&e.normalize(u)):n&&(u.shapeFlag|=J(n)?8:16),wt>0&&!l&&_e&&(u.patchFlag>0||o&6)&&u.patchFlag!==32&&_e.push(u),u}const S=ml;function ml(e,t=null,n=null,s=0,r=null,o=!1){if((!e||e===Vo)&&(e=je),Er(e)){const c=nt(e,t,!0);return n&&kn(c,n),wt>0&&!o&&_e&&(c.shapeFlag&6?_e[_e.indexOf(e)]=c:_e.push(c)),c.patchFlag|=-2,c}if(Pl(e)&&(e=e.__vccOpts),t){t=bl(t);let{class:c,style:u}=t;c&&!J(c)&&(t.class=ot(c)),W(u)&&(Zs(u)&&!P(u)&&(u=X({},u)),t.style=qt(u))}const l=J(e)?1:No(e)?128:gl(e)?64:W(e)?4:M(e)?2:0;return K(e,t,n,s,r,l,o,!0)}function bl(e){return e?Zs(e)||Gt in e?X({},e):e:null}function nt(e,t,n=!1){const{props:s,ref:r,patchFlag:o,children:l}=e,c=t?vl(s||{},t):s;return{__v_isVNode:!0,__v_skip:!0,type:e.type,props:c,key:c&&Cr(c),ref:t&&t.ref?n&&r?P(r)?r.concat(Bt(t)):[r,Bt(t)]:Bt(t):r,scopeId:e.scopeId,slotScopeIds:e.slotScopeIds,children:l,target:e.target,targetAnchor:e.targetAnchor,staticCount:e.staticCount,shapeFlag:e.shapeFlag,patchFlag:t&&e.type!==de?o===-1?16:o|16:o,dynamicProps:e.dynamicProps,dynamicChildren:e.dynamicChildren,appContext:e.appContext,dirs:e.dirs,transition:e.transition,component:e.component,suspense:e.suspense,ssContent:e.ssContent&&nt(e.ssContent),ssFallback:e.ssFallback&&nt(e.ssFallback),el:e.el,anchor:e.anchor,ctx:e.ctx,ce:e.ce}}function N(e=" ",t=0){return S(Qt,null,e,t)}function mt(e="",t=!1){return t?(V(),zn(je,null,e)):S(je,null,e)}function Ee(e){return e==null||typeof e=="boolean"?S(je):P(e)?S(de,null,e.slice()):typeof e=="object"?Ae(e):S(Qt,null,String(e))}function Ae(e){return e.el===null&&e.patchFlag!==-1||e.memo?e:nt(e)}function kn(e,t){let n=0;const{shapeFlag:s}=e;if(t==null)t=null;else if(P(t))n=16;else if(typeof t=="object")if(s&65){const r=t.default;r&&(r._c&&(r._d=!1),kn(e,r()),r._c&&(r._d=!0));return}else{n=32;const r=t._;!r&&!(Gt in t)?t._ctx=fe:r===3&&fe&&(fe.slots._===1?t._=1:(t._=2,e.patchFlag|=1024))}else M(t)?(t={default:t,_ctx:fe},n=32):(t=String(t),s&64?(n=16,t=[N(t)]):n=8);e.children=t,e.shapeFlag|=n}function vl(...e){const t={};for(let n=0;nse=e),qn=e=>{Je.length>1?Je.forEach(t=>t(e)):Je[0](e)};const st=e=>{qn(e),e.scope.on()},ke=()=>{se&&se.scope.off(),qn(null)};function Or(e){return e.vnode.shapeFlag&4}let Et=!1;function El(e,t=!1){Et=t;const{props:n,children:s}=e.vnode,r=Or(e);il(e,n,r,t),ul(e,s);const o=r?Cl(e,t):void 0;return Et=!1,o}function Cl(e,t){const n=e.type;e.accessCache=Object.create(null),e.proxy=Vs(new Proxy(e.ctx,Qo));const{setup:s}=n;if(s){const r=e.setupContext=s.length>1?Tl(e):null;st(e),lt();const o=Re(s,e,0,[e.props,r]);if(it(),ke(),$s(o)){if(o.then(ke,ke),t)return o.then(l=>{ys(e,l,t)}).catch(l=>{Jt(l,e,0)});e.asyncDep=o}else ys(e,o,t)}else Tr(e,t)}function ys(e,t,n){M(t)?e.type.__ssrInlineRender?e.ssrRender=t:e.render=t:W(t)&&(e.setupState=Gs(t)),Tr(e,n)}let ws;function Tr(e,t,n){const s=e.type;if(!e.render){if(!t&&ws&&!s.render){const r=s.template||Kn(e).template;if(r){const{isCustomElement:o,compilerOptions:l}=e.appContext.config,{delimiters:c,compilerOptions:u}=s,a=X(X({isCustomElement:o,delimiters:c},l),u);s.render=ws(r,a)}}e.render=s.render||me}st(e),lt(),Go(e),it(),ke()}function Ol(e){return e.attrsProxy||(e.attrsProxy=new Proxy(e.attrs,{get(t,n){return ue(e,"get","$attrs"),t[n]}}))}function Tl(e){const t=n=>{e.exposed=n||{}};return{get attrs(){return Ol(e)},slots:e.slots,emit:e.emit,expose:t}}function Yn(e){if(e.exposed)return e.exposeProxy||(e.exposeProxy=new Proxy(Gs(Vs(e.exposed)),{get(t,n){if(n in t)return t[n];if(n in gt)return gt[n](e)},has(t,n){return n in t||n in gt}}))}function Pl(e){return M(e)&&"__vccOpts"in e}const Pr=(e,t)=>Co(e,t,Et),Il=Symbol.for("v-scx"),Ml=()=>Nt(Il),Fl="3.3.4",Al="http://www.w3.org/2000/svg",We=typeof document<"u"?document:null,Es=We&&We.createElement("template"),$l={insert:(e,t,n)=>{t.insertBefore(e,n||null)},remove:e=>{const t=e.parentNode;t&&t.removeChild(e)},createElement:(e,t,n,s)=>{const r=t?We.createElementNS(Al,e):We.createElement(e,n?{is:n}:void 0);return e==="select"&&s&&s.multiple!=null&&r.setAttribute("multiple",s.multiple),r},createText:e=>We.createTextNode(e),createComment:e=>We.createComment(e),setText:(e,t)=>{e.nodeValue=t},setElementText:(e,t)=>{e.textContent=t},parentNode:e=>e.parentNode,nextSibling:e=>e.nextSibling,querySelector:e=>We.querySelector(e),setScopeId(e,t){e.setAttribute(t,"")},insertStaticContent(e,t,n,s,r,o){const l=n?n.previousSibling:t.lastChild;if(r&&(r===o||r.nextSibling))for(;t.insertBefore(r.cloneNode(!0),n),!(r===o||!(r=r.nextSibling)););else{Es.innerHTML=s?`${e}`:e;const c=Es.content;if(s){const u=c.firstChild;for(;u.firstChild;)c.appendChild(u.firstChild);c.removeChild(u)}t.insertBefore(c,n)}return[l?l.nextSibling:t.firstChild,n?n.previousSibling:t.lastChild]}};function Rl(e,t,n){const s=e._vtc;s&&(t=(t?[t,...s]:[...s]).join(" ")),t==null?e.removeAttribute("class"):n?e.setAttribute("class",t):e.className=t}function Sl(e,t,n){const s=e.style,r=J(n);if(n&&!r){if(t&&!J(t))for(const o in t)n[o]==null&&Tn(s,o,"");for(const o in n)Tn(s,o,n[o])}else{const o=s.display;r?t!==n&&(s.cssText=n):t&&e.removeAttribute("style"),"_vod"in e&&(s.display=o)}}const Cs=/\s*!important$/;function Tn(e,t,n){if(P(n))n.forEach(s=>Tn(e,t,s));else if(n==null&&(n=""),t.startsWith("--"))e.setProperty(t,n);else{const s=jl(e,t);Cs.test(n)?e.setProperty(rt(s),n.replace(Cs,""),"important"):e[s]=n}}const Os=["Webkit","Moz","ms"],dn={};function jl(e,t){const n=dn[t];if(n)return n;let s=et(t);if(s!=="filter"&&s in e)return dn[t]=s;s=js(s);for(let r=0;rhn||(Kl.then(()=>hn=0),hn=Date.now());function zl(e,t){const n=s=>{if(!s._vts)s._vts=Date.now();else if(s._vts<=n.attached)return;be(kl(s,n.value),t,5,[s])};return n.value=e,n.attached=Wl(),n}function kl(e,t){if(P(t)){const n=e.stopImmediatePropagation;return e.stopImmediatePropagation=()=>{n.call(e),e._stopped=!0},t.map(s=>r=>!r._stopped&&s&&s(r))}else return t}const Is=/^on[a-z]/,ql=(e,t,n,s,r=!1,o,l,c,u)=>{t==="class"?Rl(e,s,r):t==="style"?Sl(e,n,s):Wt(t)?In(t)||Ll(e,t,n,s,l):(t[0]==="."?(t=t.slice(1),!0):t[0]==="^"?(t=t.slice(1),!1):Yl(e,t,s,r))?Bl(e,t,s,o,l,c,u):(t==="true-value"?e._trueValue=s:t==="false-value"&&(e._falseValue=s),Nl(e,t,s,r))};function Yl(e,t,n,s){return s?!!(t==="innerHTML"||t==="textContent"||t in e&&Is.test(t)&&M(n)):t==="spellcheck"||t==="draggable"||t==="translate"||t==="form"||t==="list"&&e.tagName==="INPUT"||t==="type"&&e.tagName==="TEXTAREA"||Is.test(t)&&J(n)?!1:t in e}const Jl=X({patchProp:ql},$l);let Ms;function Zl(){return Ms||(Ms=dl(Jl))}const Vl=(...e)=>{const t=Zl().createApp(...e),{mount:n}=t;return t.mount=s=>{const r=Xl(s);if(!r)return;const o=t._component;!M(o)&&!o.render&&!o.template&&(o.template=r.innerHTML),r.innerHTML="";const l=n(r,!1,r instanceof SVGElement);return r instanceof Element&&(r.removeAttribute("v-cloak"),r.setAttribute("data-v-app","")),l},t};function Xl(e){return J(e)?document.querySelector(e):e}const Jn=(e,t)=>{const n=e.__vccOpts||e;for(const[s,r]of t)n[s]=r;return n},Ql={},Gl={xmlns:"http://www.w3.org/2000/svg",fill:"none",viewBox:"0 0 24 24","stroke-width":"1.5",stroke:"currentColor"},ei=K("path",{"stroke-linecap":"round","stroke-linejoin":"round",d:"M8.25 6.75L12 3m0 0l3.75 3.75M12 3v18"},null,-1),ti=[ei];function ni(e,t){return V(),ie("svg",Gl,ti)}const si=Jn(Ql,[["render",ni]]),ri={},oi={xmlns:"http://www.w3.org/2000/svg",fill:"none",viewBox:"0 0 24 24","stroke-width":"1.5",stroke:"currentColor"},li=K("path",{"stroke-linecap":"round","stroke-linejoin":"round",d:"M15.75 17.25L12 21m0 0l-3.75-3.75M12 21V3"},null,-1),ii=[li];function ci(e,t){return V(),ie("svg",oi,ii)}const fi=Jn(ri,[["render",ci]]),ui={class:"inline-block text-sm bg-gray-200 rounded-full overflow-hidden relative"},ai=Vt({__name:"Progress",props:{value:{},max:{}},setup(e){return(t,n)=>(V(),ie("div",ui,[K("div",{class:ot(["px-2 text-sm transition-[width] duration-500 whitespace-nowrap",{"bg-gray-400/50":t.value/t.max<.8,"bg-orange-300":t.value/t.max>=.8&&t.value/t.max<.9,"bg-red-300":t.value/t.max>=.9}]),style:qt({width:`${t.value/t.max*100}%`})},[dr(t.$slots,"default")],6)]))}}),di={},hi={class:"inline-block bg-gray-200 px-2 rounded-full text-sm"};function pi(e,t){return V(),ie("div",hi,[dr(e.$slots,"default")])}const gi=Jn(di,[["render",pi]]),_i=Vt({__name:"StatusIndicator",props:{status:{type:Boolean}},setup(e){return(t,n)=>(V(),ie("div",{class:ot(["rounded-full inline-block",{"bg-green-400":t.status,"bg-red-500":!t.status}])},null,2))}});function we(e,t=2){if(e===0)return"0 B";const n=1024,s=t<0?0:t,r=["B","KB","MB","GB","TB","PB","EB","ZB","YB"],o=Math.floor(Math.log(e)/Math.log(n));return`${Number.parseFloat((e/n**o).toFixed(s))} ${r[o]}`}function mi(e){const t=new Date(e*1e3),n=t.getFullYear(),s=(t.getMonth()+1).toString().padStart(2,"0"),r=t.getDate().toString().padStart(2,"0"),o=t.getHours().toString().padStart(2,"0"),l=t.getMinutes().toString().padStart(2,"0"),c=t.getSeconds().toString().padStart(2,"0");return`${n}/${s}/${r} ${o}:${l}:${c}`}function pn(e){return e.online4||e.online6}function bi(e){return/[\uD800-\uDBFF][\uDC00-\uDFFF]/g.test(e)}const vi={class:"rounded-xl px-4 py-3 transition-all relative bg-gray-100 border border-transparent hover:border-gray-400 hover:shadow-md hover:bg-white duration-300"},xi={class:"absolute right-4 top-4 group flex flex-col items-end"},yi={class:"hidden group-hover:block p-2 rounded-xl border text-sm bg-white z-[9999] mt-1 border-gray-400"},wi={class:"flex gap-2"},Ei={class:"flex items-center gap-1"},Ci={class:"flex items-center gap-1"},Oi={key:0},Ti=K("br",null,null,-1),Pi={class:"text-lg flex items-center gap-2"},Ii={key:0},Mi=["src","alt"],Fi=["src","alt"],Ai={class:"flex items-center gap-2"},$i={class:"flex items-center gap-2"},Ri={class:"flex items-center gap-2"},Si={class:"flex items-center gap-2"},ji={class:"flex items-center gap-2"},Ni={class:"flex items-center gap-2"},Bi={class:"flex gap-1 flex-wrap mt-1"},Di=Vt({__name:"ServerItem",props:{server:{}},setup(e){const t=e,n=Pr(()=>{if(!t.server.labels)return{};const s=t.server.labels.split(";"),r={};return s.forEach(o=>{if(o==="")return;const[l,c]=o.split("=");r[l]=c}),r});return(s,r)=>{const o=_i,l=gi,c=ai,u=fi,a=si;return V(),ie("div",vi,[K("div",xi,[S(o,{status:U(pn)(s.server),class:"w-3 h-3"},null,8,["status"]),K("div",yi,[K("div",wi,[K("div",Ei,[N(" IPv4 "),S(o,{status:s.server.online4,class:"w-2 h-2"},null,8,["status"])]),K("div",Ci,[N(" IPv6 "),S(o,{status:s.server.online6,class:"w-2 h-2"},null,8,["status"])])]),s.server.latest_ts?(V(),ie("div",Oi,[N(" 最后上报时间"),Ti,N(" "+k(U(mi)(s.server.latest_ts)),1)])):mt("",!0)])]),K("div",Pi,[U(bi)(s.server.location)?(V(),ie("span",Ii,k(s.server.location),1)):(V(),ie("img",{key:1,src:`/image/flags/${s.server.location}.svg`,alt:`${s.server.location} flag`,class:"h-4 inline-block rounded-sm"},null,8,Mi)),U(n).os?(V(),ie("img",{key:2,src:`/image/os/${U(n).os}.svg`,alt:`${U(n).os} os`,class:"h-4 inline-block rounded-sm"},null,8,Fi)):mt("",!0),N(" "+k(s.server.alias||s.server.name),1)]),K("div",null,[N(" 运行时间 "),K("span",{class:ot({"text-red-500":!U(pn)(s.server)})},k(U(pn)(s.server)?s.server.uptime:"离线"),3)]),K("div",Ai,[N(" 负载 "),S(l,null,{default:te(()=>[N(k(s.server.load_1),1)]),_:1}),S(l,null,{default:te(()=>[N(k(s.server.load_5),1)]),_:1}),S(l,null,{default:te(()=>[N(k(s.server.load_15),1)]),_:1})]),K("div",$i,[N(" CPU "),S(c,{value:s.server.cpu,max:100,text:`${s.server.cpu}%`,class:"flex-1"},{default:te(()=>[N(k(s.server.cpu)+"% ",1)]),_:1},8,["value","text"])]),K("div",Ri,[N(" 内存 "),S(c,{value:s.server.memory_used,max:s.server.memory_total,class:"flex-1"},{default:te(()=>[N(k(U(we)(s.server.memory_used*1024))+" / "+k(U(we)(s.server.memory_total*1024)),1)]),_:1},8,["value","max"])]),K("div",Si,[N(" 硬盘 "),S(c,{value:s.server.hdd_used,max:s.server.hdd_total,class:"flex-1"},{default:te(()=>[N(k(U(we)(s.server.hdd_used*1024*1024))+" / "+k(U(we)(s.server.hdd_total*1024*1024)),1)]),_:1},8,["value","max"])]),K("div",ji,[N(" 网络 "),S(l,{class:"flex items-center"},{default:te(()=>[S(u,{class:"w-4 h-4"}),N(k(U(we)(s.server.network_rx,1))+"/s ",1)]),_:1}),S(l,{class:"flex items-center"},{default:te(()=>[S(a,{class:"w-4 h-4"}),N(k(U(we)(s.server.network_tx,1))+"/s ",1)]),_:1})]),K("div",Ni,[N(" 流量 "),S(l,{class:"flex items-center"},{default:te(()=>[S(u,{class:"w-4 h-4"}),N(k(U(we)(s.server.network_in,1)),1)]),_:1}),S(l,{class:"flex items-center"},{default:te(()=>[S(a,{class:"w-4 h-4"}),N(k(U(we)(s.server.network_out,1)),1)]),_:1})]),K("div",null,[N(" SWAP "),S(l,null,{default:te(()=>[N(k(U(we)(s.server.swap_used*1024))+" / "+k(U(we)(s.server.swap_total*1024)),1)]),_:1})]),K("div",Bi,[S(l,null,{default:te(()=>[N(" TCP "+k(s.server.tcp_count),1)]),_:1}),S(l,null,{default:te(()=>[N(" UDP "+k(s.server.udp_count),1)]),_:1}),S(l,null,{default:te(()=>[N(" 进程 "+k(s.server.process_count),1)]),_:1}),S(l,null,{default:te(()=>[N(" 线程 "+k(s.server.thread_count),1)]),_:1})])])}}}),Hi={key:0,class:"w-fit mx-auto my-2"},Li={key:1,class:"w-fit mx-auto my-2"},Ui={key:2,class:"flex flex-wrap gap-x-4 gap-y-3"},Ki=K("div",{class:"h-16"},null,-1),Fs="/json/stats.json",Wi=Vt({__name:"App",setup(e){const t=ln(),n=ln(!0),s=ln(!1);ur(()=>{fetch(Fs).then(o=>o.json()).then(o=>{t.value=o,setInterval(()=>{r()},1e3)}).catch(()=>{s.value=!0}).finally(()=>{n.value=!1})});function r(){fetch(Fs).then(o=>o.json()).then(o=>{t.value=o,s.value=!1}).catch(()=>{s.value=!0})}return(o,l)=>{const c=Di;return V(),ie(de,null,[U(n)?(V(),ie("div",Hi," 加载中 ")):mt("",!0),U(s)?(V(),ie("div",Li," 数据加载失败，请尝试刷新页面或检查 ServerStatus 服务端状态 ")):mt("",!0),U(t)?(V(),ie("div",Ui,[(V(!0),ie(de,null,Xo(U(t).servers,u=>(V(),zn(c,{key:u.name,server:u,class:"flex-1 min-w-[300px]"},null,8,["server"]))),128))])):mt("",!0),Ki],64)}}});const zi=Vl(Wi);zi.mount("#app"); diff --git a/web/css/bootstrap-theme.min.css b/web/css/bootstrap-theme.min.css deleted file mode 100644 index 5e394019..00000000 --- a/web/css/bootstrap-theme.min.css +++ /dev/null @@ -1,6 +0,0 @@ -/*! - * Bootstrap v3.3.7 (http://getbootstrap.com) - * Copyright 2011-2016 Twitter, Inc. - * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) - */.btn-danger,.btn-default,.btn-info,.btn-primary,.btn-success,.btn-warning{text-shadow:0 -1px 0 rgba(0,0,0,.2);-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 1px rgba(0,0,0,.075)}.btn-danger.active,.btn-danger:active,.btn-default.active,.btn-default:active,.btn-info.active,.btn-info:active,.btn-primary.active,.btn-primary:active,.btn-success.active,.btn-success:active,.btn-warning.active,.btn-warning:active{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125);box-shadow:inset 0 3px 5px rgba(0,0,0,.125)}.btn-danger.disabled,.btn-danger[disabled],.btn-default.disabled,.btn-default[disabled],.btn-info.disabled,.btn-info[disabled],.btn-primary.disabled,.btn-primary[disabled],.btn-success.disabled,.btn-success[disabled],.btn-warning.disabled,.btn-warning[disabled],fieldset[disabled] .btn-danger,fieldset[disabled] .btn-default,fieldset[disabled] .btn-info,fieldset[disabled] .btn-primary,fieldset[disabled] .btn-success,fieldset[disabled] .btn-warning{-webkit-box-shadow:none;box-shadow:none}.btn-danger .badge,.btn-default .badge,.btn-info .badge,.btn-primary .badge,.btn-success .badge,.btn-warning .badge{text-shadow:none}.btn.active,.btn:active{background-image:none}.btn-default{text-shadow:0 1px 0 #fff;background-image:-webkit-linear-gradient(top,#fff 0,#e0e0e0 100%);background-image:-o-linear-gradient(top,#fff 0,#e0e0e0 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#fff),to(#e0e0e0));background-image:linear-gradient(to bottom,#fff 0,#e0e0e0 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#ffe0e0e0', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#dbdbdb;border-color:#ccc}.btn-default:focus,.btn-default:hover{background-color:#e0e0e0;background-position:0 -15px}.btn-default.active,.btn-default:active{background-color:#e0e0e0;border-color:#dbdbdb}.btn-default.disabled,.btn-default.disabled.active,.btn-default.disabled.focus,.btn-default.disabled:active,.btn-default.disabled:focus,.btn-default.disabled:hover,.btn-default[disabled],.btn-default[disabled].active,.btn-default[disabled].focus,.btn-default[disabled]:active,.btn-default[disabled]:focus,.btn-default[disabled]:hover,fieldset[disabled] .btn-default,fieldset[disabled] .btn-default.active,fieldset[disabled] .btn-default.focus,fieldset[disabled] .btn-default:active,fieldset[disabled] .btn-default:focus,fieldset[disabled] .btn-default:hover{background-color:#e0e0e0;background-image:none}.btn-primary{background-image:-webkit-linear-gradient(top,#337ab7 0,#265a88 100%);background-image:-o-linear-gradient(top,#337ab7 0,#265a88 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#265a88));background-image:linear-gradient(to bottom,#337ab7 0,#265a88 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff265a88', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#245580}.btn-primary:focus,.btn-primary:hover{background-color:#265a88;background-position:0 -15px}.btn-primary.active,.btn-primary:active{background-color:#265a88;border-color:#245580}.btn-primary.disabled,.btn-primary.disabled.active,.btn-primary.disabled.focus,.btn-primary.disabled:active,.btn-primary.disabled:focus,.btn-primary.disabled:hover,.btn-primary[disabled],.btn-primary[disabled].active,.btn-primary[disabled].focus,.btn-primary[disabled]:active,.btn-primary[disabled]:focus,.btn-primary[disabled]:hover,fieldset[disabled] .btn-primary,fieldset[disabled] .btn-primary.active,fieldset[disabled] .btn-primary.focus,fieldset[disabled] .btn-primary:active,fieldset[disabled] .btn-primary:focus,fieldset[disabled] .btn-primary:hover{background-color:#265a88;background-image:none}.btn-success{background-image:-webkit-linear-gradient(top,#5cb85c 0,#419641 100%);background-image:-o-linear-gradient(top,#5cb85c 0,#419641 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#5cb85c),to(#419641));background-image:linear-gradient(to bottom,#5cb85c 0,#419641 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5cb85c', endColorstr='#ff419641', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#3e8f3e}.btn-success:focus,.btn-success:hover{background-color:#419641;background-position:0 -15px}.btn-success.active,.btn-success:active{background-color:#419641;border-color:#3e8f3e}.btn-success.disabled,.btn-success.disabled.active,.btn-success.disabled.focus,.btn-success.disabled:active,.btn-success.disabled:focus,.btn-success.disabled:hover,.btn-success[disabled],.btn-success[disabled].active,.btn-success[disabled].focus,.btn-success[disabled]:active,.btn-success[disabled]:focus,.btn-success[disabled]:hover,fieldset[disabled] .btn-success,fieldset[disabled] .btn-success.active,fieldset[disabled] .btn-success.focus,fieldset[disabled] .btn-success:active,fieldset[disabled] .btn-success:focus,fieldset[disabled] .btn-success:hover{background-color:#419641;background-image:none}.btn-info{background-image:-webkit-linear-gradient(top,#5bc0de 0,#2aabd2 100%);background-image:-o-linear-gradient(top,#5bc0de 0,#2aabd2 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#5bc0de),to(#2aabd2));background-image:linear-gradient(to bottom,#5bc0de 0,#2aabd2 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5bc0de', endColorstr='#ff2aabd2', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#28a4c9}.btn-info:focus,.btn-info:hover{background-color:#2aabd2;background-position:0 -15px}.btn-info.active,.btn-info:active{background-color:#2aabd2;border-color:#28a4c9}.btn-info.disabled,.btn-info.disabled.active,.btn-info.disabled.focus,.btn-info.disabled:active,.btn-info.disabled:focus,.btn-info.disabled:hover,.btn-info[disabled],.btn-info[disabled].active,.btn-info[disabled].focus,.btn-info[disabled]:active,.btn-info[disabled]:focus,.btn-info[disabled]:hover,fieldset[disabled] .btn-info,fieldset[disabled] .btn-info.active,fieldset[disabled] .btn-info.focus,fieldset[disabled] .btn-info:active,fieldset[disabled] .btn-info:focus,fieldset[disabled] .btn-info:hover{background-color:#2aabd2;background-image:none}.btn-warning{background-image:-webkit-linear-gradient(top,#f0ad4e 0,#eb9316 100%);background-image:-o-linear-gradient(top,#f0ad4e 0,#eb9316 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f0ad4e),to(#eb9316));background-image:linear-gradient(to bottom,#f0ad4e 0,#eb9316 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff0ad4e', endColorstr='#ffeb9316', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#e38d13}.btn-warning:focus,.btn-warning:hover{background-color:#eb9316;background-position:0 -15px}.btn-warning.active,.btn-warning:active{background-color:#eb9316;border-color:#e38d13}.btn-warning.disabled,.btn-warning.disabled.active,.btn-warning.disabled.focus,.btn-warning.disabled:active,.btn-warning.disabled:focus,.btn-warning.disabled:hover,.btn-warning[disabled],.btn-warning[disabled].active,.btn-warning[disabled].focus,.btn-warning[disabled]:active,.btn-warning[disabled]:focus,.btn-warning[disabled]:hover,fieldset[disabled] .btn-warning,fieldset[disabled] .btn-warning.active,fieldset[disabled] .btn-warning.focus,fieldset[disabled] .btn-warning:active,fieldset[disabled] .btn-warning:focus,fieldset[disabled] .btn-warning:hover{background-color:#eb9316;background-image:none}.btn-danger{background-image:-webkit-linear-gradient(top,#d9534f 0,#c12e2a 100%);background-image:-o-linear-gradient(top,#d9534f 0,#c12e2a 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#d9534f),to(#c12e2a));background-image:linear-gradient(to bottom,#d9534f 0,#c12e2a 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffd9534f', endColorstr='#ffc12e2a', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-color:#b92c28}.btn-danger:focus,.btn-danger:hover{background-color:#c12e2a;background-position:0 -15px}.btn-danger.active,.btn-danger:active{background-color:#c12e2a;border-color:#b92c28}.btn-danger.disabled,.btn-danger.disabled.active,.btn-danger.disabled.focus,.btn-danger.disabled:active,.btn-danger.disabled:focus,.btn-danger.disabled:hover,.btn-danger[disabled],.btn-danger[disabled].active,.btn-danger[disabled].focus,.btn-danger[disabled]:active,.btn-danger[disabled]:focus,.btn-danger[disabled]:hover,fieldset[disabled] .btn-danger,fieldset[disabled] .btn-danger.active,fieldset[disabled] .btn-danger.focus,fieldset[disabled] .btn-danger:active,fieldset[disabled] .btn-danger:focus,fieldset[disabled] .btn-danger:hover{background-color:#c12e2a;background-image:none}.img-thumbnail,.thumbnail{-webkit-box-shadow:0 1px 2px rgba(0,0,0,.075);box-shadow:0 1px 2px rgba(0,0,0,.075)}.dropdown-menu>li>a:focus,.dropdown-menu>li>a:hover{background-color:#e8e8e8;background-image:-webkit-linear-gradient(top,#f5f5f5 0,#e8e8e8 100%);background-image:-o-linear-gradient(top,#f5f5f5 0,#e8e8e8 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f5f5f5),to(#e8e8e8));background-image:linear-gradient(to bottom,#f5f5f5 0,#e8e8e8 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff5f5f5', endColorstr='#ffe8e8e8', GradientType=0);background-repeat:repeat-x}.dropdown-menu>.active>a,.dropdown-menu>.active>a:focus,.dropdown-menu>.active>a:hover{background-color:#2e6da4;background-image:-webkit-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-o-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#2e6da4));background-image:linear-gradient(to bottom,#337ab7 0,#2e6da4 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff2e6da4', GradientType=0);background-repeat:repeat-x}.navbar-default{background-image:-webkit-linear-gradient(top,#fff 0,#f8f8f8 100%);background-image:-o-linear-gradient(top,#fff 0,#f8f8f8 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#fff),to(#f8f8f8));background-image:linear-gradient(to bottom,#fff 0,#f8f8f8 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#fff8f8f8', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-radius:4px;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 5px rgba(0,0,0,.075);box-shadow:inset 0 1px 0 rgba(255,255,255,.15),0 1px 5px rgba(0,0,0,.075)}.navbar-default .navbar-nav>.active>a,.navbar-default .navbar-nav>.open>a{background-image:-webkit-linear-gradient(top,#dbdbdb 0,#e2e2e2 100%);background-image:-o-linear-gradient(top,#dbdbdb 0,#e2e2e2 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#dbdbdb),to(#e2e2e2));background-image:linear-gradient(to bottom,#dbdbdb 0,#e2e2e2 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffdbdbdb', endColorstr='#ffe2e2e2', GradientType=0);background-repeat:repeat-x;-webkit-box-shadow:inset 0 3px 9px rgba(0,0,0,.075);box-shadow:inset 0 3px 9px rgba(0,0,0,.075)}.navbar-brand,.navbar-nav>li>a{text-shadow:0 1px 0 rgba(255,255,255,.25)}.navbar-inverse{background-image:-webkit-linear-gradient(top,#3c3c3c 0,#222 100%);background-image:-o-linear-gradient(top,#3c3c3c 0,#222 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#3c3c3c),to(#222));background-image:linear-gradient(to bottom,#3c3c3c 0,#222 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff3c3c3c', endColorstr='#ff222222', GradientType=0);filter:progid:DXImageTransform.Microsoft.gradient(enabled=false);background-repeat:repeat-x;border-radius:4px}.navbar-inverse .navbar-nav>.active>a,.navbar-inverse .navbar-nav>.open>a{background-image:-webkit-linear-gradient(top,#080808 0,#0f0f0f 100%);background-image:-o-linear-gradient(top,#080808 0,#0f0f0f 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#080808),to(#0f0f0f));background-image:linear-gradient(to bottom,#080808 0,#0f0f0f 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff080808', endColorstr='#ff0f0f0f', GradientType=0);background-repeat:repeat-x;-webkit-box-shadow:inset 0 3px 9px rgba(0,0,0,.25);box-shadow:inset 0 3px 9px rgba(0,0,0,.25)}.navbar-inverse .navbar-brand,.navbar-inverse .navbar-nav>li>a{text-shadow:0 -1px 0 rgba(0,0,0,.25)}.navbar-fixed-bottom,.navbar-fixed-top,.navbar-static-top{border-radius:0}@media (max-width:767px){.navbar .navbar-nav .open .dropdown-menu>.active>a,.navbar .navbar-nav .open .dropdown-menu>.active>a:focus,.navbar .navbar-nav .open .dropdown-menu>.active>a:hover{color:#fff;background-image:-webkit-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-o-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#2e6da4));background-image:linear-gradient(to bottom,#337ab7 0,#2e6da4 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff2e6da4', GradientType=0);background-repeat:repeat-x}}.alert{text-shadow:0 1px 0 rgba(255,255,255,.2);-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 2px rgba(0,0,0,.05);box-shadow:inset 0 1px 0 rgba(255,255,255,.25),0 1px 2px rgba(0,0,0,.05)}.alert-success{background-image:-webkit-linear-gradient(top,#dff0d8 0,#c8e5bc 100%);background-image:-o-linear-gradient(top,#dff0d8 0,#c8e5bc 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#dff0d8),to(#c8e5bc));background-image:linear-gradient(to bottom,#dff0d8 0,#c8e5bc 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffdff0d8', endColorstr='#ffc8e5bc', GradientType=0);background-repeat:repeat-x;border-color:#b2dba1}.alert-info{background-image:-webkit-linear-gradient(top,#d9edf7 0,#b9def0 100%);background-image:-o-linear-gradient(top,#d9edf7 0,#b9def0 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#d9edf7),to(#b9def0));background-image:linear-gradient(to bottom,#d9edf7 0,#b9def0 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffd9edf7', endColorstr='#ffb9def0', GradientType=0);background-repeat:repeat-x;border-color:#9acfea}.alert-warning{background-image:-webkit-linear-gradient(top,#fcf8e3 0,#f8efc0 100%);background-image:-o-linear-gradient(top,#fcf8e3 0,#f8efc0 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#fcf8e3),to(#f8efc0));background-image:linear-gradient(to bottom,#fcf8e3 0,#f8efc0 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffcf8e3', endColorstr='#fff8efc0', GradientType=0);background-repeat:repeat-x;border-color:#f5e79e}.alert-danger{background-image:-webkit-linear-gradient(top,#f2dede 0,#e7c3c3 100%);background-image:-o-linear-gradient(top,#f2dede 0,#e7c3c3 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f2dede),to(#e7c3c3));background-image:linear-gradient(to bottom,#f2dede 0,#e7c3c3 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff2dede', endColorstr='#ffe7c3c3', GradientType=0);background-repeat:repeat-x;border-color:#dca7a7}.progress{background-image:-webkit-linear-gradient(top,#ebebeb 0,#f5f5f5 100%);background-image:-o-linear-gradient(top,#ebebeb 0,#f5f5f5 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#ebebeb),to(#f5f5f5));background-image:linear-gradient(to bottom,#ebebeb 0,#f5f5f5 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffebebeb', endColorstr='#fff5f5f5', GradientType=0);background-repeat:repeat-x}.progress-bar{background-image:-webkit-linear-gradient(top,#337ab7 0,#286090 100%);background-image:-o-linear-gradient(top,#337ab7 0,#286090 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#286090));background-image:linear-gradient(to bottom,#337ab7 0,#286090 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff286090', GradientType=0);background-repeat:repeat-x}.progress-bar-success{background-image:-webkit-linear-gradient(top,#5cb85c 0,#449d44 100%);background-image:-o-linear-gradient(top,#5cb85c 0,#449d44 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#5cb85c),to(#449d44));background-image:linear-gradient(to bottom,#5cb85c 0,#449d44 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5cb85c', endColorstr='#ff449d44', GradientType=0);background-repeat:repeat-x}.progress-bar-info{background-image:-webkit-linear-gradient(top,#5bc0de 0,#31b0d5 100%);background-image:-o-linear-gradient(top,#5bc0de 0,#31b0d5 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#5bc0de),to(#31b0d5));background-image:linear-gradient(to bottom,#5bc0de 0,#31b0d5 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff5bc0de', endColorstr='#ff31b0d5', GradientType=0);background-repeat:repeat-x}.progress-bar-warning{background-image:-webkit-linear-gradient(top,#f0ad4e 0,#ec971f 100%);background-image:-o-linear-gradient(top,#f0ad4e 0,#ec971f 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f0ad4e),to(#ec971f));background-image:linear-gradient(to bottom,#f0ad4e 0,#ec971f 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff0ad4e', endColorstr='#ffec971f', GradientType=0);background-repeat:repeat-x}.progress-bar-danger{background-image:-webkit-linear-gradient(top,#d9534f 0,#c9302c 100%);background-image:-o-linear-gradient(top,#d9534f 0,#c9302c 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#d9534f),to(#c9302c));background-image:linear-gradient(to bottom,#d9534f 0,#c9302c 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffd9534f', endColorstr='#ffc9302c', GradientType=0);background-repeat:repeat-x}.progress-bar-striped{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.list-group{border-radius:4px;-webkit-box-shadow:0 1px 2px rgba(0,0,0,.075);box-shadow:0 1px 2px rgba(0,0,0,.075)}.list-group-item.active,.list-group-item.active:focus,.list-group-item.active:hover{text-shadow:0 -1px 0 #286090;background-image:-webkit-linear-gradient(top,#337ab7 0,#2b669a 100%);background-image:-o-linear-gradient(top,#337ab7 0,#2b669a 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#2b669a));background-image:linear-gradient(to bottom,#337ab7 0,#2b669a 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff2b669a', GradientType=0);background-repeat:repeat-x;border-color:#2b669a}.list-group-item.active .badge,.list-group-item.active:focus .badge,.list-group-item.active:hover .badge{text-shadow:none}.panel{-webkit-box-shadow:0 1px 2px rgba(0,0,0,.05);box-shadow:0 1px 2px rgba(0,0,0,.05)}.panel-default>.panel-heading{background-image:-webkit-linear-gradient(top,#f5f5f5 0,#e8e8e8 100%);background-image:-o-linear-gradient(top,#f5f5f5 0,#e8e8e8 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f5f5f5),to(#e8e8e8));background-image:linear-gradient(to bottom,#f5f5f5 0,#e8e8e8 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff5f5f5', endColorstr='#ffe8e8e8', GradientType=0);background-repeat:repeat-x}.panel-primary>.panel-heading{background-image:-webkit-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-o-linear-gradient(top,#337ab7 0,#2e6da4 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#337ab7),to(#2e6da4));background-image:linear-gradient(to bottom,#337ab7 0,#2e6da4 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff337ab7', endColorstr='#ff2e6da4', GradientType=0);background-repeat:repeat-x}.panel-success>.panel-heading{background-image:-webkit-linear-gradient(top,#dff0d8 0,#d0e9c6 100%);background-image:-o-linear-gradient(top,#dff0d8 0,#d0e9c6 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#dff0d8),to(#d0e9c6));background-image:linear-gradient(to bottom,#dff0d8 0,#d0e9c6 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffdff0d8', endColorstr='#ffd0e9c6', GradientType=0);background-repeat:repeat-x}.panel-info>.panel-heading{background-image:-webkit-linear-gradient(top,#d9edf7 0,#c4e3f3 100%);background-image:-o-linear-gradient(top,#d9edf7 0,#c4e3f3 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#d9edf7),to(#c4e3f3));background-image:linear-gradient(to bottom,#d9edf7 0,#c4e3f3 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffd9edf7', endColorstr='#ffc4e3f3', GradientType=0);background-repeat:repeat-x}.panel-warning>.panel-heading{background-image:-webkit-linear-gradient(top,#fcf8e3 0,#faf2cc 100%);background-image:-o-linear-gradient(top,#fcf8e3 0,#faf2cc 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#fcf8e3),to(#faf2cc));background-image:linear-gradient(to bottom,#fcf8e3 0,#faf2cc 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffcf8e3', endColorstr='#fffaf2cc', GradientType=0);background-repeat:repeat-x}.panel-danger>.panel-heading{background-image:-webkit-linear-gradient(top,#f2dede 0,#ebcccc 100%);background-image:-o-linear-gradient(top,#f2dede 0,#ebcccc 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#f2dede),to(#ebcccc));background-image:linear-gradient(to bottom,#f2dede 0,#ebcccc 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff2dede', endColorstr='#ffebcccc', GradientType=0);background-repeat:repeat-x}.well{background-image:-webkit-linear-gradient(top,#e8e8e8 0,#f5f5f5 100%);background-image:-o-linear-gradient(top,#e8e8e8 0,#f5f5f5 100%);background-image:-webkit-gradient(linear,left top,left bottom,from(#e8e8e8),to(#f5f5f5));background-image:linear-gradient(to bottom,#e8e8e8 0,#f5f5f5 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffe8e8e8', endColorstr='#fff5f5f5', GradientType=0);background-repeat:repeat-x;border-color:#dcdcdc;-webkit-box-shadow:inset 0 1px 3px rgba(0,0,0,.05),0 1px 0 rgba(255,255,255,.1);box-shadow:inset 0 1px 3px rgba(0,0,0,.05),0 1px 0 rgba(255,255,255,.1)} -/*# sourceMappingURL=bootstrap-theme.min.css.map */ \ No newline at end of file diff --git a/web/css/bootstrap.min.css b/web/css/bootstrap.min.css index ed3905e0..39934146 100644 --- a/web/css/bootstrap.min.css +++ b/web/css/bootstrap.min.css @@ -1,6 +1,6 @@ -/*! - * Bootstrap v3.3.7 (http://getbootstrap.com) - * Copyright 2011-2016 Twitter, Inc. - * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) - *//*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */html{font-family:sans-serif;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%}body{margin:0}article,aside,details,figcaption,figure,footer,header,hgroup,main,menu,nav,section,summary{display:block}audio,canvas,progress,video{display:inline-block;vertical-align:baseline}audio:not([controls]){display:none;height:0}[hidden],template{display:none}a{background-color:transparent}a:active,a:hover{outline:0}abbr[title]{border-bottom:1px dotted}b,strong{font-weight:700}dfn{font-style:italic}h1{margin:.67em 0;font-size:2em}mark{color:#000;background:#ff0}small{font-size:80%}sub,sup{position:relative;font-size:75%;line-height:0;vertical-align:baseline}sup{top:-.5em}sub{bottom:-.25em}img{border:0}svg:not(:root){overflow:hidden}figure{margin:1em 40px}hr{height:0;-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box}pre{overflow:auto}code,kbd,pre,samp{font-family:monospace,monospace;font-size:1em}button,input,optgroup,select,textarea{margin:0;font:inherit;color:inherit}button{overflow:visible}button,select{text-transform:none}button,html input[type=button],input[type=reset],input[type=submit]{-webkit-appearance:button;cursor:pointer}button[disabled],html input[disabled]{cursor:default}button::-moz-focus-inner,input::-moz-focus-inner{padding:0;border:0}input{line-height:normal}input[type=checkbox],input[type=radio]{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;padding:0}input[type=number]::-webkit-inner-spin-button,input[type=number]::-webkit-outer-spin-button{height:auto}input[type=search]{-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;-webkit-appearance:textfield}input[type=search]::-webkit-search-cancel-button,input[type=search]::-webkit-search-decoration{-webkit-appearance:none}fieldset{padding:.35em .625em .75em;margin:0 2px;border:1px solid silver}legend{padding:0;border:0}textarea{overflow:auto}optgroup{font-weight:700}table{border-spacing:0;border-collapse:collapse}td,th{padding:0}/*! Source: https://github.com/h5bp/html5-boilerplate/blob/master/src/css/main.css */@media print{*,:after,:before{color:#000!important;text-shadow:none!important;background:0 0!important;-webkit-box-shadow:none!important;box-shadow:none!important}a,a:visited{text-decoration:underline}a[href]:after{content:" (" attr(href) ")"}abbr[title]:after{content:" (" attr(title) ")"}a[href^="javascript:"]:after,a[href^="#"]:after{content:""}blockquote,pre{border:1px solid #999;page-break-inside:avoid}thead{display:table-header-group}img,tr{page-break-inside:avoid}img{max-width:100%!important}h2,h3,p{orphans:3;widows:3}h2,h3{page-break-after:avoid}.navbar{display:none}.btn>.caret,.dropup>.btn>.caret{border-top-color:#000!important}.label{border:1px solid #000}.table{border-collapse:collapse!important}.table td,.table th{background-color:#fff!important}.table-bordered td,.table-bordered th{border:1px solid #ddd!important}}@font-face{font-family:'Glyphicons Halflings';src:url(../fonts/glyphicons-halflings-regular.eot);src:url(../fonts/glyphicons-halflings-regular.eot?#iefix) format('embedded-opentype'),url(../fonts/glyphicons-halflings-regular.woff2) format('woff2'),url(../fonts/glyphicons-halflings-regular.woff) format('woff'),url(../fonts/glyphicons-halflings-regular.ttf) format('truetype'),url(../fonts/glyphicons-halflings-regular.svg#glyphicons_halflingsregular) format('svg')}.glyphicon{position:relative;top:1px;display:inline-block;font-family:'Glyphicons Halflings';font-style:normal;font-weight:400;line-height:1;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale}.glyphicon-asterisk:before{content:"\002a"}.glyphicon-plus:before{content:"\002b"}.glyphicon-eur:before,.glyphicon-euro:before{content:"\20ac"}.glyphicon-minus:before{content:"\2212"}.glyphicon-cloud:before{content:"\2601"}.glyphicon-envelope:before{content:"\2709"}.glyphicon-pencil:before{content:"\270f"}.glyphicon-glass:before{content:"\e001"}.glyphicon-music:before{content:"\e002"}.glyphicon-search:before{content:"\e003"}.glyphicon-heart:before{content:"\e005"}.glyphicon-star:before{content:"\e006"}.glyphicon-star-empty:before{content:"\e007"}.glyphicon-user:before{content:"\e008"}.glyphicon-film:before{content:"\e009"}.glyphicon-th-large:before{content:"\e010"}.glyphicon-th:before{content:"\e011"}.glyphicon-th-list:before{content:"\e012"}.glyphicon-ok:before{content:"\e013"}.glyphicon-remove:before{content:"\e014"}.glyphicon-zoom-in:before{content:"\e015"}.glyphicon-zoom-out:before{content:"\e016"}.glyphicon-off:before{content:"\e017"}.glyphicon-signal:before{content:"\e018"}.glyphicon-cog:before{content:"\e019"}.glyphicon-trash:before{content:"\e020"}.glyphicon-home:before{content:"\e021"}.glyphicon-file:before{content:"\e022"}.glyphicon-time:before{content:"\e023"}.glyphicon-road:before{content:"\e024"}.glyphicon-download-alt:before{content:"\e025"}.glyphicon-download:before{content:"\e026"}.glyphicon-upload:before{content:"\e027"}.glyphicon-inbox:before{content:"\e028"}.glyphicon-play-circle:before{content:"\e029"}.glyphicon-repeat:before{content:"\e030"}.glyphicon-refresh:before{content:"\e031"}.glyphicon-list-alt:before{content:"\e032"}.glyphicon-lock:before{content:"\e033"}.glyphicon-flag:before{content:"\e034"}.glyphicon-headphones:before{content:"\e035"}.glyphicon-volume-off:before{content:"\e036"}.glyphicon-volume-down:before{content:"\e037"}.glyphicon-volume-up:before{content:"\e038"}.glyphicon-qrcode:before{content:"\e039"}.glyphicon-barcode:before{content:"\e040"}.glyphicon-tag:before{content:"\e041"}.glyphicon-tags:before{content:"\e042"}.glyphicon-book:before{content:"\e043"}.glyphicon-bookmark:before{content:"\e044"}.glyphicon-print:before{content:"\e045"}.glyphicon-camera:before{content:"\e046"}.glyphicon-font:before{content:"\e047"}.glyphicon-bold:before{content:"\e048"}.glyphicon-italic:before{content:"\e049"}.glyphicon-text-height:before{content:"\e050"}.glyphicon-text-width:before{content:"\e051"}.glyphicon-align-left:before{content:"\e052"}.glyphicon-align-center:before{content:"\e053"}.glyphicon-align-right:before{content:"\e054"}.glyphicon-align-justify:before{content:"\e055"}.glyphicon-list:before{content:"\e056"}.glyphicon-indent-left:before{content:"\e057"}.glyphicon-indent-right:before{content:"\e058"}.glyphicon-facetime-video:before{content:"\e059"}.glyphicon-picture:before{content:"\e060"}.glyphicon-map-marker:before{content:"\e062"}.glyphicon-adjust:before{content:"\e063"}.glyphicon-tint:before{content:"\e064"}.glyphicon-edit:before{content:"\e065"}.glyphicon-share:before{content:"\e066"}.glyphicon-check:before{content:"\e067"}.glyphicon-move:before{content:"\e068"}.glyphicon-step-backward:before{content:"\e069"}.glyphicon-fast-backward:before{content:"\e070"}.glyphicon-backward:before{content:"\e071"}.glyphicon-play:before{content:"\e072"}.glyphicon-pause:before{content:"\e073"}.glyphicon-stop:before{content:"\e074"}.glyphicon-forward:before{content:"\e075"}.glyphicon-fast-forward:before{content:"\e076"}.glyphicon-step-forward:before{content:"\e077"}.glyphicon-eject:before{content:"\e078"}.glyphicon-chevron-left:before{content:"\e079"}.glyphicon-chevron-right:before{content:"\e080"}.glyphicon-plus-sign:before{content:"\e081"}.glyphicon-minus-sign:before{content:"\e082"}.glyphicon-remove-sign:before{content:"\e083"}.glyphicon-ok-sign:before{content:"\e084"}.glyphicon-question-sign:before{content:"\e085"}.glyphicon-info-sign:before{content:"\e086"}.glyphicon-screenshot:before{content:"\e087"}.glyphicon-remove-circle:before{content:"\e088"}.glyphicon-ok-circle:before{content:"\e089"}.glyphicon-ban-circle:before{content:"\e090"}.glyphicon-arrow-left:before{content:"\e091"}.glyphicon-arrow-right:before{content:"\e092"}.glyphicon-arrow-up:before{content:"\e093"}.glyphicon-arrow-down:before{content:"\e094"}.glyphicon-share-alt:before{content:"\e095"}.glyphicon-resize-full:before{content:"\e096"}.glyphicon-resize-small:before{content:"\e097"}.glyphicon-exclamation-sign:before{content:"\e101"}.glyphicon-gift:before{content:"\e102"}.glyphicon-leaf:before{content:"\e103"}.glyphicon-fire:before{content:"\e104"}.glyphicon-eye-open:before{content:"\e105"}.glyphicon-eye-close:before{content:"\e106"}.glyphicon-warning-sign:before{content:"\e107"}.glyphicon-plane:before{content:"\e108"}.glyphicon-calendar:before{content:"\e109"}.glyphicon-random:before{content:"\e110"}.glyphicon-comment:before{content:"\e111"}.glyphicon-magnet:before{content:"\e112"}.glyphicon-chevron-up:before{content:"\e113"}.glyphicon-chevron-down:before{content:"\e114"}.glyphicon-retweet:before{content:"\e115"}.glyphicon-shopping-cart:before{content:"\e116"}.glyphicon-folder-close:before{content:"\e117"}.glyphicon-folder-open:before{content:"\e118"}.glyphicon-resize-vertical:before{content:"\e119"}.glyphicon-resize-horizontal:before{content:"\e120"}.glyphicon-hdd:before{content:"\e121"}.glyphicon-bullhorn:before{content:"\e122"}.glyphicon-bell:before{content:"\e123"}.glyphicon-certificate:before{content:"\e124"}.glyphicon-thumbs-up:before{content:"\e125"}.glyphicon-thumbs-down:before{content:"\e126"}.glyphicon-hand-right:before{content:"\e127"}.glyphicon-hand-left:before{content:"\e128"}.glyphicon-hand-up:before{content:"\e129"}.glyphicon-hand-down:before{content:"\e130"}.glyphicon-circle-arrow-right:before{content:"\e131"}.glyphicon-circle-arrow-left:before{content:"\e132"}.glyphicon-circle-arrow-up:before{content:"\e133"}.glyphicon-circle-arrow-down:before{content:"\e134"}.glyphicon-globe:before{content:"\e135"}.glyphicon-wrench:before{content:"\e136"}.glyphicon-tasks:before{content:"\e137"}.glyphicon-filter:before{content:"\e138"}.glyphicon-briefcase:before{content:"\e139"}.glyphicon-fullscreen:before{content:"\e140"}.glyphicon-dashboard:before{content:"\e141"}.glyphicon-paperclip:before{content:"\e142"}.glyphicon-heart-empty:before{content:"\e143"}.glyphicon-link:before{content:"\e144"}.glyphicon-phone:before{content:"\e145"}.glyphicon-pushpin:before{content:"\e146"}.glyphicon-usd:before{content:"\e148"}.glyphicon-gbp:before{content:"\e149"}.glyphicon-sort:before{content:"\e150"}.glyphicon-sort-by-alphabet:before{content:"\e151"}.glyphicon-sort-by-alphabet-alt:before{content:"\e152"}.glyphicon-sort-by-order:before{content:"\e153"}.glyphicon-sort-by-order-alt:before{content:"\e154"}.glyphicon-sort-by-attributes:before{content:"\e155"}.glyphicon-sort-by-attributes-alt:before{content:"\e156"}.glyphicon-unchecked:before{content:"\e157"}.glyphicon-expand:before{content:"\e158"}.glyphicon-collapse-down:before{content:"\e159"}.glyphicon-collapse-up:before{content:"\e160"}.glyphicon-log-in:before{content:"\e161"}.glyphicon-flash:before{content:"\e162"}.glyphicon-log-out:before{content:"\e163"}.glyphicon-new-window:before{content:"\e164"}.glyphicon-record:before{content:"\e165"}.glyphicon-save:before{content:"\e166"}.glyphicon-open:before{content:"\e167"}.glyphicon-saved:before{content:"\e168"}.glyphicon-import:before{content:"\e169"}.glyphicon-export:before{content:"\e170"}.glyphicon-send:before{content:"\e171"}.glyphicon-floppy-disk:before{content:"\e172"}.glyphicon-floppy-saved:before{content:"\e173"}.glyphicon-floppy-remove:before{content:"\e174"}.glyphicon-floppy-save:before{content:"\e175"}.glyphicon-floppy-open:before{content:"\e176"}.glyphicon-credit-card:before{content:"\e177"}.glyphicon-transfer:before{content:"\e178"}.glyphicon-cutlery:before{content:"\e179"}.glyphicon-header:before{content:"\e180"}.glyphicon-compressed:before{content:"\e181"}.glyphicon-earphone:before{content:"\e182"}.glyphicon-phone-alt:before{content:"\e183"}.glyphicon-tower:before{content:"\e184"}.glyphicon-stats:before{content:"\e185"}.glyphicon-sd-video:before{content:"\e186"}.glyphicon-hd-video:before{content:"\e187"}.glyphicon-subtitles:before{content:"\e188"}.glyphicon-sound-stereo:before{content:"\e189"}.glyphicon-sound-dolby:before{content:"\e190"}.glyphicon-sound-5-1:before{content:"\e191"}.glyphicon-sound-6-1:before{content:"\e192"}.glyphicon-sound-7-1:before{content:"\e193"}.glyphicon-copyright-mark:before{content:"\e194"}.glyphicon-registration-mark:before{content:"\e195"}.glyphicon-cloud-download:before{content:"\e197"}.glyphicon-cloud-upload:before{content:"\e198"}.glyphicon-tree-conifer:before{content:"\e199"}.glyphicon-tree-deciduous:before{content:"\e200"}.glyphicon-cd:before{content:"\e201"}.glyphicon-save-file:before{content:"\e202"}.glyphicon-open-file:before{content:"\e203"}.glyphicon-level-up:before{content:"\e204"}.glyphicon-copy:before{content:"\e205"}.glyphicon-paste:before{content:"\e206"}.glyphicon-alert:before{content:"\e209"}.glyphicon-equalizer:before{content:"\e210"}.glyphicon-king:before{content:"\e211"}.glyphicon-queen:before{content:"\e212"}.glyphicon-pawn:before{content:"\e213"}.glyphicon-bishop:before{content:"\e214"}.glyphicon-knight:before{content:"\e215"}.glyphicon-baby-formula:before{content:"\e216"}.glyphicon-tent:before{content:"\26fa"}.glyphicon-blackboard:before{content:"\e218"}.glyphicon-bed:before{content:"\e219"}.glyphicon-apple:before{content:"\f8ff"}.glyphicon-erase:before{content:"\e221"}.glyphicon-hourglass:before{content:"\231b"}.glyphicon-lamp:before{content:"\e223"}.glyphicon-duplicate:before{content:"\e224"}.glyphicon-piggy-bank:before{content:"\e225"}.glyphicon-scissors:before{content:"\e226"}.glyphicon-bitcoin:before{content:"\e227"}.glyphicon-btc:before{content:"\e227"}.glyphicon-xbt:before{content:"\e227"}.glyphicon-yen:before{content:"\00a5"}.glyphicon-jpy:before{content:"\00a5"}.glyphicon-ruble:before{content:"\20bd"}.glyphicon-rub:before{content:"\20bd"}.glyphicon-scale:before{content:"\e230"}.glyphicon-ice-lolly:before{content:"\e231"}.glyphicon-ice-lolly-tasted:before{content:"\e232"}.glyphicon-education:before{content:"\e233"}.glyphicon-option-horizontal:before{content:"\e234"}.glyphicon-option-vertical:before{content:"\e235"}.glyphicon-menu-hamburger:before{content:"\e236"}.glyphicon-modal-window:before{content:"\e237"}.glyphicon-oil:before{content:"\e238"}.glyphicon-grain:before{content:"\e239"}.glyphicon-sunglasses:before{content:"\e240"}.glyphicon-text-size:before{content:"\e241"}.glyphicon-text-color:before{content:"\e242"}.glyphicon-text-background:before{content:"\e243"}.glyphicon-object-align-top:before{content:"\e244"}.glyphicon-object-align-bottom:before{content:"\e245"}.glyphicon-object-align-horizontal:before{content:"\e246"}.glyphicon-object-align-left:before{content:"\e247"}.glyphicon-object-align-vertical:before{content:"\e248"}.glyphicon-object-align-right:before{content:"\e249"}.glyphicon-triangle-right:before{content:"\e250"}.glyphicon-triangle-left:before{content:"\e251"}.glyphicon-triangle-bottom:before{content:"\e252"}.glyphicon-triangle-top:before{content:"\e253"}.glyphicon-console:before{content:"\e254"}.glyphicon-superscript:before{content:"\e255"}.glyphicon-subscript:before{content:"\e256"}.glyphicon-menu-left:before{content:"\e257"}.glyphicon-menu-right:before{content:"\e258"}.glyphicon-menu-down:before{content:"\e259"}.glyphicon-menu-up:before{content:"\e260"}*{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}:after,:before{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}html{font-size:10px;-webkit-tap-highlight-color:rgba(0,0,0,0)}body{font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:14px;line-height:1.42857143;color:#333;background-color:#fff}button,input,select,textarea{font-family:inherit;font-size:inherit;line-height:inherit}a{color:#337ab7;text-decoration:none}a:focus,a:hover{color:#23527c;text-decoration:underline}a:focus{outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}figure{margin:0}img{vertical-align:middle}.carousel-inner>.item>a>img,.carousel-inner>.item>img,.img-responsive,.thumbnail a>img,.thumbnail>img{display:block;max-width:100%;height:auto}.img-rounded{border-radius:6px}.img-thumbnail{display:inline-block;max-width:100%;height:auto;padding:4px;line-height:1.42857143;background-color:#fff;border:1px solid #ddd;border-radius:4px;-webkit-transition:all .2s ease-in-out;-o-transition:all .2s ease-in-out;transition:all .2s ease-in-out}.img-circle{border-radius:50%}hr{margin-top:20px;margin-bottom:20px;border:0;border-top:1px solid #eee}.sr-only{position:absolute;width:1px;height:1px;padding:0;margin:-1px;overflow:hidden;clip:rect(0,0,0,0);border:0}.sr-only-focusable:active,.sr-only-focusable:focus{position:static;width:auto;height:auto;margin:0;overflow:visible;clip:auto}[role=button]{cursor:pointer}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{font-family:inherit;font-weight:500;line-height:1.1;color:inherit}.h1 .small,.h1 small,.h2 .small,.h2 small,.h3 .small,.h3 small,.h4 .small,.h4 small,.h5 .small,.h5 small,.h6 .small,.h6 small,h1 .small,h1 small,h2 .small,h2 small,h3 .small,h3 small,h4 .small,h4 small,h5 .small,h5 small,h6 .small,h6 small{font-weight:400;line-height:1;color:#777}.h1,.h2,.h3,h1,h2,h3{margin-top:20px;margin-bottom:10px}.h1 .small,.h1 small,.h2 .small,.h2 small,.h3 .small,.h3 small,h1 .small,h1 small,h2 .small,h2 small,h3 .small,h3 small{font-size:65%}.h4,.h5,.h6,h4,h5,h6{margin-top:10px;margin-bottom:10px}.h4 .small,.h4 small,.h5 .small,.h5 small,.h6 .small,.h6 small,h4 .small,h4 small,h5 .small,h5 small,h6 .small,h6 small{font-size:75%}.h1,h1{font-size:36px}.h2,h2{font-size:30px}.h3,h3{font-size:24px}.h4,h4{font-size:18px}.h5,h5{font-size:14px}.h6,h6{font-size:12px}p{margin:0 0 10px}.lead{margin-bottom:20px;font-size:16px;font-weight:300;line-height:1.4}@media (min-width:768px){.lead{font-size:21px}}.small,small{font-size:85%}.mark,mark{padding:.2em;background-color:#fcf8e3}.text-left{text-align:left}.text-right{text-align:right}.text-center{text-align:center}.text-justify{text-align:justify}.text-nowrap{white-space:nowrap}.text-lowercase{text-transform:lowercase}.text-uppercase{text-transform:uppercase}.text-capitalize{text-transform:capitalize}.text-muted{color:#777}.text-primary{color:#337ab7}a.text-primary:focus,a.text-primary:hover{color:#286090}.text-success{color:#3c763d}a.text-success:focus,a.text-success:hover{color:#2b542c}.text-info{color:#31708f}a.text-info:focus,a.text-info:hover{color:#245269}.text-warning{color:#8a6d3b}a.text-warning:focus,a.text-warning:hover{color:#66512c}.text-danger{color:#a94442}a.text-danger:focus,a.text-danger:hover{color:#843534}.bg-primary{color:#fff;background-color:#337ab7}a.bg-primary:focus,a.bg-primary:hover{background-color:#286090}.bg-success{background-color:#dff0d8}a.bg-success:focus,a.bg-success:hover{background-color:#c1e2b3}.bg-info{background-color:#d9edf7}a.bg-info:focus,a.bg-info:hover{background-color:#afd9ee}.bg-warning{background-color:#fcf8e3}a.bg-warning:focus,a.bg-warning:hover{background-color:#f7ecb5}.bg-danger{background-color:#f2dede}a.bg-danger:focus,a.bg-danger:hover{background-color:#e4b9b9}.page-header{padding-bottom:9px;margin:40px 0 20px;border-bottom:1px solid #eee}ol,ul{margin-top:0;margin-bottom:10px}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;margin-left:-5px;list-style:none}.list-inline>li{display:inline-block;padding-right:5px;padding-left:5px}dl{margin-top:0;margin-bottom:20px}dd,dt{line-height:1.42857143}dt{font-weight:700}dd{margin-left:0}@media (min-width:768px){.dl-horizontal dt{float:left;width:160px;overflow:hidden;clear:left;text-align:right;text-overflow:ellipsis;white-space:nowrap}.dl-horizontal dd{margin-left:180px}}abbr[data-original-title],abbr[title]{cursor:help;border-bottom:1px dotted #777}.initialism{font-size:90%;text-transform:uppercase}blockquote{padding:10px 20px;margin:0 0 20px;font-size:17.5px;border-left:5px solid #eee}blockquote ol:last-child,blockquote p:last-child,blockquote ul:last-child{margin-bottom:0}blockquote .small,blockquote footer,blockquote small{display:block;font-size:80%;line-height:1.42857143;color:#777}blockquote .small:before,blockquote footer:before,blockquote small:before{content:'\2014 \00A0'}.blockquote-reverse,blockquote.pull-right{padding-right:15px;padding-left:0;text-align:right;border-right:5px solid #eee;border-left:0}.blockquote-reverse .small:before,.blockquote-reverse footer:before,.blockquote-reverse small:before,blockquote.pull-right .small:before,blockquote.pull-right footer:before,blockquote.pull-right small:before{content:''}.blockquote-reverse .small:after,.blockquote-reverse footer:after,.blockquote-reverse small:after,blockquote.pull-right .small:after,blockquote.pull-right footer:after,blockquote.pull-right small:after{content:'\00A0 \2014'}address{margin-bottom:20px;font-style:normal;line-height:1.42857143}code,kbd,pre,samp{font-family:Menlo,Monaco,Consolas,"Courier New",monospace}code{padding:2px 4px;font-size:90%;color:#c7254e;background-color:#f9f2f4;border-radius:4px}kbd{padding:2px 4px;font-size:90%;color:#fff;background-color:#333;border-radius:3px;-webkit-box-shadow:inset 0 -1px 0 rgba(0,0,0,.25);box-shadow:inset 0 -1px 0 rgba(0,0,0,.25)}kbd kbd{padding:0;font-size:100%;font-weight:700;-webkit-box-shadow:none;box-shadow:none}pre{display:block;padding:9.5px;margin:0 0 10px;font-size:13px;line-height:1.42857143;color:#333;word-break:break-all;word-wrap:break-word;background-color:#f5f5f5;border:1px solid #ccc;border-radius:4px}pre code{padding:0;font-size:inherit;color:inherit;white-space:pre-wrap;background-color:transparent;border-radius:0}.pre-scrollable{max-height:340px;overflow-y:scroll}.container{padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}@media (min-width:768px){.container{width:750px}}@media (min-width:992px){.container{width:970px}}@media (min-width:1200px){.container{width:1170px}}.container-fluid{padding-right:15px;padding-left:15px;margin-right:auto;margin-left:auto}.row{margin-right:-15px;margin-left:-15px}.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9,.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9,.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9,.col-xs-1,.col-xs-10,.col-xs-11,.col-xs-12,.col-xs-2,.col-xs-3,.col-xs-4,.col-xs-5,.col-xs-6,.col-xs-7,.col-xs-8,.col-xs-9{position:relative;min-height:1px;padding-right:15px;padding-left:15px}.col-xs-1,.col-xs-10,.col-xs-11,.col-xs-12,.col-xs-2,.col-xs-3,.col-xs-4,.col-xs-5,.col-xs-6,.col-xs-7,.col-xs-8,.col-xs-9{float:left}.col-xs-12{width:100%}.col-xs-11{width:91.66666667%}.col-xs-10{width:83.33333333%}.col-xs-9{width:75%}.col-xs-8{width:66.66666667%}.col-xs-7{width:58.33333333%}.col-xs-6{width:50%}.col-xs-5{width:41.66666667%}.col-xs-4{width:33.33333333%}.col-xs-3{width:25%}.col-xs-2{width:16.66666667%}.col-xs-1{width:8.33333333%}.col-xs-pull-12{right:100%}.col-xs-pull-11{right:91.66666667%}.col-xs-pull-10{right:83.33333333%}.col-xs-pull-9{right:75%}.col-xs-pull-8{right:66.66666667%}.col-xs-pull-7{right:58.33333333%}.col-xs-pull-6{right:50%}.col-xs-pull-5{right:41.66666667%}.col-xs-pull-4{right:33.33333333%}.col-xs-pull-3{right:25%}.col-xs-pull-2{right:16.66666667%}.col-xs-pull-1{right:8.33333333%}.col-xs-pull-0{right:auto}.col-xs-push-12{left:100%}.col-xs-push-11{left:91.66666667%}.col-xs-push-10{left:83.33333333%}.col-xs-push-9{left:75%}.col-xs-push-8{left:66.66666667%}.col-xs-push-7{left:58.33333333%}.col-xs-push-6{left:50%}.col-xs-push-5{left:41.66666667%}.col-xs-push-4{left:33.33333333%}.col-xs-push-3{left:25%}.col-xs-push-2{left:16.66666667%}.col-xs-push-1{left:8.33333333%}.col-xs-push-0{left:auto}.col-xs-offset-12{margin-left:100%}.col-xs-offset-11{margin-left:91.66666667%}.col-xs-offset-10{margin-left:83.33333333%}.col-xs-offset-9{margin-left:75%}.col-xs-offset-8{margin-left:66.66666667%}.col-xs-offset-7{margin-left:58.33333333%}.col-xs-offset-6{margin-left:50%}.col-xs-offset-5{margin-left:41.66666667%}.col-xs-offset-4{margin-left:33.33333333%}.col-xs-offset-3{margin-left:25%}.col-xs-offset-2{margin-left:16.66666667%}.col-xs-offset-1{margin-left:8.33333333%}.col-xs-offset-0{margin-left:0}@media (min-width:768px){.col-sm-1,.col-sm-10,.col-sm-11,.col-sm-12,.col-sm-2,.col-sm-3,.col-sm-4,.col-sm-5,.col-sm-6,.col-sm-7,.col-sm-8,.col-sm-9{float:left}.col-sm-12{width:100%}.col-sm-11{width:91.66666667%}.col-sm-10{width:83.33333333%}.col-sm-9{width:75%}.col-sm-8{width:66.66666667%}.col-sm-7{width:58.33333333%}.col-sm-6{width:50%}.col-sm-5{width:41.66666667%}.col-sm-4{width:33.33333333%}.col-sm-3{width:25%}.col-sm-2{width:16.66666667%}.col-sm-1{width:8.33333333%}.col-sm-pull-12{right:100%}.col-sm-pull-11{right:91.66666667%}.col-sm-pull-10{right:83.33333333%}.col-sm-pull-9{right:75%}.col-sm-pull-8{right:66.66666667%}.col-sm-pull-7{right:58.33333333%}.col-sm-pull-6{right:50%}.col-sm-pull-5{right:41.66666667%}.col-sm-pull-4{right:33.33333333%}.col-sm-pull-3{right:25%}.col-sm-pull-2{right:16.66666667%}.col-sm-pull-1{right:8.33333333%}.col-sm-pull-0{right:auto}.col-sm-push-12{left:100%}.col-sm-push-11{left:91.66666667%}.col-sm-push-10{left:83.33333333%}.col-sm-push-9{left:75%}.col-sm-push-8{left:66.66666667%}.col-sm-push-7{left:58.33333333%}.col-sm-push-6{left:50%}.col-sm-push-5{left:41.66666667%}.col-sm-push-4{left:33.33333333%}.col-sm-push-3{left:25%}.col-sm-push-2{left:16.66666667%}.col-sm-push-1{left:8.33333333%}.col-sm-push-0{left:auto}.col-sm-offset-12{margin-left:100%}.col-sm-offset-11{margin-left:91.66666667%}.col-sm-offset-10{margin-left:83.33333333%}.col-sm-offset-9{margin-left:75%}.col-sm-offset-8{margin-left:66.66666667%}.col-sm-offset-7{margin-left:58.33333333%}.col-sm-offset-6{margin-left:50%}.col-sm-offset-5{margin-left:41.66666667%}.col-sm-offset-4{margin-left:33.33333333%}.col-sm-offset-3{margin-left:25%}.col-sm-offset-2{margin-left:16.66666667%}.col-sm-offset-1{margin-left:8.33333333%}.col-sm-offset-0{margin-left:0}}@media (min-width:992px){.col-md-1,.col-md-10,.col-md-11,.col-md-12,.col-md-2,.col-md-3,.col-md-4,.col-md-5,.col-md-6,.col-md-7,.col-md-8,.col-md-9{float:left}.col-md-12{width:100%}.col-md-11{width:91.66666667%}.col-md-10{width:83.33333333%}.col-md-9{width:75%}.col-md-8{width:66.66666667%}.col-md-7{width:58.33333333%}.col-md-6{width:50%}.col-md-5{width:41.66666667%}.col-md-4{width:33.33333333%}.col-md-3{width:25%}.col-md-2{width:16.66666667%}.col-md-1{width:8.33333333%}.col-md-pull-12{right:100%}.col-md-pull-11{right:91.66666667%}.col-md-pull-10{right:83.33333333%}.col-md-pull-9{right:75%}.col-md-pull-8{right:66.66666667%}.col-md-pull-7{right:58.33333333%}.col-md-pull-6{right:50%}.col-md-pull-5{right:41.66666667%}.col-md-pull-4{right:33.33333333%}.col-md-pull-3{right:25%}.col-md-pull-2{right:16.66666667%}.col-md-pull-1{right:8.33333333%}.col-md-pull-0{right:auto}.col-md-push-12{left:100%}.col-md-push-11{left:91.66666667%}.col-md-push-10{left:83.33333333%}.col-md-push-9{left:75%}.col-md-push-8{left:66.66666667%}.col-md-push-7{left:58.33333333%}.col-md-push-6{left:50%}.col-md-push-5{left:41.66666667%}.col-md-push-4{left:33.33333333%}.col-md-push-3{left:25%}.col-md-push-2{left:16.66666667%}.col-md-push-1{left:8.33333333%}.col-md-push-0{left:auto}.col-md-offset-12{margin-left:100%}.col-md-offset-11{margin-left:91.66666667%}.col-md-offset-10{margin-left:83.33333333%}.col-md-offset-9{margin-left:75%}.col-md-offset-8{margin-left:66.66666667%}.col-md-offset-7{margin-left:58.33333333%}.col-md-offset-6{margin-left:50%}.col-md-offset-5{margin-left:41.66666667%}.col-md-offset-4{margin-left:33.33333333%}.col-md-offset-3{margin-left:25%}.col-md-offset-2{margin-left:16.66666667%}.col-md-offset-1{margin-left:8.33333333%}.col-md-offset-0{margin-left:0}}@media (min-width:1200px){.col-lg-1,.col-lg-10,.col-lg-11,.col-lg-12,.col-lg-2,.col-lg-3,.col-lg-4,.col-lg-5,.col-lg-6,.col-lg-7,.col-lg-8,.col-lg-9{float:left}.col-lg-12{width:100%}.col-lg-11{width:91.66666667%}.col-lg-10{width:83.33333333%}.col-lg-9{width:75%}.col-lg-8{width:66.66666667%}.col-lg-7{width:58.33333333%}.col-lg-6{width:50%}.col-lg-5{width:41.66666667%}.col-lg-4{width:33.33333333%}.col-lg-3{width:25%}.col-lg-2{width:16.66666667%}.col-lg-1{width:8.33333333%}.col-lg-pull-12{right:100%}.col-lg-pull-11{right:91.66666667%}.col-lg-pull-10{right:83.33333333%}.col-lg-pull-9{right:75%}.col-lg-pull-8{right:66.66666667%}.col-lg-pull-7{right:58.33333333%}.col-lg-pull-6{right:50%}.col-lg-pull-5{right:41.66666667%}.col-lg-pull-4{right:33.33333333%}.col-lg-pull-3{right:25%}.col-lg-pull-2{right:16.66666667%}.col-lg-pull-1{right:8.33333333%}.col-lg-pull-0{right:auto}.col-lg-push-12{left:100%}.col-lg-push-11{left:91.66666667%}.col-lg-push-10{left:83.33333333%}.col-lg-push-9{left:75%}.col-lg-push-8{left:66.66666667%}.col-lg-push-7{left:58.33333333%}.col-lg-push-6{left:50%}.col-lg-push-5{left:41.66666667%}.col-lg-push-4{left:33.33333333%}.col-lg-push-3{left:25%}.col-lg-push-2{left:16.66666667%}.col-lg-push-1{left:8.33333333%}.col-lg-push-0{left:auto}.col-lg-offset-12{margin-left:100%}.col-lg-offset-11{margin-left:91.66666667%}.col-lg-offset-10{margin-left:83.33333333%}.col-lg-offset-9{margin-left:75%}.col-lg-offset-8{margin-left:66.66666667%}.col-lg-offset-7{margin-left:58.33333333%}.col-lg-offset-6{margin-left:50%}.col-lg-offset-5{margin-left:41.66666667%}.col-lg-offset-4{margin-left:33.33333333%}.col-lg-offset-3{margin-left:25%}.col-lg-offset-2{margin-left:16.66666667%}.col-lg-offset-1{margin-left:8.33333333%}.col-lg-offset-0{margin-left:0}}table{background-color:transparent}caption{padding-top:8px;padding-bottom:8px;color:#777;text-align:left}th{text-align:left}.table{width:100%;max-width:100%;margin-bottom:20px}.table>tbody>tr>td,.table>tbody>tr>th,.table>tfoot>tr>td,.table>tfoot>tr>th,.table>thead>tr>td,.table>thead>tr>th{padding:8px;line-height:1.42857143;vertical-align:top;border-top:1px solid #ddd}.table>thead>tr>th{vertical-align:bottom;border-bottom:2px solid #ddd}.table>caption+thead>tr:first-child>td,.table>caption+thead>tr:first-child>th,.table>colgroup+thead>tr:first-child>td,.table>colgroup+thead>tr:first-child>th,.table>thead:first-child>tr:first-child>td,.table>thead:first-child>tr:first-child>th{border-top:0}.table>tbody+tbody{border-top:2px solid #ddd}.table .table{background-color:#fff}.table-condensed>tbody>tr>td,.table-condensed>tbody>tr>th,.table-condensed>tfoot>tr>td,.table-condensed>tfoot>tr>th,.table-condensed>thead>tr>td,.table-condensed>thead>tr>th{padding:5px}.table-bordered{border:1px solid #ddd}.table-bordered>tbody>tr>td,.table-bordered>tbody>tr>th,.table-bordered>tfoot>tr>td,.table-bordered>tfoot>tr>th,.table-bordered>thead>tr>td,.table-bordered>thead>tr>th{border:1px solid #ddd}.table-bordered>thead>tr>td,.table-bordered>thead>tr>th{border-bottom-width:2px}.table-striped>tbody>tr:nth-of-type(odd){background-color:#f9f9f9}.table-hover>tbody>tr:hover{background-color:#f5f5f5}table col[class*=col-]{position:static;display:table-column;float:none}table td[class*=col-],table th[class*=col-]{position:static;display:table-cell;float:none}.table>tbody>tr.active>td,.table>tbody>tr.active>th,.table>tbody>tr>td.active,.table>tbody>tr>th.active,.table>tfoot>tr.active>td,.table>tfoot>tr.active>th,.table>tfoot>tr>td.active,.table>tfoot>tr>th.active,.table>thead>tr.active>td,.table>thead>tr.active>th,.table>thead>tr>td.active,.table>thead>tr>th.active{background-color:#f5f5f5}.table-hover>tbody>tr.active:hover>td,.table-hover>tbody>tr.active:hover>th,.table-hover>tbody>tr:hover>.active,.table-hover>tbody>tr>td.active:hover,.table-hover>tbody>tr>th.active:hover{background-color:#e8e8e8}.table>tbody>tr.success>td,.table>tbody>tr.success>th,.table>tbody>tr>td.success,.table>tbody>tr>th.success,.table>tfoot>tr.success>td,.table>tfoot>tr.success>th,.table>tfoot>tr>td.success,.table>tfoot>tr>th.success,.table>thead>tr.success>td,.table>thead>tr.success>th,.table>thead>tr>td.success,.table>thead>tr>th.success{background-color:#dff0d8}.table-hover>tbody>tr.success:hover>td,.table-hover>tbody>tr.success:hover>th,.table-hover>tbody>tr:hover>.success,.table-hover>tbody>tr>td.success:hover,.table-hover>tbody>tr>th.success:hover{background-color:#d0e9c6}.table>tbody>tr.info>td,.table>tbody>tr.info>th,.table>tbody>tr>td.info,.table>tbody>tr>th.info,.table>tfoot>tr.info>td,.table>tfoot>tr.info>th,.table>tfoot>tr>td.info,.table>tfoot>tr>th.info,.table>thead>tr.info>td,.table>thead>tr.info>th,.table>thead>tr>td.info,.table>thead>tr>th.info{background-color:#d9edf7}.table-hover>tbody>tr.info:hover>td,.table-hover>tbody>tr.info:hover>th,.table-hover>tbody>tr:hover>.info,.table-hover>tbody>tr>td.info:hover,.table-hover>tbody>tr>th.info:hover{background-color:#c4e3f3}.table>tbody>tr.warning>td,.table>tbody>tr.warning>th,.table>tbody>tr>td.warning,.table>tbody>tr>th.warning,.table>tfoot>tr.warning>td,.table>tfoot>tr.warning>th,.table>tfoot>tr>td.warning,.table>tfoot>tr>th.warning,.table>thead>tr.warning>td,.table>thead>tr.warning>th,.table>thead>tr>td.warning,.table>thead>tr>th.warning{background-color:#fcf8e3}.table-hover>tbody>tr.warning:hover>td,.table-hover>tbody>tr.warning:hover>th,.table-hover>tbody>tr:hover>.warning,.table-hover>tbody>tr>td.warning:hover,.table-hover>tbody>tr>th.warning:hover{background-color:#faf2cc}.table>tbody>tr.danger>td,.table>tbody>tr.danger>th,.table>tbody>tr>td.danger,.table>tbody>tr>th.danger,.table>tfoot>tr.danger>td,.table>tfoot>tr.danger>th,.table>tfoot>tr>td.danger,.table>tfoot>tr>th.danger,.table>thead>tr.danger>td,.table>thead>tr.danger>th,.table>thead>tr>td.danger,.table>thead>tr>th.danger{background-color:#f2dede}.table-hover>tbody>tr.danger:hover>td,.table-hover>tbody>tr.danger:hover>th,.table-hover>tbody>tr:hover>.danger,.table-hover>tbody>tr>td.danger:hover,.table-hover>tbody>tr>th.danger:hover{background-color:#ebcccc}.table-responsive{min-height:.01%;overflow-x:auto}@media screen and (max-width:767px){.table-responsive{width:100%;margin-bottom:15px;overflow-y:hidden;-ms-overflow-style:-ms-autohiding-scrollbar;border:1px solid #ddd}.table-responsive>.table{margin-bottom:0}.table-responsive>.table>tbody>tr>td,.table-responsive>.table>tbody>tr>th,.table-responsive>.table>tfoot>tr>td,.table-responsive>.table>tfoot>tr>th,.table-responsive>.table>thead>tr>td,.table-responsive>.table>thead>tr>th{white-space:nowrap}.table-responsive>.table-bordered{border:0}.table-responsive>.table-bordered>tbody>tr>td:first-child,.table-responsive>.table-bordered>tbody>tr>th:first-child,.table-responsive>.table-bordered>tfoot>tr>td:first-child,.table-responsive>.table-bordered>tfoot>tr>th:first-child,.table-responsive>.table-bordered>thead>tr>td:first-child,.table-responsive>.table-bordered>thead>tr>th:first-child{border-left:0}.table-responsive>.table-bordered>tbody>tr>td:last-child,.table-responsive>.table-bordered>tbody>tr>th:last-child,.table-responsive>.table-bordered>tfoot>tr>td:last-child,.table-responsive>.table-bordered>tfoot>tr>th:last-child,.table-responsive>.table-bordered>thead>tr>td:last-child,.table-responsive>.table-bordered>thead>tr>th:last-child{border-right:0}.table-responsive>.table-bordered>tbody>tr:last-child>td,.table-responsive>.table-bordered>tbody>tr:last-child>th,.table-responsive>.table-bordered>tfoot>tr:last-child>td,.table-responsive>.table-bordered>tfoot>tr:last-child>th{border-bottom:0}}fieldset{min-width:0;padding:0;margin:0;border:0}legend{display:block;width:100%;padding:0;margin-bottom:20px;font-size:21px;line-height:inherit;color:#333;border:0;border-bottom:1px solid #e5e5e5}label{display:inline-block;max-width:100%;margin-bottom:5px;font-weight:700}input[type=search]{-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box}input[type=checkbox],input[type=radio]{margin:4px 0 0;margin-top:1px\9;line-height:normal}input[type=file]{display:block}input[type=range]{display:block;width:100%}select[multiple],select[size]{height:auto}input[type=file]:focus,input[type=checkbox]:focus,input[type=radio]:focus{outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}output{display:block;padding-top:7px;font-size:14px;line-height:1.42857143;color:#555}.form-control{display:block;width:100%;height:34px;padding:6px 12px;font-size:14px;line-height:1.42857143;color:#555;background-color:#fff;background-image:none;border:1px solid #ccc;border-radius:4px;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075);-webkit-transition:border-color ease-in-out .15s,-webkit-box-shadow ease-in-out .15s;-o-transition:border-color ease-in-out .15s,box-shadow ease-in-out .15s;transition:border-color ease-in-out .15s,box-shadow ease-in-out .15s}.form-control:focus{border-color:#66afe9;outline:0;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 8px rgba(102,175,233,.6);box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 8px rgba(102,175,233,.6)}.form-control::-moz-placeholder{color:#999;opacity:1}.form-control:-ms-input-placeholder{color:#999}.form-control::-webkit-input-placeholder{color:#999}.form-control::-ms-expand{background-color:transparent;border:0}.form-control[disabled],.form-control[readonly],fieldset[disabled] .form-control{background-color:#eee;opacity:1}.form-control[disabled],fieldset[disabled] .form-control{cursor:not-allowed}textarea.form-control{height:auto}input[type=search]{-webkit-appearance:none}@media screen and (-webkit-min-device-pixel-ratio:0){input[type=date].form-control,input[type=time].form-control,input[type=datetime-local].form-control,input[type=month].form-control{line-height:34px}.input-group-sm input[type=date],.input-group-sm input[type=time],.input-group-sm input[type=datetime-local],.input-group-sm input[type=month],input[type=date].input-sm,input[type=time].input-sm,input[type=datetime-local].input-sm,input[type=month].input-sm{line-height:30px}.input-group-lg input[type=date],.input-group-lg input[type=time],.input-group-lg input[type=datetime-local],.input-group-lg input[type=month],input[type=date].input-lg,input[type=time].input-lg,input[type=datetime-local].input-lg,input[type=month].input-lg{line-height:46px}}.form-group{margin-bottom:15px}.checkbox,.radio{position:relative;display:block;margin-top:10px;margin-bottom:10px}.checkbox label,.radio label{min-height:20px;padding-left:20px;margin-bottom:0;font-weight:400;cursor:pointer}.checkbox input[type=checkbox],.checkbox-inline input[type=checkbox],.radio input[type=radio],.radio-inline input[type=radio]{position:absolute;margin-top:4px\9;margin-left:-20px}.checkbox+.checkbox,.radio+.radio{margin-top:-5px}.checkbox-inline,.radio-inline{position:relative;display:inline-block;padding-left:20px;margin-bottom:0;font-weight:400;vertical-align:middle;cursor:pointer}.checkbox-inline+.checkbox-inline,.radio-inline+.radio-inline{margin-top:0;margin-left:10px}fieldset[disabled] input[type=checkbox],fieldset[disabled] input[type=radio],input[type=checkbox].disabled,input[type=checkbox][disabled],input[type=radio].disabled,input[type=radio][disabled]{cursor:not-allowed}.checkbox-inline.disabled,.radio-inline.disabled,fieldset[disabled] .checkbox-inline,fieldset[disabled] .radio-inline{cursor:not-allowed}.checkbox.disabled label,.radio.disabled label,fieldset[disabled] .checkbox label,fieldset[disabled] .radio label{cursor:not-allowed}.form-control-static{min-height:34px;padding-top:7px;padding-bottom:7px;margin-bottom:0}.form-control-static.input-lg,.form-control-static.input-sm{padding-right:0;padding-left:0}.input-sm{height:30px;padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}select.input-sm{height:30px;line-height:30px}select[multiple].input-sm,textarea.input-sm{height:auto}.form-group-sm .form-control{height:30px;padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}.form-group-sm select.form-control{height:30px;line-height:30px}.form-group-sm select[multiple].form-control,.form-group-sm textarea.form-control{height:auto}.form-group-sm .form-control-static{height:30px;min-height:32px;padding:6px 10px;font-size:12px;line-height:1.5}.input-lg{height:46px;padding:10px 16px;font-size:18px;line-height:1.3333333;border-radius:6px}select.input-lg{height:46px;line-height:46px}select[multiple].input-lg,textarea.input-lg{height:auto}.form-group-lg .form-control{height:46px;padding:10px 16px;font-size:18px;line-height:1.3333333;border-radius:6px}.form-group-lg select.form-control{height:46px;line-height:46px}.form-group-lg select[multiple].form-control,.form-group-lg textarea.form-control{height:auto}.form-group-lg .form-control-static{height:46px;min-height:38px;padding:11px 16px;font-size:18px;line-height:1.3333333}.has-feedback{position:relative}.has-feedback .form-control{padding-right:42.5px}.form-control-feedback{position:absolute;top:0;right:0;z-index:2;display:block;width:34px;height:34px;line-height:34px;text-align:center;pointer-events:none}.form-group-lg .form-control+.form-control-feedback,.input-group-lg+.form-control-feedback,.input-lg+.form-control-feedback{width:46px;height:46px;line-height:46px}.form-group-sm .form-control+.form-control-feedback,.input-group-sm+.form-control-feedback,.input-sm+.form-control-feedback{width:30px;height:30px;line-height:30px}.has-success .checkbox,.has-success .checkbox-inline,.has-success .control-label,.has-success .help-block,.has-success .radio,.has-success .radio-inline,.has-success.checkbox label,.has-success.checkbox-inline label,.has-success.radio label,.has-success.radio-inline label{color:#3c763d}.has-success .form-control{border-color:#3c763d;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075)}.has-success .form-control:focus{border-color:#2b542c;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #67b168;box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #67b168}.has-success .input-group-addon{color:#3c763d;background-color:#dff0d8;border-color:#3c763d}.has-success .form-control-feedback{color:#3c763d}.has-warning .checkbox,.has-warning .checkbox-inline,.has-warning .control-label,.has-warning .help-block,.has-warning .radio,.has-warning .radio-inline,.has-warning.checkbox label,.has-warning.checkbox-inline label,.has-warning.radio label,.has-warning.radio-inline label{color:#8a6d3b}.has-warning .form-control{border-color:#8a6d3b;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075)}.has-warning .form-control:focus{border-color:#66512c;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #c0a16b;box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #c0a16b}.has-warning .input-group-addon{color:#8a6d3b;background-color:#fcf8e3;border-color:#8a6d3b}.has-warning .form-control-feedback{color:#8a6d3b}.has-error .checkbox,.has-error .checkbox-inline,.has-error .control-label,.has-error .help-block,.has-error .radio,.has-error .radio-inline,.has-error.checkbox label,.has-error.checkbox-inline label,.has-error.radio label,.has-error.radio-inline label{color:#a94442}.has-error .form-control{border-color:#a94442;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075);box-shadow:inset 0 1px 1px rgba(0,0,0,.075)}.has-error .form-control:focus{border-color:#843534;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #ce8483;box-shadow:inset 0 1px 1px rgba(0,0,0,.075),0 0 6px #ce8483}.has-error .input-group-addon{color:#a94442;background-color:#f2dede;border-color:#a94442}.has-error .form-control-feedback{color:#a94442}.has-feedback label~.form-control-feedback{top:25px}.has-feedback label.sr-only~.form-control-feedback{top:0}.help-block{display:block;margin-top:5px;margin-bottom:10px;color:#737373}@media (min-width:768px){.form-inline .form-group{display:inline-block;margin-bottom:0;vertical-align:middle}.form-inline .form-control{display:inline-block;width:auto;vertical-align:middle}.form-inline .form-control-static{display:inline-block}.form-inline .input-group{display:inline-table;vertical-align:middle}.form-inline .input-group .form-control,.form-inline .input-group .input-group-addon,.form-inline .input-group .input-group-btn{width:auto}.form-inline .input-group>.form-control{width:100%}.form-inline .control-label{margin-bottom:0;vertical-align:middle}.form-inline .checkbox,.form-inline .radio{display:inline-block;margin-top:0;margin-bottom:0;vertical-align:middle}.form-inline .checkbox label,.form-inline .radio label{padding-left:0}.form-inline .checkbox input[type=checkbox],.form-inline .radio input[type=radio]{position:relative;margin-left:0}.form-inline .has-feedback .form-control-feedback{top:0}}.form-horizontal .checkbox,.form-horizontal .checkbox-inline,.form-horizontal .radio,.form-horizontal .radio-inline{padding-top:7px;margin-top:0;margin-bottom:0}.form-horizontal .checkbox,.form-horizontal .radio{min-height:27px}.form-horizontal .form-group{margin-right:-15px;margin-left:-15px}@media (min-width:768px){.form-horizontal .control-label{padding-top:7px;margin-bottom:0;text-align:right}}.form-horizontal .has-feedback .form-control-feedback{right:15px}@media (min-width:768px){.form-horizontal .form-group-lg .control-label{padding-top:11px;font-size:18px}}@media (min-width:768px){.form-horizontal .form-group-sm .control-label{padding-top:6px;font-size:12px}}.btn{display:inline-block;padding:6px 12px;margin-bottom:0;font-size:14px;font-weight:400;line-height:1.42857143;text-align:center;white-space:nowrap;vertical-align:middle;-ms-touch-action:manipulation;touch-action:manipulation;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;background-image:none;border:1px solid transparent;border-radius:4px}.btn.active.focus,.btn.active:focus,.btn.focus,.btn:active.focus,.btn:active:focus,.btn:focus{outline:5px auto -webkit-focus-ring-color;outline-offset:-2px}.btn.focus,.btn:focus,.btn:hover{color:#333;text-decoration:none}.btn.active,.btn:active{background-image:none;outline:0;-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125);box-shadow:inset 0 3px 5px rgba(0,0,0,.125)}.btn.disabled,.btn[disabled],fieldset[disabled] .btn{cursor:not-allowed;filter:alpha(opacity=65);-webkit-box-shadow:none;box-shadow:none;opacity:.65}a.btn.disabled,fieldset[disabled] a.btn{pointer-events:none}.btn-default{color:#333;background-color:#fff;border-color:#ccc}.btn-default.focus,.btn-default:focus{color:#333;background-color:#e6e6e6;border-color:#8c8c8c}.btn-default:hover{color:#333;background-color:#e6e6e6;border-color:#adadad}.btn-default.active,.btn-default:active,.open>.dropdown-toggle.btn-default{color:#333;background-color:#e6e6e6;border-color:#adadad}.btn-default.active.focus,.btn-default.active:focus,.btn-default.active:hover,.btn-default:active.focus,.btn-default:active:focus,.btn-default:active:hover,.open>.dropdown-toggle.btn-default.focus,.open>.dropdown-toggle.btn-default:focus,.open>.dropdown-toggle.btn-default:hover{color:#333;background-color:#d4d4d4;border-color:#8c8c8c}.btn-default.active,.btn-default:active,.open>.dropdown-toggle.btn-default{background-image:none}.btn-default.disabled.focus,.btn-default.disabled:focus,.btn-default.disabled:hover,.btn-default[disabled].focus,.btn-default[disabled]:focus,.btn-default[disabled]:hover,fieldset[disabled] .btn-default.focus,fieldset[disabled] .btn-default:focus,fieldset[disabled] .btn-default:hover{background-color:#fff;border-color:#ccc}.btn-default .badge{color:#fff;background-color:#333}.btn-primary{color:#fff;background-color:#337ab7;border-color:#2e6da4}.btn-primary.focus,.btn-primary:focus{color:#fff;background-color:#286090;border-color:#122b40}.btn-primary:hover{color:#fff;background-color:#286090;border-color:#204d74}.btn-primary.active,.btn-primary:active,.open>.dropdown-toggle.btn-primary{color:#fff;background-color:#286090;border-color:#204d74}.btn-primary.active.focus,.btn-primary.active:focus,.btn-primary.active:hover,.btn-primary:active.focus,.btn-primary:active:focus,.btn-primary:active:hover,.open>.dropdown-toggle.btn-primary.focus,.open>.dropdown-toggle.btn-primary:focus,.open>.dropdown-toggle.btn-primary:hover{color:#fff;background-color:#204d74;border-color:#122b40}.btn-primary.active,.btn-primary:active,.open>.dropdown-toggle.btn-primary{background-image:none}.btn-primary.disabled.focus,.btn-primary.disabled:focus,.btn-primary.disabled:hover,.btn-primary[disabled].focus,.btn-primary[disabled]:focus,.btn-primary[disabled]:hover,fieldset[disabled] .btn-primary.focus,fieldset[disabled] .btn-primary:focus,fieldset[disabled] .btn-primary:hover{background-color:#337ab7;border-color:#2e6da4}.btn-primary .badge{color:#337ab7;background-color:#fff}.btn-success{color:#fff;background-color:#5cb85c;border-color:#4cae4c}.btn-success.focus,.btn-success:focus{color:#fff;background-color:#449d44;border-color:#255625}.btn-success:hover{color:#fff;background-color:#449d44;border-color:#398439}.btn-success.active,.btn-success:active,.open>.dropdown-toggle.btn-success{color:#fff;background-color:#449d44;border-color:#398439}.btn-success.active.focus,.btn-success.active:focus,.btn-success.active:hover,.btn-success:active.focus,.btn-success:active:focus,.btn-success:active:hover,.open>.dropdown-toggle.btn-success.focus,.open>.dropdown-toggle.btn-success:focus,.open>.dropdown-toggle.btn-success:hover{color:#fff;background-color:#398439;border-color:#255625}.btn-success.active,.btn-success:active,.open>.dropdown-toggle.btn-success{background-image:none}.btn-success.disabled.focus,.btn-success.disabled:focus,.btn-success.disabled:hover,.btn-success[disabled].focus,.btn-success[disabled]:focus,.btn-success[disabled]:hover,fieldset[disabled] .btn-success.focus,fieldset[disabled] .btn-success:focus,fieldset[disabled] .btn-success:hover{background-color:#5cb85c;border-color:#4cae4c}.btn-success .badge{color:#5cb85c;background-color:#fff}.btn-info{color:#fff;background-color:#5bc0de;border-color:#46b8da}.btn-info.focus,.btn-info:focus{color:#fff;background-color:#31b0d5;border-color:#1b6d85}.btn-info:hover{color:#fff;background-color:#31b0d5;border-color:#269abc}.btn-info.active,.btn-info:active,.open>.dropdown-toggle.btn-info{color:#fff;background-color:#31b0d5;border-color:#269abc}.btn-info.active.focus,.btn-info.active:focus,.btn-info.active:hover,.btn-info:active.focus,.btn-info:active:focus,.btn-info:active:hover,.open>.dropdown-toggle.btn-info.focus,.open>.dropdown-toggle.btn-info:focus,.open>.dropdown-toggle.btn-info:hover{color:#fff;background-color:#269abc;border-color:#1b6d85}.btn-info.active,.btn-info:active,.open>.dropdown-toggle.btn-info{background-image:none}.btn-info.disabled.focus,.btn-info.disabled:focus,.btn-info.disabled:hover,.btn-info[disabled].focus,.btn-info[disabled]:focus,.btn-info[disabled]:hover,fieldset[disabled] .btn-info.focus,fieldset[disabled] .btn-info:focus,fieldset[disabled] .btn-info:hover{background-color:#5bc0de;border-color:#46b8da}.btn-info .badge{color:#5bc0de;background-color:#fff}.btn-warning{color:#fff;background-color:#f0ad4e;border-color:#eea236}.btn-warning.focus,.btn-warning:focus{color:#fff;background-color:#ec971f;border-color:#985f0d}.btn-warning:hover{color:#fff;background-color:#ec971f;border-color:#d58512}.btn-warning.active,.btn-warning:active,.open>.dropdown-toggle.btn-warning{color:#fff;background-color:#ec971f;border-color:#d58512}.btn-warning.active.focus,.btn-warning.active:focus,.btn-warning.active:hover,.btn-warning:active.focus,.btn-warning:active:focus,.btn-warning:active:hover,.open>.dropdown-toggle.btn-warning.focus,.open>.dropdown-toggle.btn-warning:focus,.open>.dropdown-toggle.btn-warning:hover{color:#fff;background-color:#d58512;border-color:#985f0d}.btn-warning.active,.btn-warning:active,.open>.dropdown-toggle.btn-warning{background-image:none}.btn-warning.disabled.focus,.btn-warning.disabled:focus,.btn-warning.disabled:hover,.btn-warning[disabled].focus,.btn-warning[disabled]:focus,.btn-warning[disabled]:hover,fieldset[disabled] .btn-warning.focus,fieldset[disabled] .btn-warning:focus,fieldset[disabled] .btn-warning:hover{background-color:#f0ad4e;border-color:#eea236}.btn-warning .badge{color:#f0ad4e;background-color:#fff}.btn-danger{color:#fff;background-color:#d9534f;border-color:#d43f3a}.btn-danger.focus,.btn-danger:focus{color:#fff;background-color:#c9302c;border-color:#761c19}.btn-danger:hover{color:#fff;background-color:#c9302c;border-color:#ac2925}.btn-danger.active,.btn-danger:active,.open>.dropdown-toggle.btn-danger{color:#fff;background-color:#c9302c;border-color:#ac2925}.btn-danger.active.focus,.btn-danger.active:focus,.btn-danger.active:hover,.btn-danger:active.focus,.btn-danger:active:focus,.btn-danger:active:hover,.open>.dropdown-toggle.btn-danger.focus,.open>.dropdown-toggle.btn-danger:focus,.open>.dropdown-toggle.btn-danger:hover{color:#fff;background-color:#ac2925;border-color:#761c19}.btn-danger.active,.btn-danger:active,.open>.dropdown-toggle.btn-danger{background-image:none}.btn-danger.disabled.focus,.btn-danger.disabled:focus,.btn-danger.disabled:hover,.btn-danger[disabled].focus,.btn-danger[disabled]:focus,.btn-danger[disabled]:hover,fieldset[disabled] .btn-danger.focus,fieldset[disabled] .btn-danger:focus,fieldset[disabled] .btn-danger:hover{background-color:#d9534f;border-color:#d43f3a}.btn-danger .badge{color:#d9534f;background-color:#fff}.btn-link{font-weight:400;color:#337ab7;border-radius:0}.btn-link,.btn-link.active,.btn-link:active,.btn-link[disabled],fieldset[disabled] .btn-link{background-color:transparent;-webkit-box-shadow:none;box-shadow:none}.btn-link,.btn-link:active,.btn-link:focus,.btn-link:hover{border-color:transparent}.btn-link:focus,.btn-link:hover{color:#23527c;text-decoration:underline;background-color:transparent}.btn-link[disabled]:focus,.btn-link[disabled]:hover,fieldset[disabled] .btn-link:focus,fieldset[disabled] .btn-link:hover{color:#777;text-decoration:none}.btn-group-lg>.btn,.btn-lg{padding:10px 16px;font-size:18px;line-height:1.3333333;border-radius:6px}.btn-group-sm>.btn,.btn-sm{padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}.btn-group-xs>.btn,.btn-xs{padding:1px 5px;font-size:12px;line-height:1.5;border-radius:3px}.btn-block{display:block;width:100%}.btn-block+.btn-block{margin-top:5px}input[type=button].btn-block,input[type=reset].btn-block,input[type=submit].btn-block{width:100%}.fade{opacity:0;-webkit-transition:opacity .15s linear;-o-transition:opacity .15s linear;transition:opacity .15s linear}.fade.in{opacity:1}.collapse{display:none}.collapse.in{display:block}tr.collapse.in{display:table-row}tbody.collapse.in{display:table-row-group}.collapsing{position:relative;height:0;overflow:hidden;-webkit-transition-timing-function:ease;-o-transition-timing-function:ease;transition-timing-function:ease;-webkit-transition-duration:.35s;-o-transition-duration:.35s;transition-duration:.35s;-webkit-transition-property:height,visibility;-o-transition-property:height,visibility;transition-property:height,visibility}.caret{display:inline-block;width:0;height:0;margin-left:2px;vertical-align:middle;border-top:4px dashed;border-top:4px solid\9;border-right:4px solid transparent;border-left:4px solid transparent}.dropdown,.dropup{position:relative}.dropdown-toggle:focus{outline:0}.dropdown-menu{position:absolute;top:100%;left:0;z-index:1000;display:none;float:left;min-width:160px;padding:5px 0;margin:2px 0 0;font-size:14px;text-align:left;list-style:none;background-color:#fff;-webkit-background-clip:padding-box;background-clip:padding-box;border:1px solid #ccc;border:1px solid rgba(0,0,0,.15);border-radius:4px;-webkit-box-shadow:0 6px 12px rgba(0,0,0,.175);box-shadow:0 6px 12px rgba(0,0,0,.175)}.dropdown-menu.pull-right{right:0;left:auto}.dropdown-menu .divider{height:1px;margin:9px 0;overflow:hidden;background-color:#e5e5e5}.dropdown-menu>li>a{display:block;padding:3px 20px;clear:both;font-weight:400;line-height:1.42857143;color:#333;white-space:nowrap}.dropdown-menu>li>a:focus,.dropdown-menu>li>a:hover{color:#262626;text-decoration:none;background-color:#f5f5f5}.dropdown-menu>.active>a,.dropdown-menu>.active>a:focus,.dropdown-menu>.active>a:hover{color:#fff;text-decoration:none;background-color:#337ab7;outline:0}.dropdown-menu>.disabled>a,.dropdown-menu>.disabled>a:focus,.dropdown-menu>.disabled>a:hover{color:#777}.dropdown-menu>.disabled>a:focus,.dropdown-menu>.disabled>a:hover{text-decoration:none;cursor:not-allowed;background-color:transparent;background-image:none;filter:progid:DXImageTransform.Microsoft.gradient(enabled=false)}.open>.dropdown-menu{display:block}.open>a{outline:0}.dropdown-menu-right{right:0;left:auto}.dropdown-menu-left{right:auto;left:0}.dropdown-header{display:block;padding:3px 20px;font-size:12px;line-height:1.42857143;color:#777;white-space:nowrap}.dropdown-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:990}.pull-right>.dropdown-menu{right:0;left:auto}.dropup .caret,.navbar-fixed-bottom .dropdown .caret{content:"";border-top:0;border-bottom:4px dashed;border-bottom:4px solid\9}.dropup .dropdown-menu,.navbar-fixed-bottom .dropdown .dropdown-menu{top:auto;bottom:100%;margin-bottom:2px}@media (min-width:768px){.navbar-right .dropdown-menu{right:0;left:auto}.navbar-right .dropdown-menu-left{right:auto;left:0}}.btn-group,.btn-group-vertical{position:relative;display:inline-block;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;float:left}.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:2}.btn-group .btn+.btn,.btn-group .btn+.btn-group,.btn-group .btn-group+.btn,.btn-group .btn-group+.btn-group{margin-left:-1px}.btn-toolbar{margin-left:-5px}.btn-toolbar .btn,.btn-toolbar .btn-group,.btn-toolbar .input-group{float:left}.btn-toolbar>.btn,.btn-toolbar>.btn-group,.btn-toolbar>.input-group{margin-left:5px}.btn-group>.btn:not(:first-child):not(:last-child):not(.dropdown-toggle){border-radius:0}.btn-group>.btn:first-child{margin-left:0}.btn-group>.btn:first-child:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn:last-child:not(:first-child),.btn-group>.dropdown-toggle:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.btn-group>.btn-group{float:left}.btn-group>.btn-group:not(:first-child):not(:last-child)>.btn{border-radius:0}.btn-group>.btn-group:first-child:not(:last-child)>.btn:last-child,.btn-group>.btn-group:first-child:not(:last-child)>.dropdown-toggle{border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:last-child:not(:first-child)>.btn:first-child{border-top-left-radius:0;border-bottom-left-radius:0}.btn-group .dropdown-toggle:active,.btn-group.open .dropdown-toggle{outline:0}.btn-group>.btn+.dropdown-toggle{padding-right:8px;padding-left:8px}.btn-group>.btn-lg+.dropdown-toggle{padding-right:12px;padding-left:12px}.btn-group.open .dropdown-toggle{-webkit-box-shadow:inset 0 3px 5px rgba(0,0,0,.125);box-shadow:inset 0 3px 5px rgba(0,0,0,.125)}.btn-group.open .dropdown-toggle.btn-link{-webkit-box-shadow:none;box-shadow:none}.btn .caret{margin-left:0}.btn-lg .caret{border-width:5px 5px 0;border-bottom-width:0}.dropup .btn-lg .caret{border-width:0 5px 5px}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group,.btn-group-vertical>.btn-group>.btn{display:block;float:none;width:100%;max-width:100%}.btn-group-vertical>.btn-group>.btn{float:none}.btn-group-vertical>.btn+.btn,.btn-group-vertical>.btn+.btn-group,.btn-group-vertical>.btn-group+.btn,.btn-group-vertical>.btn-group+.btn-group{margin-top:-1px;margin-left:0}.btn-group-vertical>.btn:not(:first-child):not(:last-child){border-radius:0}.btn-group-vertical>.btn:first-child:not(:last-child){border-top-left-radius:4px;border-top-right-radius:4px;border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn:last-child:not(:first-child){border-top-left-radius:0;border-top-right-radius:0;border-bottom-right-radius:4px;border-bottom-left-radius:4px}.btn-group-vertical>.btn-group:not(:first-child):not(:last-child)>.btn{border-radius:0}.btn-group-vertical>.btn-group:first-child:not(:last-child)>.btn:last-child,.btn-group-vertical>.btn-group:first-child:not(:last-child)>.dropdown-toggle{border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:last-child:not(:first-child)>.btn:first-child{border-top-left-radius:0;border-top-right-radius:0}.btn-group-justified{display:table;width:100%;table-layout:fixed;border-collapse:separate}.btn-group-justified>.btn,.btn-group-justified>.btn-group{display:table-cell;float:none;width:1%}.btn-group-justified>.btn-group .btn{width:100%}.btn-group-justified>.btn-group .dropdown-menu{left:auto}[data-toggle=buttons]>.btn input[type=checkbox],[data-toggle=buttons]>.btn input[type=radio],[data-toggle=buttons]>.btn-group>.btn input[type=checkbox],[data-toggle=buttons]>.btn-group>.btn input[type=radio]{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.input-group{position:relative;display:table;border-collapse:separate}.input-group[class*=col-]{float:none;padding-right:0;padding-left:0}.input-group .form-control{position:relative;z-index:2;float:left;width:100%;margin-bottom:0}.input-group .form-control:focus{z-index:3}.input-group-lg>.form-control,.input-group-lg>.input-group-addon,.input-group-lg>.input-group-btn>.btn{height:46px;padding:10px 16px;font-size:18px;line-height:1.3333333;border-radius:6px}select.input-group-lg>.form-control,select.input-group-lg>.input-group-addon,select.input-group-lg>.input-group-btn>.btn{height:46px;line-height:46px}select[multiple].input-group-lg>.form-control,select[multiple].input-group-lg>.input-group-addon,select[multiple].input-group-lg>.input-group-btn>.btn,textarea.input-group-lg>.form-control,textarea.input-group-lg>.input-group-addon,textarea.input-group-lg>.input-group-btn>.btn{height:auto}.input-group-sm>.form-control,.input-group-sm>.input-group-addon,.input-group-sm>.input-group-btn>.btn{height:30px;padding:5px 10px;font-size:12px;line-height:1.5;border-radius:3px}select.input-group-sm>.form-control,select.input-group-sm>.input-group-addon,select.input-group-sm>.input-group-btn>.btn{height:30px;line-height:30px}select[multiple].input-group-sm>.form-control,select[multiple].input-group-sm>.input-group-addon,select[multiple].input-group-sm>.input-group-btn>.btn,textarea.input-group-sm>.form-control,textarea.input-group-sm>.input-group-addon,textarea.input-group-sm>.input-group-btn>.btn{height:auto}.input-group .form-control,.input-group-addon,.input-group-btn{display:table-cell}.input-group .form-control:not(:first-child):not(:last-child),.input-group-addon:not(:first-child):not(:last-child),.input-group-btn:not(:first-child):not(:last-child){border-radius:0}.input-group-addon,.input-group-btn{width:1%;white-space:nowrap;vertical-align:middle}.input-group-addon{padding:6px 12px;font-size:14px;font-weight:400;line-height:1;color:#555;text-align:center;background-color:#eee;border:1px solid #ccc;border-radius:4px}.input-group-addon.input-sm{padding:5px 10px;font-size:12px;border-radius:3px}.input-group-addon.input-lg{padding:10px 16px;font-size:18px;border-radius:6px}.input-group-addon input[type=checkbox],.input-group-addon input[type=radio]{margin-top:0}.input-group .form-control:first-child,.input-group-addon:first-child,.input-group-btn:first-child>.btn,.input-group-btn:first-child>.btn-group>.btn,.input-group-btn:first-child>.dropdown-toggle,.input-group-btn:last-child>.btn-group:not(:last-child)>.btn,.input-group-btn:last-child>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.input-group-addon:first-child{border-right:0}.input-group .form-control:last-child,.input-group-addon:last-child,.input-group-btn:first-child>.btn-group:not(:first-child)>.btn,.input-group-btn:first-child>.btn:not(:first-child),.input-group-btn:last-child>.btn,.input-group-btn:last-child>.btn-group>.btn,.input-group-btn:last-child>.dropdown-toggle{border-top-left-radius:0;border-bottom-left-radius:0}.input-group-addon:last-child{border-left:0}.input-group-btn{position:relative;font-size:0;white-space:nowrap}.input-group-btn>.btn{position:relative}.input-group-btn>.btn+.btn{margin-left:-1px}.input-group-btn>.btn:active,.input-group-btn>.btn:focus,.input-group-btn>.btn:hover{z-index:2}.input-group-btn:first-child>.btn,.input-group-btn:first-child>.btn-group{margin-right:-1px}.input-group-btn:last-child>.btn,.input-group-btn:last-child>.btn-group{z-index:2;margin-left:-1px}.nav{padding-left:0;margin-bottom:0;list-style:none}.nav>li{position:relative;display:block}.nav>li>a{position:relative;display:block;padding:10px 15px}.nav>li>a:focus,.nav>li>a:hover{text-decoration:none;background-color:#eee}.nav>li.disabled>a{color:#777}.nav>li.disabled>a:focus,.nav>li.disabled>a:hover{color:#777;text-decoration:none;cursor:not-allowed;background-color:transparent}.nav .open>a,.nav .open>a:focus,.nav .open>a:hover{background-color:#eee;border-color:#337ab7}.nav .nav-divider{height:1px;margin:9px 0;overflow:hidden;background-color:#e5e5e5}.nav>li>a>img{max-width:none}.nav-tabs{border-bottom:1px solid #ddd}.nav-tabs>li{float:left;margin-bottom:-1px}.nav-tabs>li>a{margin-right:2px;line-height:1.42857143;border:1px solid transparent;border-radius:4px 4px 0 0}.nav-tabs>li>a:hover{border-color:#eee #eee #ddd}.nav-tabs>li.active>a,.nav-tabs>li.active>a:focus,.nav-tabs>li.active>a:hover{color:#555;cursor:default;background-color:#fff;border:1px solid #ddd;border-bottom-color:transparent}.nav-tabs.nav-justified{width:100%;border-bottom:0}.nav-tabs.nav-justified>li{float:none}.nav-tabs.nav-justified>li>a{margin-bottom:5px;text-align:center}.nav-tabs.nav-justified>.dropdown .dropdown-menu{top:auto;left:auto}@media (min-width:768px){.nav-tabs.nav-justified>li{display:table-cell;width:1%}.nav-tabs.nav-justified>li>a{margin-bottom:0}}.nav-tabs.nav-justified>li>a{margin-right:0;border-radius:4px}.nav-tabs.nav-justified>.active>a,.nav-tabs.nav-justified>.active>a:focus,.nav-tabs.nav-justified>.active>a:hover{border:1px solid #ddd}@media (min-width:768px){.nav-tabs.nav-justified>li>a{border-bottom:1px solid #ddd;border-radius:4px 4px 0 0}.nav-tabs.nav-justified>.active>a,.nav-tabs.nav-justified>.active>a:focus,.nav-tabs.nav-justified>.active>a:hover{border-bottom-color:#fff}}.nav-pills>li{float:left}.nav-pills>li>a{border-radius:4px}.nav-pills>li+li{margin-left:2px}.nav-pills>li.active>a,.nav-pills>li.active>a:focus,.nav-pills>li.active>a:hover{color:#fff;background-color:#337ab7}.nav-stacked>li{float:none}.nav-stacked>li+li{margin-top:2px;margin-left:0}.nav-justified{width:100%}.nav-justified>li{float:none}.nav-justified>li>a{margin-bottom:5px;text-align:center}.nav-justified>.dropdown .dropdown-menu{top:auto;left:auto}@media (min-width:768px){.nav-justified>li{display:table-cell;width:1%}.nav-justified>li>a{margin-bottom:0}}.nav-tabs-justified{border-bottom:0}.nav-tabs-justified>li>a{margin-right:0;border-radius:4px}.nav-tabs-justified>.active>a,.nav-tabs-justified>.active>a:focus,.nav-tabs-justified>.active>a:hover{border:1px solid #ddd}@media (min-width:768px){.nav-tabs-justified>li>a{border-bottom:1px solid #ddd;border-radius:4px 4px 0 0}.nav-tabs-justified>.active>a,.nav-tabs-justified>.active>a:focus,.nav-tabs-justified>.active>a:hover{border-bottom-color:#fff}}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.nav-tabs .dropdown-menu{margin-top:-1px;border-top-left-radius:0;border-top-right-radius:0}.navbar{position:relative;min-height:50px;margin-bottom:20px;border:1px solid transparent}@media (min-width:768px){.navbar{border-radius:4px}}@media (min-width:768px){.navbar-header{float:left}}.navbar-collapse{padding-right:15px;padding-left:15px;overflow-x:visible;-webkit-overflow-scrolling:touch;border-top:1px solid transparent;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.1);box-shadow:inset 0 1px 0 rgba(255,255,255,.1)}.navbar-collapse.in{overflow-y:auto}@media (min-width:768px){.navbar-collapse{width:auto;border-top:0;-webkit-box-shadow:none;box-shadow:none}.navbar-collapse.collapse{display:block!important;height:auto!important;padding-bottom:0;overflow:visible!important}.navbar-collapse.in{overflow-y:visible}.navbar-fixed-bottom .navbar-collapse,.navbar-fixed-top .navbar-collapse,.navbar-static-top .navbar-collapse{padding-right:0;padding-left:0}}.navbar-fixed-bottom .navbar-collapse,.navbar-fixed-top .navbar-collapse{max-height:340px}@media (max-device-width:480px) and (orientation:landscape){.navbar-fixed-bottom .navbar-collapse,.navbar-fixed-top .navbar-collapse{max-height:200px}}.container-fluid>.navbar-collapse,.container-fluid>.navbar-header,.container>.navbar-collapse,.container>.navbar-header{margin-right:-15px;margin-left:-15px}@media (min-width:768px){.container-fluid>.navbar-collapse,.container-fluid>.navbar-header,.container>.navbar-collapse,.container>.navbar-header{margin-right:0;margin-left:0}}.navbar-static-top{z-index:1000;border-width:0 0 1px}@media (min-width:768px){.navbar-static-top{border-radius:0}}.navbar-fixed-bottom,.navbar-fixed-top{position:fixed;right:0;left:0;z-index:1030}@media (min-width:768px){.navbar-fixed-bottom,.navbar-fixed-top{border-radius:0}}.navbar-fixed-top{top:0;border-width:0 0 1px}.navbar-fixed-bottom{bottom:0;margin-bottom:0;border-width:1px 0 0}.navbar-brand{float:left;height:50px;padding:15px 15px;font-size:18px;line-height:20px}.navbar-brand:focus,.navbar-brand:hover{text-decoration:none}.navbar-brand>img{display:block}@media (min-width:768px){.navbar>.container .navbar-brand,.navbar>.container-fluid .navbar-brand{margin-left:-15px}}.navbar-toggle{position:relative;float:right;padding:9px 10px;margin-top:8px;margin-right:15px;margin-bottom:8px;background-color:transparent;background-image:none;border:1px solid transparent;border-radius:4px}.navbar-toggle:focus{outline:0}.navbar-toggle .icon-bar{display:block;width:22px;height:2px;border-radius:1px}.navbar-toggle .icon-bar+.icon-bar{margin-top:4px}@media (min-width:768px){.navbar-toggle{display:none}}.navbar-nav{margin:7.5px -15px}.navbar-nav>li>a{padding-top:10px;padding-bottom:10px;line-height:20px}@media (max-width:767px){.navbar-nav .open .dropdown-menu{position:static;float:none;width:auto;margin-top:0;background-color:transparent;border:0;-webkit-box-shadow:none;box-shadow:none}.navbar-nav .open .dropdown-menu .dropdown-header,.navbar-nav .open .dropdown-menu>li>a{padding:5px 15px 5px 25px}.navbar-nav .open .dropdown-menu>li>a{line-height:20px}.navbar-nav .open .dropdown-menu>li>a:focus,.navbar-nav .open .dropdown-menu>li>a:hover{background-image:none}}@media (min-width:768px){.navbar-nav{float:left;margin:0}.navbar-nav>li{float:left}.navbar-nav>li>a{padding-top:15px;padding-bottom:15px}}.navbar-form{padding:10px 15px;margin-top:8px;margin-right:-15px;margin-bottom:8px;margin-left:-15px;border-top:1px solid transparent;border-bottom:1px solid transparent;-webkit-box-shadow:inset 0 1px 0 rgba(255,255,255,.1),0 1px 0 rgba(255,255,255,.1);box-shadow:inset 0 1px 0 rgba(255,255,255,.1),0 1px 0 rgba(255,255,255,.1)}@media (min-width:768px){.navbar-form .form-group{display:inline-block;margin-bottom:0;vertical-align:middle}.navbar-form .form-control{display:inline-block;width:auto;vertical-align:middle}.navbar-form .form-control-static{display:inline-block}.navbar-form .input-group{display:inline-table;vertical-align:middle}.navbar-form .input-group .form-control,.navbar-form .input-group .input-group-addon,.navbar-form .input-group .input-group-btn{width:auto}.navbar-form .input-group>.form-control{width:100%}.navbar-form .control-label{margin-bottom:0;vertical-align:middle}.navbar-form .checkbox,.navbar-form .radio{display:inline-block;margin-top:0;margin-bottom:0;vertical-align:middle}.navbar-form .checkbox label,.navbar-form .radio label{padding-left:0}.navbar-form .checkbox input[type=checkbox],.navbar-form .radio input[type=radio]{position:relative;margin-left:0}.navbar-form .has-feedback .form-control-feedback{top:0}}@media (max-width:767px){.navbar-form .form-group{margin-bottom:5px}.navbar-form .form-group:last-child{margin-bottom:0}}@media (min-width:768px){.navbar-form{width:auto;padding-top:0;padding-bottom:0;margin-right:0;margin-left:0;border:0;-webkit-box-shadow:none;box-shadow:none}}.navbar-nav>li>.dropdown-menu{margin-top:0;border-top-left-radius:0;border-top-right-radius:0}.navbar-fixed-bottom .navbar-nav>li>.dropdown-menu{margin-bottom:0;border-top-left-radius:4px;border-top-right-radius:4px;border-bottom-right-radius:0;border-bottom-left-radius:0}.navbar-btn{margin-top:8px;margin-bottom:8px}.navbar-btn.btn-sm{margin-top:10px;margin-bottom:10px}.navbar-btn.btn-xs{margin-top:14px;margin-bottom:14px}.navbar-text{margin-top:15px;margin-bottom:15px}@media (min-width:768px){.navbar-text{float:left;margin-right:15px;margin-left:15px}}@media (min-width:768px){.navbar-left{float:left!important}.navbar-right{float:right!important;margin-right:-15px}.navbar-right~.navbar-right{margin-right:0}}.navbar-default{background-color:#f8f8f8;border-color:#e7e7e7}.navbar-default .navbar-brand{color:#777}.navbar-default .navbar-brand:focus,.navbar-default .navbar-brand:hover{color:#5e5e5e;background-color:transparent}.navbar-default .navbar-text{color:#777}.navbar-default .navbar-nav>li>a{color:#777}.navbar-default .navbar-nav>li>a:focus,.navbar-default .navbar-nav>li>a:hover{color:#333;background-color:transparent}.navbar-default .navbar-nav>.active>a,.navbar-default .navbar-nav>.active>a:focus,.navbar-default .navbar-nav>.active>a:hover{color:#555;background-color:#e7e7e7}.navbar-default .navbar-nav>.disabled>a,.navbar-default .navbar-nav>.disabled>a:focus,.navbar-default .navbar-nav>.disabled>a:hover{color:#ccc;background-color:transparent}.navbar-default .navbar-toggle{border-color:#ddd}.navbar-default .navbar-toggle:focus,.navbar-default .navbar-toggle:hover{background-color:#ddd}.navbar-default .navbar-toggle .icon-bar{background-color:#888}.navbar-default .navbar-collapse,.navbar-default .navbar-form{border-color:#e7e7e7}.navbar-default .navbar-nav>.open>a,.navbar-default .navbar-nav>.open>a:focus,.navbar-default .navbar-nav>.open>a:hover{color:#555;background-color:#e7e7e7}@media (max-width:767px){.navbar-default .navbar-nav .open .dropdown-menu>li>a{color:#777}.navbar-default .navbar-nav .open .dropdown-menu>li>a:focus,.navbar-default .navbar-nav .open .dropdown-menu>li>a:hover{color:#333;background-color:transparent}.navbar-default .navbar-nav .open .dropdown-menu>.active>a,.navbar-default .navbar-nav .open .dropdown-menu>.active>a:focus,.navbar-default .navbar-nav .open .dropdown-menu>.active>a:hover{color:#555;background-color:#e7e7e7}.navbar-default .navbar-nav .open .dropdown-menu>.disabled>a,.navbar-default .navbar-nav .open .dropdown-menu>.disabled>a:focus,.navbar-default .navbar-nav .open .dropdown-menu>.disabled>a:hover{color:#ccc;background-color:transparent}}.navbar-default .navbar-link{color:#777}.navbar-default .navbar-link:hover{color:#333}.navbar-default .btn-link{color:#777}.navbar-default .btn-link:focus,.navbar-default .btn-link:hover{color:#333}.navbar-default .btn-link[disabled]:focus,.navbar-default .btn-link[disabled]:hover,fieldset[disabled] .navbar-default .btn-link:focus,fieldset[disabled] .navbar-default .btn-link:hover{color:#ccc}.navbar-inverse{background-color:#222;border-color:#080808}.navbar-inverse .navbar-brand{color:#9d9d9d}.navbar-inverse .navbar-brand:focus,.navbar-inverse .navbar-brand:hover{color:#fff;background-color:transparent}.navbar-inverse .navbar-text{color:#9d9d9d}.navbar-inverse .navbar-nav>li>a{color:#9d9d9d}.navbar-inverse .navbar-nav>li>a:focus,.navbar-inverse .navbar-nav>li>a:hover{color:#fff;background-color:transparent}.navbar-inverse .navbar-nav>.active>a,.navbar-inverse .navbar-nav>.active>a:focus,.navbar-inverse .navbar-nav>.active>a:hover{color:#fff;background-color:#080808}.navbar-inverse .navbar-nav>.disabled>a,.navbar-inverse .navbar-nav>.disabled>a:focus,.navbar-inverse .navbar-nav>.disabled>a:hover{color:#444;background-color:transparent}.navbar-inverse .navbar-toggle{border-color:#333}.navbar-inverse .navbar-toggle:focus,.navbar-inverse .navbar-toggle:hover{background-color:#333}.navbar-inverse .navbar-toggle .icon-bar{background-color:#fff}.navbar-inverse .navbar-collapse,.navbar-inverse .navbar-form{border-color:#101010}.navbar-inverse .navbar-nav>.open>a,.navbar-inverse .navbar-nav>.open>a:focus,.navbar-inverse .navbar-nav>.open>a:hover{color:#fff;background-color:#080808}@media (max-width:767px){.navbar-inverse .navbar-nav .open .dropdown-menu>.dropdown-header{border-color:#080808}.navbar-inverse .navbar-nav .open .dropdown-menu .divider{background-color:#080808}.navbar-inverse .navbar-nav .open .dropdown-menu>li>a{color:#9d9d9d}.navbar-inverse .navbar-nav .open .dropdown-menu>li>a:focus,.navbar-inverse .navbar-nav .open .dropdown-menu>li>a:hover{color:#fff;background-color:transparent}.navbar-inverse .navbar-nav .open .dropdown-menu>.active>a,.navbar-inverse .navbar-nav .open .dropdown-menu>.active>a:focus,.navbar-inverse .navbar-nav .open .dropdown-menu>.active>a:hover{color:#fff;background-color:#080808}.navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a,.navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a:focus,.navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a:hover{color:#444;background-color:transparent}}.navbar-inverse .navbar-link{color:#9d9d9d}.navbar-inverse .navbar-link:hover{color:#fff}.navbar-inverse .btn-link{color:#9d9d9d}.navbar-inverse .btn-link:focus,.navbar-inverse .btn-link:hover{color:#fff}.navbar-inverse .btn-link[disabled]:focus,.navbar-inverse .btn-link[disabled]:hover,fieldset[disabled] .navbar-inverse .btn-link:focus,fieldset[disabled] .navbar-inverse .btn-link:hover{color:#444}.breadcrumb{padding:8px 15px;margin-bottom:20px;list-style:none;background-color:#f5f5f5;border-radius:4px}.breadcrumb>li{display:inline-block}.breadcrumb>li+li:before{padding:0 5px;color:#ccc;content:"/\00a0"}.breadcrumb>.active{color:#777}.pagination{display:inline-block;padding-left:0;margin:20px 0;border-radius:4px}.pagination>li{display:inline}.pagination>li>a,.pagination>li>span{position:relative;float:left;padding:6px 12px;margin-left:-1px;line-height:1.42857143;color:#337ab7;text-decoration:none;background-color:#fff;border:1px solid #ddd}.pagination>li:first-child>a,.pagination>li:first-child>span{margin-left:0;border-top-left-radius:4px;border-bottom-left-radius:4px}.pagination>li:last-child>a,.pagination>li:last-child>span{border-top-right-radius:4px;border-bottom-right-radius:4px}.pagination>li>a:focus,.pagination>li>a:hover,.pagination>li>span:focus,.pagination>li>span:hover{z-index:2;color:#23527c;background-color:#eee;border-color:#ddd}.pagination>.active>a,.pagination>.active>a:focus,.pagination>.active>a:hover,.pagination>.active>span,.pagination>.active>span:focus,.pagination>.active>span:hover{z-index:3;color:#fff;cursor:default;background-color:#337ab7;border-color:#337ab7}.pagination>.disabled>a,.pagination>.disabled>a:focus,.pagination>.disabled>a:hover,.pagination>.disabled>span,.pagination>.disabled>span:focus,.pagination>.disabled>span:hover{color:#777;cursor:not-allowed;background-color:#fff;border-color:#ddd}.pagination-lg>li>a,.pagination-lg>li>span{padding:10px 16px;font-size:18px;line-height:1.3333333}.pagination-lg>li:first-child>a,.pagination-lg>li:first-child>span{border-top-left-radius:6px;border-bottom-left-radius:6px}.pagination-lg>li:last-child>a,.pagination-lg>li:last-child>span{border-top-right-radius:6px;border-bottom-right-radius:6px}.pagination-sm>li>a,.pagination-sm>li>span{padding:5px 10px;font-size:12px;line-height:1.5}.pagination-sm>li:first-child>a,.pagination-sm>li:first-child>span{border-top-left-radius:3px;border-bottom-left-radius:3px}.pagination-sm>li:last-child>a,.pagination-sm>li:last-child>span{border-top-right-radius:3px;border-bottom-right-radius:3px}.pager{padding-left:0;margin:20px 0;text-align:center;list-style:none}.pager li{display:inline}.pager li>a,.pager li>span{display:inline-block;padding:5px 14px;background-color:#fff;border:1px solid #ddd;border-radius:15px}.pager li>a:focus,.pager li>a:hover{text-decoration:none;background-color:#eee}.pager .next>a,.pager .next>span{float:right}.pager .previous>a,.pager .previous>span{float:left}.pager .disabled>a,.pager .disabled>a:focus,.pager .disabled>a:hover,.pager .disabled>span{color:#777;cursor:not-allowed;background-color:#fff}.label{display:inline;padding:.2em .6em .3em;font-size:75%;font-weight:700;line-height:1;color:#fff;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25em}a.label:focus,a.label:hover{color:#fff;text-decoration:none;cursor:pointer}.label:empty{display:none}.btn .label{position:relative;top:-1px}.label-default{background-color:#777}.label-default[href]:focus,.label-default[href]:hover{background-color:#5e5e5e}.label-primary{background-color:#337ab7}.label-primary[href]:focus,.label-primary[href]:hover{background-color:#286090}.label-success{background-color:#5cb85c}.label-success[href]:focus,.label-success[href]:hover{background-color:#449d44}.label-info{background-color:#5bc0de}.label-info[href]:focus,.label-info[href]:hover{background-color:#31b0d5}.label-warning{background-color:#f0ad4e}.label-warning[href]:focus,.label-warning[href]:hover{background-color:#ec971f}.label-danger{background-color:#d9534f}.label-danger[href]:focus,.label-danger[href]:hover{background-color:#c9302c}.badge{display:inline-block;min-width:10px;padding:3px 7px;font-size:12px;font-weight:700;line-height:1;color:#fff;text-align:center;white-space:nowrap;vertical-align:middle;background-color:#777;border-radius:10px}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.btn-group-xs>.btn .badge,.btn-xs .badge{top:0;padding:1px 5px}a.badge:focus,a.badge:hover{color:#fff;text-decoration:none;cursor:pointer}.list-group-item.active>.badge,.nav-pills>.active>a>.badge{color:#337ab7;background-color:#fff}.list-group-item>.badge{float:right}.list-group-item>.badge+.badge{margin-right:5px}.nav-pills>li>a>.badge{margin-left:3px}.jumbotron{padding-top:30px;padding-bottom:30px;margin-bottom:30px;color:inherit;background-color:#eee}.jumbotron .h1,.jumbotron h1{color:inherit}.jumbotron p{margin-bottom:15px;font-size:21px;font-weight:200}.jumbotron>hr{border-top-color:#d5d5d5}.container .jumbotron,.container-fluid .jumbotron{padding-right:15px;padding-left:15px;border-radius:6px}.jumbotron .container{max-width:100%}@media screen and (min-width:768px){.jumbotron{padding-top:48px;padding-bottom:48px}.container .jumbotron,.container-fluid .jumbotron{padding-right:60px;padding-left:60px}.jumbotron .h1,.jumbotron h1{font-size:63px}}.thumbnail{display:block;padding:4px;margin-bottom:20px;line-height:1.42857143;background-color:#fff;border:1px solid #ddd;border-radius:4px;-webkit-transition:border .2s ease-in-out;-o-transition:border .2s ease-in-out;transition:border .2s ease-in-out}.thumbnail a>img,.thumbnail>img{margin-right:auto;margin-left:auto}a.thumbnail.active,a.thumbnail:focus,a.thumbnail:hover{border-color:#337ab7}.thumbnail .caption{padding:9px;color:#333}.alert{padding:15px;margin-bottom:20px;border:1px solid transparent;border-radius:4px}.alert h4{margin-top:0;color:inherit}.alert .alert-link{font-weight:700}.alert>p,.alert>ul{margin-bottom:0}.alert>p+p{margin-top:5px}.alert-dismissable,.alert-dismissible{padding-right:35px}.alert-dismissable .close,.alert-dismissible .close{position:relative;top:-2px;right:-21px;color:inherit}.alert-success{color:#3c763d;background-color:#dff0d8;border-color:#d6e9c6}.alert-success hr{border-top-color:#c9e2b3}.alert-success .alert-link{color:#2b542c}.alert-info{color:#31708f;background-color:#d9edf7;border-color:#bce8f1}.alert-info hr{border-top-color:#a6e1ec}.alert-info .alert-link{color:#245269}.alert-warning{color:#8a6d3b;background-color:#fcf8e3;border-color:#faebcc}.alert-warning hr{border-top-color:#f7e1b5}.alert-warning .alert-link{color:#66512c}.alert-danger{color:#a94442;background-color:#f2dede;border-color:#ebccd1}.alert-danger hr{border-top-color:#e4b9c0}.alert-danger .alert-link{color:#843534}@-webkit-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@-o-keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}@keyframes progress-bar-stripes{from{background-position:40px 0}to{background-position:0 0}}.progress{height:20px;margin-bottom:20px;overflow:hidden;background-color:#f5f5f5;border-radius:4px;-webkit-box-shadow:inset 0 1px 2px rgba(0,0,0,.1);box-shadow:inset 0 1px 2px rgba(0,0,0,.1)}.progress-bar{float:left;width:0;height:100%;font-size:12px;line-height:20px;color:#fff;text-align:center;background-color:#337ab7;-webkit-box-shadow:inset 0 -1px 0 rgba(0,0,0,.15);box-shadow:inset 0 -1px 0 rgba(0,0,0,.15);-webkit-transition:width .6s ease;-o-transition:width .6s ease;transition:width .6s ease}.progress-bar-striped,.progress-striped .progress-bar{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);-webkit-background-size:40px 40px;background-size:40px 40px}.progress-bar.active,.progress.active .progress-bar{-webkit-animation:progress-bar-stripes 2s linear infinite;-o-animation:progress-bar-stripes 2s linear infinite;animation:progress-bar-stripes 2s linear infinite}.progress-bar-success{background-color:#5cb85c}.progress-striped .progress-bar-success{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.progress-bar-info{background-color:#5bc0de}.progress-striped .progress-bar-info{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.progress-bar-warning{background-color:#f0ad4e}.progress-striped .progress-bar-warning{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.progress-bar-danger{background-color:#d9534f}.progress-striped .progress-bar-danger{background-image:-webkit-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:-o-linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent)}.media{margin-top:15px}.media:first-child{margin-top:0}.media,.media-body{overflow:hidden;zoom:1}.media-body{width:10000px}.media-object{display:block}.media-object.img-thumbnail{max-width:none}.media-right,.media>.pull-right{padding-left:10px}.media-left,.media>.pull-left{padding-right:10px}.media-body,.media-left,.media-right{display:table-cell;vertical-align:top}.media-middle{vertical-align:middle}.media-bottom{vertical-align:bottom}.media-heading{margin-top:0;margin-bottom:5px}.media-list{padding-left:0;list-style:none}.list-group{padding-left:0;margin-bottom:20px}.list-group-item{position:relative;display:block;padding:10px 15px;margin-bottom:-1px;background-color:#fff;border:1px solid #ddd}.list-group-item:first-child{border-top-left-radius:4px;border-top-right-radius:4px}.list-group-item:last-child{margin-bottom:0;border-bottom-right-radius:4px;border-bottom-left-radius:4px}a.list-group-item,button.list-group-item{color:#555}a.list-group-item .list-group-item-heading,button.list-group-item .list-group-item-heading{color:#333}a.list-group-item:focus,a.list-group-item:hover,button.list-group-item:focus,button.list-group-item:hover{color:#555;text-decoration:none;background-color:#f5f5f5}button.list-group-item{width:100%;text-align:left}.list-group-item.disabled,.list-group-item.disabled:focus,.list-group-item.disabled:hover{color:#777;cursor:not-allowed;background-color:#eee}.list-group-item.disabled .list-group-item-heading,.list-group-item.disabled:focus .list-group-item-heading,.list-group-item.disabled:hover .list-group-item-heading{color:inherit}.list-group-item.disabled .list-group-item-text,.list-group-item.disabled:focus .list-group-item-text,.list-group-item.disabled:hover .list-group-item-text{color:#777}.list-group-item.active,.list-group-item.active:focus,.list-group-item.active:hover{z-index:2;color:#fff;background-color:#337ab7;border-color:#337ab7}.list-group-item.active .list-group-item-heading,.list-group-item.active .list-group-item-heading>.small,.list-group-item.active .list-group-item-heading>small,.list-group-item.active:focus .list-group-item-heading,.list-group-item.active:focus .list-group-item-heading>.small,.list-group-item.active:focus .list-group-item-heading>small,.list-group-item.active:hover .list-group-item-heading,.list-group-item.active:hover .list-group-item-heading>.small,.list-group-item.active:hover .list-group-item-heading>small{color:inherit}.list-group-item.active .list-group-item-text,.list-group-item.active:focus .list-group-item-text,.list-group-item.active:hover .list-group-item-text{color:#c7ddef}.list-group-item-success{color:#3c763d;background-color:#dff0d8}a.list-group-item-success,button.list-group-item-success{color:#3c763d}a.list-group-item-success .list-group-item-heading,button.list-group-item-success .list-group-item-heading{color:inherit}a.list-group-item-success:focus,a.list-group-item-success:hover,button.list-group-item-success:focus,button.list-group-item-success:hover{color:#3c763d;background-color:#d0e9c6}a.list-group-item-success.active,a.list-group-item-success.active:focus,a.list-group-item-success.active:hover,button.list-group-item-success.active,button.list-group-item-success.active:focus,button.list-group-item-success.active:hover{color:#fff;background-color:#3c763d;border-color:#3c763d}.list-group-item-info{color:#31708f;background-color:#d9edf7}a.list-group-item-info,button.list-group-item-info{color:#31708f}a.list-group-item-info .list-group-item-heading,button.list-group-item-info .list-group-item-heading{color:inherit}a.list-group-item-info:focus,a.list-group-item-info:hover,button.list-group-item-info:focus,button.list-group-item-info:hover{color:#31708f;background-color:#c4e3f3}a.list-group-item-info.active,a.list-group-item-info.active:focus,a.list-group-item-info.active:hover,button.list-group-item-info.active,button.list-group-item-info.active:focus,button.list-group-item-info.active:hover{color:#fff;background-color:#31708f;border-color:#31708f}.list-group-item-warning{color:#8a6d3b;background-color:#fcf8e3}a.list-group-item-warning,button.list-group-item-warning{color:#8a6d3b}a.list-group-item-warning .list-group-item-heading,button.list-group-item-warning .list-group-item-heading{color:inherit}a.list-group-item-warning:focus,a.list-group-item-warning:hover,button.list-group-item-warning:focus,button.list-group-item-warning:hover{color:#8a6d3b;background-color:#faf2cc}a.list-group-item-warning.active,a.list-group-item-warning.active:focus,a.list-group-item-warning.active:hover,button.list-group-item-warning.active,button.list-group-item-warning.active:focus,button.list-group-item-warning.active:hover{color:#fff;background-color:#8a6d3b;border-color:#8a6d3b}.list-group-item-danger{color:#a94442;background-color:#f2dede}a.list-group-item-danger,button.list-group-item-danger{color:#a94442}a.list-group-item-danger .list-group-item-heading,button.list-group-item-danger .list-group-item-heading{color:inherit}a.list-group-item-danger:focus,a.list-group-item-danger:hover,button.list-group-item-danger:focus,button.list-group-item-danger:hover{color:#a94442;background-color:#ebcccc}a.list-group-item-danger.active,a.list-group-item-danger.active:focus,a.list-group-item-danger.active:hover,button.list-group-item-danger.active,button.list-group-item-danger.active:focus,button.list-group-item-danger.active:hover{color:#fff;background-color:#a94442;border-color:#a94442}.list-group-item-heading{margin-top:0;margin-bottom:5px}.list-group-item-text{margin-bottom:0;line-height:1.3}.panel{margin-bottom:20px;background-color:#fff;border:1px solid transparent;border-radius:4px;-webkit-box-shadow:0 1px 1px rgba(0,0,0,.05);box-shadow:0 1px 1px rgba(0,0,0,.05)}.panel-body{padding:15px}.panel-heading{padding:10px 15px;border-bottom:1px solid transparent;border-top-left-radius:3px;border-top-right-radius:3px}.panel-heading>.dropdown .dropdown-toggle{color:inherit}.panel-title{margin-top:0;margin-bottom:0;font-size:16px;color:inherit}.panel-title>.small,.panel-title>.small>a,.panel-title>a,.panel-title>small,.panel-title>small>a{color:inherit}.panel-footer{padding:10px 15px;background-color:#f5f5f5;border-top:1px solid #ddd;border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.list-group,.panel>.panel-collapse>.list-group{margin-bottom:0}.panel>.list-group .list-group-item,.panel>.panel-collapse>.list-group .list-group-item{border-width:1px 0;border-radius:0}.panel>.list-group:first-child .list-group-item:first-child,.panel>.panel-collapse>.list-group:first-child .list-group-item:first-child{border-top:0;border-top-left-radius:3px;border-top-right-radius:3px}.panel>.list-group:last-child .list-group-item:last-child,.panel>.panel-collapse>.list-group:last-child .list-group-item:last-child{border-bottom:0;border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.panel-heading+.panel-collapse>.list-group .list-group-item:first-child{border-top-left-radius:0;border-top-right-radius:0}.panel-heading+.list-group .list-group-item:first-child{border-top-width:0}.list-group+.panel-footer{border-top-width:0}.panel>.panel-collapse>.table,.panel>.table,.panel>.table-responsive>.table{margin-bottom:0}.panel>.panel-collapse>.table caption,.panel>.table caption,.panel>.table-responsive>.table caption{padding-right:15px;padding-left:15px}.panel>.table-responsive:first-child>.table:first-child,.panel>.table:first-child{border-top-left-radius:3px;border-top-right-radius:3px}.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child,.panel>.table:first-child>tbody:first-child>tr:first-child,.panel>.table:first-child>thead:first-child>tr:first-child{border-top-left-radius:3px;border-top-right-radius:3px}.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child td:first-child,.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child th:first-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child td:first-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child th:first-child,.panel>.table:first-child>tbody:first-child>tr:first-child td:first-child,.panel>.table:first-child>tbody:first-child>tr:first-child th:first-child,.panel>.table:first-child>thead:first-child>tr:first-child td:first-child,.panel>.table:first-child>thead:first-child>tr:first-child th:first-child{border-top-left-radius:3px}.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child td:last-child,.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child th:last-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child td:last-child,.panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child th:last-child,.panel>.table:first-child>tbody:first-child>tr:first-child td:last-child,.panel>.table:first-child>tbody:first-child>tr:first-child th:last-child,.panel>.table:first-child>thead:first-child>tr:first-child td:last-child,.panel>.table:first-child>thead:first-child>tr:first-child th:last-child{border-top-right-radius:3px}.panel>.table-responsive:last-child>.table:last-child,.panel>.table:last-child{border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child,.panel>.table:last-child>tbody:last-child>tr:last-child,.panel>.table:last-child>tfoot:last-child>tr:last-child{border-bottom-right-radius:3px;border-bottom-left-radius:3px}.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child td:first-child,.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child th:first-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child td:first-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child th:first-child,.panel>.table:last-child>tbody:last-child>tr:last-child td:first-child,.panel>.table:last-child>tbody:last-child>tr:last-child th:first-child,.panel>.table:last-child>tfoot:last-child>tr:last-child td:first-child,.panel>.table:last-child>tfoot:last-child>tr:last-child th:first-child{border-bottom-left-radius:3px}.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child td:last-child,.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child th:last-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child td:last-child,.panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child th:last-child,.panel>.table:last-child>tbody:last-child>tr:last-child td:last-child,.panel>.table:last-child>tbody:last-child>tr:last-child th:last-child,.panel>.table:last-child>tfoot:last-child>tr:last-child td:last-child,.panel>.table:last-child>tfoot:last-child>tr:last-child th:last-child{border-bottom-right-radius:3px}.panel>.panel-body+.table,.panel>.panel-body+.table-responsive,.panel>.table+.panel-body,.panel>.table-responsive+.panel-body{border-top:1px solid #ddd}.panel>.table>tbody:first-child>tr:first-child td,.panel>.table>tbody:first-child>tr:first-child th{border-top:0}.panel>.table-bordered,.panel>.table-responsive>.table-bordered{border:0}.panel>.table-bordered>tbody>tr>td:first-child,.panel>.table-bordered>tbody>tr>th:first-child,.panel>.table-bordered>tfoot>tr>td:first-child,.panel>.table-bordered>tfoot>tr>th:first-child,.panel>.table-bordered>thead>tr>td:first-child,.panel>.table-bordered>thead>tr>th:first-child,.panel>.table-responsive>.table-bordered>tbody>tr>td:first-child,.panel>.table-responsive>.table-bordered>tbody>tr>th:first-child,.panel>.table-responsive>.table-bordered>tfoot>tr>td:first-child,.panel>.table-responsive>.table-bordered>tfoot>tr>th:first-child,.panel>.table-responsive>.table-bordered>thead>tr>td:first-child,.panel>.table-responsive>.table-bordered>thead>tr>th:first-child{border-left:0}.panel>.table-bordered>tbody>tr>td:last-child,.panel>.table-bordered>tbody>tr>th:last-child,.panel>.table-bordered>tfoot>tr>td:last-child,.panel>.table-bordered>tfoot>tr>th:last-child,.panel>.table-bordered>thead>tr>td:last-child,.panel>.table-bordered>thead>tr>th:last-child,.panel>.table-responsive>.table-bordered>tbody>tr>td:last-child,.panel>.table-responsive>.table-bordered>tbody>tr>th:last-child,.panel>.table-responsive>.table-bordered>tfoot>tr>td:last-child,.panel>.table-responsive>.table-bordered>tfoot>tr>th:last-child,.panel>.table-responsive>.table-bordered>thead>tr>td:last-child,.panel>.table-responsive>.table-bordered>thead>tr>th:last-child{border-right:0}.panel>.table-bordered>tbody>tr:first-child>td,.panel>.table-bordered>tbody>tr:first-child>th,.panel>.table-bordered>thead>tr:first-child>td,.panel>.table-bordered>thead>tr:first-child>th,.panel>.table-responsive>.table-bordered>tbody>tr:first-child>td,.panel>.table-responsive>.table-bordered>tbody>tr:first-child>th,.panel>.table-responsive>.table-bordered>thead>tr:first-child>td,.panel>.table-responsive>.table-bordered>thead>tr:first-child>th{border-bottom:0}.panel>.table-bordered>tbody>tr:last-child>td,.panel>.table-bordered>tbody>tr:last-child>th,.panel>.table-bordered>tfoot>tr:last-child>td,.panel>.table-bordered>tfoot>tr:last-child>th,.panel>.table-responsive>.table-bordered>tbody>tr:last-child>td,.panel>.table-responsive>.table-bordered>tbody>tr:last-child>th,.panel>.table-responsive>.table-bordered>tfoot>tr:last-child>td,.panel>.table-responsive>.table-bordered>tfoot>tr:last-child>th{border-bottom:0}.panel>.table-responsive{margin-bottom:0;border:0}.panel-group{margin-bottom:20px}.panel-group .panel{margin-bottom:0;border-radius:4px}.panel-group .panel+.panel{margin-top:5px}.panel-group .panel-heading{border-bottom:0}.panel-group .panel-heading+.panel-collapse>.list-group,.panel-group .panel-heading+.panel-collapse>.panel-body{border-top:1px solid #ddd}.panel-group .panel-footer{border-top:0}.panel-group .panel-footer+.panel-collapse .panel-body{border-bottom:1px solid #ddd}.panel-default{border-color:#ddd}.panel-default>.panel-heading{color:#333;background-color:#f5f5f5;border-color:#ddd}.panel-default>.panel-heading+.panel-collapse>.panel-body{border-top-color:#ddd}.panel-default>.panel-heading .badge{color:#f5f5f5;background-color:#333}.panel-default>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#ddd}.panel-primary{border-color:#337ab7}.panel-primary>.panel-heading{color:#fff;background-color:#337ab7;border-color:#337ab7}.panel-primary>.panel-heading+.panel-collapse>.panel-body{border-top-color:#337ab7}.panel-primary>.panel-heading .badge{color:#337ab7;background-color:#fff}.panel-primary>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#337ab7}.panel-success{border-color:#d6e9c6}.panel-success>.panel-heading{color:#3c763d;background-color:#dff0d8;border-color:#d6e9c6}.panel-success>.panel-heading+.panel-collapse>.panel-body{border-top-color:#d6e9c6}.panel-success>.panel-heading .badge{color:#dff0d8;background-color:#3c763d}.panel-success>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#d6e9c6}.panel-info{border-color:#bce8f1}.panel-info>.panel-heading{color:#31708f;background-color:#d9edf7;border-color:#bce8f1}.panel-info>.panel-heading+.panel-collapse>.panel-body{border-top-color:#bce8f1}.panel-info>.panel-heading .badge{color:#d9edf7;background-color:#31708f}.panel-info>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#bce8f1}.panel-warning{border-color:#faebcc}.panel-warning>.panel-heading{color:#8a6d3b;background-color:#fcf8e3;border-color:#faebcc}.panel-warning>.panel-heading+.panel-collapse>.panel-body{border-top-color:#faebcc}.panel-warning>.panel-heading .badge{color:#fcf8e3;background-color:#8a6d3b}.panel-warning>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#faebcc}.panel-danger{border-color:#ebccd1}.panel-danger>.panel-heading{color:#a94442;background-color:#f2dede;border-color:#ebccd1}.panel-danger>.panel-heading+.panel-collapse>.panel-body{border-top-color:#ebccd1}.panel-danger>.panel-heading .badge{color:#f2dede;background-color:#a94442}.panel-danger>.panel-footer+.panel-collapse>.panel-body{border-bottom-color:#ebccd1}.embed-responsive{position:relative;display:block;height:0;padding:0;overflow:hidden}.embed-responsive .embed-responsive-item,.embed-responsive embed,.embed-responsive iframe,.embed-responsive object,.embed-responsive video{position:absolute;top:0;bottom:0;left:0;width:100%;height:100%;border:0}.embed-responsive-16by9{padding-bottom:56.25%}.embed-responsive-4by3{padding-bottom:75%}.well{min-height:20px;padding:19px;margin-bottom:20px;background-color:#f5f5f5;border:1px solid #e3e3e3;border-radius:4px;-webkit-box-shadow:inset 0 1px 1px rgba(0,0,0,.05);box-shadow:inset 0 1px 1px rgba(0,0,0,.05)}.well blockquote{border-color:#ddd;border-color:rgba(0,0,0,.15)}.well-lg{padding:24px;border-radius:6px}.well-sm{padding:9px;border-radius:3px}.close{float:right;font-size:21px;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;filter:alpha(opacity=20);opacity:.2}.close:focus,.close:hover{color:#000;text-decoration:none;cursor:pointer;filter:alpha(opacity=50);opacity:.5}button.close{-webkit-appearance:none;padding:0;cursor:pointer;background:0 0;border:0}.modal-open{overflow:hidden}.modal{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1050;display:none;overflow:hidden;-webkit-overflow-scrolling:touch;outline:0}.modal.fade .modal-dialog{-webkit-transition:-webkit-transform .3s ease-out;-o-transition:-o-transform .3s ease-out;transition:transform .3s ease-out;-webkit-transform:translate(0,-25%);-ms-transform:translate(0,-25%);-o-transform:translate(0,-25%);transform:translate(0,-25%)}.modal.in .modal-dialog{-webkit-transform:translate(0,0);-ms-transform:translate(0,0);-o-transform:translate(0,0);transform:translate(0,0)}.modal-open .modal{overflow-x:hidden;overflow-y:auto}.modal-dialog{position:relative;width:auto;margin:10px}.modal-content{position:relative;background-color:#fff;-webkit-background-clip:padding-box;background-clip:padding-box;border:1px solid #999;border:1px solid rgba(0,0,0,.2);border-radius:6px;outline:0;-webkit-box-shadow:0 3px 9px rgba(0,0,0,.5);box-shadow:0 3px 9px rgba(0,0,0,.5)}.modal-backdrop{position:fixed;top:0;right:0;bottom:0;left:0;z-index:1040;background-color:#000}.modal-backdrop.fade{filter:alpha(opacity=0);opacity:0}.modal-backdrop.in{filter:alpha(opacity=50);opacity:.5}.modal-header{padding:15px;border-bottom:1px solid #e5e5e5}.modal-header .close{margin-top:-2px}.modal-title{margin:0;line-height:1.42857143}.modal-body{position:relative;padding:15px}.modal-footer{padding:15px;text-align:right;border-top:1px solid #e5e5e5}.modal-footer .btn+.btn{margin-bottom:0;margin-left:5px}.modal-footer .btn-group .btn+.btn{margin-left:-1px}.modal-footer .btn-block+.btn-block{margin-left:0}.modal-scrollbar-measure{position:absolute;top:-9999px;width:50px;height:50px;overflow:scroll}@media (min-width:768px){.modal-dialog{width:600px;margin:30px auto}.modal-content{-webkit-box-shadow:0 5px 15px rgba(0,0,0,.5);box-shadow:0 5px 15px rgba(0,0,0,.5)}.modal-sm{width:300px}}@media (min-width:992px){.modal-lg{width:900px}}.tooltip{position:absolute;z-index:1070;display:block;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:12px;font-style:normal;font-weight:400;line-height:1.42857143;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;word-wrap:normal;white-space:normal;filter:alpha(opacity=0);opacity:0;line-break:auto}.tooltip.in{filter:alpha(opacity=90);opacity:.9}.tooltip.top{padding:5px 0;margin-top:-3px}.tooltip.right{padding:0 5px;margin-left:3px}.tooltip.bottom{padding:5px 0;margin-top:3px}.tooltip.left{padding:0 5px;margin-left:-3px}.tooltip-inner{max-width:200px;padding:3px 8px;color:#fff;text-align:center;background-color:#000;border-radius:4px}.tooltip-arrow{position:absolute;width:0;height:0;border-color:transparent;border-style:solid}.tooltip.top .tooltip-arrow{bottom:0;left:50%;margin-left:-5px;border-width:5px 5px 0;border-top-color:#000}.tooltip.top-left .tooltip-arrow{right:5px;bottom:0;margin-bottom:-5px;border-width:5px 5px 0;border-top-color:#000}.tooltip.top-right .tooltip-arrow{bottom:0;left:5px;margin-bottom:-5px;border-width:5px 5px 0;border-top-color:#000}.tooltip.right .tooltip-arrow{top:50%;left:0;margin-top:-5px;border-width:5px 5px 5px 0;border-right-color:#000}.tooltip.left .tooltip-arrow{top:50%;right:0;margin-top:-5px;border-width:5px 0 5px 5px;border-left-color:#000}.tooltip.bottom .tooltip-arrow{top:0;left:50%;margin-left:-5px;border-width:0 5px 5px;border-bottom-color:#000}.tooltip.bottom-left .tooltip-arrow{top:0;right:5px;margin-top:-5px;border-width:0 5px 5px;border-bottom-color:#000}.tooltip.bottom-right .tooltip-arrow{top:0;left:5px;margin-top:-5px;border-width:0 5px 5px;border-bottom-color:#000}.popover{position:absolute;top:0;left:0;z-index:1060;display:none;max-width:276px;padding:1px;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:14px;font-style:normal;font-weight:400;line-height:1.42857143;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;word-spacing:normal;word-wrap:normal;white-space:normal;background-color:#fff;-webkit-background-clip:padding-box;background-clip:padding-box;border:1px solid #ccc;border:1px solid rgba(0,0,0,.2);border-radius:6px;-webkit-box-shadow:0 5px 10px rgba(0,0,0,.2);box-shadow:0 5px 10px rgba(0,0,0,.2);line-break:auto}.popover.top{margin-top:-10px}.popover.right{margin-left:10px}.popover.bottom{margin-top:10px}.popover.left{margin-left:-10px}.popover-title{padding:8px 14px;margin:0;font-size:14px;background-color:#f7f7f7;border-bottom:1px solid #ebebeb;border-radius:5px 5px 0 0}.popover-content{padding:9px 14px}.popover>.arrow,.popover>.arrow:after{position:absolute;display:block;width:0;height:0;border-color:transparent;border-style:solid}.popover>.arrow{border-width:11px}.popover>.arrow:after{content:"";border-width:10px}.popover.top>.arrow{bottom:-11px;left:50%;margin-left:-11px;border-top-color:#999;border-top-color:rgba(0,0,0,.25);border-bottom-width:0}.popover.top>.arrow:after{bottom:1px;margin-left:-10px;content:" ";border-top-color:#fff;border-bottom-width:0}.popover.right>.arrow{top:50%;left:-11px;margin-top:-11px;border-right-color:#999;border-right-color:rgba(0,0,0,.25);border-left-width:0}.popover.right>.arrow:after{bottom:-10px;left:1px;content:" ";border-right-color:#fff;border-left-width:0}.popover.bottom>.arrow{top:-11px;left:50%;margin-left:-11px;border-top-width:0;border-bottom-color:#999;border-bottom-color:rgba(0,0,0,.25)}.popover.bottom>.arrow:after{top:1px;margin-left:-10px;content:" ";border-top-width:0;border-bottom-color:#fff}.popover.left>.arrow{top:50%;right:-11px;margin-top:-11px;border-right-width:0;border-left-color:#999;border-left-color:rgba(0,0,0,.25)}.popover.left>.arrow:after{right:1px;bottom:-10px;content:" ";border-right-width:0;border-left-color:#fff}.carousel{position:relative}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner>.item{position:relative;display:none;-webkit-transition:.6s ease-in-out left;-o-transition:.6s ease-in-out left;transition:.6s ease-in-out left}.carousel-inner>.item>a>img,.carousel-inner>.item>img{line-height:1}@media all and (transform-3d),(-webkit-transform-3d){.carousel-inner>.item{-webkit-transition:-webkit-transform .6s ease-in-out;-o-transition:-o-transform .6s ease-in-out;transition:transform .6s ease-in-out;-webkit-backface-visibility:hidden;backface-visibility:hidden;-webkit-perspective:1000px;perspective:1000px}.carousel-inner>.item.active.right,.carousel-inner>.item.next{left:0;-webkit-transform:translate3d(100%,0,0);transform:translate3d(100%,0,0)}.carousel-inner>.item.active.left,.carousel-inner>.item.prev{left:0;-webkit-transform:translate3d(-100%,0,0);transform:translate3d(-100%,0,0)}.carousel-inner>.item.active,.carousel-inner>.item.next.left,.carousel-inner>.item.prev.right{left:0;-webkit-transform:translate3d(0,0,0);transform:translate3d(0,0,0)}}.carousel-inner>.active,.carousel-inner>.next,.carousel-inner>.prev{display:block}.carousel-inner>.active{left:0}.carousel-inner>.next,.carousel-inner>.prev{position:absolute;top:0;width:100%}.carousel-inner>.next{left:100%}.carousel-inner>.prev{left:-100%}.carousel-inner>.next.left,.carousel-inner>.prev.right{left:0}.carousel-inner>.active.left{left:-100%}.carousel-inner>.active.right{left:100%}.carousel-control{position:absolute;top:0;bottom:0;left:0;width:15%;font-size:20px;color:#fff;text-align:center;text-shadow:0 1px 2px rgba(0,0,0,.6);background-color:rgba(0,0,0,0);filter:alpha(opacity=50);opacity:.5}.carousel-control.left{background-image:-webkit-linear-gradient(left,rgba(0,0,0,.5) 0,rgba(0,0,0,.0001) 100%);background-image:-o-linear-gradient(left,rgba(0,0,0,.5) 0,rgba(0,0,0,.0001) 100%);background-image:-webkit-gradient(linear,left top,right top,from(rgba(0,0,0,.5)),to(rgba(0,0,0,.0001)));background-image:linear-gradient(to right,rgba(0,0,0,.5) 0,rgba(0,0,0,.0001) 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#80000000', endColorstr='#00000000', GradientType=1);background-repeat:repeat-x}.carousel-control.right{right:0;left:auto;background-image:-webkit-linear-gradient(left,rgba(0,0,0,.0001) 0,rgba(0,0,0,.5) 100%);background-image:-o-linear-gradient(left,rgba(0,0,0,.0001) 0,rgba(0,0,0,.5) 100%);background-image:-webkit-gradient(linear,left top,right top,from(rgba(0,0,0,.0001)),to(rgba(0,0,0,.5)));background-image:linear-gradient(to right,rgba(0,0,0,.0001) 0,rgba(0,0,0,.5) 100%);filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#00000000', endColorstr='#80000000', GradientType=1);background-repeat:repeat-x}.carousel-control:focus,.carousel-control:hover{color:#fff;text-decoration:none;filter:alpha(opacity=90);outline:0;opacity:.9}.carousel-control .glyphicon-chevron-left,.carousel-control .glyphicon-chevron-right,.carousel-control .icon-next,.carousel-control .icon-prev{position:absolute;top:50%;z-index:5;display:inline-block;margin-top:-10px}.carousel-control .glyphicon-chevron-left,.carousel-control .icon-prev{left:50%;margin-left:-10px}.carousel-control .glyphicon-chevron-right,.carousel-control .icon-next{right:50%;margin-right:-10px}.carousel-control .icon-next,.carousel-control .icon-prev{width:20px;height:20px;font-family:serif;line-height:1}.carousel-control .icon-prev:before{content:'\2039'}.carousel-control .icon-next:before{content:'\203a'}.carousel-indicators{position:absolute;bottom:10px;left:50%;z-index:15;width:60%;padding-left:0;margin-left:-30%;text-align:center;list-style:none}.carousel-indicators li{display:inline-block;width:10px;height:10px;margin:1px;text-indent:-999px;cursor:pointer;background-color:#000\9;background-color:rgba(0,0,0,0);border:1px solid #fff;border-radius:10px}.carousel-indicators .active{width:12px;height:12px;margin:0;background-color:#fff}.carousel-caption{position:absolute;right:15%;bottom:20px;left:15%;z-index:10;padding-top:20px;padding-bottom:20px;color:#fff;text-align:center;text-shadow:0 1px 2px rgba(0,0,0,.6)}.carousel-caption .btn{text-shadow:none}@media screen and (min-width:768px){.carousel-control .glyphicon-chevron-left,.carousel-control .glyphicon-chevron-right,.carousel-control .icon-next,.carousel-control .icon-prev{width:30px;height:30px;margin-top:-10px;font-size:30px}.carousel-control .glyphicon-chevron-left,.carousel-control .icon-prev{margin-left:-10px}.carousel-control .glyphicon-chevron-right,.carousel-control .icon-next{margin-right:-10px}.carousel-caption{right:20%;left:20%;padding-bottom:30px}.carousel-indicators{bottom:20px}}.btn-group-vertical>.btn-group:after,.btn-group-vertical>.btn-group:before,.btn-toolbar:after,.btn-toolbar:before,.clearfix:after,.clearfix:before,.container-fluid:after,.container-fluid:before,.container:after,.container:before,.dl-horizontal dd:after,.dl-horizontal dd:before,.form-horizontal .form-group:after,.form-horizontal .form-group:before,.modal-footer:after,.modal-footer:before,.modal-header:after,.modal-header:before,.nav:after,.nav:before,.navbar-collapse:after,.navbar-collapse:before,.navbar-header:after,.navbar-header:before,.navbar:after,.navbar:before,.pager:after,.pager:before,.panel-body:after,.panel-body:before,.row:after,.row:before{display:table;content:" "}.btn-group-vertical>.btn-group:after,.btn-toolbar:after,.clearfix:after,.container-fluid:after,.container:after,.dl-horizontal dd:after,.form-horizontal .form-group:after,.modal-footer:after,.modal-header:after,.nav:after,.navbar-collapse:after,.navbar-header:after,.navbar:after,.pager:after,.panel-body:after,.row:after{clear:both}.center-block{display:block;margin-right:auto;margin-left:auto}.pull-right{float:right!important}.pull-left{float:left!important}.hide{display:none!important}.show{display:block!important}.invisible{visibility:hidden}.text-hide{font:0/0 a;color:transparent;text-shadow:none;background-color:transparent;border:0}.hidden{display:none!important}.affix{position:fixed}@-ms-viewport{width:device-width}.visible-lg,.visible-md,.visible-sm,.visible-xs{display:none!important}.visible-lg-block,.visible-lg-inline,.visible-lg-inline-block,.visible-md-block,.visible-md-inline,.visible-md-inline-block,.visible-sm-block,.visible-sm-inline,.visible-sm-inline-block,.visible-xs-block,.visible-xs-inline,.visible-xs-inline-block{display:none!important}@media (max-width:767px){.visible-xs{display:block!important}table.visible-xs{display:table!important}tr.visible-xs{display:table-row!important}td.visible-xs,th.visible-xs{display:table-cell!important}}@media (max-width:767px){.visible-xs-block{display:block!important}}@media (max-width:767px){.visible-xs-inline{display:inline!important}}@media (max-width:767px){.visible-xs-inline-block{display:inline-block!important}}@media (min-width:768px) and (max-width:991px){.visible-sm{display:block!important}table.visible-sm{display:table!important}tr.visible-sm{display:table-row!important}td.visible-sm,th.visible-sm{display:table-cell!important}}@media (min-width:768px) and (max-width:991px){.visible-sm-block{display:block!important}}@media (min-width:768px) and (max-width:991px){.visible-sm-inline{display:inline!important}}@media (min-width:768px) and (max-width:991px){.visible-sm-inline-block{display:inline-block!important}}@media (min-width:992px) and (max-width:1199px){.visible-md{display:block!important}table.visible-md{display:table!important}tr.visible-md{display:table-row!important}td.visible-md,th.visible-md{display:table-cell!important}}@media (min-width:992px) and (max-width:1199px){.visible-md-block{display:block!important}}@media (min-width:992px) and (max-width:1199px){.visible-md-inline{display:inline!important}}@media (min-width:992px) and (max-width:1199px){.visible-md-inline-block{display:inline-block!important}}@media (min-width:1200px){.visible-lg{display:block!important}table.visible-lg{display:table!important}tr.visible-lg{display:table-row!important}td.visible-lg,th.visible-lg{display:table-cell!important}}@media (min-width:1200px){.visible-lg-block{display:block!important}}@media (min-width:1200px){.visible-lg-inline{display:inline!important}}@media (min-width:1200px){.visible-lg-inline-block{display:inline-block!important}}@media (max-width:767px){.hidden-xs{display:none!important}}@media (min-width:768px) and (max-width:991px){.hidden-sm{display:none!important}}@media (min-width:992px) and (max-width:1199px){.hidden-md{display:none!important}}@media (min-width:1200px){.hidden-lg{display:none!important}}.visible-print{display:none!important}@media print{.visible-print{display:block!important}table.visible-print{display:table!important}tr.visible-print{display:table-row!important}td.visible-print,th.visible-print{display:table-cell!important}}.visible-print-block{display:none!important}@media print{.visible-print-block{display:block!important}}.visible-print-inline{display:none!important}@media print{.visible-print-inline{display:inline!important}}.visible-print-inline-block{display:none!important}@media print{.visible-print-inline-block{display:inline-block!important}}@media print{.hidden-print{display:none!important}} +@charset "UTF-8";/*! + * Bootstrap v5.3.3 (https://getbootstrap.com/) + * Copyright 2011-2024 The Bootstrap Authors + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */:root,[data-bs-theme=light]{--bs-blue:#0d6efd;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#dc3545;--bs-orange:#fd7e14;--bs-yellow:#ffc107;--bs-green:#198754;--bs-teal:#20c997;--bs-cyan:#0dcaf0;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#0d6efd;--bs-secondary:#6c757d;--bs-success:#198754;--bs-info:#0dcaf0;--bs-warning:#ffc107;--bs-danger:#dc3545;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:13,110,253;--bs-secondary-rgb:108,117,125;--bs-success-rgb:25,135,84;--bs-info-rgb:13,202,240;--bs-warning-rgb:255,193,7;--bs-danger-rgb:220,53,69;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-primary-text-emphasis:#052c65;--bs-secondary-text-emphasis:#2b2f32;--bs-success-text-emphasis:#0a3622;--bs-info-text-emphasis:#055160;--bs-warning-text-emphasis:#664d03;--bs-danger-text-emphasis:#58151c;--bs-light-text-emphasis:#495057;--bs-dark-text-emphasis:#495057;--bs-primary-bg-subtle:#cfe2ff;--bs-secondary-bg-subtle:#e2e3e5;--bs-success-bg-subtle:#d1e7dd;--bs-info-bg-subtle:#cff4fc;--bs-warning-bg-subtle:#fff3cd;--bs-danger-bg-subtle:#f8d7da;--bs-light-bg-subtle:#fcfcfd;--bs-dark-bg-subtle:#ced4da;--bs-primary-border-subtle:#9ec5fe;--bs-secondary-border-subtle:#c4c8cb;--bs-success-border-subtle:#a3cfbb;--bs-info-border-subtle:#9eeaf9;--bs-warning-border-subtle:#ffe69c;--bs-danger-border-subtle:#f1aeb5;--bs-light-border-subtle:#e9ecef;--bs-dark-border-subtle:#adb5bd;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-font-sans-serif:system-ui,-apple-system,"Segoe UI",Roboto,"Helvetica Neue","Noto Sans","Liberation Sans",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#212529;--bs-body-color-rgb:33,37,41;--bs-body-bg:#fff;--bs-body-bg-rgb:255,255,255;--bs-emphasis-color:#000;--bs-emphasis-color-rgb:0,0,0;--bs-secondary-color:rgba(33, 37, 41, 0.75);--bs-secondary-color-rgb:33,37,41;--bs-secondary-bg:#e9ecef;--bs-secondary-bg-rgb:233,236,239;--bs-tertiary-color:rgba(33, 37, 41, 0.5);--bs-tertiary-color-rgb:33,37,41;--bs-tertiary-bg:#f8f9fa;--bs-tertiary-bg-rgb:248,249,250;--bs-heading-color:inherit;--bs-link-color:#0d6efd;--bs-link-color-rgb:13,110,253;--bs-link-decoration:underline;--bs-link-hover-color:#0a58ca;--bs-link-hover-color-rgb:10,88,202;--bs-code-color:#d63384;--bs-highlight-color:#212529;--bs-highlight-bg:#fff3cd;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-xxl:2rem;--bs-border-radius-2xl:var(--bs-border-radius-xxl);--bs-border-radius-pill:50rem;--bs-box-shadow:0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-box-shadow-sm:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-box-shadow-lg:0 1rem 3rem rgba(0, 0, 0, 0.175);--bs-box-shadow-inset:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-focus-ring-width:0.25rem;--bs-focus-ring-opacity:0.25;--bs-focus-ring-color:rgba(13, 110, 253, 0.25);--bs-form-valid-color:#198754;--bs-form-valid-border-color:#198754;--bs-form-invalid-color:#dc3545;--bs-form-invalid-border-color:#dc3545}[data-bs-theme=dark]{color-scheme:dark;--bs-body-color:#dee2e6;--bs-body-color-rgb:222,226,230;--bs-body-bg:#212529;--bs-body-bg-rgb:33,37,41;--bs-emphasis-color:#fff;--bs-emphasis-color-rgb:255,255,255;--bs-secondary-color:rgba(222, 226, 230, 0.75);--bs-secondary-color-rgb:222,226,230;--bs-secondary-bg:#343a40;--bs-secondary-bg-rgb:52,58,64;--bs-tertiary-color:rgba(222, 226, 230, 0.5);--bs-tertiary-color-rgb:222,226,230;--bs-tertiary-bg:#2b3035;--bs-tertiary-bg-rgb:43,48,53;--bs-primary-text-emphasis:#6ea8fe;--bs-secondary-text-emphasis:#a7acb1;--bs-success-text-emphasis:#75b798;--bs-info-text-emphasis:#6edff6;--bs-warning-text-emphasis:#ffda6a;--bs-danger-text-emphasis:#ea868f;--bs-light-text-emphasis:#f8f9fa;--bs-dark-text-emphasis:#dee2e6;--bs-primary-bg-subtle:#031633;--bs-secondary-bg-subtle:#161719;--bs-success-bg-subtle:#051b11;--bs-info-bg-subtle:#032830;--bs-warning-bg-subtle:#332701;--bs-danger-bg-subtle:#2c0b0e;--bs-light-bg-subtle:#343a40;--bs-dark-bg-subtle:#1a1d20;--bs-primary-border-subtle:#084298;--bs-secondary-border-subtle:#41464b;--bs-success-border-subtle:#0f5132;--bs-info-border-subtle:#087990;--bs-warning-border-subtle:#997404;--bs-danger-border-subtle:#842029;--bs-light-border-subtle:#495057;--bs-dark-border-subtle:#343a40;--bs-heading-color:inherit;--bs-link-color:#6ea8fe;--bs-link-hover-color:#8bb9fe;--bs-link-color-rgb:110,168,254;--bs-link-hover-color-rgb:139,185,254;--bs-code-color:#e685b5;--bs-highlight-color:#dee2e6;--bs-highlight-bg:#664d03;--bs-border-color:#495057;--bs-border-color-translucent:rgba(255, 255, 255, 0.15);--bs-form-valid-color:#75b798;--bs-form-valid-border-color:#75b798;--bs-form-invalid-color:#ea868f;--bs-form-invalid-border-color:#ea868f}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}hr{margin:1rem 0;color:inherit;border:0;border-top:var(--bs-border-width) solid;opacity:.25}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2;color:var(--bs-heading-color)}.h1,h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width:1200px){.h1,h1{font-size:2.5rem}}.h2,h2{font-size:calc(1.325rem + .9vw)}@media (min-width:1200px){.h2,h2{font-size:2rem}}.h3,h3{font-size:calc(1.3rem + .6vw)}@media (min-width:1200px){.h3,h3{font-size:1.75rem}}.h4,h4{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h4,h4{font-size:1.5rem}}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}.small,small{font-size:.875em}.mark,mark{padding:.1875em;color:var(--bs-highlight-color);background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,1));text-decoration:underline}a:hover{--bs-link-color-rgb:var(--bs-link-hover-color-rgb)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-secondary-color);text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:var(--bs-body-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:var(--bs-secondary-color)}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}:root{--bs-breakpoint-xs:0;--bs-breakpoint-sm:576px;--bs-breakpoint-md:768px;--bs-breakpoint-lg:992px;--bs-breakpoint-xl:1200px;--bs-breakpoint-xxl:1400px}.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.66666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.66666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.66666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.66666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.66666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.66666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color-type:initial;--bs-table-bg-type:initial;--bs-table-color-state:initial;--bs-table-bg-state:initial;--bs-table-color:var(--bs-emphasis-color);--bs-table-bg:var(--bs-body-bg);--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-emphasis-color);--bs-table-striped-bg:rgba(var(--bs-emphasis-color-rgb), 0.05);--bs-table-active-color:var(--bs-emphasis-color);--bs-table-active-bg:rgba(var(--bs-emphasis-color-rgb), 0.1);--bs-table-hover-color:var(--bs-emphasis-color);--bs-table-hover-bg:rgba(var(--bs-emphasis-color-rgb), 0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;color:var(--bs-table-color-state,var(--bs-table-color-type,var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:var(--bs-border-width);box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state,var(--bs-table-bg-type,var(--bs-table-accent-bg)))}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:calc(var(--bs-border-width) * 2) solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:var(--bs-border-width) 0}.table-bordered>:not(caption)>*>*{border-width:0 var(--bs-border-width)}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-active{--bs-table-color-state:var(--bs-table-active-color);--bs-table-bg-state:var(--bs-table-active-bg)}.table-hover>tbody>tr:hover>*{--bs-table-color-state:var(--bs-table-hover-color);--bs-table-bg-state:var(--bs-table-hover-bg)}.table-primary{--bs-table-color:#000;--bs-table-bg:#cfe2ff;--bs-table-border-color:#a6b5cc;--bs-table-striped-bg:#c5d7f2;--bs-table-striped-color:#000;--bs-table-active-bg:#bacbe6;--bs-table-active-color:#000;--bs-table-hover-bg:#bfd1ec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:#e2e3e5;--bs-table-border-color:#b5b6b7;--bs-table-striped-bg:#d7d8da;--bs-table-striped-color:#000;--bs-table-active-bg:#cbccce;--bs-table-active-color:#000;--bs-table-hover-bg:#d1d2d4;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d1e7dd;--bs-table-border-color:#a7b9b1;--bs-table-striped-bg:#c7dbd2;--bs-table-striped-color:#000;--bs-table-active-bg:#bcd0c7;--bs-table-active-color:#000;--bs-table-hover-bg:#c1d6cc;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#cff4fc;--bs-table-border-color:#a6c3ca;--bs-table-striped-bg:#c5e8ef;--bs-table-striped-color:#000;--bs-table-active-bg:#badce3;--bs-table-active-color:#000;--bs-table-hover-bg:#bfe2e9;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fff3cd;--bs-table-border-color:#ccc2a4;--bs-table-striped-bg:#f2e7c3;--bs-table-striped-color:#000;--bs-table-active-bg:#e6dbb9;--bs-table-active-color:#000;--bs-table-hover-bg:#ece1be;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d7da;--bs-table-border-color:#c6acae;--bs-table-striped-bg:#eccccf;--bs-table-striped-color:#000;--bs-table-active-bg:#dfc2c4;--bs-table-active-color:#000;--bs-table-hover-bg:#e5c7ca;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#c6c7c8;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#4d5154;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(.375rem + var(--bs-border-width));padding-bottom:calc(.375rem + var(--bs-border-width));margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + var(--bs-border-width));padding-bottom:calc(.5rem + var(--bs-border-width));font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + var(--bs-border-width));padding-bottom:calc(.25rem + var(--bs-border-width));font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:var(--bs-secondary-color)}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-clip:padding-box;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:var(--bs-body-color);background-color:var(--bs-body-bg);border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{min-width:85px;height:1.5em;margin:0}.form-control::-webkit-datetime-edit{display:block;padding:0}.form-control::-moz-placeholder{color:var(--bs-secondary-color);opacity:1}.form-control::placeholder{color:var(--bs-secondary-color);opacity:1}.form-control:disabled{background-color:var(--bs-secondary-bg);opacity:1}.form-control::-webkit-file-upload-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.375rem .75rem;margin:-.375rem -.75rem;-webkit-margin-end:.75rem;margin-inline-end:.75rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:var(--bs-secondary-bg)}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:var(--bs-secondary-bg)}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:var(--bs-body-color);background-color:transparent;border:solid transparent;border-width:var(--bs-border-width) 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2))}textarea.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}textarea.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-control-color{width:3rem;height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2));padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color::-webkit-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color.form-control-sm{height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-image:var(--bs-form-select-bg-img),var(--bs-form-select-bg-icon,none);background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:var(--bs-secondary-bg)}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 var(--bs-body-color)}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}[data-bs-theme=dark] .form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23dee2e6' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e")}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{--bs-form-check-bg:var(--bs-body-bg);flex-shrink:0;width:1em;height:1em;margin-top:.25em;vertical-align:top;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:var(--bs-border-width) solid var(--bs-border-color);-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");width:2em;margin-left:-2.5em;background-image:var(--bs-form-switch-bg);background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus){--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e")}.form-range{width:100%;height:1.5rem;padding:0;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;-webkit-appearance:none;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;-moz-appearance:none;appearance:none;background-color:#0d6efd;border:0;border-radius:1rem;-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:var(--bs-secondary-color)}.form-range:disabled::-moz-range-thumb{background-color:var(--bs-secondary-color)}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + calc(var(--bs-border-width) * 2));min-height:calc(3.5rem + calc(var(--bs-border-width) * 2));line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;z-index:2;height:100%;padding:1rem .75rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:var(--bs-border-width) solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:not(:-moz-placeholder-shown)~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control-plaintext~label::after,.form-floating>.form-control:focus~label::after,.form-floating>.form-control:not(:placeholder-shown)~label::after,.form-floating>.form-select~label::after{position:absolute;inset:1rem 0.375rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control:-webkit-autofill~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:var(--bs-border-width) 0}.form-floating>.form-control:disabled~label,.form-floating>:disabled~label{color:#6c757d}.form-floating>.form-control:disabled~label::after,.form-floating>:disabled~label::after{background-color:var(--bs-secondary-bg)}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-floating,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-floating:focus-within,.input-group>.form-select:focus{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);text-align:center;white-space:nowrap;background-color:var(--bs-tertiary-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius)}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select,.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select,.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:calc(var(--bs-border-width) * -1);border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-valid-color)}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-success);border-radius:var(--bs-border-radius)}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:var(--bs-form-valid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:var(--bs-form-valid-border-color)}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:var(--bs-form-valid-border-color)}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:var(--bs-form-valid-color)}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:var(--bs-form-valid-color)}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-valid,.input-group>.form-floating:not(:focus-within).is-valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-control:not(:focus):valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.was-validated .input-group>.form-select:not(:focus):valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-invalid-color)}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-danger);border-radius:var(--bs-border-radius)}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:var(--bs-form-invalid-border-color);padding-right:calc(1.5em + .75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .1875rem) center;background-size:calc(.75em + .375rem) calc(.75em + .375rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + .75rem);background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:var(--bs-form-invalid-border-color)}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");padding-right:4.125rem;background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(.75em + .375rem) calc(.75em + .375rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + .75rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:var(--bs-form-invalid-border-color)}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:var(--bs-form-invalid-color)}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:var(--bs-form-invalid-color)}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-invalid,.input-group>.form-floating:not(:focus-within).is-invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-control:not(:focus):invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.was-validated .input-group>.form-select:not(:focus):invalid{z-index:4}.btn{--bs-btn-padding-x:0.75rem;--bs-btn-padding-y:0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight:400;--bs-btn-line-height:1.5;--bs-btn-color:var(--bs-body-color);--bs-btn-bg:transparent;--bs-btn-border-width:var(--bs-border-width);--bs-btn-border-color:transparent;--bs-btn-border-radius:var(--bs-border-radius);--bs-btn-hover-border-color:transparent;--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15),0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check+.btn:hover{color:var(--bs-btn-color);background-color:var(--bs-btn-bg);border-color:var(--bs-btn-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,.btn.active,.btn.show,.btn:first-child:active,:not(.btn-check)+.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:checked+.btn:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible,.btn:first-child:active:focus-visible,:not(.btn-check)+.btn:active:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked:focus-visible+.btn{box-shadow:var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0b5ed7;--bs-btn-hover-border-color:#0a58ca;--bs-btn-focus-shadow-rgb:49,132,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0a58ca;--bs-btn-active-border-color:#0a53be;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#0d6efd;--bs-btn-disabled-border-color:#0d6efd}.btn-secondary{--bs-btn-color:#fff;--bs-btn-bg:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#5c636a;--bs-btn-hover-border-color:#565e64;--bs-btn-focus-shadow-rgb:130,138,145;--bs-btn-active-color:#fff;--bs-btn-active-bg:#565e64;--bs-btn-active-border-color:#51585e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#6c757d;--bs-btn-disabled-border-color:#6c757d}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#157347;--bs-btn-hover-border-color:#146c43;--bs-btn-focus-shadow-rgb:60,153,110;--bs-btn-active-color:#fff;--bs-btn-active-bg:#146c43;--bs-btn-active-border-color:#13653f;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#198754;--bs-btn-disabled-border-color:#198754}.btn-info{--bs-btn-color:#000;--bs-btn-bg:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#31d2f2;--bs-btn-hover-border-color:#25cff2;--bs-btn-focus-shadow-rgb:11,172,204;--bs-btn-active-color:#000;--bs-btn-active-bg:#3dd5f3;--bs-btn-active-border-color:#25cff2;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#0dcaf0;--bs-btn-disabled-border-color:#0dcaf0}.btn-warning{--bs-btn-color:#000;--bs-btn-bg:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffca2c;--bs-btn-hover-border-color:#ffc720;--bs-btn-focus-shadow-rgb:217,164,6;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffcd39;--bs-btn-active-border-color:#ffc720;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#ffc107;--bs-btn-disabled-border-color:#ffc107}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#bb2d3b;--bs-btn-hover-border-color:#b02a37;--bs-btn-focus-shadow-rgb:225,83,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#b02a37;--bs-btn-active-border-color:#a52834;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#dc3545;--bs-btn-disabled-border-color:#dc3545}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#000;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#424649;--bs-btn-hover-border-color:#373b3e;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#4d5154;--bs-btn-active-border-color:#373b3e;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#0d6efd;--bs-btn-border-color:#0d6efd;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#0d6efd;--bs-btn-hover-border-color:#0d6efd;--bs-btn-focus-shadow-rgb:13,110,253;--bs-btn-active-color:#fff;--bs-btn-active-bg:#0d6efd;--bs-btn-active-border-color:#0d6efd;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0d6efd;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0d6efd;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#6c757d;--bs-btn-border-color:#6c757d;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#6c757d;--bs-btn-hover-border-color:#6c757d;--bs-btn-focus-shadow-rgb:108,117,125;--bs-btn-active-color:#fff;--bs-btn-active-bg:#6c757d;--bs-btn-active-border-color:#6c757d;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#6c757d;--bs-gradient:none}.btn-outline-success{--bs-btn-color:#198754;--bs-btn-border-color:#198754;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#198754;--bs-btn-hover-border-color:#198754;--bs-btn-focus-shadow-rgb:25,135,84;--bs-btn-active-color:#fff;--bs-btn-active-bg:#198754;--bs-btn-active-border-color:#198754;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#198754;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#198754;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#0dcaf0;--bs-btn-border-color:#0dcaf0;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#0dcaf0;--bs-btn-hover-border-color:#0dcaf0;--bs-btn-focus-shadow-rgb:13,202,240;--bs-btn-active-color:#000;--bs-btn-active-bg:#0dcaf0;--bs-btn-active-border-color:#0dcaf0;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#0dcaf0;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#0dcaf0;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#ffc107;--bs-btn-border-color:#ffc107;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#ffc107;--bs-btn-hover-border-color:#ffc107;--bs-btn-focus-shadow-rgb:255,193,7;--bs-btn-active-color:#000;--bs-btn-active-bg:#ffc107;--bs-btn-active-border-color:#ffc107;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#ffc107;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#ffc107;--bs-gradient:none}.btn-outline-danger{--bs-btn-color:#dc3545;--bs-btn-border-color:#dc3545;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#dc3545;--bs-btn-hover-border-color:#dc3545;--bs-btn-focus-shadow-rgb:220,53,69;--bs-btn-active-color:#fff;--bs-btn-active-bg:#dc3545;--bs-btn-active-border-color:#dc3545;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#dc3545;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#dc3545;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#212529;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-color:var(--bs-link-hover-color);--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:0 0 0 #000;--bs-btn-focus-shadow-rgb:49,132,253;text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:var(--bs-border-radius-lg)}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:var(--bs-border-radius-sm)}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex:1000;--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color:var(--bs-body-color);--bs-dropdown-bg:var(--bs-body-bg);--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-border-radius:var(--bs-border-radius);--bs-dropdown-border-width:var(--bs-border-width);--bs-dropdown-inner-border-radius:calc(var(--bs-border-radius) - var(--bs-border-width));--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:var(--bs-box-shadow);--bs-dropdown-link-color:var(--bs-body-color);--bs-dropdown-link-hover-color:var(--bs-body-color);--bs-dropdown-link-hover-bg:var(--bs-tertiary-bg);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:var(--bs-tertiary-color);--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.25rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0;border-radius:var(--bs-dropdown-item-border-radius,0)}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#0d6efd;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:var(--bs-border-radius)}.btn-group>.btn-group:not(:first-child),.btn-group>:not(.btn-check:first-child)+.btn{margin-left:calc(var(--bs-border-width) * -1)}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:calc(var(--bs-border-width) * -1)}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-link-color);--bs-nav-link-hover-color:var(--bs-link-hover-color);--bs-nav-link-disabled-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;background:0 0;border:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:var(--bs-border-width);--bs-nav-tabs-border-color:var(--bs-border-color);--bs-nav-tabs-border-radius:var(--bs-border-radius);--bs-nav-tabs-link-hover-border-color:var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);--bs-nav-tabs-link-active-color:var(--bs-emphasis-color);--bs-nav-tabs-link-active-bg:var(--bs-body-bg);--bs-nav-tabs-link-active-border-color:var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1 * var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:var(--bs-border-radius);--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#0d6efd}.nav-pills .nav-link{border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-underline{--bs-nav-underline-gap:1rem;--bs-nav-underline-border-width:0.125rem;--bs-nav-underline-link-active-color:var(--bs-emphasis-color);gap:var(--bs-nav-underline-gap)}.nav-underline .nav-link{padding-right:0;padding-left:0;border-bottom:var(--bs-nav-underline-border-width) solid transparent}.nav-underline .nav-link:focus,.nav-underline .nav-link:hover{border-bottom-color:currentcolor}.nav-underline .nav-link.active,.nav-underline .show>.nav-link{font-weight:700;color:var(--bs-nav-underline-link-active-color);border-bottom-color:currentcolor}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.5rem;--bs-navbar-color:rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color:rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color:rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-nav-link-padding-x:0.5rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833, 37, 41, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(var(--bs-emphasis-color-rgb), 0.15);--bs-navbar-toggler-border-radius:var(--bs-border-radius);--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark,.navbar[data-bs-theme=dark]{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}[data-bs-theme=dark] .navbar-toggler-icon{--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1rem;--bs-card-title-spacer-y:0.5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width:var(--bs-border-width);--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:var(--bs-border-radius);--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-card-cap-padding-y:0.5rem;--bs-card-cap-padding-x:1rem;--bs-card-cap-bg:rgba(var(--bs-body-color-rgb), 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:var(--bs-body-bg);--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0;color:var(--bs-card-subtitle-color)}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:var(--bs-body-color);--bs-accordion-bg:var(--bs-body-bg);--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:var(--bs-border-width);--bs-accordion-border-radius:var(--bs-border-radius);--bs-accordion-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23212529' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='M2 5L8 11L14 5'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23052c65' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='M2 5L8 11L14 5'/%3e%3c/svg%3e");--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:var(--bs-primary-text-emphasis);--bs-accordion-active-bg:var(--bs-primary-bg-subtle)}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type>.accordion-header .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type>.accordion-header .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type>.accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush>.accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush>.accordion-item:first-child{border-top:0}.accordion-flush>.accordion-item:last-child{border-bottom:0}.accordion-flush>.accordion-item>.accordion-header .accordion-button,.accordion-flush>.accordion-item>.accordion-header .accordion-button.collapsed{border-radius:0}.accordion-flush>.accordion-item>.accordion-collapse{border-radius:0}[data-bs-theme=dark] .accordion-button::after{--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.breadcrumb{--bs-breadcrumb-padding-x:0;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:var(--bs-secondary-color);--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:0.75rem;--bs-pagination-padding-y:0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-link-color);--bs-pagination-bg:var(--bs-body-bg);--bs-pagination-border-width:var(--bs-border-width);--bs-pagination-border-color:var(--bs-border-color);--bs-pagination-border-radius:var(--bs-border-radius);--bs-pagination-hover-color:var(--bs-link-hover-color);--bs-pagination-hover-bg:var(--bs-tertiary-bg);--bs-pagination-hover-border-color:var(--bs-border-color);--bs-pagination-focus-color:var(--bs-link-hover-color);--bs-pagination-focus-bg:var(--bs-secondary-bg);--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#0d6efd;--bs-pagination-active-border-color:#0d6efd;--bs-pagination-disabled-color:var(--bs-secondary-color);--bs-pagination-disabled-bg:var(--bs-secondary-bg);--bs-pagination-disabled-border-color:var(--bs-border-color);display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:calc(var(--bs-border-width) * -1)}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:var(--bs-border-radius-lg)}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:var(--bs-border-radius-sm)}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:var(--bs-border-radius);display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:var(--bs-border-width) solid var(--bs-alert-border-color);--bs-alert-border-radius:var(--bs-border-radius);--bs-alert-link-color:inherit;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700;color:var(--bs-alert-link-color)}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:var(--bs-primary-text-emphasis);--bs-alert-bg:var(--bs-primary-bg-subtle);--bs-alert-border-color:var(--bs-primary-border-subtle);--bs-alert-link-color:var(--bs-primary-text-emphasis)}.alert-secondary{--bs-alert-color:var(--bs-secondary-text-emphasis);--bs-alert-bg:var(--bs-secondary-bg-subtle);--bs-alert-border-color:var(--bs-secondary-border-subtle);--bs-alert-link-color:var(--bs-secondary-text-emphasis)}.alert-success{--bs-alert-color:var(--bs-success-text-emphasis);--bs-alert-bg:var(--bs-success-bg-subtle);--bs-alert-border-color:var(--bs-success-border-subtle);--bs-alert-link-color:var(--bs-success-text-emphasis)}.alert-info{--bs-alert-color:var(--bs-info-text-emphasis);--bs-alert-bg:var(--bs-info-bg-subtle);--bs-alert-border-color:var(--bs-info-border-subtle);--bs-alert-link-color:var(--bs-info-text-emphasis)}.alert-warning{--bs-alert-color:var(--bs-warning-text-emphasis);--bs-alert-bg:var(--bs-warning-bg-subtle);--bs-alert-border-color:var(--bs-warning-border-subtle);--bs-alert-link-color:var(--bs-warning-text-emphasis)}.alert-danger{--bs-alert-color:var(--bs-danger-text-emphasis);--bs-alert-bg:var(--bs-danger-bg-subtle);--bs-alert-border-color:var(--bs-danger-border-subtle);--bs-alert-link-color:var(--bs-danger-text-emphasis)}.alert-light{--bs-alert-color:var(--bs-light-text-emphasis);--bs-alert-bg:var(--bs-light-bg-subtle);--bs-alert-border-color:var(--bs-light-border-subtle);--bs-alert-link-color:var(--bs-light-text-emphasis)}.alert-dark{--bs-alert-color:var(--bs-dark-text-emphasis);--bs-alert-bg:var(--bs-dark-bg-subtle);--bs-alert-border-color:var(--bs-dark-border-subtle);--bs-alert-link-color:var(--bs-dark-text-emphasis)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress,.progress-stacked{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:var(--bs-secondary-bg);--bs-progress-border-radius:var(--bs-border-radius);--bs-progress-box-shadow:var(--bs-box-shadow-inset);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#0d6efd;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-stacked>.progress{overflow:visible}.progress-stacked>.progress>.progress-bar{width:100%}.progress-bar-animated{animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{animation:none}}.list-group{--bs-list-group-color:var(--bs-body-color);--bs-list-group-bg:var(--bs-body-bg);--bs-list-group-border-color:var(--bs-border-color);--bs-list-group-border-width:var(--bs-border-width);--bs-list-group-border-radius:var(--bs-border-radius);--bs-list-group-item-padding-x:1rem;--bs-list-group-item-padding-y:0.5rem;--bs-list-group-action-color:var(--bs-secondary-color);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-tertiary-bg);--bs-list-group-action-active-color:var(--bs-body-color);--bs-list-group-action-active-bg:var(--bs-secondary-bg);--bs-list-group-disabled-color:var(--bs-secondary-color);--bs-list-group-disabled-bg:var(--bs-body-bg);--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#0d6efd;--bs-list-group-active-border-color:#0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1 * var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{--bs-list-group-color:var(--bs-primary-text-emphasis);--bs-list-group-bg:var(--bs-primary-bg-subtle);--bs-list-group-border-color:var(--bs-primary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-primary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-primary-border-subtle);--bs-list-group-active-color:var(--bs-primary-bg-subtle);--bs-list-group-active-bg:var(--bs-primary-text-emphasis);--bs-list-group-active-border-color:var(--bs-primary-text-emphasis)}.list-group-item-secondary{--bs-list-group-color:var(--bs-secondary-text-emphasis);--bs-list-group-bg:var(--bs-secondary-bg-subtle);--bs-list-group-border-color:var(--bs-secondary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-secondary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-secondary-border-subtle);--bs-list-group-active-color:var(--bs-secondary-bg-subtle);--bs-list-group-active-bg:var(--bs-secondary-text-emphasis);--bs-list-group-active-border-color:var(--bs-secondary-text-emphasis)}.list-group-item-success{--bs-list-group-color:var(--bs-success-text-emphasis);--bs-list-group-bg:var(--bs-success-bg-subtle);--bs-list-group-border-color:var(--bs-success-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-success-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-success-border-subtle);--bs-list-group-active-color:var(--bs-success-bg-subtle);--bs-list-group-active-bg:var(--bs-success-text-emphasis);--bs-list-group-active-border-color:var(--bs-success-text-emphasis)}.list-group-item-info{--bs-list-group-color:var(--bs-info-text-emphasis);--bs-list-group-bg:var(--bs-info-bg-subtle);--bs-list-group-border-color:var(--bs-info-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-info-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-info-border-subtle);--bs-list-group-active-color:var(--bs-info-bg-subtle);--bs-list-group-active-bg:var(--bs-info-text-emphasis);--bs-list-group-active-border-color:var(--bs-info-text-emphasis)}.list-group-item-warning{--bs-list-group-color:var(--bs-warning-text-emphasis);--bs-list-group-bg:var(--bs-warning-bg-subtle);--bs-list-group-border-color:var(--bs-warning-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-warning-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-warning-border-subtle);--bs-list-group-active-color:var(--bs-warning-bg-subtle);--bs-list-group-active-bg:var(--bs-warning-text-emphasis);--bs-list-group-active-border-color:var(--bs-warning-text-emphasis)}.list-group-item-danger{--bs-list-group-color:var(--bs-danger-text-emphasis);--bs-list-group-bg:var(--bs-danger-bg-subtle);--bs-list-group-border-color:var(--bs-danger-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-danger-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-danger-border-subtle);--bs-list-group-active-color:var(--bs-danger-bg-subtle);--bs-list-group-active-bg:var(--bs-danger-text-emphasis);--bs-list-group-active-border-color:var(--bs-danger-text-emphasis)}.list-group-item-light{--bs-list-group-color:var(--bs-light-text-emphasis);--bs-list-group-bg:var(--bs-light-bg-subtle);--bs-list-group-border-color:var(--bs-light-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-light-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-light-border-subtle);--bs-list-group-active-color:var(--bs-light-bg-subtle);--bs-list-group-active-bg:var(--bs-light-text-emphasis);--bs-list-group-active-border-color:var(--bs-light-text-emphasis)}.list-group-item-dark{--bs-list-group-color:var(--bs-dark-text-emphasis);--bs-list-group-bg:var(--bs-dark-bg-subtle);--bs-list-group-border-color:var(--bs-dark-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-dark-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-dark-border-subtle);--bs-list-group-active-color:var(--bs-dark-bg-subtle);--bs-list-group-active-bg:var(--bs-dark-text-emphasis);--bs-list-group-active-border-color:var(--bs-dark-text-emphasis)}.btn-close{--bs-btn-close-color:#000;--bs-btn-close-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e");--bs-btn-close-opacity:0.5;--bs-btn-close-hover-opacity:0.75;--bs-btn-close-focus-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-btn-close-focus-opacity:1;--bs-btn-close-disabled-opacity:0.25;--bs-btn-close-white-filter:invert(1) grayscale(100%) brightness(200%);box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:var(--bs-btn-close-color);background:transparent var(--bs-btn-close-bg) center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:var(--bs-btn-close-opacity)}.btn-close:hover{color:var(--bs-btn-close-color);text-decoration:none;opacity:var(--bs-btn-close-hover-opacity)}.btn-close:focus{outline:0;box-shadow:var(--bs-btn-close-focus-shadow);opacity:var(--bs-btn-close-focus-opacity)}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:var(--bs-btn-close-disabled-opacity)}.btn-close-white{filter:var(--bs-btn-close-white-filter)}[data-bs-theme=dark] .btn-close{filter:var(--bs-btn-close-white-filter)}.toast{--bs-toast-zindex:1090;--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-border-width:var(--bs-border-width);--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:var(--bs-border-radius);--bs-toast-box-shadow:var(--bs-box-shadow);--bs-toast-header-color:var(--bs-secondary-color);--bs-toast-header-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-header-border-color:var(--bs-border-color-translucent);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{--bs-toast-zindex:1090;position:absolute;z-index:var(--bs-toast-zindex);width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-.5 * var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:var(--bs-body-bg);--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:var(--bs-border-width);--bs-modal-border-radius:var(--bs-border-radius-lg);--bs-modal-box-shadow:var(--bs-box-shadow-sm);--bs-modal-inner-border-radius:calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:var(--bs-border-width);--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:var(--bs-border-width);position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:var(--bs-box-shadow)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:var(--bs-body-bg);--bs-tooltip-bg:var(--bs-emphasis-color);--bs-tooltip-border-radius:var(--bs-border-radius);--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:var(--bs-body-bg);--bs-popover-border-width:var(--bs-border-width);--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:var(--bs-border-radius-lg);--bs-popover-inner-border-radius:calc(var(--bs-border-radius-lg) - var(--bs-border-width));--bs-popover-box-shadow:var(--bs-box-shadow);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color:inherit;--bs-popover-header-bg:var(--bs-secondary-bg);--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:var(--bs-body-color);--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-.5 * var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}[data-bs-theme=dark] .carousel .carousel-control-next-icon,[data-bs-theme=dark] .carousel .carousel-control-prev-icon,[data-bs-theme=dark].carousel .carousel-control-next-icon,[data-bs-theme=dark].carousel .carousel-control-prev-icon{filter:invert(1) grayscale(100)}[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target],[data-bs-theme=dark].carousel .carousel-indicators [data-bs-target]{background-color:#000}[data-bs-theme=dark] .carousel .carousel-caption,[data-bs-theme=dark].carousel .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-zindex:1045;--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color:var(--bs-body-color);--bs-offcanvas-bg:var(--bs-body-bg);--bs-offcanvas-border-width:var(--bs-border-width);--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:var(--bs-box-shadow-sm);--bs-offcanvas-transition:transform 0.3s ease-in-out;--bs-offcanvas-title-line-height:1.5}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:var(--bs-offcanvas-transition)}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin:calc(-.5 * var(--bs-offcanvas-padding-y)) calc(-.5 * var(--bs-offcanvas-padding-x)) calc(-.5 * var(--bs-offcanvas-padding-y)) auto}.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{animation:placeholder-glow 2s ease-in-out infinite}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;animation:placeholder-wave 2s linear infinite}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(var(--bs-primary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#fff!important;background-color:RGBA(var(--bs-secondary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(var(--bs-success-rgb),var(--bs-bg-opacity,1))!important}.text-bg-info{color:#000!important;background-color:RGBA(var(--bs-info-rgb),var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#000!important;background-color:RGBA(var(--bs-warning-rgb),var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(var(--bs-danger-rgb),var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(var(--bs-light-rgb),var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(var(--bs-dark-rgb),var(--bs-bg-opacity,1))!important}.link-primary{color:RGBA(var(--bs-primary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important}.link-primary:focus,.link-primary:hover{color:RGBA(10,88,202,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(10,88,202,var(--bs-link-underline-opacity,1))!important}.link-secondary{color:RGBA(var(--bs-secondary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important}.link-secondary:focus,.link-secondary:hover{color:RGBA(86,94,100,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(86,94,100,var(--bs-link-underline-opacity,1))!important}.link-success{color:RGBA(var(--bs-success-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important}.link-success:focus,.link-success:hover{color:RGBA(20,108,67,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(20,108,67,var(--bs-link-underline-opacity,1))!important}.link-info{color:RGBA(var(--bs-info-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important}.link-info:focus,.link-info:hover{color:RGBA(61,213,243,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(61,213,243,var(--bs-link-underline-opacity,1))!important}.link-warning{color:RGBA(var(--bs-warning-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important}.link-warning:focus,.link-warning:hover{color:RGBA(255,205,57,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(255,205,57,var(--bs-link-underline-opacity,1))!important}.link-danger{color:RGBA(var(--bs-danger-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important}.link-danger:focus,.link-danger:hover{color:RGBA(176,42,55,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(176,42,55,var(--bs-link-underline-opacity,1))!important}.link-light{color:RGBA(var(--bs-light-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important}.link-light:focus,.link-light:hover{color:RGBA(249,250,251,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important}.link-dark{color:RGBA(var(--bs-dark-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important}.link-dark:focus,.link-dark:hover{color:RGBA(26,30,33,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important}.link-body-emphasis{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-body-emphasis:focus,.link-body-emphasis:hover{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,.75))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important}.focus-ring:focus{outline:0;box-shadow:var(--bs-focus-ring-x,0) var(--bs-focus-ring-y,0) var(--bs-focus-ring-blur,0) var(--bs-focus-ring-width) var(--bs-focus-ring-color)}.icon-link{display:inline-flex;gap:.375rem;align-items:center;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-underline-offset:0.25em;-webkit-backface-visibility:hidden;backface-visibility:hidden}.icon-link>.bi{flex-shrink:0;width:1em;height:1em;fill:currentcolor;transition:.2s ease-in-out transform}@media (prefers-reduced-motion:reduce){.icon-link>.bi{transition:none}}.icon-link-hover:focus-visible>.bi,.icon-link-hover:hover>.bi{transform:var(--bs-icon-link-transform,translate3d(.25em,0,0))}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption),.visually-hidden:not(caption){position:absolute!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:var(--bs-border-width);min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.object-fit-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-none{-o-object-fit:none!important;object-fit:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.overflow-x-auto{overflow-x:auto!important}.overflow-x-hidden{overflow-x:hidden!important}.overflow-x-visible{overflow-x:visible!important}.overflow-x-scroll{overflow-x:scroll!important}.overflow-y-auto{overflow-y:auto!important}.overflow-y-hidden{overflow-y:hidden!important}.overflow-y-visible{overflow-y:visible!important}.overflow-y-scroll{overflow-y:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-inline-grid{display:inline-grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:var(--bs-box-shadow)!important}.shadow-sm{box-shadow:var(--bs-box-shadow-sm)!important}.shadow-lg{box-shadow:var(--bs-box-shadow-lg)!important}.shadow-none{box-shadow:none!important}.focus-ring-primary{--bs-focus-ring-color:rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-secondary{--bs-focus-ring-color:rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-success{--bs-focus-ring-color:rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity))}.focus-ring-info{--bs-focus-ring-color:rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity))}.focus-ring-warning{--bs-focus-ring-color:rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity))}.focus-ring-danger{--bs-focus-ring-color:rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity))}.focus-ring-light{--bs-focus-ring-color:rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity))}.focus-ring-dark{--bs-focus-ring-color:rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity))}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-black{--bs-border-opacity:1;border-color:rgba(var(--bs-black-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-primary-subtle{border-color:var(--bs-primary-border-subtle)!important}.border-secondary-subtle{border-color:var(--bs-secondary-border-subtle)!important}.border-success-subtle{border-color:var(--bs-success-border-subtle)!important}.border-info-subtle{border-color:var(--bs-info-border-subtle)!important}.border-warning-subtle{border-color:var(--bs-warning-border-subtle)!important}.border-danger-subtle{border-color:var(--bs-danger-border-subtle)!important}.border-light-subtle{border-color:var(--bs-light-border-subtle)!important}.border-dark-subtle{border-color:var(--bs-dark-border-subtle)!important}.border-1{border-width:1px!important}.border-2{border-width:2px!important}.border-3{border-width:3px!important}.border-4{border-width:4px!important}.border-5{border-width:5px!important}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.row-gap-0{row-gap:0!important}.row-gap-1{row-gap:.25rem!important}.row-gap-2{row-gap:.5rem!important}.row-gap-3{row-gap:1rem!important}.row-gap-4{row-gap:1.5rem!important}.row-gap-5{row-gap:3rem!important}.column-gap-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-lighter{font-weight:lighter!important}.fw-light{font-weight:300!important}.fw-normal{font-weight:400!important}.fw-medium{font-weight:500!important}.fw-semibold{font-weight:600!important}.fw-bold{font-weight:700!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-body-secondary{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-body-tertiary{--bs-text-opacity:1;color:var(--bs-tertiary-color)!important}.text-body-emphasis{--bs-text-opacity:1;color:var(--bs-emphasis-color)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.text-primary-emphasis{color:var(--bs-primary-text-emphasis)!important}.text-secondary-emphasis{color:var(--bs-secondary-text-emphasis)!important}.text-success-emphasis{color:var(--bs-success-text-emphasis)!important}.text-info-emphasis{color:var(--bs-info-text-emphasis)!important}.text-warning-emphasis{color:var(--bs-warning-text-emphasis)!important}.text-danger-emphasis{color:var(--bs-danger-text-emphasis)!important}.text-light-emphasis{color:var(--bs-light-text-emphasis)!important}.text-dark-emphasis{color:var(--bs-dark-text-emphasis)!important}.link-opacity-10{--bs-link-opacity:0.1}.link-opacity-10-hover:hover{--bs-link-opacity:0.1}.link-opacity-25{--bs-link-opacity:0.25}.link-opacity-25-hover:hover{--bs-link-opacity:0.25}.link-opacity-50{--bs-link-opacity:0.5}.link-opacity-50-hover:hover{--bs-link-opacity:0.5}.link-opacity-75{--bs-link-opacity:0.75}.link-opacity-75-hover:hover{--bs-link-opacity:0.75}.link-opacity-100{--bs-link-opacity:1}.link-opacity-100-hover:hover{--bs-link-opacity:1}.link-offset-1{text-underline-offset:0.125em!important}.link-offset-1-hover:hover{text-underline-offset:0.125em!important}.link-offset-2{text-underline-offset:0.25em!important}.link-offset-2-hover:hover{text-underline-offset:0.25em!important}.link-offset-3{text-underline-offset:0.375em!important}.link-offset-3-hover:hover{text-underline-offset:0.375em!important}.link-underline-primary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-secondary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-success{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important}.link-underline-info{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important}.link-underline-warning{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important}.link-underline-danger{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important}.link-underline-light{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important}.link-underline-dark{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important}.link-underline{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-underline-opacity-0{--bs-link-underline-opacity:0}.link-underline-opacity-0-hover:hover{--bs-link-underline-opacity:0}.link-underline-opacity-10{--bs-link-underline-opacity:0.1}.link-underline-opacity-10-hover:hover{--bs-link-underline-opacity:0.1}.link-underline-opacity-25{--bs-link-underline-opacity:0.25}.link-underline-opacity-25-hover:hover{--bs-link-underline-opacity:0.25}.link-underline-opacity-50{--bs-link-underline-opacity:0.5}.link-underline-opacity-50-hover:hover{--bs-link-underline-opacity:0.5}.link-underline-opacity-75{--bs-link-underline-opacity:0.75}.link-underline-opacity-75-hover:hover{--bs-link-underline-opacity:0.75}.link-underline-opacity-100{--bs-link-underline-opacity:1}.link-underline-opacity-100-hover:hover{--bs-link-underline-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-body-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-bg-rgb),var(--bs-bg-opacity))!important}.bg-body-tertiary{--bs-bg-opacity:1;background-color:rgba(var(--bs-tertiary-bg-rgb),var(--bs-bg-opacity))!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-primary-subtle{background-color:var(--bs-primary-bg-subtle)!important}.bg-secondary-subtle{background-color:var(--bs-secondary-bg-subtle)!important}.bg-success-subtle{background-color:var(--bs-success-bg-subtle)!important}.bg-info-subtle{background-color:var(--bs-info-bg-subtle)!important}.bg-warning-subtle{background-color:var(--bs-warning-bg-subtle)!important}.bg-danger-subtle{background-color:var(--bs-danger-bg-subtle)!important}.bg-light-subtle{background-color:var(--bs-light-bg-subtle)!important}.bg-dark-subtle{background-color:var(--bs-dark-bg-subtle)!important}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-xxl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-0{border-top-left-radius:0!important;border-top-right-radius:0!important}.rounded-top-1{border-top-left-radius:var(--bs-border-radius-sm)!important;border-top-right-radius:var(--bs-border-radius-sm)!important}.rounded-top-2{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-3{border-top-left-radius:var(--bs-border-radius-lg)!important;border-top-right-radius:var(--bs-border-radius-lg)!important}.rounded-top-4{border-top-left-radius:var(--bs-border-radius-xl)!important;border-top-right-radius:var(--bs-border-radius-xl)!important}.rounded-top-5{border-top-left-radius:var(--bs-border-radius-xxl)!important;border-top-right-radius:var(--bs-border-radius-xxl)!important}.rounded-top-circle{border-top-left-radius:50%!important;border-top-right-radius:50%!important}.rounded-top-pill{border-top-left-radius:var(--bs-border-radius-pill)!important;border-top-right-radius:var(--bs-border-radius-pill)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-0{border-top-right-radius:0!important;border-bottom-right-radius:0!important}.rounded-end-1{border-top-right-radius:var(--bs-border-radius-sm)!important;border-bottom-right-radius:var(--bs-border-radius-sm)!important}.rounded-end-2{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-3{border-top-right-radius:var(--bs-border-radius-lg)!important;border-bottom-right-radius:var(--bs-border-radius-lg)!important}.rounded-end-4{border-top-right-radius:var(--bs-border-radius-xl)!important;border-bottom-right-radius:var(--bs-border-radius-xl)!important}.rounded-end-5{border-top-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-right-radius:var(--bs-border-radius-xxl)!important}.rounded-end-circle{border-top-right-radius:50%!important;border-bottom-right-radius:50%!important}.rounded-end-pill{border-top-right-radius:var(--bs-border-radius-pill)!important;border-bottom-right-radius:var(--bs-border-radius-pill)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-0{border-bottom-right-radius:0!important;border-bottom-left-radius:0!important}.rounded-bottom-1{border-bottom-right-radius:var(--bs-border-radius-sm)!important;border-bottom-left-radius:var(--bs-border-radius-sm)!important}.rounded-bottom-2{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-3{border-bottom-right-radius:var(--bs-border-radius-lg)!important;border-bottom-left-radius:var(--bs-border-radius-lg)!important}.rounded-bottom-4{border-bottom-right-radius:var(--bs-border-radius-xl)!important;border-bottom-left-radius:var(--bs-border-radius-xl)!important}.rounded-bottom-5{border-bottom-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-left-radius:var(--bs-border-radius-xxl)!important}.rounded-bottom-circle{border-bottom-right-radius:50%!important;border-bottom-left-radius:50%!important}.rounded-bottom-pill{border-bottom-right-radius:var(--bs-border-radius-pill)!important;border-bottom-left-radius:var(--bs-border-radius-pill)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-0{border-bottom-left-radius:0!important;border-top-left-radius:0!important}.rounded-start-1{border-bottom-left-radius:var(--bs-border-radius-sm)!important;border-top-left-radius:var(--bs-border-radius-sm)!important}.rounded-start-2{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-3{border-bottom-left-radius:var(--bs-border-radius-lg)!important;border-top-left-radius:var(--bs-border-radius-lg)!important}.rounded-start-4{border-bottom-left-radius:var(--bs-border-radius-xl)!important;border-top-left-radius:var(--bs-border-radius-xl)!important}.rounded-start-5{border-bottom-left-radius:var(--bs-border-radius-xxl)!important;border-top-left-radius:var(--bs-border-radius-xxl)!important}.rounded-start-circle{border-bottom-left-radius:50%!important;border-top-left-radius:50%!important}.rounded-start-pill{border-bottom-left-radius:var(--bs-border-radius-pill)!important;border-top-left-radius:var(--bs-border-radius-pill)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}.z-n1{z-index:-1!important}.z-0{z-index:0!important}.z-1{z-index:1!important}.z-2{z-index:2!important}.z-3{z-index:3!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.object-fit-sm-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-sm-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-sm-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-sm-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-sm-none{-o-object-fit:none!important;object-fit:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-inline-grid{display:inline-grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.row-gap-sm-0{row-gap:0!important}.row-gap-sm-1{row-gap:.25rem!important}.row-gap-sm-2{row-gap:.5rem!important}.row-gap-sm-3{row-gap:1rem!important}.row-gap-sm-4{row-gap:1.5rem!important}.row-gap-sm-5{row-gap:3rem!important}.column-gap-sm-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-sm-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-sm-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-sm-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-sm-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-sm-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.object-fit-md-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-md-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-md-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-md-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-md-none{-o-object-fit:none!important;object-fit:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-inline-grid{display:inline-grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.row-gap-md-0{row-gap:0!important}.row-gap-md-1{row-gap:.25rem!important}.row-gap-md-2{row-gap:.5rem!important}.row-gap-md-3{row-gap:1rem!important}.row-gap-md-4{row-gap:1.5rem!important}.row-gap-md-5{row-gap:3rem!important}.column-gap-md-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-md-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-md-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-md-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-md-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-md-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.object-fit-lg-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-lg-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-lg-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-lg-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-lg-none{-o-object-fit:none!important;object-fit:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-inline-grid{display:inline-grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.row-gap-lg-0{row-gap:0!important}.row-gap-lg-1{row-gap:.25rem!important}.row-gap-lg-2{row-gap:.5rem!important}.row-gap-lg-3{row-gap:1rem!important}.row-gap-lg-4{row-gap:1.5rem!important}.row-gap-lg-5{row-gap:3rem!important}.column-gap-lg-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-lg-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-lg-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-lg-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-lg-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-lg-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.object-fit-xl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xl-none{-o-object-fit:none!important;object-fit:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-inline-grid{display:inline-grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.row-gap-xl-0{row-gap:0!important}.row-gap-xl-1{row-gap:.25rem!important}.row-gap-xl-2{row-gap:.5rem!important}.row-gap-xl-3{row-gap:1rem!important}.row-gap-xl-4{row-gap:1.5rem!important}.row-gap-xl-5{row-gap:3rem!important}.column-gap-xl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.object-fit-xxl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xxl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xxl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xxl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xxl-none{-o-object-fit:none!important;object-fit:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-inline-grid{display:inline-grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.row-gap-xxl-0{row-gap:0!important}.row-gap-xxl-1{row-gap:.25rem!important}.row-gap-xxl-2{row-gap:.5rem!important}.row-gap-xxl-3{row-gap:1rem!important}.row-gap-xxl-4{row-gap:1.5rem!important}.row-gap-xxl-5{row-gap:3rem!important}.column-gap-xxl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xxl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xxl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xxl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xxl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xxl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-inline-grid{display:inline-grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}} /*# sourceMappingURL=bootstrap.min.css.map */ \ No newline at end of file diff --git a/web/css/dark.css b/web/css/dark.css index f12fe191..11103506 100644 --- a/web/css/dark.css +++ b/web/css/dark.css @@ -1,54 +1,182 @@ -body { background: #222 url('../img/dark.png'); color: #fff; } -.navbar { min-height: 40px; } -.navbar-brand { color: #FFF !important; padding: 10px; font-size: 20px; } -.dropdown .dropdown-toggle { padding-bottom: 10px; padding-top: 10px; } -.dropdown-menu > li > a { color: #FFF !important; background-color: #222222 !important; } -.dropdown-menu > li > a:hover { color: #FFF !important; background: #000 !important; } -.dropdown-menu { background: #222 !important; background-color: #222222 !important; } -.navbar-inverse .navbar-inner { background-color:#1B1B1B; background-image:-moz-linear-gradient(top, #222222, #111111); background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#222222), to(#111111)); background-image:-webkit-linear-gradient(top, #222222, #111111); background-image:-o-linear-gradient(top, #222222, #111111); background-image:linear-gradient(to bottom, #222222, #111111); background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff222222', endColorstr='#ff111111', GradientType=0); border-color: #252525; } -.content { background: #222; padding: 20px; border-radius: 5px; border: 1px #000 solid; -webkit-box-shadow: 0 1px 10px rgba(0, 0, 0, .1); -moz-box-shadow: 0 1px 10px rgba(0, 0, 0, .1); box-shadow: 0 1px 10px rgba(0, 0, 0, .1); margin-bottom: 20px; } -.table { background: #000; margin-bottom: 0; border-collapse: collapse; border-radius: 3px; } -.table th { text-align: center; } -.table-striped tbody > tr.even > td, .table-striped tbody > tr.even > th { background-color: #2F2F2F; } -.table-striped tbody > tr.odd > td, .table-striped tbody > tr.odd > th { background-color: #000; } -.table td { text-align: center; border-color: #2F2F2F; } -.progress { margin-bottom: 0; background: #222; } -.table-hover > tbody > tr:hover > td { background: #414141; } -tr.even.expandRow > :hover { background: #2F2F2F !important; } -tr.odd.expandRow > :hover { background: #000 !important; } -.expandRow > td { padding: 0 !important; border-top: 0px !important; } -#cpu, #ram, #hdd, #network { min-width: 55px; max-width: 100px; } -#ping { min-width: 55px; max-width: 130px; } - -@media only screen and (max-width: 992px) { - #location, tr td:nth-child(5) { display:none; visibility:hidden; } +body { + background: #212e36 url('../img/dark.png') repeat; + color: #dcdcdc; + font-size: 15px; + padding-top: 70px; + padding-bottom: 30px; } + +.navbar { + min-height: 40px; + background-color: #1B1B1B; +} + +.navbar-brand { + color: #FFF !important; + padding: 10px; + font-size: 20px; +} + +.dropdown .dropdown-toggle { + padding-bottom: 10px; + padding-top: 10px; +} + +.dropdown-menu > li > a { + color: #FFF !important; + background-color: #222222 !important; +} + +.dropdown-menu > li > a:hover { + color: #FFF !important; + background: #000 !important; +} + +.dropdown-menu { + background: #222 !important; + background-color: #222222 !important; +} + +.navbar-inverse .navbar-inner { + background-color: #1B1B1B; + background-image: linear-gradient(to bottom, #212e36, #212e36); + background-repeat: repeat-x; + border-color: #252525; +} + +.content { + background: #212e36; + padding: 20px; + border-radius: 5px; + border: 1px solid #212e36; + box-shadow: 0 0px 0px rgba(0, 0, 0, 0); + margin-bottom: 20px; +} + +.table { + background-color: #212e36 !important; + margin-bottom: 0; + border-collapse: collapse; + border-radius: 3px; + width: 100%; +} + +.table th, .table td { + background-color: #212e36 !important; + color: #dcdcdc !important; + text-align: center; + padding: 8px; +} + +.table-striped tbody tr:nth-child(even) { + background-color: #212e36; +} + +.table-striped tbody tr:nth-child(odd) { + background-color: #212e36; +} + +.progress { + margin-bottom: 0; + background: #363b40; +} + +.progress-bar { + overflow: visible; +} + +.table-hover tbody tr:hover td { + background: #414141; +} + +tr.even.expandRow:hover { + background: #212e36 !important; +} + +tr.odd.expandRow:hover { + background: #212e36 !important; +} + +.expandRow td { + padding: 0 !important; + border-top: 0 !important; +} + +#month_traffic { + min-width: 85px; + max-width: 95px; +} + +#traffic, #network { + width: 165px; +} + +#cpu, #ram, #hdd { + min-width: 45px; + max-width: 68px; +} + +#ping { + width: 115px; +} + +@media only screen and (max-width: 1200px) { + body { + font-size: 10px; + } + + .content { + padding: 0; + } + #traffic, #network { + width: 115px; + } + #type, #location, #uptime, #ping { + display: none; + visibility: hidden; + } +} + @media only screen and (max-width: 720px) { - #type, tr td:nth-child(4) { display:none; visibility:hidden; } - #location, tr td:nth-child(5) { display:none; visibility:hidden; } - #ping, tr td:nth-child(13) { display:none; visibility:hidden; } -} -@media only screen and (max-width: 600px) { - #type, tr td:nth-child(4) { display:none; visibility:hidden; } - #location, tr td:nth-child(5) { display:none; visibility:hidden; } - #uptime, tr td:nth-child(6) { display:none; visibility:hidden; } - #ping, tr td:nth-child(13) { display:none; visibility:hidden; } -} -@media only screen and (max-width: 533px) { - #type, tr td:nth-child(4) { display:none; visibility:hidden; } - #location, tr td:nth-child(5) { display:none; visibility:hidden; } - #uptime, tr td:nth-child(6) { display:none; visibility:hidden; } - #network, tr td:nth-child(8) { display:none; visibility:hidden; } - #ping, tr td:nth-child(13) { display:none; visibility:hidden; } -} -@media only screen and (max-width: 450px) { - body { font-size: 10px; } - .content { padding: 0; } - #name, tr td:nth-child(3) { min-width: 55px; max-width: 85px; text-overflow: ellipsis; white-space: nowrap; overflow: hidden; } - #type, tr td:nth-child(4) { display:none; visibility:hidden; } - #location, tr td:nth-child(5) { display:none; visibility:hidden; } - #uptime, tr td:nth-child(6) { display:none; visibility:hidden; } - #network, tr td:nth-child(8) { display:none; visibility:hidden; } - #cpu, #ram, #hdd { min-width: 25px; max-width: 50px; } - #ping, tr td:nth-child(13) { display:none; visibility:hidden; } -} \ No newline at end of file + body { + font-size: 10px; + } + + .content { + padding: 0; + } + #traffic, #network { + width: 115px; + } + #month_traffic, #type, #location, #uptime, #ping { + display: none; + visibility: hidden; + } +} + +@media only screen and (max-width: 620px) { + body { + font-size: 10px; + } + + .content { + padding: 0; + } + #network { + width: 115px; + } + #month_traffic, #type, #location, #uptime, #traffic, #ping { + display: none; + visibility: hidden; + } +} + +.navbar-nav .nav-link { + padding-top: 0.5rem; + padding-bottom: 0.5rem; + line-height: 1.5; +} + +.navbar-nav .dropdown-toggle::after { + vertical-align: 0.15em; +} diff --git a/web/css/light.css b/web/css/light.css index b10abfd5..b2ca0284 100644 --- a/web/css/light.css +++ b/web/css/light.css @@ -1,51 +1,163 @@ -body { background: #ebebeb url('../img/light.png'); } -.navbar { min-height: 40px; } -.navbar-brand { color: #fff; padding: 10px; font-size: 20px; } -.dropdown .dropdown-toggle { padding-bottom: 10px; padding-top: 10px; } -.navbar-inverse .navbar-brand { color: #fff; padding: 10px; font-size: 20px; } -.content { background: #ffffff; padding: 20px; border-radius: 5px; border: 1px #cecece solid; -webkit-box-shadow: 0 1px 10px rgba(0, 0, 0, .1); -moz-box-shadow: 0 1px 10px rgba(0, 0, 0, .1); box-shadow: 0 1px 10px rgba(0, 0, 0, .1); margin-bottom: 20px; } -.table { background: #ffffff; margin-bottom: 0; border-collapse: collapse; border-radius: 3px; } -.table th, .table td { text-align: center; } -.table-striped tbody > tr.even > td, .table-striped tbody > tr.even > th { background-color: #F9F9F9; } -.table-striped tbody > tr.odd > td, .table-striped tbody > tr.odd > th { background-color: #FFF; } -.progress { margin-bottom: 0; } -.progress-bar { color: #000; } -.table-hover > tbody > tr:hover > td { background: #E6E6E6; } -tr.even.expandRow > :hover { background: #F9F9F9 !important; } -tr.odd.expandRow > :hover { background: #FFF !important; } -.expandRow > td { padding: 0 !important; border-top: 0px !important; } -#cpu, #ram, #hdd, #network { min-width: 55px; max-width: 100px; } -#ping { min-width: 55px; max-width: 130px; } - -@media only screen and (max-width: 992px) { - #location, tr td:nth-child(5) { display:none; visibility:hidden; } +body { + background: #ebebeb url('../img/light.png') repeat; + font-size: 15px; + padding-top: 70px; + padding-bottom: 30px; } + +.navbar { + min-height: 40px; + background-color: #333; +} + +.navbar-brand { + color: #fff; + padding: 10px; + font-size: 20px; +} + +.dropdown .dropdown-toggle { + padding-bottom: 10px; + padding-top: 10px; +} + +.navbar-inverse .navbar-brand { + color: #fff; + padding: 10px; + font-size: 20px; +} + +.content { + background: #ffffff; + padding: 20px; + border-radius: 5px; + border: 1px solid #cecece; + box-shadow: 0 1px 10px rgba(0, 0, 0, .1); + margin-bottom: 20px; +} + +.table { + background: #ffffff; + margin-bottom: 0; + border-collapse: collapse; + border-radius: 3px; + width: 100%; +} + +.table th, .table td { + text-align: center; + padding: 8px; +} + +.table-striped tbody tr:nth-child(even) { + background-color: #F9F9F9; +} + +.table-striped tbody tr:nth-child(odd) { + background-color: #FFF; +} + +.progress { + margin-bottom: 0; +} + +.progress-bar { + color: #000; + overflow: visible; +} + +.table-hover tbody tr:hover td { + background: #E6E6E6; +} + +tr.even.expandRow:hover { + background: #F9F9F9 !important; +} + +tr.odd.expandRow:hover { + background: #FFF !important; +} + +.expandRow td { + padding: 0 !important; + border-top: 0 !important; +} + +#month_traffic { + min-width: 85px; + max-width: 95px; +} + +#traffic, #network { + width: 165px; +} + +#cpu, #ram, #hdd { + min-width: 45px; + max-width: 68px; +} + +#ping { + width: 115px; +} + +@media only screen and (max-width: 1200px) { + body { + font-size: 10px; + } + + .content { + padding: 0; + } + #traffic, #network { + width: 115px; + } + #type, #location, #uptime, #ping { + display: none; + visibility: hidden; + } +} + @media only screen and (max-width: 720px) { - #type, tr td:nth-child(4) { display:none; visibility:hidden; } - #location, tr td:nth-child(5) { display:none; visibility:hidden; } - #ping, tr td:nth-child(13) { display:none; visibility:hidden; } -} -@media only screen and (max-width: 600px) { - #type, tr td:nth-child(4) { display:none; visibility:hidden; } - #location, tr td:nth-child(5) { display:none; visibility:hidden; } - #uptime, tr td:nth-child(6) { display:none; visibility:hidden; } - #ping, tr td:nth-child(13) { display:none; visibility:hidden; } -} -@media only screen and (max-width: 533px) { - #type, tr td:nth-child(4) { display:none; visibility:hidden; } - #location, tr td:nth-child(5) { display:none; visibility:hidden; } - #uptime, tr td:nth-child(6) { display:none; visibility:hidden; } - #network, tr td:nth-child(8) { display:none; visibility:hidden; } - #ping, tr td:nth-child(13) { display:none; visibility:hidden; } -} -@media only screen and (max-width: 450px) { - body { font-size: 10px; } - .content { padding: 0; } - #name, tr td:nth-child(3) { min-width: 55px; max-width: 85px; text-overflow: ellipsis; white-space: nowrap; overflow: hidden; } - #type, tr td:nth-child(4) { display:none; visibility:hidden; } - #location, tr td:nth-child(5) { display:none; visibility:hidden; } - #uptime, tr td:nth-child(6) { display:none; visibility:hidden; } - #network, tr td:nth-child(8) { display:none; visibility:hidden; } - #cpu, #ram, #hdd { min-width: 25px; max-width: 50px; } - #ping, tr td:nth-child(13) { display:none; visibility:hidden; } -} \ No newline at end of file + body { + font-size: 10px; + } + + .content { + padding: 0; + } + #traffic, #network { + width: 115px; + } + #month_traffic, #type, #location, #uptime, #ping { + display: none; + visibility: hidden; + } +} + +@media only screen and (max-width: 620px) { + body { + font-size: 10px; + } + + .content { + padding: 0; + } + #network { + width: 115px; + } + #month_traffic, #type, #location, #uptime, #traffic, #ping { + display: none; + visibility: hidden; + } +} + +.navbar-nav .nav-link { + padding-top: 0.5rem; + padding-bottom: 0.5rem; + line-height: 1.5; +} + +.navbar-nav .dropdown-toggle::after { + vertical-align: 0.15em; +} diff --git a/web/image/flags/ac.svg b/web/image/flags/ac.svg new file mode 100644 index 00000000..1a6d5080 --- /dev/null +++ b/web/image/flags/ac.svg @@ -0,0 +1,76 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/ad.svg b/web/image/flags/ad.svg new file mode 100644 index 00000000..726f981b --- /dev/null +++ b/web/image/flags/ad.svg @@ -0,0 +1,150 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/ae.svg b/web/image/flags/ae.svg new file mode 100644 index 00000000..b7acdbdb --- /dev/null +++ b/web/image/flags/ae.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/af.svg b/web/image/flags/af.svg new file mode 100644 index 00000000..6e755396 --- /dev/null +++ b/web/image/flags/af.svg @@ -0,0 +1,81 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/ag.svg b/web/image/flags/ag.svg new file mode 100644 index 00000000..3bce7482 --- /dev/null +++ b/web/image/flags/ag.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/web/image/flags/ai.svg b/web/image/flags/ai.svg new file mode 100644 index 00000000..cf91b39b --- /dev/null +++ b/web/image/flags/ai.svg @@ -0,0 +1,758 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/al.svg b/web/image/flags/al.svg new file mode 100644 index 00000000..4e7098f3 --- /dev/null +++ b/web/image/flags/al.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/am.svg b/web/image/flags/am.svg new file mode 100644 index 00000000..99fa4dc5 --- /dev/null +++ b/web/image/flags/am.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/ao.svg b/web/image/flags/ao.svg new file mode 100644 index 00000000..4dc39f6a --- /dev/null +++ b/web/image/flags/ao.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/aq.svg b/web/image/flags/aq.svg new file mode 100644 index 00000000..53840ccc --- /dev/null +++ b/web/image/flags/aq.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/ar.svg b/web/image/flags/ar.svg new file mode 100644 index 00000000..d1810f25 --- /dev/null +++ b/web/image/flags/ar.svg @@ -0,0 +1,32 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/as.svg b/web/image/flags/as.svg new file mode 100644 index 00000000..88e2ca5d --- /dev/null +++ b/web/image/flags/as.svg @@ -0,0 +1,72 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/at.svg b/web/image/flags/at.svg new file mode 100644 index 00000000..c2825088 --- /dev/null +++ b/web/image/flags/at.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/au.svg b/web/image/flags/au.svg new file mode 100644 index 00000000..407fef43 --- /dev/null +++ b/web/image/flags/au.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/aw.svg b/web/image/flags/aw.svg new file mode 100644 index 00000000..e840233b --- /dev/null +++ b/web/image/flags/aw.svg @@ -0,0 +1,186 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/ax.svg b/web/image/flags/ax.svg new file mode 100644 index 00000000..9f04648b --- /dev/null +++ b/web/image/flags/ax.svg @@ -0,0 +1,18 @@ + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/az.svg b/web/image/flags/az.svg new file mode 100644 index 00000000..8e56ef53 --- /dev/null +++ b/web/image/flags/az.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/ba.svg b/web/image/flags/ba.svg new file mode 100644 index 00000000..7c304215 --- /dev/null +++ b/web/image/flags/ba.svg @@ -0,0 +1,12 @@ + + + + + + + + + + + + diff --git a/web/image/flags/bb.svg b/web/image/flags/bb.svg new file mode 100644 index 00000000..420a6885 --- /dev/null +++ b/web/image/flags/bb.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/bd.svg b/web/image/flags/bd.svg new file mode 100644 index 00000000..16b794de --- /dev/null +++ b/web/image/flags/bd.svg @@ -0,0 +1,4 @@ + + + + diff --git a/web/image/flags/be.svg b/web/image/flags/be.svg new file mode 100644 index 00000000..327f28fa --- /dev/null +++ b/web/image/flags/be.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/bf.svg b/web/image/flags/bf.svg new file mode 100644 index 00000000..47138225 --- /dev/null +++ b/web/image/flags/bf.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/bg.svg b/web/image/flags/bg.svg new file mode 100644 index 00000000..b100dd0d --- /dev/null +++ b/web/image/flags/bg.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/bh.svg b/web/image/flags/bh.svg new file mode 100644 index 00000000..7a2ea549 --- /dev/null +++ b/web/image/flags/bh.svg @@ -0,0 +1,4 @@ + + + + diff --git a/web/image/flags/bi.svg b/web/image/flags/bi.svg new file mode 100644 index 00000000..a37bc67f --- /dev/null +++ b/web/image/flags/bi.svg @@ -0,0 +1,15 @@ + + + + + + + + + + + + + + + diff --git a/web/image/flags/bj.svg b/web/image/flags/bj.svg new file mode 100644 index 00000000..871c57ee --- /dev/null +++ b/web/image/flags/bj.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/web/image/flags/bl.svg b/web/image/flags/bl.svg new file mode 100644 index 00000000..15803ff9 --- /dev/null +++ b/web/image/flags/bl.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/bm.svg b/web/image/flags/bm.svg new file mode 100644 index 00000000..330d5ec3 --- /dev/null +++ b/web/image/flags/bm.svg @@ -0,0 +1,97 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/bn.svg b/web/image/flags/bn.svg new file mode 100644 index 00000000..19f15fa5 --- /dev/null +++ b/web/image/flags/bn.svg @@ -0,0 +1,36 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/bo.svg b/web/image/flags/bo.svg new file mode 100644 index 00000000..391e2267 --- /dev/null +++ b/web/image/flags/bo.svg @@ -0,0 +1,676 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/bq.svg b/web/image/flags/bq.svg new file mode 100644 index 00000000..0e6bc76e --- /dev/null +++ b/web/image/flags/bq.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/br.svg b/web/image/flags/br.svg new file mode 100644 index 00000000..354a7013 --- /dev/null +++ b/web/image/flags/br.svg @@ -0,0 +1,45 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/bs.svg b/web/image/flags/bs.svg new file mode 100644 index 00000000..b26d4769 --- /dev/null +++ b/web/image/flags/bs.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/bt.svg b/web/image/flags/bt.svg new file mode 100644 index 00000000..cea6006c --- /dev/null +++ b/web/image/flags/bt.svg @@ -0,0 +1,89 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/bv.svg b/web/image/flags/bv.svg new file mode 100644 index 00000000..86431fcc --- /dev/null +++ b/web/image/flags/bv.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/bw.svg b/web/image/flags/bw.svg new file mode 100644 index 00000000..a1c8db0a --- /dev/null +++ b/web/image/flags/bw.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/by.svg b/web/image/flags/by.svg new file mode 100644 index 00000000..20ae52bd --- /dev/null +++ b/web/image/flags/by.svg @@ -0,0 +1,20 @@ + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/bz.svg b/web/image/flags/bz.svg new file mode 100644 index 00000000..fbc6d7cb --- /dev/null +++ b/web/image/flags/bz.svg @@ -0,0 +1,145 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/ca.svg b/web/image/flags/ca.svg new file mode 100644 index 00000000..f1b2c968 --- /dev/null +++ b/web/image/flags/ca.svg @@ -0,0 +1,4 @@ + + + + diff --git a/web/image/flags/cc.svg b/web/image/flags/cc.svg new file mode 100644 index 00000000..c4457dee --- /dev/null +++ b/web/image/flags/cc.svg @@ -0,0 +1,19 @@ + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/cd.svg b/web/image/flags/cd.svg new file mode 100644 index 00000000..e106ddd5 --- /dev/null +++ b/web/image/flags/cd.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/cefta.svg b/web/image/flags/cefta.svg new file mode 100644 index 00000000..d66e18be --- /dev/null +++ b/web/image/flags/cefta.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/cf.svg b/web/image/flags/cf.svg new file mode 100644 index 00000000..fd30063c --- /dev/null +++ b/web/image/flags/cf.svg @@ -0,0 +1,15 @@ + + + + + + + + + + + + + + + diff --git a/web/image/flags/cg.svg b/web/image/flags/cg.svg new file mode 100644 index 00000000..a2902345 --- /dev/null +++ b/web/image/flags/cg.svg @@ -0,0 +1,12 @@ + + + + + + + + + + + + diff --git a/web/image/flags/ch.svg b/web/image/flags/ch.svg new file mode 100644 index 00000000..b42d6709 --- /dev/null +++ b/web/image/flags/ch.svg @@ -0,0 +1,9 @@ + + + + + + + + + diff --git a/web/image/flags/ci.svg b/web/image/flags/ci.svg new file mode 100644 index 00000000..e400f0c1 --- /dev/null +++ b/web/image/flags/ci.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/ck.svg b/web/image/flags/ck.svg new file mode 100644 index 00000000..18e547b1 --- /dev/null +++ b/web/image/flags/ck.svg @@ -0,0 +1,9 @@ + + + + + + + + + diff --git a/web/image/flags/cl.svg b/web/image/flags/cl.svg new file mode 100644 index 00000000..50218c82 --- /dev/null +++ b/web/image/flags/cl.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/cm.svg b/web/image/flags/cm.svg new file mode 100644 index 00000000..d06f6560 --- /dev/null +++ b/web/image/flags/cm.svg @@ -0,0 +1,15 @@ + + + + + + + + + + + + + + + diff --git a/web/image/flags/cn.svg b/web/image/flags/cn.svg new file mode 100644 index 00000000..24162360 --- /dev/null +++ b/web/image/flags/cn.svg @@ -0,0 +1,11 @@ + + + + + + + + + + + diff --git a/web/image/flags/co.svg b/web/image/flags/co.svg new file mode 100644 index 00000000..ebd0a0fb --- /dev/null +++ b/web/image/flags/co.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/cp.svg b/web/image/flags/cp.svg new file mode 100644 index 00000000..b3efb074 --- /dev/null +++ b/web/image/flags/cp.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/cr.svg b/web/image/flags/cr.svg new file mode 100644 index 00000000..5a409eeb --- /dev/null +++ b/web/image/flags/cr.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/cu.svg b/web/image/flags/cu.svg new file mode 100644 index 00000000..31cf99c2 --- /dev/null +++ b/web/image/flags/cu.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/cv.svg b/web/image/flags/cv.svg new file mode 100644 index 00000000..381985a7 --- /dev/null +++ b/web/image/flags/cv.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/cw.svg b/web/image/flags/cw.svg new file mode 100644 index 00000000..4294b5bc --- /dev/null +++ b/web/image/flags/cw.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/web/image/flags/cx.svg b/web/image/flags/cx.svg new file mode 100644 index 00000000..39fa9b07 --- /dev/null +++ b/web/image/flags/cx.svg @@ -0,0 +1,15 @@ + + + + + + + + + + + + + + + diff --git a/web/image/flags/cy.svg b/web/image/flags/cy.svg new file mode 100644 index 00000000..b72473ab --- /dev/null +++ b/web/image/flags/cy.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/cz.svg b/web/image/flags/cz.svg new file mode 100644 index 00000000..7913de38 --- /dev/null +++ b/web/image/flags/cz.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/de.svg b/web/image/flags/de.svg new file mode 100644 index 00000000..b08334b6 --- /dev/null +++ b/web/image/flags/de.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/dg.svg b/web/image/flags/dg.svg new file mode 100644 index 00000000..8ba67509 --- /dev/null +++ b/web/image/flags/dg.svg @@ -0,0 +1,129 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/dj.svg b/web/image/flags/dj.svg new file mode 100644 index 00000000..674d7ef4 --- /dev/null +++ b/web/image/flags/dj.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/dk.svg b/web/image/flags/dk.svg new file mode 100644 index 00000000..563277f8 --- /dev/null +++ b/web/image/flags/dk.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/dm.svg b/web/image/flags/dm.svg new file mode 100644 index 00000000..7fa4dd8a --- /dev/null +++ b/web/image/flags/dm.svg @@ -0,0 +1,152 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/do.svg b/web/image/flags/do.svg new file mode 100644 index 00000000..e8114b32 --- /dev/null +++ b/web/image/flags/do.svg @@ -0,0 +1,6745 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/dz.svg b/web/image/flags/dz.svg new file mode 100644 index 00000000..5ff29a74 --- /dev/null +++ b/web/image/flags/dz.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/ea.svg b/web/image/flags/ea.svg new file mode 100644 index 00000000..d55c9b6c --- /dev/null +++ b/web/image/flags/ea.svg @@ -0,0 +1,544 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/ec.svg b/web/image/flags/ec.svg new file mode 100644 index 00000000..65b78858 --- /dev/null +++ b/web/image/flags/ec.svg @@ -0,0 +1,138 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/ee.svg b/web/image/flags/ee.svg new file mode 100644 index 00000000..36ea288c --- /dev/null +++ b/web/image/flags/ee.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/eg.svg b/web/image/flags/eg.svg new file mode 100644 index 00000000..728538ba --- /dev/null +++ b/web/image/flags/eg.svg @@ -0,0 +1,38 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/eh.svg b/web/image/flags/eh.svg new file mode 100644 index 00000000..87433715 --- /dev/null +++ b/web/image/flags/eh.svg @@ -0,0 +1,16 @@ + + + + + + + + + + + + + + + + diff --git a/web/image/flags/er.svg b/web/image/flags/er.svg new file mode 100644 index 00000000..2705295f --- /dev/null +++ b/web/image/flags/er.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/es-ct.svg b/web/image/flags/es-ct.svg new file mode 100644 index 00000000..4d859114 --- /dev/null +++ b/web/image/flags/es-ct.svg @@ -0,0 +1,4 @@ + + + + diff --git a/web/image/flags/es-ga.svg b/web/image/flags/es-ga.svg new file mode 100644 index 00000000..cc52c846 --- /dev/null +++ b/web/image/flags/es-ga.svg @@ -0,0 +1,187 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/es.svg b/web/image/flags/es.svg new file mode 100644 index 00000000..815e0f84 --- /dev/null +++ b/web/image/flags/es.svg @@ -0,0 +1,544 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/et.svg b/web/image/flags/et.svg new file mode 100644 index 00000000..7075040b --- /dev/null +++ b/web/image/flags/et.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/web/image/flags/eu.svg b/web/image/flags/eu.svg new file mode 100644 index 00000000..1bb04ecb --- /dev/null +++ b/web/image/flags/eu.svg @@ -0,0 +1,28 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/fi.svg b/web/image/flags/fi.svg new file mode 100644 index 00000000..470be2d0 --- /dev/null +++ b/web/image/flags/fi.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/fj.svg b/web/image/flags/fj.svg new file mode 100644 index 00000000..2d7cd980 --- /dev/null +++ b/web/image/flags/fj.svg @@ -0,0 +1,120 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/fk.svg b/web/image/flags/fk.svg new file mode 100644 index 00000000..8aeee57c --- /dev/null +++ b/web/image/flags/fk.svg @@ -0,0 +1,90 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/fm.svg b/web/image/flags/fm.svg new file mode 100644 index 00000000..baa96683 --- /dev/null +++ b/web/image/flags/fm.svg @@ -0,0 +1,11 @@ + + + + + + + + + + + diff --git a/web/image/flags/fo.svg b/web/image/flags/fo.svg new file mode 100644 index 00000000..898f6695 --- /dev/null +++ b/web/image/flags/fo.svg @@ -0,0 +1,12 @@ + + + + + + + + + + + + diff --git a/web/image/flags/fr.svg b/web/image/flags/fr.svg new file mode 100644 index 00000000..1be61911 --- /dev/null +++ b/web/image/flags/fr.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/ga.svg b/web/image/flags/ga.svg new file mode 100644 index 00000000..76edab42 --- /dev/null +++ b/web/image/flags/ga.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/gb-eng.svg b/web/image/flags/gb-eng.svg new file mode 100644 index 00000000..12e3b67d --- /dev/null +++ b/web/image/flags/gb-eng.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/gb-nir.svg b/web/image/flags/gb-nir.svg new file mode 100644 index 00000000..e34b224b --- /dev/null +++ b/web/image/flags/gb-nir.svg @@ -0,0 +1,132 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/gb-sct.svg b/web/image/flags/gb-sct.svg new file mode 100644 index 00000000..f50cd322 --- /dev/null +++ b/web/image/flags/gb-sct.svg @@ -0,0 +1,4 @@ + + + + diff --git a/web/image/flags/gb-wls.svg b/web/image/flags/gb-wls.svg new file mode 100644 index 00000000..6e15fd01 --- /dev/null +++ b/web/image/flags/gb-wls.svg @@ -0,0 +1,9 @@ + + + + + + + + + diff --git a/web/image/flags/gb.svg b/web/image/flags/gb.svg new file mode 100644 index 00000000..dbac25ea --- /dev/null +++ b/web/image/flags/gb.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/gd.svg b/web/image/flags/gd.svg new file mode 100644 index 00000000..dad1107f --- /dev/null +++ b/web/image/flags/gd.svg @@ -0,0 +1,27 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/ge.svg b/web/image/flags/ge.svg new file mode 100644 index 00000000..453898b0 --- /dev/null +++ b/web/image/flags/ge.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/gf.svg b/web/image/flags/gf.svg new file mode 100644 index 00000000..f8752d9e --- /dev/null +++ b/web/image/flags/gf.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/gg.svg b/web/image/flags/gg.svg new file mode 100644 index 00000000..e40a8387 --- /dev/null +++ b/web/image/flags/gg.svg @@ -0,0 +1,9 @@ + + + + + + + + + diff --git a/web/image/flags/gh.svg b/web/image/flags/gh.svg new file mode 100644 index 00000000..a6497de8 --- /dev/null +++ b/web/image/flags/gh.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/gi.svg b/web/image/flags/gi.svg new file mode 100644 index 00000000..64a69e8b --- /dev/null +++ b/web/image/flags/gi.svg @@ -0,0 +1,32 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/gl.svg b/web/image/flags/gl.svg new file mode 100644 index 00000000..eb5a52e9 --- /dev/null +++ b/web/image/flags/gl.svg @@ -0,0 +1,4 @@ + + + + diff --git a/web/image/flags/gm.svg b/web/image/flags/gm.svg new file mode 100644 index 00000000..2fbcb196 --- /dev/null +++ b/web/image/flags/gm.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/web/image/flags/gn.svg b/web/image/flags/gn.svg new file mode 100644 index 00000000..40d6ad4f --- /dev/null +++ b/web/image/flags/gn.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/gp.svg b/web/image/flags/gp.svg new file mode 100644 index 00000000..1b381588 --- /dev/null +++ b/web/image/flags/gp.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/gq.svg b/web/image/flags/gq.svg new file mode 100644 index 00000000..ba2acf28 --- /dev/null +++ b/web/image/flags/gq.svg @@ -0,0 +1,23 @@ + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/gr.svg b/web/image/flags/gr.svg new file mode 100644 index 00000000..599741ee --- /dev/null +++ b/web/image/flags/gr.svg @@ -0,0 +1,16 @@ + + + + + + + + + + + + + + + + diff --git a/web/image/flags/gs.svg b/web/image/flags/gs.svg new file mode 100644 index 00000000..7e0692c1 --- /dev/null +++ b/web/image/flags/gs.svg @@ -0,0 +1,133 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/gt.svg b/web/image/flags/gt.svg new file mode 100644 index 00000000..be453241 --- /dev/null +++ b/web/image/flags/gt.svg @@ -0,0 +1,220 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/gu.svg b/web/image/flags/gu.svg new file mode 100644 index 00000000..a5584ffd --- /dev/null +++ b/web/image/flags/gu.svg @@ -0,0 +1,23 @@ + + + + + + + + + + G + U + A + M + + + + + + + + + + diff --git a/web/image/flags/gw.svg b/web/image/flags/gw.svg new file mode 100644 index 00000000..9e0aeebd --- /dev/null +++ b/web/image/flags/gw.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/gy.svg b/web/image/flags/gy.svg new file mode 100644 index 00000000..f4d9b8ab --- /dev/null +++ b/web/image/flags/gy.svg @@ -0,0 +1,9 @@ + + + + + + + + + diff --git a/web/image/flags/hk.svg b/web/image/flags/hk.svg new file mode 100644 index 00000000..e32924f1 --- /dev/null +++ b/web/image/flags/hk.svg @@ -0,0 +1,30 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/hm.svg b/web/image/flags/hm.svg new file mode 100644 index 00000000..c0748d3b --- /dev/null +++ b/web/image/flags/hm.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/hn.svg b/web/image/flags/hn.svg new file mode 100644 index 00000000..6f929500 --- /dev/null +++ b/web/image/flags/hn.svg @@ -0,0 +1,18 @@ + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/hr.svg b/web/image/flags/hr.svg new file mode 100644 index 00000000..70115ae9 --- /dev/null +++ b/web/image/flags/hr.svg @@ -0,0 +1,58 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/ht.svg b/web/image/flags/ht.svg new file mode 100644 index 00000000..9cddb293 --- /dev/null +++ b/web/image/flags/ht.svg @@ -0,0 +1,116 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/hu.svg b/web/image/flags/hu.svg new file mode 100644 index 00000000..baddf7f5 --- /dev/null +++ b/web/image/flags/hu.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/ic.svg b/web/image/flags/ic.svg new file mode 100644 index 00000000..81e6ee2e --- /dev/null +++ b/web/image/flags/ic.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/id.svg b/web/image/flags/id.svg new file mode 100644 index 00000000..3b7c8fcf --- /dev/null +++ b/web/image/flags/id.svg @@ -0,0 +1,4 @@ + + + + diff --git a/web/image/flags/ie.svg b/web/image/flags/ie.svg new file mode 100644 index 00000000..049be14d --- /dev/null +++ b/web/image/flags/ie.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/il.svg b/web/image/flags/il.svg new file mode 100644 index 00000000..d9d82135 --- /dev/null +++ b/web/image/flags/il.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/web/image/flags/im.svg b/web/image/flags/im.svg new file mode 100644 index 00000000..ce1243c0 --- /dev/null +++ b/web/image/flags/im.svg @@ -0,0 +1,36 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/in.svg b/web/image/flags/in.svg new file mode 100644 index 00000000..53c29b3a --- /dev/null +++ b/web/image/flags/in.svg @@ -0,0 +1,25 @@ + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/io.svg b/web/image/flags/io.svg new file mode 100644 index 00000000..c0ed2af3 --- /dev/null +++ b/web/image/flags/io.svg @@ -0,0 +1,129 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/iq.svg b/web/image/flags/iq.svg new file mode 100644 index 00000000..68917853 --- /dev/null +++ b/web/image/flags/iq.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/web/image/flags/ir.svg b/web/image/flags/ir.svg new file mode 100644 index 00000000..c937a369 --- /dev/null +++ b/web/image/flags/ir.svg @@ -0,0 +1,219 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/is.svg b/web/image/flags/is.svg new file mode 100644 index 00000000..b0828a4c --- /dev/null +++ b/web/image/flags/is.svg @@ -0,0 +1,12 @@ + + + + + + + + + + + + diff --git a/web/image/flags/it.svg b/web/image/flags/it.svg new file mode 100644 index 00000000..20a8bfdc --- /dev/null +++ b/web/image/flags/it.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/je.svg b/web/image/flags/je.svg new file mode 100644 index 00000000..b65965cc --- /dev/null +++ b/web/image/flags/je.svg @@ -0,0 +1,45 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/jm.svg b/web/image/flags/jm.svg new file mode 100644 index 00000000..e03a3422 --- /dev/null +++ b/web/image/flags/jm.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/jo.svg b/web/image/flags/jo.svg new file mode 100644 index 00000000..df0ce75f --- /dev/null +++ b/web/image/flags/jo.svg @@ -0,0 +1,16 @@ + + + + + + + + + + + + + + + + diff --git a/web/image/flags/jp.svg b/web/image/flags/jp.svg new file mode 100644 index 00000000..90af6c49 --- /dev/null +++ b/web/image/flags/jp.svg @@ -0,0 +1,11 @@ + + + + + + + + + + + diff --git a/web/image/flags/ke.svg b/web/image/flags/ke.svg new file mode 100644 index 00000000..ad190f53 --- /dev/null +++ b/web/image/flags/ke.svg @@ -0,0 +1,23 @@ + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/kg.svg b/web/image/flags/kg.svg new file mode 100644 index 00000000..1d237fe3 --- /dev/null +++ b/web/image/flags/kg.svg @@ -0,0 +1,15 @@ + + + + + + + + + + + + + + + diff --git a/web/image/flags/kh.svg b/web/image/flags/kh.svg new file mode 100644 index 00000000..984e84e5 --- /dev/null +++ b/web/image/flags/kh.svg @@ -0,0 +1,61 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/ki.svg b/web/image/flags/ki.svg new file mode 100644 index 00000000..c4693700 --- /dev/null +++ b/web/image/flags/ki.svg @@ -0,0 +1,36 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/km.svg b/web/image/flags/km.svg new file mode 100644 index 00000000..fda3a53f --- /dev/null +++ b/web/image/flags/km.svg @@ -0,0 +1,16 @@ + + + + + + + + + + + + + + + + diff --git a/web/image/flags/kn.svg b/web/image/flags/kn.svg new file mode 100644 index 00000000..f96b06cd --- /dev/null +++ b/web/image/flags/kn.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/web/image/flags/kp.svg b/web/image/flags/kp.svg new file mode 100644 index 00000000..b405e454 --- /dev/null +++ b/web/image/flags/kp.svg @@ -0,0 +1,15 @@ + + + + + + + + + + + + + + + diff --git a/web/image/flags/kr.svg b/web/image/flags/kr.svg new file mode 100644 index 00000000..39fa999e --- /dev/null +++ b/web/image/flags/kr.svg @@ -0,0 +1,24 @@ + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/kw.svg b/web/image/flags/kw.svg new file mode 100644 index 00000000..d55aa19f --- /dev/null +++ b/web/image/flags/kw.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/ky.svg b/web/image/flags/ky.svg new file mode 100644 index 00000000..103af5ba --- /dev/null +++ b/web/image/flags/ky.svg @@ -0,0 +1,109 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/kz.svg b/web/image/flags/kz.svg new file mode 100644 index 00000000..64776c38 --- /dev/null +++ b/web/image/flags/kz.svg @@ -0,0 +1,23 @@ + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/la.svg b/web/image/flags/la.svg new file mode 100644 index 00000000..cd7ea9da --- /dev/null +++ b/web/image/flags/la.svg @@ -0,0 +1,12 @@ + + + + + + + + + + + + diff --git a/web/image/flags/lb.svg b/web/image/flags/lb.svg new file mode 100644 index 00000000..f8b8b6d1 --- /dev/null +++ b/web/image/flags/lb.svg @@ -0,0 +1,15 @@ + + + + + + + + + + + + + + + diff --git a/web/image/flags/lc.svg b/web/image/flags/lc.svg new file mode 100644 index 00000000..46bbc6cc --- /dev/null +++ b/web/image/flags/lc.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/li.svg b/web/image/flags/li.svg new file mode 100644 index 00000000..d557d314 --- /dev/null +++ b/web/image/flags/li.svg @@ -0,0 +1,43 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/lk.svg b/web/image/flags/lk.svg new file mode 100644 index 00000000..416c0f07 --- /dev/null +++ b/web/image/flags/lk.svg @@ -0,0 +1,22 @@ + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/lr.svg b/web/image/flags/lr.svg new file mode 100644 index 00000000..00252212 --- /dev/null +++ b/web/image/flags/lr.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/web/image/flags/ls.svg b/web/image/flags/ls.svg new file mode 100644 index 00000000..e7016502 --- /dev/null +++ b/web/image/flags/ls.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/lt.svg b/web/image/flags/lt.svg new file mode 100644 index 00000000..90ec5d24 --- /dev/null +++ b/web/image/flags/lt.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/lu.svg b/web/image/flags/lu.svg new file mode 100644 index 00000000..c31d2bfa --- /dev/null +++ b/web/image/flags/lu.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/lv.svg b/web/image/flags/lv.svg new file mode 100644 index 00000000..6a9e75ec --- /dev/null +++ b/web/image/flags/lv.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/ly.svg b/web/image/flags/ly.svg new file mode 100644 index 00000000..7324a87d --- /dev/null +++ b/web/image/flags/ly.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/ma.svg b/web/image/flags/ma.svg new file mode 100644 index 00000000..7ce56eff --- /dev/null +++ b/web/image/flags/ma.svg @@ -0,0 +1,4 @@ + + + + diff --git a/web/image/flags/mc.svg b/web/image/flags/mc.svg new file mode 100644 index 00000000..9cb6c9e8 --- /dev/null +++ b/web/image/flags/mc.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/md.svg b/web/image/flags/md.svg new file mode 100644 index 00000000..a806572c --- /dev/null +++ b/web/image/flags/md.svg @@ -0,0 +1,70 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/me.svg b/web/image/flags/me.svg new file mode 100644 index 00000000..b56cce09 --- /dev/null +++ b/web/image/flags/me.svg @@ -0,0 +1,116 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/mf.svg b/web/image/flags/mf.svg new file mode 100644 index 00000000..0e5ae112 --- /dev/null +++ b/web/image/flags/mf.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/mg.svg b/web/image/flags/mg.svg new file mode 100644 index 00000000..5fa2d244 --- /dev/null +++ b/web/image/flags/mg.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/mh.svg b/web/image/flags/mh.svg new file mode 100644 index 00000000..46351e54 --- /dev/null +++ b/web/image/flags/mh.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/mk.svg b/web/image/flags/mk.svg new file mode 100644 index 00000000..4f5cae77 --- /dev/null +++ b/web/image/flags/mk.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/ml.svg b/web/image/flags/ml.svg new file mode 100644 index 00000000..6f6b7169 --- /dev/null +++ b/web/image/flags/ml.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/mm.svg b/web/image/flags/mm.svg new file mode 100644 index 00000000..35277829 --- /dev/null +++ b/web/image/flags/mm.svg @@ -0,0 +1,12 @@ + + + + + + + + + + + + diff --git a/web/image/flags/mn.svg b/web/image/flags/mn.svg new file mode 100644 index 00000000..56cb0729 --- /dev/null +++ b/web/image/flags/mn.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/web/image/flags/mo.svg b/web/image/flags/mo.svg new file mode 100644 index 00000000..6b70cc72 --- /dev/null +++ b/web/image/flags/mo.svg @@ -0,0 +1,9 @@ + + + + + + + + + diff --git a/web/image/flags/mp.svg b/web/image/flags/mp.svg new file mode 100644 index 00000000..d94f688b --- /dev/null +++ b/web/image/flags/mp.svg @@ -0,0 +1,86 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/mq.svg b/web/image/flags/mq.svg new file mode 100644 index 00000000..750b396e --- /dev/null +++ b/web/image/flags/mq.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/mr.svg b/web/image/flags/mr.svg new file mode 100644 index 00000000..e9cc2916 --- /dev/null +++ b/web/image/flags/mr.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/ms.svg b/web/image/flags/ms.svg new file mode 100644 index 00000000..a1e52d9d --- /dev/null +++ b/web/image/flags/ms.svg @@ -0,0 +1,33 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/mt.svg b/web/image/flags/mt.svg new file mode 100644 index 00000000..676e801c --- /dev/null +++ b/web/image/flags/mt.svg @@ -0,0 +1,49 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/mu.svg b/web/image/flags/mu.svg new file mode 100644 index 00000000..82d7a3be --- /dev/null +++ b/web/image/flags/mu.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/mv.svg b/web/image/flags/mv.svg new file mode 100644 index 00000000..10450f98 --- /dev/null +++ b/web/image/flags/mv.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/mw.svg b/web/image/flags/mw.svg new file mode 100644 index 00000000..113aae54 --- /dev/null +++ b/web/image/flags/mw.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/web/image/flags/mx.svg b/web/image/flags/mx.svg new file mode 100644 index 00000000..42191950 --- /dev/null +++ b/web/image/flags/mx.svg @@ -0,0 +1,382 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/my.svg b/web/image/flags/my.svg new file mode 100644 index 00000000..773a4327 --- /dev/null +++ b/web/image/flags/my.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/mz.svg b/web/image/flags/mz.svg new file mode 100644 index 00000000..dab81a6e --- /dev/null +++ b/web/image/flags/mz.svg @@ -0,0 +1,21 @@ + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/na.svg b/web/image/flags/na.svg new file mode 100644 index 00000000..3b9202b7 --- /dev/null +++ b/web/image/flags/na.svg @@ -0,0 +1,16 @@ + + + + + + + + + + + + + + + + diff --git a/web/image/flags/nc.svg b/web/image/flags/nc.svg new file mode 100644 index 00000000..96795408 --- /dev/null +++ b/web/image/flags/nc.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/ne.svg b/web/image/flags/ne.svg new file mode 100644 index 00000000..39a82b82 --- /dev/null +++ b/web/image/flags/ne.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/nf.svg b/web/image/flags/nf.svg new file mode 100644 index 00000000..ecdb4a3b --- /dev/null +++ b/web/image/flags/nf.svg @@ -0,0 +1,9 @@ + + + + + + + + + diff --git a/web/image/flags/ng.svg b/web/image/flags/ng.svg new file mode 100644 index 00000000..81eb35f7 --- /dev/null +++ b/web/image/flags/ng.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/ni.svg b/web/image/flags/ni.svg new file mode 100644 index 00000000..64d2aa0e --- /dev/null +++ b/web/image/flags/ni.svg @@ -0,0 +1,129 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/nl.svg b/web/image/flags/nl.svg new file mode 100644 index 00000000..4faaf498 --- /dev/null +++ b/web/image/flags/nl.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/no.svg b/web/image/flags/no.svg new file mode 100644 index 00000000..a5f2a152 --- /dev/null +++ b/web/image/flags/no.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/np.svg b/web/image/flags/np.svg new file mode 100644 index 00000000..2f5e1f3c --- /dev/null +++ b/web/image/flags/np.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/web/image/flags/nr.svg b/web/image/flags/nr.svg new file mode 100644 index 00000000..c7db7dd2 --- /dev/null +++ b/web/image/flags/nr.svg @@ -0,0 +1,12 @@ + + + + + + + + + + + + diff --git a/web/image/flags/nu.svg b/web/image/flags/nu.svg new file mode 100644 index 00000000..4067baff --- /dev/null +++ b/web/image/flags/nu.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/web/image/flags/nz.svg b/web/image/flags/nz.svg new file mode 100644 index 00000000..8ae592a4 --- /dev/null +++ b/web/image/flags/nz.svg @@ -0,0 +1,36 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/om.svg b/web/image/flags/om.svg new file mode 100644 index 00000000..5be12ed1 --- /dev/null +++ b/web/image/flags/om.svg @@ -0,0 +1,115 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/pa.svg b/web/image/flags/pa.svg new file mode 100644 index 00000000..658c87e1 --- /dev/null +++ b/web/image/flags/pa.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/web/image/flags/pe.svg b/web/image/flags/pe.svg new file mode 100644 index 00000000..eeb29a32 --- /dev/null +++ b/web/image/flags/pe.svg @@ -0,0 +1,244 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/pf.svg b/web/image/flags/pf.svg new file mode 100644 index 00000000..1b35cdb2 --- /dev/null +++ b/web/image/flags/pf.svg @@ -0,0 +1,19 @@ + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/pg.svg b/web/image/flags/pg.svg new file mode 100644 index 00000000..1080add5 --- /dev/null +++ b/web/image/flags/pg.svg @@ -0,0 +1,9 @@ + + + + + + + + + diff --git a/web/image/flags/ph.svg b/web/image/flags/ph.svg new file mode 100644 index 00000000..65489e1c --- /dev/null +++ b/web/image/flags/ph.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/pk.svg b/web/image/flags/pk.svg new file mode 100644 index 00000000..0babde69 --- /dev/null +++ b/web/image/flags/pk.svg @@ -0,0 +1,15 @@ + + + + + + + + + + + + + + + diff --git a/web/image/flags/pl.svg b/web/image/flags/pl.svg new file mode 100644 index 00000000..0fa51452 --- /dev/null +++ b/web/image/flags/pl.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/pm.svg b/web/image/flags/pm.svg new file mode 100644 index 00000000..42bfcee0 --- /dev/null +++ b/web/image/flags/pm.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/pn.svg b/web/image/flags/pn.svg new file mode 100644 index 00000000..972792f8 --- /dev/null +++ b/web/image/flags/pn.svg @@ -0,0 +1,53 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/pr.svg b/web/image/flags/pr.svg new file mode 100644 index 00000000..964b421f --- /dev/null +++ b/web/image/flags/pr.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/ps.svg b/web/image/flags/ps.svg new file mode 100644 index 00000000..ddd1dc1b --- /dev/null +++ b/web/image/flags/ps.svg @@ -0,0 +1,15 @@ + + + + + + + + + + + + + + + diff --git a/web/image/flags/pt.svg b/web/image/flags/pt.svg new file mode 100644 index 00000000..afd2e4a3 --- /dev/null +++ b/web/image/flags/pt.svg @@ -0,0 +1,57 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/pw.svg b/web/image/flags/pw.svg new file mode 100644 index 00000000..77547c7f --- /dev/null +++ b/web/image/flags/pw.svg @@ -0,0 +1,11 @@ + + + + + + + + + + + diff --git a/web/image/flags/py.svg b/web/image/flags/py.svg new file mode 100644 index 00000000..bfbf01f1 --- /dev/null +++ b/web/image/flags/py.svg @@ -0,0 +1,157 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/qa.svg b/web/image/flags/qa.svg new file mode 100644 index 00000000..bd493c38 --- /dev/null +++ b/web/image/flags/qa.svg @@ -0,0 +1,4 @@ + + + + diff --git a/web/image/flags/re.svg b/web/image/flags/re.svg new file mode 100644 index 00000000..6c56aa41 --- /dev/null +++ b/web/image/flags/re.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/ro.svg b/web/image/flags/ro.svg new file mode 100644 index 00000000..fda0f7be --- /dev/null +++ b/web/image/flags/ro.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/rs.svg b/web/image/flags/rs.svg new file mode 100644 index 00000000..86ad291a --- /dev/null +++ b/web/image/flags/rs.svg @@ -0,0 +1,292 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/ru.svg b/web/image/flags/ru.svg new file mode 100644 index 00000000..f4d27efc --- /dev/null +++ b/web/image/flags/ru.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/rw.svg b/web/image/flags/rw.svg new file mode 100644 index 00000000..2c6c5d90 --- /dev/null +++ b/web/image/flags/rw.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/sa.svg b/web/image/flags/sa.svg new file mode 100644 index 00000000..6fcf86b0 --- /dev/null +++ b/web/image/flags/sa.svg @@ -0,0 +1,26 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/sb.svg b/web/image/flags/sb.svg new file mode 100644 index 00000000..f450a9c6 --- /dev/null +++ b/web/image/flags/sb.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/sc.svg b/web/image/flags/sc.svg new file mode 100644 index 00000000..9a46b369 --- /dev/null +++ b/web/image/flags/sc.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/sd.svg b/web/image/flags/sd.svg new file mode 100644 index 00000000..c00a1a53 --- /dev/null +++ b/web/image/flags/sd.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/se.svg b/web/image/flags/se.svg new file mode 100644 index 00000000..0e41780e --- /dev/null +++ b/web/image/flags/se.svg @@ -0,0 +1,4 @@ + + + + diff --git a/web/image/flags/sg.svg b/web/image/flags/sg.svg new file mode 100644 index 00000000..c0d3d083 --- /dev/null +++ b/web/image/flags/sg.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/sh.svg b/web/image/flags/sh.svg new file mode 100644 index 00000000..131b069a --- /dev/null +++ b/web/image/flags/sh.svg @@ -0,0 +1,76 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/si.svg b/web/image/flags/si.svg new file mode 100644 index 00000000..223fc495 --- /dev/null +++ b/web/image/flags/si.svg @@ -0,0 +1,18 @@ + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/sj.svg b/web/image/flags/sj.svg new file mode 100644 index 00000000..bb2799ce --- /dev/null +++ b/web/image/flags/sj.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/sk.svg b/web/image/flags/sk.svg new file mode 100644 index 00000000..a1953fa6 --- /dev/null +++ b/web/image/flags/sk.svg @@ -0,0 +1,9 @@ + + + + + + + + + diff --git a/web/image/flags/sl.svg b/web/image/flags/sl.svg new file mode 100644 index 00000000..a07baf75 --- /dev/null +++ b/web/image/flags/sl.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/sm.svg b/web/image/flags/sm.svg new file mode 100644 index 00000000..0892990b --- /dev/null +++ b/web/image/flags/sm.svg @@ -0,0 +1,75 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/sn.svg b/web/image/flags/sn.svg new file mode 100644 index 00000000..7c0673d6 --- /dev/null +++ b/web/image/flags/sn.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/so.svg b/web/image/flags/so.svg new file mode 100644 index 00000000..4d4337af --- /dev/null +++ b/web/image/flags/so.svg @@ -0,0 +1,11 @@ + + + + + + + + + + + diff --git a/web/image/flags/sr.svg b/web/image/flags/sr.svg new file mode 100644 index 00000000..5e71c400 --- /dev/null +++ b/web/image/flags/sr.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/ss.svg b/web/image/flags/ss.svg new file mode 100644 index 00000000..73804d80 --- /dev/null +++ b/web/image/flags/ss.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/st.svg b/web/image/flags/st.svg new file mode 100644 index 00000000..2259f318 --- /dev/null +++ b/web/image/flags/st.svg @@ -0,0 +1,16 @@ + + + + + + + + + + + + + + + + diff --git a/web/image/flags/sv.svg b/web/image/flags/sv.svg new file mode 100644 index 00000000..752dd3d4 --- /dev/null +++ b/web/image/flags/sv.svg @@ -0,0 +1,594 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/sx.svg b/web/image/flags/sx.svg new file mode 100644 index 00000000..bcc90d66 --- /dev/null +++ b/web/image/flags/sx.svg @@ -0,0 +1,56 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/sy.svg b/web/image/flags/sy.svg new file mode 100644 index 00000000..29636ae0 --- /dev/null +++ b/web/image/flags/sy.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/sz.svg b/web/image/flags/sz.svg new file mode 100644 index 00000000..02ef495a --- /dev/null +++ b/web/image/flags/sz.svg @@ -0,0 +1,34 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/ta.svg b/web/image/flags/ta.svg new file mode 100644 index 00000000..b68ad23c --- /dev/null +++ b/web/image/flags/ta.svg @@ -0,0 +1,76 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/tc.svg b/web/image/flags/tc.svg new file mode 100644 index 00000000..dbdb7168 --- /dev/null +++ b/web/image/flags/tc.svg @@ -0,0 +1,50 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/td.svg b/web/image/flags/td.svg new file mode 100644 index 00000000..9fadf85a --- /dev/null +++ b/web/image/flags/td.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/tf.svg b/web/image/flags/tf.svg new file mode 100644 index 00000000..4572f4ee --- /dev/null +++ b/web/image/flags/tf.svg @@ -0,0 +1,15 @@ + + + + + + + + + + + + + + + diff --git a/web/image/flags/tg.svg b/web/image/flags/tg.svg new file mode 100644 index 00000000..8d763cb4 --- /dev/null +++ b/web/image/flags/tg.svg @@ -0,0 +1,14 @@ + + + + + + + + + + + + + + diff --git a/web/image/flags/th.svg b/web/image/flags/th.svg new file mode 100644 index 00000000..1e93a61e --- /dev/null +++ b/web/image/flags/th.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/tj.svg b/web/image/flags/tj.svg new file mode 100644 index 00000000..563c97b6 --- /dev/null +++ b/web/image/flags/tj.svg @@ -0,0 +1,22 @@ + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/tk.svg b/web/image/flags/tk.svg new file mode 100644 index 00000000..65bab137 --- /dev/null +++ b/web/image/flags/tk.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/tl.svg b/web/image/flags/tl.svg new file mode 100644 index 00000000..1f11e925 --- /dev/null +++ b/web/image/flags/tl.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/tm.svg b/web/image/flags/tm.svg new file mode 100644 index 00000000..3c72f09d --- /dev/null +++ b/web/image/flags/tm.svg @@ -0,0 +1,205 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/tn.svg b/web/image/flags/tn.svg new file mode 100644 index 00000000..73676881 --- /dev/null +++ b/web/image/flags/tn.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/to.svg b/web/image/flags/to.svg new file mode 100644 index 00000000..d0723370 --- /dev/null +++ b/web/image/flags/to.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/web/image/flags/tr.svg b/web/image/flags/tr.svg new file mode 100644 index 00000000..a92804f8 --- /dev/null +++ b/web/image/flags/tr.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/tt.svg b/web/image/flags/tt.svg new file mode 100644 index 00000000..14adbe04 --- /dev/null +++ b/web/image/flags/tt.svg @@ -0,0 +1,5 @@ + + + + + diff --git a/web/image/flags/tv.svg b/web/image/flags/tv.svg new file mode 100644 index 00000000..675210ec --- /dev/null +++ b/web/image/flags/tv.svg @@ -0,0 +1,9 @@ + + + + + + + + + diff --git a/web/image/flags/tw.svg b/web/image/flags/tw.svg new file mode 100644 index 00000000..78f3b9d4 --- /dev/null +++ b/web/image/flags/tw.svg @@ -0,0 +1,34 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/tz.svg b/web/image/flags/tz.svg new file mode 100644 index 00000000..ca74eeca --- /dev/null +++ b/web/image/flags/tz.svg @@ -0,0 +1,13 @@ + + + + + + + + + + + + + diff --git a/web/image/flags/ua.svg b/web/image/flags/ua.svg new file mode 100644 index 00000000..a339eb1b --- /dev/null +++ b/web/image/flags/ua.svg @@ -0,0 +1,6 @@ + + + + + + diff --git a/web/image/flags/ug.svg b/web/image/flags/ug.svg new file mode 100644 index 00000000..f9c5e1b2 --- /dev/null +++ b/web/image/flags/ug.svg @@ -0,0 +1,30 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/um.svg b/web/image/flags/um.svg new file mode 100644 index 00000000..7b918389 --- /dev/null +++ b/web/image/flags/um.svg @@ -0,0 +1,15 @@ + + + + + + + + + + + + + + + diff --git a/web/image/flags/un.svg b/web/image/flags/un.svg new file mode 100644 index 00000000..b04c3c43 --- /dev/null +++ b/web/image/flags/un.svg @@ -0,0 +1,16 @@ + + + + + + + + + + + + + + + + diff --git a/web/image/flags/us.svg b/web/image/flags/us.svg new file mode 100644 index 00000000..73b62457 --- /dev/null +++ b/web/image/flags/us.svg @@ -0,0 +1,10 @@ + + + + + + + + + + diff --git a/web/image/flags/uy.svg b/web/image/flags/uy.svg new file mode 100644 index 00000000..1634d71b --- /dev/null +++ b/web/image/flags/uy.svg @@ -0,0 +1,28 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/uz.svg b/web/image/flags/uz.svg new file mode 100644 index 00000000..8c6a5324 --- /dev/null +++ b/web/image/flags/uz.svg @@ -0,0 +1,30 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/va.svg b/web/image/flags/va.svg new file mode 100644 index 00000000..6a03dc46 --- /dev/null +++ b/web/image/flags/va.svg @@ -0,0 +1,479 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/vc.svg b/web/image/flags/vc.svg new file mode 100644 index 00000000..450f6f0a --- /dev/null +++ b/web/image/flags/vc.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/ve.svg b/web/image/flags/ve.svg new file mode 100644 index 00000000..77bb549e --- /dev/null +++ b/web/image/flags/ve.svg @@ -0,0 +1,26 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/vg.svg b/web/image/flags/vg.svg new file mode 100644 index 00000000..39023a93 --- /dev/null +++ b/web/image/flags/vg.svg @@ -0,0 +1,63 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/vi.svg b/web/image/flags/vi.svg new file mode 100644 index 00000000..8a0941fa --- /dev/null +++ b/web/image/flags/vi.svg @@ -0,0 +1,28 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/vn.svg b/web/image/flags/vn.svg new file mode 100644 index 00000000..c557e3af --- /dev/null +++ b/web/image/flags/vn.svg @@ -0,0 +1,11 @@ + + + + + + + + + + + diff --git a/web/image/flags/vu.svg b/web/image/flags/vu.svg new file mode 100644 index 00000000..32f43779 --- /dev/null +++ b/web/image/flags/vu.svg @@ -0,0 +1,21 @@ + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/wf.svg b/web/image/flags/wf.svg new file mode 100644 index 00000000..b0cc4c73 --- /dev/null +++ b/web/image/flags/wf.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/ws.svg b/web/image/flags/ws.svg new file mode 100644 index 00000000..0e758a7a --- /dev/null +++ b/web/image/flags/ws.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/xk.svg b/web/image/flags/xk.svg new file mode 100644 index 00000000..0edc0c7c --- /dev/null +++ b/web/image/flags/xk.svg @@ -0,0 +1,8 @@ + + + + + + + + diff --git a/web/image/flags/xx.svg b/web/image/flags/xx.svg new file mode 100644 index 00000000..34515ce7 --- /dev/null +++ b/web/image/flags/xx.svg @@ -0,0 +1,4 @@ + + + + diff --git a/web/image/flags/ye.svg b/web/image/flags/ye.svg new file mode 100644 index 00000000..61f0ed61 --- /dev/null +++ b/web/image/flags/ye.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/yt.svg b/web/image/flags/yt.svg new file mode 100644 index 00000000..e84f439a --- /dev/null +++ b/web/image/flags/yt.svg @@ -0,0 +1,7 @@ + + + + + + + diff --git a/web/image/flags/za.svg b/web/image/flags/za.svg new file mode 100644 index 00000000..0c1f3aff --- /dev/null +++ b/web/image/flags/za.svg @@ -0,0 +1,17 @@ + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/zm.svg b/web/image/flags/zm.svg new file mode 100644 index 00000000..84c99c2e --- /dev/null +++ b/web/image/flags/zm.svg @@ -0,0 +1,27 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/flags/zw.svg b/web/image/flags/zw.svg new file mode 100644 index 00000000..64e8d483 --- /dev/null +++ b/web/image/flags/zw.svg @@ -0,0 +1,21 @@ + + + + + + + + + + + + + + + + + + + + + diff --git a/web/image/os/android.svg b/web/image/os/android.svg new file mode 100644 index 00000000..d29cca80 --- /dev/null +++ b/web/image/os/android.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/web/image/os/arch.svg b/web/image/os/arch.svg new file mode 100644 index 00000000..bbc3a073 --- /dev/null +++ b/web/image/os/arch.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/web/image/os/archlinux.svg b/web/image/os/archlinux.svg new file mode 100644 index 00000000..bbc3a073 --- /dev/null +++ b/web/image/os/archlinux.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/web/image/os/centos.svg b/web/image/os/centos.svg new file mode 100644 index 00000000..61be9e56 --- /dev/null +++ b/web/image/os/centos.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/web/image/os/debian.svg b/web/image/os/debian.svg new file mode 100644 index 00000000..74d9d995 --- /dev/null +++ b/web/image/os/debian.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/web/image/os/linux.svg b/web/image/os/linux.svg new file mode 100644 index 00000000..bea317f2 --- /dev/null +++ b/web/image/os/linux.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/web/image/os/macos.svg b/web/image/os/macos.svg new file mode 100644 index 00000000..c24c4152 --- /dev/null +++ b/web/image/os/macos.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/web/image/os/raspberry.svg b/web/image/os/raspberry.svg new file mode 100644 index 00000000..d7d47ca8 --- /dev/null +++ b/web/image/os/raspberry.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/web/image/os/ubuntu.svg b/web/image/os/ubuntu.svg new file mode 100644 index 00000000..85be9798 --- /dev/null +++ b/web/image/os/ubuntu.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/web/image/os/window.svg b/web/image/os/window.svg new file mode 100644 index 00000000..52a0ccad --- /dev/null +++ b/web/image/os/window.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/web/img/dark.png b/web/img/dark.png index 20922820..bc814c08 100644 Binary files a/web/img/dark.png and b/web/img/dark.png differ diff --git a/web/index.html b/web/index.html index 7d734074..d75f879d 100644 --- a/web/index.html +++ b/web/index.html @@ -1,111 +1,111 @@ - - - - 云监控 - - - - - - - - - - - - - - - + + + + + + + 云监控 + + + + + + -
-
- -
- 警告:如果出现此消息，请确保您已启用Javascript!
否则云监控主服务没启动或已关闭. -
-

-
- - - - - - - - - - - - - - - - - - - - - -
协议Flight节点名虚拟化位置在线时间负载网络 ↓|↑流量 ↓|↑处理器内存硬盘丢包率(CU|CT|CM)
-
-
Updating...
-
+
+ +
+ 警告：如果出现此消息，请确保您已启用 Javascript！
+ 否则云监控主服务没启动或已关闭。 +
-
-

- ServerStatus中文版 -

-
- - - - - +
+
+ + + + + + + + + + + + + + + + + + + + + + +
🔗协议📊月流量↓|↑📌节点🗂️虚拟化🌍位置⏱️在线负载🚦网络↓|↑📋总流量↓|↑🎯核芯⚡️内存💾硬盘🌐CU|CT|CM
+
+
+ + + + + + + + + + + + + +
🔗协议📌监测节点🌍监测位置📋监测内容
+
+
+ +
+
更新中...
+
+ + + + + + + \ No newline at end of file diff --git a/web/index3.html b/web/index3.html new file mode 100644 index 00000000..ac2a1902 --- /dev/null +++ b/web/index3.html @@ -0,0 +1,29 @@ + + + + + + + ServerStatus + + + + + + +
+

+ Light Default +

+
+
+ Powered by ServerStatus中文版. + Theme Light by OriLight +
+
+ + + + diff --git a/web/js/bootstrap.bundle.min.js b/web/js/bootstrap.bundle.min.js new file mode 100644 index 00000000..04e9185b --- /dev/null +++ b/web/js/bootstrap.bundle.min.js @@ -0,0 +1,7 @@ +/*! + * Bootstrap v5.3.3 (https://getbootstrap.com/) + * Copyright 2011-2024 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ +!function(t,e){"object"==typeof exports&&"undefined"!=typeof module?module.exports=e():"function"==typeof define&&define.amd?define(e):(t="undefined"!=typeof globalThis?globalThis:t||self).bootstrap=e()}(this,(function(){"use strict";const t=new Map,e={set(e,i,n){t.has(e)||t.set(e,new Map);const s=t.get(e);s.has(i)||0===s.size?s.set(i,n):console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(s.keys())[0]}.`)},get:(e,i)=>t.has(e)&&t.get(e).get(i)||null,remove(e,i){if(!t.has(e))return;const n=t.get(e);n.delete(i),0===n.size&&t.delete(e)}},i="transitionend",n=t=>(t&&window.CSS&&window.CSS.escape&&(t=t.replace(/#([^\s"#']+)/g,((t,e)=>`#${CSS.escape(e)}`))),t),s=t=>{t.dispatchEvent(new Event(i))},o=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),r=t=>o(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(n(t)):null,a=t=>{if(!o(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},l=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),c=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?c(t.parentNode):null},h=()=>{},d=t=>{t.offsetHeight},u=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,f=[],p=()=>"rtl"===document.documentElement.dir,m=t=>{var e;e=()=>{const e=u();if(e){const i=t.NAME,n=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=n,t.jQueryInterface)}},"loading"===document.readyState?(f.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of f)t()})),f.push(e)):e()},g=(t,e=[],i=t)=>"function"==typeof t?t(...e):i,_=(t,e,n=!0)=>{if(!n)return void g(t);const o=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const n=Number.parseFloat(e),s=Number.parseFloat(i);return n||s?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let r=!1;const a=({target:n})=>{n===e&&(r=!0,e.removeEventListener(i,a),g(t))};e.addEventListener(i,a),setTimeout((()=>{r||s(e)}),o)},b=(t,e,i,n)=>{const s=t.length;let o=t.indexOf(e);return-1===o?!i&&n?t[s-1]:t[0]:(o+=i?1:-1,n&&(o=(o+s)%s),t[Math.max(0,Math.min(o,s-1))])},v=/[^.]*(?=\..*)\.|.*/,y=/\..*/,w=/::\d+$/,A={};let E=1;const T={mouseenter:"mouseover",mouseleave:"mouseout"},C=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function O(t,e){return e&&`${e}::${E++}`||t.uidEvent||E++}function x(t){const e=O(t);return t.uidEvent=e,A[e]=A[e]||{},A[e]}function k(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function L(t,e,i){const n="string"==typeof e,s=n?i:e||i;let o=I(t);return C.has(o)||(o=t),[n,s,o]}function S(t,e,i,n,s){if("string"!=typeof e||!t)return;let[o,r,a]=L(e,i,n);if(e in T){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=x(t),c=l[a]||(l[a]={}),h=k(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&s);const d=O(r,e.replace(v,"")),u=o?function(t,e,i){return function n(s){const o=t.querySelectorAll(e);for(let{target:r}=s;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return P(s,{delegateTarget:r}),n.oneOff&&N.off(t,s.type,e,i),i.apply(r,[s])}}(t,i,r):function(t,e){return function i(n){return P(n,{delegateTarget:t}),i.oneOff&&N.off(t,n.type,e),e.apply(t,[n])}}(t,r);u.delegationSelector=o?i:null,u.callable=r,u.oneOff=s,u.uidEvent=d,c[d]=u,t.addEventListener(a,u,o)}function D(t,e,i,n,s){const o=k(e[i],n,s);o&&(t.removeEventListener(i,o,Boolean(s)),delete e[i][o.uidEvent])}function $(t,e,i,n){const s=e[i]||{};for(const[o,r]of Object.entries(s))o.includes(n)&&D(t,e,i,r.callable,r.delegationSelector)}function I(t){return t=t.replace(y,""),T[t]||t}const N={on(t,e,i,n){S(t,e,i,n,!1)},one(t,e,i,n){S(t,e,i,n,!0)},off(t,e,i,n){if("string"!=typeof e||!t)return;const[s,o,r]=L(e,i,n),a=r!==e,l=x(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))$(t,l,i,e.slice(1));for(const[i,n]of Object.entries(c)){const s=i.replace(w,"");a&&!e.includes(s)||D(t,l,r,n.callable,n.delegationSelector)}}else{if(!Object.keys(c).length)return;D(t,l,r,o,s?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const n=u();let s=null,o=!0,r=!0,a=!1;e!==I(e)&&n&&(s=n.Event(e,i),n(t).trigger(s),o=!s.isPropagationStopped(),r=!s.isImmediatePropagationStopped(),a=s.isDefaultPrevented());const l=P(new Event(e,{bubbles:o,cancelable:!0}),i);return a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&s&&s.preventDefault(),l}};function P(t,e={}){for(const[i,n]of Object.entries(e))try{t[i]=n}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>n})}return t}function j(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function M(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const F={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${M(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${M(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const n of i){let i=n.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=j(t.dataset[n])}return e},getDataAttribute:(t,e)=>j(t.getAttribute(`data-bs-${M(e)}`))};class H{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=o(e)?F.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...o(e)?F.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const[n,s]of Object.entries(e)){const e=t[n],r=o(e)?"element":null==(i=e)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(s).test(r))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${n}" provided type "${r}" but expected type "${s}".`)}var i}}class W extends H{constructor(t,i){super(),(t=r(t))&&(this._element=t,this._config=this._getConfig(i),e.set(this._element,this.constructor.DATA_KEY,this))}dispose(){e.remove(this._element,this.constructor.DATA_KEY),N.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){_(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return e.get(r(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.3.3"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const B=t=>{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?i.trim():null}return e?e.split(",").map((t=>n(t))).join(","):null},z={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let n=t.parentNode.closest(e);for(;n;)i.push(n),n=n.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!l(t)&&a(t)))},getSelectorFromElement(t){const e=B(t);return e&&z.findOne(e)?e:null},getElementFromSelector(t){const e=B(t);return e?z.findOne(e):null},getMultipleElementsFromSelector(t){const e=B(t);return e?z.find(e):[]}},R=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,n=t.NAME;N.on(document,i,`[data-bs-dismiss="${n}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),l(this))return;const s=z.getElementFromSelector(this)||this.closest(`.${n}`);t.getOrCreateInstance(s)[e]()}))},q=".bs.alert",V=`close${q}`,K=`closed${q}`;class Q extends W{static get NAME(){return"alert"}close(){if(N.trigger(this._element,V).defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),N.trigger(this._element,K),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Q.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}R(Q,"close"),m(Q);const X='[data-bs-toggle="button"]';class Y extends W{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=Y.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}N.on(document,"click.bs.button.data-api",X,(t=>{t.preventDefault();const e=t.target.closest(X);Y.getOrCreateInstance(e).toggle()})),m(Y);const U=".bs.swipe",G=`touchstart${U}`,J=`touchmove${U}`,Z=`touchend${U}`,tt=`pointerdown${U}`,et=`pointerup${U}`,it={endCallback:null,leftCallback:null,rightCallback:null},nt={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class st extends H{constructor(t,e){super(),this._element=t,t&&st.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return it}static get DefaultType(){return nt}static get NAME(){return"swipe"}dispose(){N.off(this._element,U)}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),g(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&g(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?(N.on(this._element,tt,(t=>this._start(t))),N.on(this._element,et,(t=>this._end(t))),this._element.classList.add("pointer-event")):(N.on(this._element,G,(t=>this._start(t))),N.on(this._element,J,(t=>this._move(t))),N.on(this._element,Z,(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const ot=".bs.carousel",rt=".data-api",at="next",lt="prev",ct="left",ht="right",dt=`slide${ot}`,ut=`slid${ot}`,ft=`keydown${ot}`,pt=`mouseenter${ot}`,mt=`mouseleave${ot}`,gt=`dragstart${ot}`,_t=`load${ot}${rt}`,bt=`click${ot}${rt}`,vt="carousel",yt="active",wt=".active",At=".carousel-item",Et=wt+At,Tt={ArrowLeft:ht,ArrowRight:ct},Ct={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},Ot={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class xt extends W{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=z.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===vt&&this.cycle()}static get Default(){return Ct}static get DefaultType(){return Ot}static get NAME(){return"carousel"}next(){this._slide(at)}nextWhenVisible(){!document.hidden&&a(this._element)&&this.next()}prev(){this._slide(lt)}pause(){this._isSliding&&s(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?N.one(this._element,ut,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void N.one(this._element,ut,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const n=t>i?at:lt;this._slide(n,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&N.on(this._element,ft,(t=>this._keydown(t))),"hover"===this._config.pause&&(N.on(this._element,pt,(()=>this.pause())),N.on(this._element,mt,(()=>this._maybeEnableCycle()))),this._config.touch&&st.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of z.find(".carousel-item img",this._element))N.on(t,gt,(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(ct)),rightCallback:()=>this._slide(this._directionToOrder(ht)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new st(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=Tt[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=z.findOne(wt,this._indicatorsElement);e.classList.remove(yt),e.removeAttribute("aria-current");const i=z.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(yt),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),n=t===at,s=e||b(this._getItems(),i,n,this._config.wrap);if(s===i)return;const o=this._getItemIndex(s),r=e=>N.trigger(this._element,e,{relatedTarget:s,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r(dt).defaultPrevented)return;if(!i||!s)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=s;const l=n?"carousel-item-start":"carousel-item-end",c=n?"carousel-item-next":"carousel-item-prev";s.classList.add(c),d(s),i.classList.add(l),s.classList.add(l),this._queueCallback((()=>{s.classList.remove(l,c),s.classList.add(yt),i.classList.remove(yt,c,l),this._isSliding=!1,r(ut)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return z.findOne(Et,this._element)}_getItems(){return z.find(At,this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return p()?t===ct?lt:at:t===ct?at:lt}_orderToDirection(t){return p()?t===lt?ct:ht:t===lt?ht:ct}static jQueryInterface(t){return this.each((function(){const e=xt.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}N.on(document,bt,"[data-bs-slide], [data-bs-slide-to]",(function(t){const e=z.getElementFromSelector(this);if(!e||!e.classList.contains(vt))return;t.preventDefault();const i=xt.getOrCreateInstance(e),n=this.getAttribute("data-bs-slide-to");return n?(i.to(n),void i._maybeEnableCycle()):"next"===F.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),N.on(window,_t,(()=>{const t=z.find('[data-bs-ride="carousel"]');for(const e of t)xt.getOrCreateInstance(e)})),m(xt);const kt=".bs.collapse",Lt=`show${kt}`,St=`shown${kt}`,Dt=`hide${kt}`,$t=`hidden${kt}`,It=`click${kt}.data-api`,Nt="show",Pt="collapse",jt="collapsing",Mt=`:scope .${Pt} .${Pt}`,Ft='[data-bs-toggle="collapse"]',Ht={parent:null,toggle:!0},Wt={parent:"(null|element)",toggle:"boolean"};class Bt extends W{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=z.find(Ft);for(const t of i){const e=z.getSelectorFromElement(t),i=z.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return Ht}static get DefaultType(){return Wt}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>Bt.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if(N.trigger(this._element,Lt).defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(Pt),this._element.classList.add(jt),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(jt),this._element.classList.add(Pt,Nt),this._element.style[e]="",N.trigger(this._element,St)}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if(N.trigger(this._element,Dt).defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,d(this._element),this._element.classList.add(jt),this._element.classList.remove(Pt,Nt);for(const t of this._triggerArray){const e=z.getElementFromSelector(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(jt),this._element.classList.add(Pt),N.trigger(this._element,$t)}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(Nt)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=r(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(Ft);for(const e of t){const t=z.getElementFromSelector(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=z.find(Mt,this._config.parent);return z.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=Bt.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}N.on(document,It,Ft,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();for(const t of z.getMultipleElementsFromSelector(this))Bt.getOrCreateInstance(t,{toggle:!1}).toggle()})),m(Bt);var zt="top",Rt="bottom",qt="right",Vt="left",Kt="auto",Qt=[zt,Rt,qt,Vt],Xt="start",Yt="end",Ut="clippingParents",Gt="viewport",Jt="popper",Zt="reference",te=Qt.reduce((function(t,e){return t.concat([e+"-"+Xt,e+"-"+Yt])}),[]),ee=[].concat(Qt,[Kt]).reduce((function(t,e){return t.concat([e,e+"-"+Xt,e+"-"+Yt])}),[]),ie="beforeRead",ne="read",se="afterRead",oe="beforeMain",re="main",ae="afterMain",le="beforeWrite",ce="write",he="afterWrite",de=[ie,ne,se,oe,re,ae,le,ce,he];function ue(t){return t?(t.nodeName||"").toLowerCase():null}function fe(t){if(null==t)return window;if("[object Window]"!==t.toString()){var e=t.ownerDocument;return e&&e.defaultView||window}return t}function pe(t){return t instanceof fe(t).Element||t instanceof Element}function me(t){return t instanceof fe(t).HTMLElement||t instanceof HTMLElement}function ge(t){return"undefined"!=typeof ShadowRoot&&(t instanceof fe(t).ShadowRoot||t instanceof ShadowRoot)}const _e={name:"applyStyles",enabled:!0,phase:"write",fn:function(t){var e=t.state;Object.keys(e.elements).forEach((function(t){var i=e.styles[t]||{},n=e.attributes[t]||{},s=e.elements[t];me(s)&&ue(s)&&(Object.assign(s.style,i),Object.keys(n).forEach((function(t){var e=n[t];!1===e?s.removeAttribute(t):s.setAttribute(t,!0===e?"":e)})))}))},effect:function(t){var e=t.state,i={popper:{position:e.options.strategy,left:"0",top:"0",margin:"0"},arrow:{position:"absolute"},reference:{}};return Object.assign(e.elements.popper.style,i.popper),e.styles=i,e.elements.arrow&&Object.assign(e.elements.arrow.style,i.arrow),function(){Object.keys(e.elements).forEach((function(t){var n=e.elements[t],s=e.attributes[t]||{},o=Object.keys(e.styles.hasOwnProperty(t)?e.styles[t]:i[t]).reduce((function(t,e){return t[e]="",t}),{});me(n)&&ue(n)&&(Object.assign(n.style,o),Object.keys(s).forEach((function(t){n.removeAttribute(t)})))}))}},requires:["computeStyles"]};function be(t){return t.split("-")[0]}var ve=Math.max,ye=Math.min,we=Math.round;function Ae(){var t=navigator.userAgentData;return null!=t&&t.brands&&Array.isArray(t.brands)?t.brands.map((function(t){return t.brand+"/"+t.version})).join(" "):navigator.userAgent}function Ee(){return!/^((?!chrome|android).)*safari/i.test(Ae())}function Te(t,e,i){void 0===e&&(e=!1),void 0===i&&(i=!1);var n=t.getBoundingClientRect(),s=1,o=1;e&&me(t)&&(s=t.offsetWidth>0&&we(n.width)/t.offsetWidth||1,o=t.offsetHeight>0&&we(n.height)/t.offsetHeight||1);var r=(pe(t)?fe(t):window).visualViewport,a=!Ee()&&i,l=(n.left+(a&&r?r.offsetLeft:0))/s,c=(n.top+(a&&r?r.offsetTop:0))/o,h=n.width/s,d=n.height/o;return{width:h,height:d,top:c,right:l+h,bottom:c+d,left:l,x:l,y:c}}function Ce(t){var e=Te(t),i=t.offsetWidth,n=t.offsetHeight;return Math.abs(e.width-i)<=1&&(i=e.width),Math.abs(e.height-n)<=1&&(n=e.height),{x:t.offsetLeft,y:t.offsetTop,width:i,height:n}}function Oe(t,e){var i=e.getRootNode&&e.getRootNode();if(t.contains(e))return!0;if(i&&ge(i)){var n=e;do{if(n&&t.isSameNode(n))return!0;n=n.parentNode||n.host}while(n)}return!1}function xe(t){return fe(t).getComputedStyle(t)}function ke(t){return["table","td","th"].indexOf(ue(t))>=0}function Le(t){return((pe(t)?t.ownerDocument:t.document)||window.document).documentElement}function Se(t){return"html"===ue(t)?t:t.assignedSlot||t.parentNode||(ge(t)?t.host:null)||Le(t)}function De(t){return me(t)&&"fixed"!==xe(t).position?t.offsetParent:null}function $e(t){for(var e=fe(t),i=De(t);i&&ke(i)&&"static"===xe(i).position;)i=De(i);return i&&("html"===ue(i)||"body"===ue(i)&&"static"===xe(i).position)?e:i||function(t){var e=/firefox/i.test(Ae());if(/Trident/i.test(Ae())&&me(t)&&"fixed"===xe(t).position)return null;var i=Se(t);for(ge(i)&&(i=i.host);me(i)&&["html","body"].indexOf(ue(i))<0;){var n=xe(i);if("none"!==n.transform||"none"!==n.perspective||"paint"===n.contain||-1!==["transform","perspective"].indexOf(n.willChange)||e&&"filter"===n.willChange||e&&n.filter&&"none"!==n.filter)return i;i=i.parentNode}return null}(t)||e}function Ie(t){return["top","bottom"].indexOf(t)>=0?"x":"y"}function Ne(t,e,i){return ve(t,ye(e,i))}function Pe(t){return Object.assign({},{top:0,right:0,bottom:0,left:0},t)}function je(t,e){return e.reduce((function(e,i){return e[i]=t,e}),{})}const Me={name:"arrow",enabled:!0,phase:"main",fn:function(t){var e,i=t.state,n=t.name,s=t.options,o=i.elements.arrow,r=i.modifiersData.popperOffsets,a=be(i.placement),l=Ie(a),c=[Vt,qt].indexOf(a)>=0?"height":"width";if(o&&r){var h=function(t,e){return Pe("number"!=typeof(t="function"==typeof t?t(Object.assign({},e.rects,{placement:e.placement})):t)?t:je(t,Qt))}(s.padding,i),d=Ce(o),u="y"===l?zt:Vt,f="y"===l?Rt:qt,p=i.rects.reference[c]+i.rects.reference[l]-r[l]-i.rects.popper[c],m=r[l]-i.rects.reference[l],g=$e(o),_=g?"y"===l?g.clientHeight||0:g.clientWidth||0:0,b=p/2-m/2,v=h[u],y=_-d[c]-h[f],w=_/2-d[c]/2+b,A=Ne(v,w,y),E=l;i.modifiersData[n]=((e={})[E]=A,e.centerOffset=A-w,e)}},effect:function(t){var e=t.state,i=t.options.element,n=void 0===i?"[data-popper-arrow]":i;null!=n&&("string"!=typeof n||(n=e.elements.popper.querySelector(n)))&&Oe(e.elements.popper,n)&&(e.elements.arrow=n)},requires:["popperOffsets"],requiresIfExists:["preventOverflow"]};function Fe(t){return t.split("-")[1]}var He={top:"auto",right:"auto",bottom:"auto",left:"auto"};function We(t){var e,i=t.popper,n=t.popperRect,s=t.placement,o=t.variation,r=t.offsets,a=t.position,l=t.gpuAcceleration,c=t.adaptive,h=t.roundOffsets,d=t.isFixed,u=r.x,f=void 0===u?0:u,p=r.y,m=void 0===p?0:p,g="function"==typeof h?h({x:f,y:m}):{x:f,y:m};f=g.x,m=g.y;var _=r.hasOwnProperty("x"),b=r.hasOwnProperty("y"),v=Vt,y=zt,w=window;if(c){var A=$e(i),E="clientHeight",T="clientWidth";A===fe(i)&&"static"!==xe(A=Le(i)).position&&"absolute"===a&&(E="scrollHeight",T="scrollWidth"),(s===zt||(s===Vt||s===qt)&&o===Yt)&&(y=Rt,m-=(d&&A===w&&w.visualViewport?w.visualViewport.height:A[E])-n.height,m*=l?1:-1),s!==Vt&&(s!==zt&&s!==Rt||o!==Yt)||(v=qt,f-=(d&&A===w&&w.visualViewport?w.visualViewport.width:A[T])-n.width,f*=l?1:-1)}var C,O=Object.assign({position:a},c&&He),x=!0===h?function(t,e){var i=t.x,n=t.y,s=e.devicePixelRatio||1;return{x:we(i*s)/s||0,y:we(n*s)/s||0}}({x:f,y:m},fe(i)):{x:f,y:m};return f=x.x,m=x.y,l?Object.assign({},O,((C={})[y]=b?"0":"",C[v]=_?"0":"",C.transform=(w.devicePixelRatio||1)<=1?"translate("+f+"px, "+m+"px)":"translate3d("+f+"px, "+m+"px, 0)",C)):Object.assign({},O,((e={})[y]=b?m+"px":"",e[v]=_?f+"px":"",e.transform="",e))}const Be={name:"computeStyles",enabled:!0,phase:"beforeWrite",fn:function(t){var e=t.state,i=t.options,n=i.gpuAcceleration,s=void 0===n||n,o=i.adaptive,r=void 0===o||o,a=i.roundOffsets,l=void 0===a||a,c={placement:be(e.placement),variation:Fe(e.placement),popper:e.elements.popper,popperRect:e.rects.popper,gpuAcceleration:s,isFixed:"fixed"===e.options.strategy};null!=e.modifiersData.popperOffsets&&(e.styles.popper=Object.assign({},e.styles.popper,We(Object.assign({},c,{offsets:e.modifiersData.popperOffsets,position:e.options.strategy,adaptive:r,roundOffsets:l})))),null!=e.modifiersData.arrow&&(e.styles.arrow=Object.assign({},e.styles.arrow,We(Object.assign({},c,{offsets:e.modifiersData.arrow,position:"absolute",adaptive:!1,roundOffsets:l})))),e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-placement":e.placement})},data:{}};var ze={passive:!0};const Re={name:"eventListeners",enabled:!0,phase:"write",fn:function(){},effect:function(t){var e=t.state,i=t.instance,n=t.options,s=n.scroll,o=void 0===s||s,r=n.resize,a=void 0===r||r,l=fe(e.elements.popper),c=[].concat(e.scrollParents.reference,e.scrollParents.popper);return o&&c.forEach((function(t){t.addEventListener("scroll",i.update,ze)})),a&&l.addEventListener("resize",i.update,ze),function(){o&&c.forEach((function(t){t.removeEventListener("scroll",i.update,ze)})),a&&l.removeEventListener("resize",i.update,ze)}},data:{}};var qe={left:"right",right:"left",bottom:"top",top:"bottom"};function Ve(t){return t.replace(/left|right|bottom|top/g,(function(t){return qe[t]}))}var Ke={start:"end",end:"start"};function Qe(t){return t.replace(/start|end/g,(function(t){return Ke[t]}))}function Xe(t){var e=fe(t);return{scrollLeft:e.pageXOffset,scrollTop:e.pageYOffset}}function Ye(t){return Te(Le(t)).left+Xe(t).scrollLeft}function Ue(t){var e=xe(t),i=e.overflow,n=e.overflowX,s=e.overflowY;return/auto|scroll|overlay|hidden/.test(i+s+n)}function Ge(t){return["html","body","#document"].indexOf(ue(t))>=0?t.ownerDocument.body:me(t)&&Ue(t)?t:Ge(Se(t))}function Je(t,e){var i;void 0===e&&(e=[]);var n=Ge(t),s=n===(null==(i=t.ownerDocument)?void 0:i.body),o=fe(n),r=s?[o].concat(o.visualViewport||[],Ue(n)?n:[]):n,a=e.concat(r);return s?a:a.concat(Je(Se(r)))}function Ze(t){return Object.assign({},t,{left:t.x,top:t.y,right:t.x+t.width,bottom:t.y+t.height})}function ti(t,e,i){return e===Gt?Ze(function(t,e){var i=fe(t),n=Le(t),s=i.visualViewport,o=n.clientWidth,r=n.clientHeight,a=0,l=0;if(s){o=s.width,r=s.height;var c=Ee();(c||!c&&"fixed"===e)&&(a=s.offsetLeft,l=s.offsetTop)}return{width:o,height:r,x:a+Ye(t),y:l}}(t,i)):pe(e)?function(t,e){var i=Te(t,!1,"fixed"===e);return i.top=i.top+t.clientTop,i.left=i.left+t.clientLeft,i.bottom=i.top+t.clientHeight,i.right=i.left+t.clientWidth,i.width=t.clientWidth,i.height=t.clientHeight,i.x=i.left,i.y=i.top,i}(e,i):Ze(function(t){var e,i=Le(t),n=Xe(t),s=null==(e=t.ownerDocument)?void 0:e.body,o=ve(i.scrollWidth,i.clientWidth,s?s.scrollWidth:0,s?s.clientWidth:0),r=ve(i.scrollHeight,i.clientHeight,s?s.scrollHeight:0,s?s.clientHeight:0),a=-n.scrollLeft+Ye(t),l=-n.scrollTop;return"rtl"===xe(s||i).direction&&(a+=ve(i.clientWidth,s?s.clientWidth:0)-o),{width:o,height:r,x:a,y:l}}(Le(t)))}function ei(t){var e,i=t.reference,n=t.element,s=t.placement,o=s?be(s):null,r=s?Fe(s):null,a=i.x+i.width/2-n.width/2,l=i.y+i.height/2-n.height/2;switch(o){case zt:e={x:a,y:i.y-n.height};break;case Rt:e={x:a,y:i.y+i.height};break;case qt:e={x:i.x+i.width,y:l};break;case Vt:e={x:i.x-n.width,y:l};break;default:e={x:i.x,y:i.y}}var c=o?Ie(o):null;if(null!=c){var h="y"===c?"height":"width";switch(r){case Xt:e[c]=e[c]-(i[h]/2-n[h]/2);break;case Yt:e[c]=e[c]+(i[h]/2-n[h]/2)}}return e}function ii(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=void 0===n?t.placement:n,o=i.strategy,r=void 0===o?t.strategy:o,a=i.boundary,l=void 0===a?Ut:a,c=i.rootBoundary,h=void 0===c?Gt:c,d=i.elementContext,u=void 0===d?Jt:d,f=i.altBoundary,p=void 0!==f&&f,m=i.padding,g=void 0===m?0:m,_=Pe("number"!=typeof g?g:je(g,Qt)),b=u===Jt?Zt:Jt,v=t.rects.popper,y=t.elements[p?b:u],w=function(t,e,i,n){var s="clippingParents"===e?function(t){var e=Je(Se(t)),i=["absolute","fixed"].indexOf(xe(t).position)>=0&&me(t)?$e(t):t;return pe(i)?e.filter((function(t){return pe(t)&&Oe(t,i)&&"body"!==ue(t)})):[]}(t):[].concat(e),o=[].concat(s,[i]),r=o[0],a=o.reduce((function(e,i){var s=ti(t,i,n);return e.top=ve(s.top,e.top),e.right=ye(s.right,e.right),e.bottom=ye(s.bottom,e.bottom),e.left=ve(s.left,e.left),e}),ti(t,r,n));return a.width=a.right-a.left,a.height=a.bottom-a.top,a.x=a.left,a.y=a.top,a}(pe(y)?y:y.contextElement||Le(t.elements.popper),l,h,r),A=Te(t.elements.reference),E=ei({reference:A,element:v,strategy:"absolute",placement:s}),T=Ze(Object.assign({},v,E)),C=u===Jt?T:A,O={top:w.top-C.top+_.top,bottom:C.bottom-w.bottom+_.bottom,left:w.left-C.left+_.left,right:C.right-w.right+_.right},x=t.modifiersData.offset;if(u===Jt&&x){var k=x[s];Object.keys(O).forEach((function(t){var e=[qt,Rt].indexOf(t)>=0?1:-1,i=[zt,Rt].indexOf(t)>=0?"y":"x";O[t]+=k[i]*e}))}return O}function ni(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=i.boundary,o=i.rootBoundary,r=i.padding,a=i.flipVariations,l=i.allowedAutoPlacements,c=void 0===l?ee:l,h=Fe(n),d=h?a?te:te.filter((function(t){return Fe(t)===h})):Qt,u=d.filter((function(t){return c.indexOf(t)>=0}));0===u.length&&(u=d);var f=u.reduce((function(e,i){return e[i]=ii(t,{placement:i,boundary:s,rootBoundary:o,padding:r})[be(i)],e}),{});return Object.keys(f).sort((function(t,e){return f[t]-f[e]}))}const si={name:"flip",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,n=t.name;if(!e.modifiersData[n]._skip){for(var s=i.mainAxis,o=void 0===s||s,r=i.altAxis,a=void 0===r||r,l=i.fallbackPlacements,c=i.padding,h=i.boundary,d=i.rootBoundary,u=i.altBoundary,f=i.flipVariations,p=void 0===f||f,m=i.allowedAutoPlacements,g=e.options.placement,_=be(g),b=l||(_!==g&&p?function(t){if(be(t)===Kt)return[];var e=Ve(t);return[Qe(t),e,Qe(e)]}(g):[Ve(g)]),v=[g].concat(b).reduce((function(t,i){return t.concat(be(i)===Kt?ni(e,{placement:i,boundary:h,rootBoundary:d,padding:c,flipVariations:p,allowedAutoPlacements:m}):i)}),[]),y=e.rects.reference,w=e.rects.popper,A=new Map,E=!0,T=v[0],C=0;C=0,S=L?"width":"height",D=ii(e,{placement:O,boundary:h,rootBoundary:d,altBoundary:u,padding:c}),$=L?k?qt:Vt:k?Rt:zt;y[S]>w[S]&&($=Ve($));var I=Ve($),N=[];if(o&&N.push(D[x]<=0),a&&N.push(D[$]<=0,D[I]<=0),N.every((function(t){return t}))){T=O,E=!1;break}A.set(O,N)}if(E)for(var P=function(t){var e=v.find((function(e){var i=A.get(e);if(i)return i.slice(0,t).every((function(t){return t}))}));if(e)return T=e,"break"},j=p?3:1;j>0&&"break"!==P(j);j--);e.placement!==T&&(e.modifiersData[n]._skip=!0,e.placement=T,e.reset=!0)}},requiresIfExists:["offset"],data:{_skip:!1}};function oi(t,e,i){return void 0===i&&(i={x:0,y:0}),{top:t.top-e.height-i.y,right:t.right-e.width+i.x,bottom:t.bottom-e.height+i.y,left:t.left-e.width-i.x}}function ri(t){return[zt,qt,Rt,Vt].some((function(e){return t[e]>=0}))}const ai={name:"hide",enabled:!0,phase:"main",requiresIfExists:["preventOverflow"],fn:function(t){var e=t.state,i=t.name,n=e.rects.reference,s=e.rects.popper,o=e.modifiersData.preventOverflow,r=ii(e,{elementContext:"reference"}),a=ii(e,{altBoundary:!0}),l=oi(r,n),c=oi(a,s,o),h=ri(l),d=ri(c);e.modifiersData[i]={referenceClippingOffsets:l,popperEscapeOffsets:c,isReferenceHidden:h,hasPopperEscaped:d},e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-reference-hidden":h,"data-popper-escaped":d})}},li={name:"offset",enabled:!0,phase:"main",requires:["popperOffsets"],fn:function(t){var e=t.state,i=t.options,n=t.name,s=i.offset,o=void 0===s?[0,0]:s,r=ee.reduce((function(t,i){return t[i]=function(t,e,i){var n=be(t),s=[Vt,zt].indexOf(n)>=0?-1:1,o="function"==typeof i?i(Object.assign({},e,{placement:t})):i,r=o[0],a=o[1];return r=r||0,a=(a||0)*s,[Vt,qt].indexOf(n)>=0?{x:a,y:r}:{x:r,y:a}}(i,e.rects,o),t}),{}),a=r[e.placement],l=a.x,c=a.y;null!=e.modifiersData.popperOffsets&&(e.modifiersData.popperOffsets.x+=l,e.modifiersData.popperOffsets.y+=c),e.modifiersData[n]=r}},ci={name:"popperOffsets",enabled:!0,phase:"read",fn:function(t){var e=t.state,i=t.name;e.modifiersData[i]=ei({reference:e.rects.reference,element:e.rects.popper,strategy:"absolute",placement:e.placement})},data:{}},hi={name:"preventOverflow",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,n=t.name,s=i.mainAxis,o=void 0===s||s,r=i.altAxis,a=void 0!==r&&r,l=i.boundary,c=i.rootBoundary,h=i.altBoundary,d=i.padding,u=i.tether,f=void 0===u||u,p=i.tetherOffset,m=void 0===p?0:p,g=ii(e,{boundary:l,rootBoundary:c,padding:d,altBoundary:h}),_=be(e.placement),b=Fe(e.placement),v=!b,y=Ie(_),w="x"===y?"y":"x",A=e.modifiersData.popperOffsets,E=e.rects.reference,T=e.rects.popper,C="function"==typeof m?m(Object.assign({},e.rects,{placement:e.placement})):m,O="number"==typeof C?{mainAxis:C,altAxis:C}:Object.assign({mainAxis:0,altAxis:0},C),x=e.modifiersData.offset?e.modifiersData.offset[e.placement]:null,k={x:0,y:0};if(A){if(o){var L,S="y"===y?zt:Vt,D="y"===y?Rt:qt,$="y"===y?"height":"width",I=A[y],N=I+g[S],P=I-g[D],j=f?-T[$]/2:0,M=b===Xt?E[$]:T[$],F=b===Xt?-T[$]:-E[$],H=e.elements.arrow,W=f&&H?Ce(H):{width:0,height:0},B=e.modifiersData["arrow#persistent"]?e.modifiersData["arrow#persistent"].padding:{top:0,right:0,bottom:0,left:0},z=B[S],R=B[D],q=Ne(0,E[$],W[$]),V=v?E[$]/2-j-q-z-O.mainAxis:M-q-z-O.mainAxis,K=v?-E[$]/2+j+q+R+O.mainAxis:F+q+R+O.mainAxis,Q=e.elements.arrow&&$e(e.elements.arrow),X=Q?"y"===y?Q.clientTop||0:Q.clientLeft||0:0,Y=null!=(L=null==x?void 0:x[y])?L:0,U=I+K-Y,G=Ne(f?ye(N,I+V-Y-X):N,I,f?ve(P,U):P);A[y]=G,k[y]=G-I}if(a){var J,Z="x"===y?zt:Vt,tt="x"===y?Rt:qt,et=A[w],it="y"===w?"height":"width",nt=et+g[Z],st=et-g[tt],ot=-1!==[zt,Vt].indexOf(_),rt=null!=(J=null==x?void 0:x[w])?J:0,at=ot?nt:et-E[it]-T[it]-rt+O.altAxis,lt=ot?et+E[it]+T[it]-rt-O.altAxis:st,ct=f&&ot?function(t,e,i){var n=Ne(t,e,i);return n>i?i:n}(at,et,lt):Ne(f?at:nt,et,f?lt:st);A[w]=ct,k[w]=ct-et}e.modifiersData[n]=k}},requiresIfExists:["offset"]};function di(t,e,i){void 0===i&&(i=!1);var n,s,o=me(e),r=me(e)&&function(t){var e=t.getBoundingClientRect(),i=we(e.width)/t.offsetWidth||1,n=we(e.height)/t.offsetHeight||1;return 1!==i||1!==n}(e),a=Le(e),l=Te(t,r,i),c={scrollLeft:0,scrollTop:0},h={x:0,y:0};return(o||!o&&!i)&&(("body"!==ue(e)||Ue(a))&&(c=(n=e)!==fe(n)&&me(n)?{scrollLeft:(s=n).scrollLeft,scrollTop:s.scrollTop}:Xe(n)),me(e)?((h=Te(e,!0)).x+=e.clientLeft,h.y+=e.clientTop):a&&(h.x=Ye(a))),{x:l.left+c.scrollLeft-h.x,y:l.top+c.scrollTop-h.y,width:l.width,height:l.height}}function ui(t){var e=new Map,i=new Set,n=[];function s(t){i.add(t.name),[].concat(t.requires||[],t.requiresIfExists||[]).forEach((function(t){if(!i.has(t)){var n=e.get(t);n&&s(n)}})),n.push(t)}return t.forEach((function(t){e.set(t.name,t)})),t.forEach((function(t){i.has(t.name)||s(t)})),n}var fi={placement:"bottom",modifiers:[],strategy:"absolute"};function pi(){for(var t=arguments.length,e=new Array(t),i=0;iNumber.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(F.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,...g(this._config.popperConfig,[t])}}_selectMenuItem({key:t,target:e}){const i=z.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>a(t)));i.length&&b(i,e,t===Ti,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=qi.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=z.find(Ni);for(const i of e){const e=qi.getInstance(i);if(!e||!1===e._config.autoClose)continue;const n=t.composedPath(),s=n.includes(e._menu);if(n.includes(e._element)||"inside"===e._config.autoClose&&!s||"outside"===e._config.autoClose&&s)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,n=[Ei,Ti].includes(t.key);if(!n&&!i)return;if(e&&!i)return;t.preventDefault();const s=this.matches(Ii)?this:z.prev(this,Ii)[0]||z.next(this,Ii)[0]||z.findOne(Ii,t.delegateTarget.parentNode),o=qi.getOrCreateInstance(s);if(n)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),s.focus())}}N.on(document,Si,Ii,qi.dataApiKeydownHandler),N.on(document,Si,Pi,qi.dataApiKeydownHandler),N.on(document,Li,qi.clearMenus),N.on(document,Di,qi.clearMenus),N.on(document,Li,Ii,(function(t){t.preventDefault(),qi.getOrCreateInstance(this).toggle()})),m(qi);const Vi="backdrop",Ki="show",Qi=`mousedown.bs.${Vi}`,Xi={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},Yi={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class Ui extends H{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return Xi}static get DefaultType(){return Yi}static get NAME(){return Vi}show(t){if(!this._config.isVisible)return void g(t);this._append();const e=this._getElement();this._config.isAnimated&&d(e),e.classList.add(Ki),this._emulateAnimation((()=>{g(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(Ki),this._emulateAnimation((()=>{this.dispose(),g(t)}))):g(t)}dispose(){this._isAppended&&(N.off(this._element,Qi),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=r(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),N.on(t,Qi,(()=>{g(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){_(t,this._getElement(),this._config.isAnimated)}}const Gi=".bs.focustrap",Ji=`focusin${Gi}`,Zi=`keydown.tab${Gi}`,tn="backward",en={autofocus:!0,trapElement:null},nn={autofocus:"boolean",trapElement:"element"};class sn extends H{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return en}static get DefaultType(){return nn}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),N.off(document,Gi),N.on(document,Ji,(t=>this._handleFocusin(t))),N.on(document,Zi,(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,N.off(document,Gi))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=z.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===tn?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?tn:"forward")}}const on=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",rn=".sticky-top",an="padding-right",ln="margin-right";class cn{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,an,(e=>e+t)),this._setElementAttributes(on,an,(e=>e+t)),this._setElementAttributes(rn,ln,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,an),this._resetElementAttributes(on,an),this._resetElementAttributes(rn,ln)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const n=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+n)return;this._saveInitialAttribute(t,e);const s=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(s))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&F.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=F.getDataAttribute(t,e);null!==i?(F.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(o(t))e(t);else for(const i of z.find(t,this._element))e(i)}}const hn=".bs.modal",dn=`hide${hn}`,un=`hidePrevented${hn}`,fn=`hidden${hn}`,pn=`show${hn}`,mn=`shown${hn}`,gn=`resize${hn}`,_n=`click.dismiss${hn}`,bn=`mousedown.dismiss${hn}`,vn=`keydown.dismiss${hn}`,yn=`click${hn}.data-api`,wn="modal-open",An="show",En="modal-static",Tn={backdrop:!0,focus:!0,keyboard:!0},Cn={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class On extends W{constructor(t,e){super(t,e),this._dialog=z.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new cn,this._addEventListeners()}static get Default(){return Tn}static get DefaultType(){return Cn}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||N.trigger(this._element,pn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(wn),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&(N.trigger(this._element,dn).defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(An),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){N.off(window,hn),N.off(this._dialog,hn),this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new Ui({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new sn({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=z.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),d(this._element),this._element.classList.add(An),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,N.trigger(this._element,mn,{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){N.on(this._element,vn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():this._triggerBackdropTransition())})),N.on(window,gn,(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),N.on(this._element,bn,(t=>{N.one(this._element,_n,(e=>{this._element===t.target&&this._element===e.target&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(wn),this._resetAdjustments(),this._scrollBar.reset(),N.trigger(this._element,fn)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if(N.trigger(this._element,un).defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(En)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(En),this._queueCallback((()=>{this._element.classList.remove(En),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=p()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=p()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=On.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}N.on(document,yn,'[data-bs-toggle="modal"]',(function(t){const e=z.getElementFromSelector(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),N.one(e,pn,(t=>{t.defaultPrevented||N.one(e,fn,(()=>{a(this)&&this.focus()}))}));const i=z.findOne(".modal.show");i&&On.getInstance(i).hide(),On.getOrCreateInstance(e).toggle(this)})),R(On),m(On);const xn=".bs.offcanvas",kn=".data-api",Ln=`load${xn}${kn}`,Sn="show",Dn="showing",$n="hiding",In=".offcanvas.show",Nn=`show${xn}`,Pn=`shown${xn}`,jn=`hide${xn}`,Mn=`hidePrevented${xn}`,Fn=`hidden${xn}`,Hn=`resize${xn}`,Wn=`click${xn}${kn}`,Bn=`keydown.dismiss${xn}`,zn={backdrop:!0,keyboard:!0,scroll:!1},Rn={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class qn extends W{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return zn}static get DefaultType(){return Rn}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||N.trigger(this._element,Nn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new cn).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(Dn),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add(Sn),this._element.classList.remove(Dn),N.trigger(this._element,Pn,{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&(N.trigger(this._element,jn).defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add($n),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove(Sn,$n),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new cn).reset(),N.trigger(this._element,Fn)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new Ui({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():N.trigger(this._element,Mn)}:null})}_initializeFocusTrap(){return new sn({trapElement:this._element})}_addEventListeners(){N.on(this._element,Bn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():N.trigger(this._element,Mn))}))}static jQueryInterface(t){return this.each((function(){const e=qn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}N.on(document,Wn,'[data-bs-toggle="offcanvas"]',(function(t){const e=z.getElementFromSelector(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),l(this))return;N.one(e,Fn,(()=>{a(this)&&this.focus()}));const i=z.findOne(In);i&&i!==e&&qn.getInstance(i).hide(),qn.getOrCreateInstance(e).toggle(this)})),N.on(window,Ln,(()=>{for(const t of z.find(In))qn.getOrCreateInstance(t).show()})),N.on(window,Hn,(()=>{for(const t of z.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&qn.getOrCreateInstance(t).hide()})),R(qn),m(qn);const Vn={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],dd:[],div:[],dl:[],dt:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},Kn=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),Qn=/^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i,Xn=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!Kn.has(i)||Boolean(Qn.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},Yn={allowList:Vn,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"
"},Un={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},Gn={entry:"(string|element|function|null)",selector:"(string|element)"};class Jn extends H{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return Yn}static get DefaultType(){return Un}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},Gn)}_setContent(t,e,i){const n=z.findOne(i,t);n&&((e=this._resolvePossibleFunction(e))?o(e)?this._putElementInTemplate(r(e),n):this._config.html?n.innerHTML=this._maybeSanitize(e):n.textContent=e:n.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const n=(new window.DOMParser).parseFromString(t,"text/html"),s=[].concat(...n.body.querySelectorAll("*"));for(const t of s){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const n=[].concat(...t.attributes),s=[].concat(e["*"]||[],e[i]||[]);for(const e of n)Xn(e,s)||t.removeAttribute(e.nodeName)}return n.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return g(t,[this])}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const Zn=new Set(["sanitize","allowList","sanitizeFn"]),ts="fade",es="show",is=".modal",ns="hide.bs.modal",ss="hover",os="focus",rs={AUTO:"auto",TOP:"top",RIGHT:p()?"left":"right",BOTTOM:"bottom",LEFT:p()?"right":"left"},as={allowList:Vn,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,6],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'',title:"",trigger:"hover focus"},ls={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class cs extends W{constructor(t,e){if(void 0===vi)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,e),this._isEnabled=!0,this._timeout=0,this._isHovered=null,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners(),this._config.selector||this._fixTitle()}static get Default(){return as}static get DefaultType(){return ls}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(){this._isEnabled&&(this._activeTrigger.click=!this._activeTrigger.click,this._isShown()?this._leave():this._enter())}dispose(){clearTimeout(this._timeout),N.off(this._element.closest(is),ns,this._hideModalHandler),this._element.getAttribute("data-bs-original-title")&&this._element.setAttribute("title",this._element.getAttribute("data-bs-original-title")),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=N.trigger(this._element,this.constructor.eventName("show")),e=(c(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this._disposePopper();const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:n}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(n.append(i),N.trigger(this._element,this.constructor.eventName("inserted"))),this._popper=this._createPopper(i),i.classList.add(es),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.on(t,"mouseover",h);this._queueCallback((()=>{N.trigger(this._element,this.constructor.eventName("shown")),!1===this._isHovered&&this._leave(),this._isHovered=!1}),this.tip,this._isAnimated())}hide(){if(this._isShown()&&!N.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented){if(this._getTipElement().classList.remove(es),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))N.off(t,"mouseover",h);this._activeTrigger.click=!1,this._activeTrigger[os]=!1,this._activeTrigger[ss]=!1,this._isHovered=null,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||this._disposePopper(),this._element.removeAttribute("aria-describedby"),N.trigger(this._element,this.constructor.eventName("hidden")))}),this.tip,this._isAnimated())}}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(ts,es),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(ts),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new Jn({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{".tooltip-inner":this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._element.getAttribute("data-bs-original-title")}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(ts)}_isShown(){return this.tip&&this.tip.classList.contains(es)}_createPopper(t){const e=g(this._config.placement,[this,t,this._element]),i=rs[e.toUpperCase()];return bi(this._element,t,this._getPopperConfig(i))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return g(t,[this._element])}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,...g(this._config.popperConfig,[e])}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)N.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>{this._initializeOnDelegatedTarget(t).toggle()}));else if("manual"!==e){const t=e===ss?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===ss?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");N.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?os:ss]=!0,e._enter()})),N.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?os:ss]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},N.on(this._element.closest(is),ns,this._hideModalHandler)}_fixTitle(){const t=this._element.getAttribute("title");t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.setAttribute("data-bs-original-title",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=F.getDataAttributes(this._element);for(const t of Object.keys(e))Zn.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:r(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const[e,i]of Object.entries(this._config))this.constructor.Default[e]!==i&&(t[e]=i);return t.selector=!1,t.trigger="manual",t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null),this.tip&&(this.tip.remove(),this.tip=null)}static jQueryInterface(t){return this.each((function(){const e=cs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}m(cs);const hs={...cs.Default,content:"",offset:[0,8],placement:"right",template:'',trigger:"click"},ds={...cs.DefaultType,content:"(null|string|element|function)"};class us extends cs{static get Default(){return hs}static get DefaultType(){return ds}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{".popover-header":this._getTitle(),".popover-body":this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=us.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}m(us);const fs=".bs.scrollspy",ps=`activate${fs}`,ms=`click${fs}`,gs=`load${fs}.data-api`,_s="active",bs="[href]",vs=".nav-link",ys=`${vs}, .nav-item > ${vs}, .list-group-item`,ws={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null,threshold:[.1,.5,1]},As={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element",threshold:"array"};class Es extends W{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return ws}static get DefaultType(){return As}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=r(t.target)||document.body,t.rootMargin=t.offset?`${t.offset}px 0px -30%`:t.rootMargin,"string"==typeof t.threshold&&(t.threshold=t.threshold.split(",").map((t=>Number.parseFloat(t)))),t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&(N.off(this._config.target,ms),N.on(this._config.target,ms,bs,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,n=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:n,behavior:"smooth"});i.scrollTop=n}})))}_getNewObserver(){const t={root:this._rootElement,threshold:this._config.threshold,rootMargin:this._config.rootMargin};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},n=(this._rootElement||document.documentElement).scrollTop,s=n>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=n;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(s&&t){if(i(o),!n)return}else s||t||i(o)}}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=z.find(bs,this._config.target);for(const e of t){if(!e.hash||l(e))continue;const t=z.findOne(decodeURI(e.hash),this._element);a(t)&&(this._targetLinks.set(decodeURI(e.hash),e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(_s),this._activateParents(t),N.trigger(this._element,ps,{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))z.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(_s);else for(const e of z.parents(t,".nav, .list-group"))for(const t of z.prev(e,ys))t.classList.add(_s)}_clearActiveClass(t){t.classList.remove(_s);const e=z.find(`${bs}.${_s}`,t);for(const t of e)t.classList.remove(_s)}static jQueryInterface(t){return this.each((function(){const e=Es.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}N.on(window,gs,(()=>{for(const t of z.find('[data-bs-spy="scroll"]'))Es.getOrCreateInstance(t)})),m(Es);const Ts=".bs.tab",Cs=`hide${Ts}`,Os=`hidden${Ts}`,xs=`show${Ts}`,ks=`shown${Ts}`,Ls=`click${Ts}`,Ss=`keydown${Ts}`,Ds=`load${Ts}`,$s="ArrowLeft",Is="ArrowRight",Ns="ArrowUp",Ps="ArrowDown",js="Home",Ms="End",Fs="active",Hs="fade",Ws="show",Bs=".dropdown-toggle",zs=`:not(${Bs})`,Rs='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',qs=`.nav-link${zs}, .list-group-item${zs}, [role="tab"]${zs}, ${Rs}`,Vs=`.${Fs}[data-bs-toggle="tab"], .${Fs}[data-bs-toggle="pill"], .${Fs}[data-bs-toggle="list"]`;class Ks extends W{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),N.on(this._element,Ss,(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?N.trigger(e,Cs,{relatedTarget:t}):null;N.trigger(t,xs,{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(Fs),this._activate(z.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),N.trigger(t,ks,{relatedTarget:e})):t.classList.add(Ws)}),t,t.classList.contains(Hs)))}_deactivate(t,e){t&&(t.classList.remove(Fs),t.blur(),this._deactivate(z.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),N.trigger(t,Os,{relatedTarget:e})):t.classList.remove(Ws)}),t,t.classList.contains(Hs)))}_keydown(t){if(![$s,Is,Ns,Ps,js,Ms].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=this._getChildren().filter((t=>!l(t)));let i;if([js,Ms].includes(t.key))i=e[t.key===js?0:e.length-1];else{const n=[Is,Ps].includes(t.key);i=b(e,t.target,n,!0)}i&&(i.focus({preventScroll:!0}),Ks.getOrCreateInstance(i).show())}_getChildren(){return z.find(qs,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=z.getElementFromSelector(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const n=(t,n)=>{const s=z.findOne(t,i);s&&s.classList.toggle(n,e)};n(Bs,Fs),n(".dropdown-menu",Ws),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(Fs)}_getInnerElement(t){return t.matches(qs)?t:z.findOne(qs,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Ks.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}N.on(document,Ls,Rs,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),l(this)||Ks.getOrCreateInstance(this).show()})),N.on(window,Ds,(()=>{for(const t of z.find(Vs))Ks.getOrCreateInstance(t)})),m(Ks);const Qs=".bs.toast",Xs=`mouseover${Qs}`,Ys=`mouseout${Qs}`,Us=`focusin${Qs}`,Gs=`focusout${Qs}`,Js=`hide${Qs}`,Zs=`hidden${Qs}`,to=`show${Qs}`,eo=`shown${Qs}`,io="hide",no="show",so="showing",oo={animation:"boolean",autohide:"boolean",delay:"number"},ro={animation:!0,autohide:!0,delay:5e3};class ao extends W{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return ro}static get DefaultType(){return oo}static get NAME(){return"toast"}show(){N.trigger(this._element,to).defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(io),d(this._element),this._element.classList.add(no,so),this._queueCallback((()=>{this._element.classList.remove(so),N.trigger(this._element,eo),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&(N.trigger(this._element,Js).defaultPrevented||(this._element.classList.add(so),this._queueCallback((()=>{this._element.classList.add(io),this._element.classList.remove(so,no),N.trigger(this._element,Zs)}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(no),super.dispose()}isShown(){return this._element.classList.contains(no)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){N.on(this._element,Xs,(t=>this._onInteraction(t,!0))),N.on(this._element,Ys,(t=>this._onInteraction(t,!1))),N.on(this._element,Us,(t=>this._onInteraction(t,!0))),N.on(this._element,Gs,(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=ao.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}return R(ao),m(ao),{Alert:Q,Button:Y,Carousel:xt,Collapse:Bt,Dropdown:qi,Modal:On,Offcanvas:qn,Popover:us,ScrollSpy:Es,Tab:Ks,Toast:ao,Tooltip:cs}})); +//# sourceMappingURL=bootstrap.bundle.min.js.map \ No newline at end of file diff --git a/web/js/bootstrap.min.js b/web/js/bootstrap.min.js deleted file mode 100644 index 9bcd2fcc..00000000 --- a/web/js/bootstrap.min.js +++ /dev/null @@ -1,7 +0,0 @@ -/*! - * Bootstrap v3.3.7 (http://getbootstrap.com) - * Copyright 2011-2016 Twitter, Inc. - * Licensed under the MIT license - */ -if("undefined"==typeof jQuery)throw new Error("Bootstrap's JavaScript requires jQuery");+function(a){"use strict";var b=a.fn.jquery.split(" ")[0].split(".");if(b[0]<2&&b[1]<9||1==b[0]&&9==b[1]&&b[2]<1||b[0]>3)throw new Error("Bootstrap's JavaScript requires jQuery version 1.9.1 or higher, but lower than version 4")}(jQuery),+function(a){"use strict";function b(){var a=document.createElement("bootstrap"),b={WebkitTransition:"webkitTransitionEnd",MozTransition:"transitionend",OTransition:"oTransitionEnd otransitionend",transition:"transitionend"};for(var c in b)if(void 0!==a.style[c])return{end:b[c]};return!1}a.fn.emulateTransitionEnd=function(b){var c=!1,d=this;a(this).one("bsTransitionEnd",function(){c=!0});var e=function(){c||a(d).trigger(a.support.transition.end)};return setTimeout(e,b),this},a(function(){a.support.transition=b(),a.support.transition&&(a.event.special.bsTransitionEnd={bindType:a.support.transition.end,delegateType:a.support.transition.end,handle:function(b){if(a(b.target).is(this))return b.handleObj.handler.apply(this,arguments)}})})}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var c=a(this),e=c.data("bs.alert");e||c.data("bs.alert",e=new d(this)),"string"==typeof b&&e[b].call(c)})}var c='[data-dismiss="alert"]',d=function(b){a(b).on("click",c,this.close)};d.VERSION="3.3.7",d.TRANSITION_DURATION=150,d.prototype.close=function(b){function c(){g.detach().trigger("closed.bs.alert").remove()}var e=a(this),f=e.attr("data-target");f||(f=e.attr("href"),f=f&&f.replace(/.*(?=#[^\s]*$)/,""));var g=a("#"===f?[]:f);b&&b.preventDefault(),g.length||(g=e.closest(".alert")),g.trigger(b=a.Event("close.bs.alert")),b.isDefaultPrevented()||(g.removeClass("in"),a.support.transition&&g.hasClass("fade")?g.one("bsTransitionEnd",c).emulateTransitionEnd(d.TRANSITION_DURATION):c())};var e=a.fn.alert;a.fn.alert=b,a.fn.alert.Constructor=d,a.fn.alert.noConflict=function(){return a.fn.alert=e,this},a(document).on("click.bs.alert.data-api",c,d.prototype.close)}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.button"),f="object"==typeof b&&b;e||d.data("bs.button",e=new c(this,f)),"toggle"==b?e.toggle():b&&e.setState(b)})}var c=function(b,d){this.$element=a(b),this.options=a.extend({},c.DEFAULTS,d),this.isLoading=!1};c.VERSION="3.3.7",c.DEFAULTS={loadingText:"loading..."},c.prototype.setState=function(b){var c="disabled",d=this.$element,e=d.is("input")?"val":"html",f=d.data();b+="Text",null==f.resetText&&d.data("resetText",d[e]()),setTimeout(a.proxy(function(){d[e](null==f[b]?this.options[b]:f[b]),"loadingText"==b?(this.isLoading=!0,d.addClass(c).attr(c,c).prop(c,!0)):this.isLoading&&(this.isLoading=!1,d.removeClass(c).removeAttr(c).prop(c,!1))},this),0)},c.prototype.toggle=function(){var a=!0,b=this.$element.closest('[data-toggle="buttons"]');if(b.length){var c=this.$element.find("input");"radio"==c.prop("type")?(c.prop("checked")&&(a=!1),b.find(".active").removeClass("active"),this.$element.addClass("active")):"checkbox"==c.prop("type")&&(c.prop("checked")!==this.$element.hasClass("active")&&(a=!1),this.$element.toggleClass("active")),c.prop("checked",this.$element.hasClass("active")),a&&c.trigger("change")}else this.$element.attr("aria-pressed",!this.$element.hasClass("active")),this.$element.toggleClass("active")};var d=a.fn.button;a.fn.button=b,a.fn.button.Constructor=c,a.fn.button.noConflict=function(){return a.fn.button=d,this},a(document).on("click.bs.button.data-api",'[data-toggle^="button"]',function(c){var d=a(c.target).closest(".btn");b.call(d,"toggle"),a(c.target).is('input[type="radio"], input[type="checkbox"]')||(c.preventDefault(),d.is("input,button")?d.trigger("focus"):d.find("input:visible,button:visible").first().trigger("focus"))}).on("focus.bs.button.data-api blur.bs.button.data-api",'[data-toggle^="button"]',function(b){a(b.target).closest(".btn").toggleClass("focus",/^focus(in)?$/.test(b.type))})}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.carousel"),f=a.extend({},c.DEFAULTS,d.data(),"object"==typeof b&&b),g="string"==typeof b?b:f.slide;e||d.data("bs.carousel",e=new c(this,f)),"number"==typeof b?e.to(b):g?e[g]():f.interval&&e.pause().cycle()})}var c=function(b,c){this.$element=a(b),this.$indicators=this.$element.find(".carousel-indicators"),this.options=c,this.paused=null,this.sliding=null,this.interval=null,this.$active=null,this.$items=null,this.options.keyboard&&this.$element.on("keydown.bs.carousel",a.proxy(this.keydown,this)),"hover"==this.options.pause&&!("ontouchstart"in document.documentElement)&&this.$element.on("mouseenter.bs.carousel",a.proxy(this.pause,this)).on("mouseleave.bs.carousel",a.proxy(this.cycle,this))};c.VERSION="3.3.7",c.TRANSITION_DURATION=600,c.DEFAULTS={interval:5e3,pause:"hover",wrap:!0,keyboard:!0},c.prototype.keydown=function(a){if(!/input|textarea/i.test(a.target.tagName)){switch(a.which){case 37:this.prev();break;case 39:this.next();break;default:return}a.preventDefault()}},c.prototype.cycle=function(b){return b||(this.paused=!1),this.interval&&clearInterval(this.interval),this.options.interval&&!this.paused&&(this.interval=setInterval(a.proxy(this.next,this),this.options.interval)),this},c.prototype.getItemIndex=function(a){return this.$items=a.parent().children(".item"),this.$items.index(a||this.$active)},c.prototype.getItemForDirection=function(a,b){var c=this.getItemIndex(b),d="prev"==a&&0===c||"next"==a&&c==this.$items.length-1;if(d&&!this.options.wrap)return b;var e="prev"==a?-1:1,f=(c+e)%this.$items.length;return this.$items.eq(f)},c.prototype.to=function(a){var b=this,c=this.getItemIndex(this.$active=this.$element.find(".item.active"));if(!(a>this.$items.length-1||a<0))return this.sliding?this.$element.one("slid.bs.carousel",function(){b.to(a)}):c==a?this.pause().cycle():this.slide(a>c?"next":"prev",this.$items.eq(a))},c.prototype.pause=function(b){return b||(this.paused=!0),this.$element.find(".next, .prev").length&&a.support.transition&&(this.$element.trigger(a.support.transition.end),this.cycle(!0)),this.interval=clearInterval(this.interval),this},c.prototype.next=function(){if(!this.sliding)return this.slide("next")},c.prototype.prev=function(){if(!this.sliding)return this.slide("prev")},c.prototype.slide=function(b,d){var e=this.$element.find(".item.active"),f=d||this.getItemForDirection(b,e),g=this.interval,h="next"==b?"left":"right",i=this;if(f.hasClass("active"))return this.sliding=!1;var j=f[0],k=a.Event("slide.bs.carousel",{relatedTarget:j,direction:h});if(this.$element.trigger(k),!k.isDefaultPrevented()){if(this.sliding=!0,g&&this.pause(),this.$indicators.length){this.$indicators.find(".active").removeClass("active");var l=a(this.$indicators.children()[this.getItemIndex(f)]);l&&l.addClass("active")}var m=a.Event("slid.bs.carousel",{relatedTarget:j,direction:h});return a.support.transition&&this.$element.hasClass("slide")?(f.addClass(b),f[0].offsetWidth,e.addClass(h),f.addClass(h),e.one("bsTransitionEnd",function(){f.removeClass([b,h].join(" ")).addClass("active"),e.removeClass(["active",h].join(" ")),i.sliding=!1,setTimeout(function(){i.$element.trigger(m)},0)}).emulateTransitionEnd(c.TRANSITION_DURATION)):(e.removeClass("active"),f.addClass("active"),this.sliding=!1,this.$element.trigger(m)),g&&this.cycle(),this}};var d=a.fn.carousel;a.fn.carousel=b,a.fn.carousel.Constructor=c,a.fn.carousel.noConflict=function(){return a.fn.carousel=d,this};var e=function(c){var d,e=a(this),f=a(e.attr("data-target")||(d=e.attr("href"))&&d.replace(/.*(?=#[^\s]+$)/,""));if(f.hasClass("carousel")){var g=a.extend({},f.data(),e.data()),h=e.attr("data-slide-to");h&&(g.interval=!1),b.call(f,g),h&&f.data("bs.carousel").to(h),c.preventDefault()}};a(document).on("click.bs.carousel.data-api","[data-slide]",e).on("click.bs.carousel.data-api","[data-slide-to]",e),a(window).on("load",function(){a('[data-ride="carousel"]').each(function(){var c=a(this);b.call(c,c.data())})})}(jQuery),+function(a){"use strict";function b(b){var c,d=b.attr("data-target")||(c=b.attr("href"))&&c.replace(/.*(?=#[^\s]+$)/,"");return a(d)}function c(b){return this.each(function(){var c=a(this),e=c.data("bs.collapse"),f=a.extend({},d.DEFAULTS,c.data(),"object"==typeof b&&b);!e&&f.toggle&&/show|hide/.test(b)&&(f.toggle=!1),e||c.data("bs.collapse",e=new d(this,f)),"string"==typeof b&&e[b]()})}var d=function(b,c){this.$element=a(b),this.options=a.extend({},d.DEFAULTS,c),this.$trigger=a('[data-toggle="collapse"][href="#'+b.id+'"],[data-toggle="collapse"][data-target="#'+b.id+'"]'),this.transitioning=null,this.options.parent?this.$parent=this.getParent():this.addAriaAndCollapsedClass(this.$element,this.$trigger),this.options.toggle&&this.toggle()};d.VERSION="3.3.7",d.TRANSITION_DURATION=350,d.DEFAULTS={toggle:!0},d.prototype.dimension=function(){var a=this.$element.hasClass("width");return a?"width":"height"},d.prototype.show=function(){if(!this.transitioning&&!this.$element.hasClass("in")){var b,e=this.$parent&&this.$parent.children(".panel").children(".in, .collapsing");if(!(e&&e.length&&(b=e.data("bs.collapse"),b&&b.transitioning))){var f=a.Event("show.bs.collapse");if(this.$element.trigger(f),!f.isDefaultPrevented()){e&&e.length&&(c.call(e,"hide"),b||e.data("bs.collapse",null));var g=this.dimension();this.$element.removeClass("collapse").addClass("collapsing")[g](0).attr("aria-expanded",!0),this.$trigger.removeClass("collapsed").attr("aria-expanded",!0),this.transitioning=1;var h=function(){this.$element.removeClass("collapsing").addClass("collapse in")[g](""),this.transitioning=0,this.$element.trigger("shown.bs.collapse")};if(!a.support.transition)return h.call(this);var i=a.camelCase(["scroll",g].join("-"));this.$element.one("bsTransitionEnd",a.proxy(h,this)).emulateTransitionEnd(d.TRANSITION_DURATION)[g](this.$element[0][i])}}}},d.prototype.hide=function(){if(!this.transitioning&&this.$element.hasClass("in")){var b=a.Event("hide.bs.collapse");if(this.$element.trigger(b),!b.isDefaultPrevented()){var c=this.dimension();this.$element[c](this.$element[c]())[0].offsetHeight,this.$element.addClass("collapsing").removeClass("collapse in").attr("aria-expanded",!1),this.$trigger.addClass("collapsed").attr("aria-expanded",!1),this.transitioning=1;var e=function(){this.transitioning=0,this.$element.removeClass("collapsing").addClass("collapse").trigger("hidden.bs.collapse")};return a.support.transition?void this.$element[c](0).one("bsTransitionEnd",a.proxy(e,this)).emulateTransitionEnd(d.TRANSITION_DURATION):e.call(this)}}},d.prototype.toggle=function(){this[this.$element.hasClass("in")?"hide":"show"]()},d.prototype.getParent=function(){return a(this.options.parent).find('[data-toggle="collapse"][data-parent="'+this.options.parent+'"]').each(a.proxy(function(c,d){var e=a(d);this.addAriaAndCollapsedClass(b(e),e)},this)).end()},d.prototype.addAriaAndCollapsedClass=function(a,b){var c=a.hasClass("in");a.attr("aria-expanded",c),b.toggleClass("collapsed",!c).attr("aria-expanded",c)};var e=a.fn.collapse;a.fn.collapse=c,a.fn.collapse.Constructor=d,a.fn.collapse.noConflict=function(){return a.fn.collapse=e,this},a(document).on("click.bs.collapse.data-api",'[data-toggle="collapse"]',function(d){var e=a(this);e.attr("data-target")||d.preventDefault();var f=b(e),g=f.data("bs.collapse"),h=g?"toggle":e.data();c.call(f,h)})}(jQuery),+function(a){"use strict";function b(b){var c=b.attr("data-target");c||(c=b.attr("href"),c=c&&/#[A-Za-z]/.test(c)&&c.replace(/.*(?=#[^\s]*$)/,""));var d=c&&a(c);return d&&d.length?d:b.parent()}function c(c){c&&3===c.which||(a(e).remove(),a(f).each(function(){var d=a(this),e=b(d),f={relatedTarget:this};e.hasClass("open")&&(c&&"click"==c.type&&/input|textarea/i.test(c.target.tagName)&&a.contains(e[0],c.target)||(e.trigger(c=a.Event("hide.bs.dropdown",f)),c.isDefaultPrevented()||(d.attr("aria-expanded","false"),e.removeClass("open").trigger(a.Event("hidden.bs.dropdown",f)))))}))}function d(b){return this.each(function(){var c=a(this),d=c.data("bs.dropdown");d||c.data("bs.dropdown",d=new g(this)),"string"==typeof b&&d[b].call(c)})}var e=".dropdown-backdrop",f='[data-toggle="dropdown"]',g=function(b){a(b).on("click.bs.dropdown",this.toggle)};g.VERSION="3.3.7",g.prototype.toggle=function(d){var e=a(this);if(!e.is(".disabled, :disabled")){var f=b(e),g=f.hasClass("open");if(c(),!g){"ontouchstart"in document.documentElement&&!f.closest(".navbar-nav").length&&a(document.createElement("div")).addClass("dropdown-backdrop").insertAfter(a(this)).on("click",c);var h={relatedTarget:this};if(f.trigger(d=a.Event("show.bs.dropdown",h)),d.isDefaultPrevented())return;e.trigger("focus").attr("aria-expanded","true"),f.toggleClass("open").trigger(a.Event("shown.bs.dropdown",h))}return!1}},g.prototype.keydown=function(c){if(/(38|40|27|32)/.test(c.which)&&!/input|textarea/i.test(c.target.tagName)){var d=a(this);if(c.preventDefault(),c.stopPropagation(),!d.is(".disabled, :disabled")){var e=b(d),g=e.hasClass("open");if(!g&&27!=c.which||g&&27==c.which)return 27==c.which&&e.find(f).trigger("focus"),d.trigger("click");var h=" li:not(.disabled):visible a",i=e.find(".dropdown-menu"+h);if(i.length){var j=i.index(c.target);38==c.which&&j>0&&j--,40==c.which&&jdocument.documentElement.clientHeight;this.$element.css({paddingLeft:!this.bodyIsOverflowing&&a?this.scrollbarWidth:"",paddingRight:this.bodyIsOverflowing&&!a?this.scrollbarWidth:""})},c.prototype.resetAdjustments=function(){this.$element.css({paddingLeft:"",paddingRight:""})},c.prototype.checkScrollbar=function(){var a=window.innerWidth;if(!a){var b=document.documentElement.getBoundingClientRect();a=b.right-Math.abs(b.left)}this.bodyIsOverflowing=document.body.clientWidth
',trigger:"hover focus",title:"",delay:0,html:!1,container:!1,viewport:{selector:"body",padding:0}},c.prototype.init=function(b,c,d){if(this.enabled=!0,this.type=b,this.$element=a(c),this.options=this.getOptions(d),this.$viewport=this.options.viewport&&a(a.isFunction(this.options.viewport)?this.options.viewport.call(this,this.$element):this.options.viewport.selector||this.options.viewport),this.inState={click:!1,hover:!1,focus:!1},this.$element[0]instanceof document.constructor&&!this.options.selector)throw new Error("`selector` option must be specified when initializing "+this.type+" on the window.document object!");for(var e=this.options.trigger.split(" "),f=e.length;f--;){var g=e[f];if("click"==g)this.$element.on("click."+this.type,this.options.selector,a.proxy(this.toggle,this));else if("manual"!=g){var h="hover"==g?"mouseenter":"focusin",i="hover"==g?"mouseleave":"focusout";this.$element.on(h+"."+this.type,this.options.selector,a.proxy(this.enter,this)),this.$element.on(i+"."+this.type,this.options.selector,a.proxy(this.leave,this))}}this.options.selector?this._options=a.extend({},this.options,{trigger:"manual",selector:""}):this.fixTitle()},c.prototype.getDefaults=function(){return c.DEFAULTS},c.prototype.getOptions=function(b){return b=a.extend({},this.getDefaults(),this.$element.data(),b),b.delay&&"number"==typeof b.delay&&(b.delay={show:b.delay,hide:b.delay}),b},c.prototype.getDelegateOptions=function(){var b={},c=this.getDefaults();return this._options&&a.each(this._options,function(a,d){c[a]!=d&&(b[a]=d)}),b},c.prototype.enter=function(b){var c=b instanceof this.constructor?b:a(b.currentTarget).data("bs."+this.type);return c||(c=new this.constructor(b.currentTarget,this.getDelegateOptions()),a(b.currentTarget).data("bs."+this.type,c)),b instanceof a.Event&&(c.inState["focusin"==b.type?"focus":"hover"]=!0),c.tip().hasClass("in")||"in"==c.hoverState?void(c.hoverState="in"):(clearTimeout(c.timeout),c.hoverState="in",c.options.delay&&c.options.delay.show?void(c.timeout=setTimeout(function(){"in"==c.hoverState&&c.show()},c.options.delay.show)):c.show())},c.prototype.isInStateTrue=function(){for(var a in this.inState)if(this.inState[a])return!0;return!1},c.prototype.leave=function(b){var c=b instanceof this.constructor?b:a(b.currentTarget).data("bs."+this.type);if(c||(c=new this.constructor(b.currentTarget,this.getDelegateOptions()),a(b.currentTarget).data("bs."+this.type,c)),b instanceof a.Event&&(c.inState["focusout"==b.type?"focus":"hover"]=!1),!c.isInStateTrue())return clearTimeout(c.timeout),c.hoverState="out",c.options.delay&&c.options.delay.hide?void(c.timeout=setTimeout(function(){"out"==c.hoverState&&c.hide()},c.options.delay.hide)):c.hide()},c.prototype.show=function(){var b=a.Event("show.bs."+this.type);if(this.hasContent()&&this.enabled){this.$element.trigger(b);var d=a.contains(this.$element[0].ownerDocument.documentElement,this.$element[0]);if(b.isDefaultPrevented()||!d)return;var e=this,f=this.tip(),g=this.getUID(this.type);this.setContent(),f.attr("id",g),this.$element.attr("aria-describedby",g),this.options.animation&&f.addClass("fade");var h="function"==typeof this.options.placement?this.options.placement.call(this,f[0],this.$element[0]):this.options.placement,i=/\s?auto?\s?/i,j=i.test(h);j&&(h=h.replace(i,"")||"top"),f.detach().css({top:0,left:0,display:"block"}).addClass(h).data("bs."+this.type,this),this.options.container?f.appendTo(this.options.container):f.insertAfter(this.$element),this.$element.trigger("inserted.bs."+this.type);var k=this.getPosition(),l=f[0].offsetWidth,m=f[0].offsetHeight;if(j){var n=h,o=this.getPosition(this.$viewport);h="bottom"==h&&k.bottom+m>o.bottom?"top":"top"==h&&k.top-mo.width?"left":"left"==h&&k.left-lg.top+g.height&&(e.top=g.top+g.height-i)}else{var j=b.left-f,k=b.left+f+c;jg.right&&(e.left=g.left+g.width-k)}return e},c.prototype.getTitle=function(){var a,b=this.$element,c=this.options;return a=b.attr("data-original-title")||("function"==typeof c.title?c.title.call(b[0]):c.title)},c.prototype.getUID=function(a){do a+=~~(1e6*Math.random());while(document.getElementById(a));return a},c.prototype.tip=function(){if(!this.$tip&&(this.$tip=a(this.options.template),1!=this.$tip.length))throw new Error(this.type+" `template` option must consist of exactly 1 top-level element!");return this.$tip},c.prototype.arrow=function(){return this.$arrow=this.$arrow||this.tip().find(".tooltip-arrow")},c.prototype.enable=function(){this.enabled=!0},c.prototype.disable=function(){this.enabled=!1},c.prototype.toggleEnabled=function(){this.enabled=!this.enabled},c.prototype.toggle=function(b){var c=this;b&&(c=a(b.currentTarget).data("bs."+this.type),c||(c=new this.constructor(b.currentTarget,this.getDelegateOptions()),a(b.currentTarget).data("bs."+this.type,c))),b?(c.inState.click=!c.inState.click,c.isInStateTrue()?c.enter(c):c.leave(c)):c.tip().hasClass("in")?c.leave(c):c.enter(c)},c.prototype.destroy=function(){var a=this;clearTimeout(this.timeout),this.hide(function(){a.$element.off("."+a.type).removeData("bs."+a.type),a.$tip&&a.$tip.detach(),a.$tip=null,a.$arrow=null,a.$viewport=null,a.$element=null})};var d=a.fn.tooltip;a.fn.tooltip=b,a.fn.tooltip.Constructor=c,a.fn.tooltip.noConflict=function(){return a.fn.tooltip=d,this}}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.popover"),f="object"==typeof b&&b;!e&&/destroy|hide/.test(b)||(e||d.data("bs.popover",e=new c(this,f)),"string"==typeof b&&e[b]())})}var c=function(a,b){this.init("popover",a,b)};if(!a.fn.tooltip)throw new Error("Popover requires tooltip.js");c.VERSION="3.3.7",c.DEFAULTS=a.extend({},a.fn.tooltip.Constructor.DEFAULTS,{placement:"right",trigger:"click",content:"",template:''}),c.prototype=a.extend({},a.fn.tooltip.Constructor.prototype),c.prototype.constructor=c,c.prototype.getDefaults=function(){return c.DEFAULTS},c.prototype.setContent=function(){var a=this.tip(),b=this.getTitle(),c=this.getContent();a.find(".popover-title")[this.options.html?"html":"text"](b),a.find(".popover-content").children().detach().end()[this.options.html?"string"==typeof c?"html":"append":"text"](c),a.removeClass("fade top bottom left right in"),a.find(".popover-title").html()||a.find(".popover-title").hide()},c.prototype.hasContent=function(){return this.getTitle()||this.getContent()},c.prototype.getContent=function(){var a=this.$element,b=this.options;return a.attr("data-content")||("function"==typeof b.content?b.content.call(a[0]):b.content)},c.prototype.arrow=function(){return this.$arrow=this.$arrow||this.tip().find(".arrow")};var d=a.fn.popover;a.fn.popover=b,a.fn.popover.Constructor=c,a.fn.popover.noConflict=function(){return a.fn.popover=d,this}}(jQuery),+function(a){"use strict";function b(c,d){this.$body=a(document.body),this.$scrollElement=a(a(c).is(document.body)?window:c),this.options=a.extend({},b.DEFAULTS,d),this.selector=(this.options.target||"")+" .nav li > a",this.offsets=[],this.targets=[],this.activeTarget=null,this.scrollHeight=0,this.$scrollElement.on("scroll.bs.scrollspy",a.proxy(this.process,this)),this.refresh(),this.process()}function c(c){return this.each(function(){var d=a(this),e=d.data("bs.scrollspy"),f="object"==typeof c&&c;e||d.data("bs.scrollspy",e=new b(this,f)),"string"==typeof c&&e[c]()})}b.VERSION="3.3.7",b.DEFAULTS={offset:10},b.prototype.getScrollHeight=function(){return this.$scrollElement[0].scrollHeight||Math.max(this.$body[0].scrollHeight,document.documentElement.scrollHeight)},b.prototype.refresh=function(){var b=this,c="offset",d=0;this.offsets=[],this.targets=[],this.scrollHeight=this.getScrollHeight(),a.isWindow(this.$scrollElement[0])||(c="position",d=this.$scrollElement.scrollTop()),this.$body.find(this.selector).map(function(){var b=a(this),e=b.data("target")||b.attr("href"),f=/^#./.test(e)&&a(e);return f&&f.length&&f.is(":visible")&&[[f[c]().top+d,e]]||null}).sort(function(a,b){return a[0]-b[0]}).each(function(){b.offsets.push(this[0]),b.targets.push(this[1])})},b.prototype.process=function(){var a,b=this.$scrollElement.scrollTop()+this.options.offset,c=this.getScrollHeight(),d=this.options.offset+c-this.$scrollElement.height(),e=this.offsets,f=this.targets,g=this.activeTarget;if(this.scrollHeight!=c&&this.refresh(),b>=d)return g!=(a=f[f.length-1])&&this.activate(a);if(g&&b=e[a]&&(void 0===e[a+1]||b .dropdown-menu > .active").removeClass("active").end().find('[data-toggle="tab"]').attr("aria-expanded",!1),b.addClass("active").find('[data-toggle="tab"]').attr("aria-expanded",!0),h?(b[0].offsetWidth,b.addClass("in")):b.removeClass("fade"),b.parent(".dropdown-menu").length&&b.closest("li.dropdown").addClass("active").end().find('[data-toggle="tab"]').attr("aria-expanded",!0),e&&e()}var g=d.find("> .active"),h=e&&a.support.transition&&(g.length&&g.hasClass("fade")||!!d.find("> .fade").length);g.length&&h?g.one("bsTransitionEnd",f).emulateTransitionEnd(c.TRANSITION_DURATION):f(),g.removeClass("in")};var d=a.fn.tab;a.fn.tab=b,a.fn.tab.Constructor=c,a.fn.tab.noConflict=function(){return a.fn.tab=d,this};var e=function(c){c.preventDefault(),b.call(a(this),"show")};a(document).on("click.bs.tab.data-api",'[data-toggle="tab"]',e).on("click.bs.tab.data-api",'[data-toggle="pill"]',e)}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.affix"),f="object"==typeof b&&b;e||d.data("bs.affix",e=new c(this,f)),"string"==typeof b&&e[b]()})}var c=function(b,d){this.options=a.extend({},c.DEFAULTS,d),this.$target=a(this.options.target).on("scroll.bs.affix.data-api",a.proxy(this.checkPosition,this)).on("click.bs.affix.data-api",a.proxy(this.checkPositionWithEventLoop,this)),this.$element=a(b),this.affixed=null,this.unpin=null,this.pinnedOffset=null,this.checkPosition()};c.VERSION="3.3.7",c.RESET="affix affix-top affix-bottom",c.DEFAULTS={offset:0,target:window},c.prototype.getState=function(a,b,c,d){var e=this.$target.scrollTop(),f=this.$element.offset(),g=this.$target.height();if(null!=c&&"top"==this.affixed)return e=a-d&&"bottom"},c.prototype.getPinnedOffset=function(){if(this.pinnedOffset)return this.pinnedOffset;this.$element.removeClass(c.RESET).addClass("affix");var a=this.$target.scrollTop(),b=this.$element.offset();return this.pinnedOffset=b.top-a},c.prototype.checkPositionWithEventLoop=function(){setTimeout(a.proxy(this.checkPosition,this),1)},c.prototype.checkPosition=function(){if(this.$element.is(":visible")){var b=this.$element.height(),d=this.options.offset,e=d.top,f=d.bottom,g=Math.max(a(document).height(),a(document.body).height());"object"!=typeof d&&(f=e=d),"function"==typeof e&&(e=d.top(this.$element)),"function"==typeof f&&(f=d.bottom(this.$element));var h=this.getState(g,b,e,f);if(this.affixed!=h){null!=this.unpin&&this.$element.css("top","");var i="affix"+(h?"-"+h:""),j=a.Event(i+".bs.affix");if(this.$element.trigger(j),j.isDefaultPrevented())return;this.affixed=h,this.unpin="bottom"==h?this.getPinnedOffset():null,this.$element.removeClass(c.RESET).addClass(i).trigger(i.replace("affix","affixed")+".bs.affix")}"bottom"==h&&this.$element.offset({top:g-b-f})}};var d=a.fn.affix;a.fn.affix=b,a.fn.affix.Constructor=c,a.fn.affix.noConflict=function(){return a.fn.affix=d,this},a(window).on("load",function(){a('[data-spy="affix"]').each(function(){var c=a(this),d=c.data();d.offset=d.offset||{},null!=d.offsetBottom&&(d.offset.bottom=d.offsetBottom),null!=d.offsetTop&&(d.offset.top=d.offsetTop),b.call(c,d)})})}(jQuery); \ No newline at end of file diff --git a/web/js/html5shiv.js b/web/js/html5shiv.js deleted file mode 100644 index 45ea723d..00000000 --- a/web/js/html5shiv.js +++ /dev/null @@ -1,326 +0,0 @@ -/** -* @preserve HTML5 Shiv 3.7.3 | @afarkas @jdalton @jon_neal @rem | MIT/GPL2 Licensed -*/ -;(function(window, document) { -/*jshint evil:true */ - /** version */ - var version = '3.7.3'; - - /** Preset options */ - var options = window.html5 || {}; - - /** Used to skip problem elements */ - var reSkip = /^<|^(?:button|map|select|textarea|object|iframe|option|optgroup)$/i; - - /** Not all elements can be cloned in IE **/ - var saveClones = /^(?:a|b|code|div|fieldset|h1|h2|h3|h4|h5|h6|i|label|li|ol|p|q|span|strong|style|table|tbody|td|th|tr|ul)$/i; - - /** Detect whether the browser supports default html5 styles */ - var supportsHtml5Styles; - - /** Name of the expando, to work with multiple documents or to re-shiv one document */ - var expando = '_html5shiv'; - - /** The id for the the documents expando */ - var expanID = 0; - - /** Cached data for each document */ - var expandoData = {}; - - /** Detect whether the browser supports unknown elements */ - var supportsUnknownElements; - - (function() { - try { - var a = document.createElement('a'); - a.innerHTML = ''; - //if the hidden property is implemented we can assume, that the browser supports basic HTML5 Styles - supportsHtml5Styles = ('hidden' in a); - - supportsUnknownElements = a.childNodes.length == 1 || (function() { - // assign a false positive if unable to shiv - (document.createElement)('a'); - var frag = document.createDocumentFragment(); - return ( - typeof frag.cloneNode == 'undefined' || - typeof frag.createDocumentFragment == 'undefined' || - typeof frag.createElement == 'undefined' - ); - }()); - } catch(e) { - // assign a false positive if detection fails => unable to shiv - supportsHtml5Styles = true; - supportsUnknownElements = true; - } - - }()); - - /*--------------------------------------------------------------------------*/ - - /** - * Creates a style sheet with the given CSS text and adds it to the document. - * @private - * @param {Document} ownerDocument The document. - * @param {String} cssText The CSS text. - * @returns {StyleSheet} The style element. - */ - function addStyleSheet(ownerDocument, cssText) { - var p = ownerDocument.createElement('p'), - parent = ownerDocument.getElementsByTagName('head')[0] || ownerDocument.documentElement; - - p.innerHTML = 'x'; - return parent.insertBefore(p.lastChild, parent.firstChild); - } - - /** - * Returns the value of `html5.elements` as an array. - * @private - * @returns {Array} An array of shived element node names. - */ - function getElements() { - var elements = html5.elements; - return typeof elements == 'string' ? elements.split(' ') : elements; - } - - /** - * Extends the built-in list of html5 elements - * @memberOf html5 - * @param {String|Array} newElements whitespace separated list or array of new element names to shiv - * @param {Document} ownerDocument The context document. - */ - function addElements(newElements, ownerDocument) { - var elements = html5.elements; - if(typeof elements != 'string'){ - elements = elements.join(' '); - } - if(typeof newElements != 'string'){ - newElements = newElements.join(' '); - } - html5.elements = elements +' '+ newElements; - shivDocument(ownerDocument); - } - - /** - * Returns the data associated to the given document - * @private - * @param {Document} ownerDocument The document. - * @returns {Object} An object of data. - */ - function getExpandoData(ownerDocument) { - var data = expandoData[ownerDocument[expando]]; - if (!data) { - data = {}; - expanID++; - ownerDocument[expando] = expanID; - expandoData[expanID] = data; - } - return data; - } - - /** - * returns a shived element for the given nodeName and document - * @memberOf html5 - * @param {String} nodeName name of the element - * @param {Document|DocumentFragment} ownerDocument The context document. - * @returns {Object} The shived element. - */ - function createElement(nodeName, ownerDocument, data){ - if (!ownerDocument) { - ownerDocument = document; - } - if(supportsUnknownElements){ - return ownerDocument.createElement(nodeName); - } - if (!data) { - data = getExpandoData(ownerDocument); - } - var node; - - if (data.cache[nodeName]) { - node = data.cache[nodeName].cloneNode(); - } else if (saveClones.test(nodeName)) { - node = (data.cache[nodeName] = data.createElem(nodeName)).cloneNode(); - } else { - node = data.createElem(nodeName); - } - - // Avoid adding some elements to fragments in IE < 9 because - // * Attributes like `name` or `type` cannot be set/changed once an element - // is inserted into a document/fragment - // * Link elements with `src` attributes that are inaccessible, as with - // a 403 response, will cause the tab/window to crash - // * Script elements appended to fragments will execute when their `src` - // or `text` property is set - return node.canHaveChildren && !reSkip.test(nodeName) && !node.tagUrn ? data.frag.appendChild(node) : node; - } - - /** - * returns a shived DocumentFragment for the given document - * @memberOf html5 - * @param {Document} ownerDocument The context document. - * @returns {Object} The shived DocumentFragment. - */ - function createDocumentFragment(ownerDocument, data){ - if (!ownerDocument) { - ownerDocument = document; - } - if(supportsUnknownElements){ - return ownerDocument.createDocumentFragment(); - } - data = data || getExpandoData(ownerDocument); - var clone = data.frag.cloneNode(), - i = 0, - elems = getElements(), - l = elems.length; - for(;i=0&&n0&&t-1 in e)}var E=function(e){var t,n,r,i,o,a,s,u,l,c,f,p,d,h,g,y,v,m,x,b="sizzle"+1*new Date,w=e.document,T=0,C=0,E=ae(),k=ae(),S=ae(),D=function(e,t){return e===t&&(f=!0),0},N={}.hasOwnProperty,A=[],j=A.pop,q=A.push,L=A.push,H=A.slice,O=function(e,t){for(var n=0,r=e.length;n+~]|"+M+")"+M+"*"),z=new RegExp("="+M+"*([^\\]'\"]*?)"+M+"*\\]","g"),X=new RegExp(W),U=new RegExp("^"+R+"$"),V={ID:new RegExp("^#("+R+")"),CLASS:new RegExp("^\\.("+R+")"),TAG:new RegExp("^("+R+"|[*])"),ATTR:new RegExp("^"+I),PSEUDO:new RegExp("^"+W),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+M+"*(even|odd|(([+-]|)(\\d*)n|)"+M+"*(?:([+-]|)"+M+"*(\\d+)|))"+M+"*\\)|)","i"),bool:new RegExp("^(?:"+P+")$","i"),needsContext:new RegExp("^"+M+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+M+"*((?:-\\d)?\\d*)"+M+"*\\)|)(?=[^-]|$)","i")},G=/^(?:input|select|textarea|button)$/i,Y=/^h\d$/i,Q=/^[^{]+\{\s*\[native \w/,J=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,K=/[+~]/,Z=new RegExp("\\\\([\\da-f]{1,6}"+M+"?|("+M+")|.)","ig"),ee=function(e,t,n){var r="0x"+t-65536;return r!==r||n?t:r<0?String.fromCharCode(r+65536):String.fromCharCode(r>>10|55296,1023&r|56320)},te=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,ne=function(e,t){return t?"\0"===e?"\ufffd":e.slice(0,-1)+"\\"+e.charCodeAt(e.length-1).toString(16)+" ":"\\"+e},re=function(){p()},ie=me(function(e){return!0===e.disabled&&("form"in e||"label"in e)},{dir:"parentNode",next:"legend"});try{L.apply(A=H.call(w.childNodes),w.childNodes),A[w.childNodes.length].nodeType}catch(e){L={apply:A.length?function(e,t){q.apply(e,H.call(t))}:function(e,t){var n=e.length,r=0;while(e[n++]=t[r++]);e.length=n-1}}}function oe(e,t,r,i){var o,s,l,c,f,h,v,m=t&&t.ownerDocument,T=t?t.nodeType:9;if(r=r||[],"string"!=typeof e||!e||1!==T&&9!==T&&11!==T)return r;if(!i&&((t?t.ownerDocument||t:w)!==d&&p(t),t=t||d,g)){if(11!==T&&(f=J.exec(e)))if(o=f[1]){if(9===T){if(!(l=t.getElementById(o)))return r;if(l.id===o)return r.push(l),r}else if(m&&(l=m.getElementById(o))&&x(t,l)&&l.id===o)return r.push(l),r}else{if(f[2])return L.apply(r,t.getElementsByTagName(e)),r;if((o=f[3])&&n.getElementsByClassName&&t.getElementsByClassName)return L.apply(r,t.getElementsByClassName(o)),r}if(n.qsa&&!S[e+" "]&&(!y||!y.test(e))){if(1!==T)m=t,v=e;else if("object"!==t.nodeName.toLowerCase()){(c=t.getAttribute("id"))?c=c.replace(te,ne):t.setAttribute("id",c=b),s=(h=a(e)).length;while(s--)h[s]="#"+c+" "+ve(h[s]);v=h.join(","),m=K.test(e)&&ge(t.parentNode)||t}if(v)try{return L.apply(r,m.querySelectorAll(v)),r}catch(e){}finally{c===b&&t.removeAttribute("id")}}}return u(e.replace(B,"$1"),t,r,i)}function ae(){var e=[];function t(n,i){return e.push(n+" ")>r.cacheLength&&delete t[e.shift()],t[n+" "]=i}return t}function se(e){return e[b]=!0,e}function ue(e){var t=d.createElement("fieldset");try{return!!e(t)}catch(e){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function le(e,t){var n=e.split("|"),i=n.length;while(i--)r.attrHandle[n[i]]=t}function ce(e,t){var n=t&&e,r=n&&1===e.nodeType&&1===t.nodeType&&e.sourceIndex-t.sourceIndex;if(r)return r;if(n)while(n=n.nextSibling)if(n===t)return-1;return e?1:-1}function fe(e){return function(t){return"input"===t.nodeName.toLowerCase()&&t.type===e}}function pe(e){return function(t){var n=t.nodeName.toLowerCase();return("input"===n||"button"===n)&&t.type===e}}function de(e){return function(t){return"form"in t?t.parentNode&&!1===t.disabled?"label"in t?"label"in t.parentNode?t.parentNode.disabled===e:t.disabled===e:t.isDisabled===e||t.isDisabled!==!e&&ie(t)===e:t.disabled===e:"label"in t&&t.disabled===e}}function he(e){return se(function(t){return t=+t,se(function(n,r){var i,o=e([],n.length,t),a=o.length;while(a--)n[i=o[a]]&&(n[i]=!(r[i]=n[i]))})})}function ge(e){return e&&"undefined"!=typeof e.getElementsByTagName&&e}n=oe.support={},o=oe.isXML=function(e){var t=e&&(e.ownerDocument||e).documentElement;return!!t&&"HTML"!==t.nodeName},p=oe.setDocument=function(e){var t,i,a=e?e.ownerDocument||e:w;return a!==d&&9===a.nodeType&&a.documentElement?(d=a,h=d.documentElement,g=!o(d),w!==d&&(i=d.defaultView)&&i.top!==i&&(i.addEventListener?i.addEventListener("unload",re,!1):i.attachEvent&&i.attachEvent("onunload",re)),n.attributes=ue(function(e){return e.className="i",!e.getAttribute("className")}),n.getElementsByTagName=ue(function(e){return e.appendChild(d.createComment("")),!e.getElementsByTagName("*").length}),n.getElementsByClassName=Q.test(d.getElementsByClassName),n.getById=ue(function(e){return h.appendChild(e).id=b,!d.getElementsByName||!d.getElementsByName(b).length}),n.getById?(r.filter.ID=function(e){var t=e.replace(Z,ee);return function(e){return e.getAttribute("id")===t}},r.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&g){var n=t.getElementById(e);return n?[n]:[]}}):(r.filter.ID=function(e){var t=e.replace(Z,ee);return function(e){var n="undefined"!=typeof e.getAttributeNode&&e.getAttributeNode("id");return n&&n.value===t}},r.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&g){var n,r,i,o=t.getElementById(e);if(o){if((n=o.getAttributeNode("id"))&&n.value===e)return[o];i=t.getElementsByName(e),r=0;while(o=i[r++])if((n=o.getAttributeNode("id"))&&n.value===e)return[o]}return[]}}),r.find.TAG=n.getElementsByTagName?function(e,t){return"undefined"!=typeof t.getElementsByTagName?t.getElementsByTagName(e):n.qsa?t.querySelectorAll(e):void 0}:function(e,t){var n,r=[],i=0,o=t.getElementsByTagName(e);if("*"===e){while(n=o[i++])1===n.nodeType&&r.push(n);return r}return o},r.find.CLASS=n.getElementsByClassName&&function(e,t){if("undefined"!=typeof t.getElementsByClassName&&g)return t.getElementsByClassName(e)},v=[],y=[],(n.qsa=Q.test(d.querySelectorAll))&&(ue(function(e){h.appendChild(e).innerHTML="",e.querySelectorAll("[msallowcapture^='']").length&&y.push("[*^$]="+M+"*(?:''|\"\")"),e.querySelectorAll("[selected]").length||y.push("\\["+M+"*(?:value|"+P+")"),e.querySelectorAll("[id~="+b+"-]").length||y.push("~="),e.querySelectorAll(":checked").length||y.push(":checked"),e.querySelectorAll("a#"+b+"+*").length||y.push(".#.+[+~]")}),ue(function(e){e.innerHTML="";var t=d.createElement("input");t.setAttribute("type","hidden"),e.appendChild(t).setAttribute("name","D"),e.querySelectorAll("[name=d]").length&&y.push("name"+M+"*[*^$|!~]?="),2!==e.querySelectorAll(":enabled").length&&y.push(":enabled",":disabled"),h.appendChild(e).disabled=!0,2!==e.querySelectorAll(":disabled").length&&y.push(":enabled",":disabled"),e.querySelectorAll("*,:x"),y.push(",.*:")})),(n.matchesSelector=Q.test(m=h.matches||h.webkitMatchesSelector||h.mozMatchesSelector||h.oMatchesSelector||h.msMatchesSelector))&&ue(function(e){n.disconnectedMatch=m.call(e,"*"),m.call(e,"[s!='']:x"),v.push("!=",W)}),y=y.length&&new RegExp(y.join("|")),v=v.length&&new RegExp(v.join("|")),t=Q.test(h.compareDocumentPosition),x=t||Q.test(h.contains)?function(e,t){var n=9===e.nodeType?e.documentElement:e,r=t&&t.parentNode;return e===r||!(!r||1!==r.nodeType||!(n.contains?n.contains(r):e.compareDocumentPosition&&16&e.compareDocumentPosition(r)))}:function(e,t){if(t)while(t=t.parentNode)if(t===e)return!0;return!1},D=t?function(e,t){if(e===t)return f=!0,0;var r=!e.compareDocumentPosition-!t.compareDocumentPosition;return r||(1&(r=(e.ownerDocument||e)===(t.ownerDocument||t)?e.compareDocumentPosition(t):1)||!n.sortDetached&&t.compareDocumentPosition(e)===r?e===d||e.ownerDocument===w&&x(w,e)?-1:t===d||t.ownerDocument===w&&x(w,t)?1:c?O(c,e)-O(c,t):0:4&r?-1:1)}:function(e,t){if(e===t)return f=!0,0;var n,r=0,i=e.parentNode,o=t.parentNode,a=[e],s=[t];if(!i||!o)return e===d?-1:t===d?1:i?-1:o?1:c?O(c,e)-O(c,t):0;if(i===o)return ce(e,t);n=e;while(n=n.parentNode)a.unshift(n);n=t;while(n=n.parentNode)s.unshift(n);while(a[r]===s[r])r++;return r?ce(a[r],s[r]):a[r]===w?-1:s[r]===w?1:0},d):d},oe.matches=function(e,t){return oe(e,null,null,t)},oe.matchesSelector=function(e,t){if((e.ownerDocument||e)!==d&&p(e),t=t.replace(z,"='$1']"),n.matchesSelector&&g&&!S[t+" "]&&(!v||!v.test(t))&&(!y||!y.test(t)))try{var r=m.call(e,t);if(r||n.disconnectedMatch||e.document&&11!==e.document.nodeType)return r}catch(e){}return oe(t,d,null,[e]).length>0},oe.contains=function(e,t){return(e.ownerDocument||e)!==d&&p(e),x(e,t)},oe.attr=function(e,t){(e.ownerDocument||e)!==d&&p(e);var i=r.attrHandle[t.toLowerCase()],o=i&&N.call(r.attrHandle,t.toLowerCase())?i(e,t,!g):void 0;return void 0!==o?o:n.attributes||!g?e.getAttribute(t):(o=e.getAttributeNode(t))&&o.specified?o.value:null},oe.escape=function(e){return(e+"").replace(te,ne)},oe.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)},oe.uniqueSort=function(e){var t,r=[],i=0,o=0;if(f=!n.detectDuplicates,c=!n.sortStable&&e.slice(0),e.sort(D),f){while(t=e[o++])t===e[o]&&(i=r.push(o));while(i--)e.splice(r[i],1)}return c=null,e},i=oe.getText=function(e){var t,n="",r=0,o=e.nodeType;if(o){if(1===o||9===o||11===o){if("string"==typeof e.textContent)return e.textContent;for(e=e.firstChild;e;e=e.nextSibling)n+=i(e)}else if(3===o||4===o)return e.nodeValue}else while(t=e[r++])n+=i(t);return n},(r=oe.selectors={cacheLength:50,createPseudo:se,match:V,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(Z,ee),e[3]=(e[3]||e[4]||e[5]||"").replace(Z,ee),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||oe.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&oe.error(e[0]),e},PSEUDO:function(e){var t,n=!e[6]&&e[2];return V.CHILD.test(e[0])?null:(e[3]?e[2]=e[4]||e[5]||"":n&&X.test(n)&&(t=a(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(Z,ee).toLowerCase();return"*"===e?function(){return!0}:function(e){return e.nodeName&&e.nodeName.toLowerCase()===t}},CLASS:function(e){var t=E[e+" "];return t||(t=new RegExp("(^|"+M+")"+e+"("+M+"|$)"))&&E(e,function(e){return t.test("string"==typeof e.className&&e.className||"undefined"!=typeof e.getAttribute&&e.getAttribute("class")||"")})},ATTR:function(e,t,n){return function(r){var i=oe.attr(r,e);return null==i?"!="===t:!t||(i+="","="===t?i===n:"!="===t?i!==n:"^="===t?n&&0===i.indexOf(n):"*="===t?n&&i.indexOf(n)>-1:"$="===t?n&&i.slice(-n.length)===n:"~="===t?(" "+i.replace($," ")+" ").indexOf(n)>-1:"|="===t&&(i===n||i.slice(0,n.length+1)===n+"-"))}},CHILD:function(e,t,n,r,i){var o="nth"!==e.slice(0,3),a="last"!==e.slice(-4),s="of-type"===t;return 1===r&&0===i?function(e){return!!e.parentNode}:function(t,n,u){var l,c,f,p,d,h,g=o!==a?"nextSibling":"previousSibling",y=t.parentNode,v=s&&t.nodeName.toLowerCase(),m=!u&&!s,x=!1;if(y){if(o){while(g){p=t;while(p=p[g])if(s?p.nodeName.toLowerCase()===v:1===p.nodeType)return!1;h=g="only"===e&&!h&&"nextSibling"}return!0}if(h=[a?y.firstChild:y.lastChild],a&&m){x=(d=(l=(c=(f=(p=y)[b]||(p[b]={}))[p.uniqueID]||(f[p.uniqueID]={}))[e]||[])[0]===T&&l[1])&&l[2],p=d&&y.childNodes[d];while(p=++d&&p&&p[g]||(x=d=0)||h.pop())if(1===p.nodeType&&++x&&p===t){c[e]=[T,d,x];break}}else if(m&&(x=d=(l=(c=(f=(p=t)[b]||(p[b]={}))[p.uniqueID]||(f[p.uniqueID]={}))[e]||[])[0]===T&&l[1]),!1===x)while(p=++d&&p&&p[g]||(x=d=0)||h.pop())if((s?p.nodeName.toLowerCase()===v:1===p.nodeType)&&++x&&(m&&((c=(f=p[b]||(p[b]={}))[p.uniqueID]||(f[p.uniqueID]={}))[e]=[T,x]),p===t))break;return(x-=i)===r||x%r==0&&x/r>=0}}},PSEUDO:function(e,t){var n,i=r.pseudos[e]||r.setFilters[e.toLowerCase()]||oe.error("unsupported pseudo: "+e);return i[b]?i(t):i.length>1?(n=[e,e,"",t],r.setFilters.hasOwnProperty(e.toLowerCase())?se(function(e,n){var r,o=i(e,t),a=o.length;while(a--)e[r=O(e,o[a])]=!(n[r]=o[a])}):function(e){return i(e,0,n)}):i}},pseudos:{not:se(function(e){var t=[],n=[],r=s(e.replace(B,"$1"));return r[b]?se(function(e,t,n,i){var o,a=r(e,null,i,[]),s=e.length;while(s--)(o=a[s])&&(e[s]=!(t[s]=o))}):function(e,i,o){return t[0]=e,r(t,null,o,n),t[0]=null,!n.pop()}}),has:se(function(e){return function(t){return oe(e,t).length>0}}),contains:se(function(e){return e=e.replace(Z,ee),function(t){return(t.textContent||t.innerText||i(t)).indexOf(e)>-1}}),lang:se(function(e){return U.test(e||"")||oe.error("unsupported lang: "+e),e=e.replace(Z,ee).toLowerCase(),function(t){var n;do{if(n=g?t.lang:t.getAttribute("xml:lang")||t.getAttribute("lang"))return(n=n.toLowerCase())===e||0===n.indexOf(e+"-")}while((t=t.parentNode)&&1===t.nodeType);return!1}}),target:function(t){var n=e.location&&e.location.hash;return n&&n.slice(1)===t.id},root:function(e){return e===h},focus:function(e){return e===d.activeElement&&(!d.hasFocus||d.hasFocus())&&!!(e.type||e.href||~e.tabIndex)},enabled:de(!1),disabled:de(!0),checked:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&!!e.checked||"option"===t&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,!0===e.selected},empty:function(e){for(e=e.firstChild;e;e=e.nextSibling)if(e.nodeType<6)return!1;return!0},parent:function(e){return!r.pseudos.empty(e)},header:function(e){return Y.test(e.nodeName)},input:function(e){return G.test(e.nodeName)},button:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&"button"===e.type||"button"===t},text:function(e){var t;return"input"===e.nodeName.toLowerCase()&&"text"===e.type&&(null==(t=e.getAttribute("type"))||"text"===t.toLowerCase())},first:he(function(){return[0]}),last:he(function(e,t){return[t-1]}),eq:he(function(e,t,n){return[n<0?n+t:n]}),even:he(function(e,t){for(var n=0;n=0;)e.push(r);return e}),gt:he(function(e,t,n){for(var r=n<0?n+t:n;++r1?function(t,n,r){var i=e.length;while(i--)if(!e[i](t,n,r))return!1;return!0}:e[0]}function be(e,t,n){for(var r=0,i=t.length;r-1&&(o[l]=!(a[l]=f))}}else v=we(v===a?v.splice(h,v.length):v),i?i(null,a,v,u):L.apply(a,v)})}function Ce(e){for(var t,n,i,o=e.length,a=r.relative[e[0].type],s=a||r.relative[" "],u=a?1:0,c=me(function(e){return e===t},s,!0),f=me(function(e){return O(t,e)>-1},s,!0),p=[function(e,n,r){var i=!a&&(r||n!==l)||((t=n).nodeType?c(e,n,r):f(e,n,r));return t=null,i}];u1&&xe(p),u>1&&ve(e.slice(0,u-1).concat({value:" "===e[u-2].type?"*":""})).replace(B,"$1"),n,u0,i=e.length>0,o=function(o,a,s,u,c){var f,h,y,v=0,m="0",x=o&&[],b=[],w=l,C=o||i&&r.find.TAG("*",c),E=T+=null==w?1:Math.random()||.1,k=C.length;for(c&&(l=a===d||a||c);m!==k&&null!=(f=C[m]);m++){if(i&&f){h=0,a||f.ownerDocument===d||(p(f),s=!g);while(y=e[h++])if(y(f,a||d,s)){u.push(f);break}c&&(T=E)}n&&((f=!y&&f)&&v--,o&&x.push(f))}if(v+=m,n&&m!==v){h=0;while(y=t[h++])y(x,b,a,s);if(o){if(v>0)while(m--)x[m]||b[m]||(b[m]=j.call(u));b=we(b)}L.apply(u,b),c&&!o&&b.length>0&&v+t.length>1&&oe.uniqueSort(u)}return c&&(T=E,l=w),x};return n?se(o):o}return s=oe.compile=function(e,t){var n,r=[],i=[],o=S[e+" "];if(!o){t||(t=a(e)),n=t.length;while(n--)(o=Ce(t[n]))[b]?r.push(o):i.push(o);(o=S(e,Ee(i,r))).selector=e}return o},u=oe.select=function(e,t,n,i){var o,u,l,c,f,p="function"==typeof e&&e,d=!i&&a(e=p.selector||e);if(n=n||[],1===d.length){if((u=d[0]=d[0].slice(0)).length>2&&"ID"===(l=u[0]).type&&9===t.nodeType&&g&&r.relative[u[1].type]){if(!(t=(r.find.ID(l.matches[0].replace(Z,ee),t)||[])[0]))return n;p&&(t=t.parentNode),e=e.slice(u.shift().value.length)}o=V.needsContext.test(e)?0:u.length;while(o--){if(l=u[o],r.relative[c=l.type])break;if((f=r.find[c])&&(i=f(l.matches[0].replace(Z,ee),K.test(u[0].type)&&ge(t.parentNode)||t))){if(u.splice(o,1),!(e=i.length&&ve(u)))return L.apply(n,i),n;break}}}return(p||s(e,d))(i,t,!g,n,!t||K.test(e)&&ge(t.parentNode)||t),n},n.sortStable=b.split("").sort(D).join("")===b,n.detectDuplicates=!!f,p(),n.sortDetached=ue(function(e){return 1&e.compareDocumentPosition(d.createElement("fieldset"))}),ue(function(e){return e.innerHTML="","#"===e.firstChild.getAttribute("href")})||le("type|href|height|width",function(e,t,n){if(!n)return e.getAttribute(t,"type"===t.toLowerCase()?1:2)}),n.attributes&&ue(function(e){return e.innerHTML="",e.firstChild.setAttribute("value",""),""===e.firstChild.getAttribute("value")})||le("value",function(e,t,n){if(!n&&"input"===e.nodeName.toLowerCase())return e.defaultValue}),ue(function(e){return null==e.getAttribute("disabled")})||le(P,function(e,t,n){var r;if(!n)return!0===e[t]?t.toLowerCase():(r=e.getAttributeNode(t))&&r.specified?r.value:null}),oe}(e);w.find=E,w.expr=E.selectors,w.expr[":"]=w.expr.pseudos,w.uniqueSort=w.unique=E.uniqueSort,w.text=E.getText,w.isXMLDoc=E.isXML,w.contains=E.contains,w.escapeSelector=E.escape;var k=function(e,t,n){var r=[],i=void 0!==n;while((e=e[t])&&9!==e.nodeType)if(1===e.nodeType){if(i&&w(e).is(n))break;r.push(e)}return r},S=function(e,t){for(var n=[];e;e=e.nextSibling)1===e.nodeType&&e!==t&&n.push(e);return n},D=w.expr.match.needsContext;function N(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()}var A=/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i;function j(e,t,n){return g(t)?w.grep(e,function(e,r){return!!t.call(e,r,e)!==n}):t.nodeType?w.grep(e,function(e){return e===t!==n}):"string"!=typeof t?w.grep(e,function(e){return u.call(t,e)>-1!==n}):w.filter(t,e,n)}w.filter=function(e,t,n){var r=t[0];return n&&(e=":not("+e+")"),1===t.length&&1===r.nodeType?w.find.matchesSelector(r,e)?[r]:[]:w.find.matches(e,w.grep(t,function(e){return 1===e.nodeType}))},w.fn.extend({find:function(e){var t,n,r=this.length,i=this;if("string"!=typeof e)return this.pushStack(w(e).filter(function(){for(t=0;t1?w.uniqueSort(n):n},filter:function(e){return this.pushStack(j(this,e||[],!1))},not:function(e){return this.pushStack(j(this,e||[],!0))},is:function(e){return!!j(this,"string"==typeof e&&D.test(e)?w(e):e||[],!1).length}});var q,L=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/;(w.fn.init=function(e,t,n){var i,o;if(!e)return this;if(n=n||q,"string"==typeof e){if(!(i="<"===e[0]&&">"===e[e.length-1]&&e.length>=3?[null,e,null]:L.exec(e))||!i[1]&&t)return!t||t.jquery?(t||n).find(e):this.constructor(t).find(e);if(i[1]){if(t=t instanceof w?t[0]:t,w.merge(this,w.parseHTML(i[1],t&&t.nodeType?t.ownerDocument||t:r,!0)),A.test(i[1])&&w.isPlainObject(t))for(i in t)g(this[i])?this[i](t[i]):this.attr(i,t[i]);return this}return(o=r.getElementById(i[2]))&&(this[0]=o,this.length=1),this}return e.nodeType?(this[0]=e,this.length=1,this):g(e)?void 0!==n.ready?n.ready(e):e(w):w.makeArray(e,this)}).prototype=w.fn,q=w(r);var H=/^(?:parents|prev(?:Until|All))/,O={children:!0,contents:!0,next:!0,prev:!0};w.fn.extend({has:function(e){var t=w(e,this),n=t.length;return this.filter(function(){for(var e=0;e-1:1===n.nodeType&&w.find.matchesSelector(n,e))){o.push(n);break}return this.pushStack(o.length>1?w.uniqueSort(o):o)},index:function(e){return e?"string"==typeof e?u.call(w(e),this[0]):u.call(this,e.jquery?e[0]:e):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(e,t){return this.pushStack(w.uniqueSort(w.merge(this.get(),w(e,t))))},addBack:function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}});function P(e,t){while((e=e[t])&&1!==e.nodeType);return e}w.each({parent:function(e){var t=e.parentNode;return t&&11!==t.nodeType?t:null},parents:function(e){return k(e,"parentNode")},parentsUntil:function(e,t,n){return k(e,"parentNode",n)},next:function(e){return P(e,"nextSibling")},prev:function(e){return P(e,"previousSibling")},nextAll:function(e){return k(e,"nextSibling")},prevAll:function(e){return k(e,"previousSibling")},nextUntil:function(e,t,n){return k(e,"nextSibling",n)},prevUntil:function(e,t,n){return k(e,"previousSibling",n)},siblings:function(e){return S((e.parentNode||{}).firstChild,e)},children:function(e){return S(e.firstChild)},contents:function(e){return N(e,"iframe")?e.contentDocument:(N(e,"template")&&(e=e.content||e),w.merge([],e.childNodes))}},function(e,t){w.fn[e]=function(n,r){var i=w.map(this,t,n);return"Until"!==e.slice(-5)&&(r=n),r&&"string"==typeof r&&(i=w.filter(r,i)),this.length>1&&(O[e]||w.uniqueSort(i),H.test(e)&&i.reverse()),this.pushStack(i)}});var M=/[^\x20\t\r\n\f]+/g;function R(e){var t={};return w.each(e.match(M)||[],function(e,n){t[n]=!0}),t}w.Callbacks=function(e){e="string"==typeof e?R(e):w.extend({},e);var t,n,r,i,o=[],a=[],s=-1,u=function(){for(i=i||e.once,r=t=!0;a.length;s=-1){n=a.shift();while(++s-1)o.splice(n,1),n<=s&&s--}),this},has:function(e){return e?w.inArray(e,o)>-1:o.length>0},empty:function(){return o&&(o=[]),this},disable:function(){return i=a=[],o=n="",this},disabled:function(){return!o},lock:function(){return i=a=[],n||t||(o=n=""),this},locked:function(){return!!i},fireWith:function(e,n){return i||(n=[e,(n=n||[]).slice?n.slice():n],a.push(n),t||u()),this},fire:function(){return l.fireWith(this,arguments),this},fired:function(){return!!r}};return l};function I(e){return e}function W(e){throw e}function $(e,t,n,r){var i;try{e&&g(i=e.promise)?i.call(e).done(t).fail(n):e&&g(i=e.then)?i.call(e,t,n):t.apply(void 0,[e].slice(r))}catch(e){n.apply(void 0,[e])}}w.extend({Deferred:function(t){var n=[["notify","progress",w.Callbacks("memory"),w.Callbacks("memory"),2],["resolve","done",w.Callbacks("once memory"),w.Callbacks("once memory"),0,"resolved"],["reject","fail",w.Callbacks("once memory"),w.Callbacks("once memory"),1,"rejected"]],r="pending",i={state:function(){return r},always:function(){return o.done(arguments).fail(arguments),this},"catch":function(e){return i.then(null,e)},pipe:function(){var e=arguments;return w.Deferred(function(t){w.each(n,function(n,r){var i=g(e[r[4]])&&e[r[4]];o[r[1]](function(){var e=i&&i.apply(this,arguments);e&&g(e.promise)?e.promise().progress(t.notify).done(t.resolve).fail(t.reject):t[r[0]+"With"](this,i?[e]:arguments)})}),e=null}).promise()},then:function(t,r,i){var o=0;function a(t,n,r,i){return function(){var s=this,u=arguments,l=function(){var e,l;if(!(t=o&&(r!==W&&(s=void 0,u=[e]),n.rejectWith(s,u))}};t?c():(w.Deferred.getStackHook&&(c.stackTrace=w.Deferred.getStackHook()),e.setTimeout(c))}}return w.Deferred(function(e){n[0][3].add(a(0,e,g(i)?i:I,e.notifyWith)),n[1][3].add(a(0,e,g(t)?t:I)),n[2][3].add(a(0,e,g(r)?r:W))}).promise()},promise:function(e){return null!=e?w.extend(e,i):i}},o={};return w.each(n,function(e,t){var a=t[2],s=t[5];i[t[1]]=a.add,s&&a.add(function(){r=s},n[3-e][2].disable,n[3-e][3].disable,n[0][2].lock,n[0][3].lock),a.add(t[3].fire),o[t[0]]=function(){return o[t[0]+"With"](this===o?void 0:this,arguments),this},o[t[0]+"With"]=a.fireWith}),i.promise(o),t&&t.call(o,o),o},when:function(e){var t=arguments.length,n=t,r=Array(n),i=o.call(arguments),a=w.Deferred(),s=function(e){return function(n){r[e]=this,i[e]=arguments.length>1?o.call(arguments):n,--t||a.resolveWith(r,i)}};if(t<=1&&($(e,a.done(s(n)).resolve,a.reject,!t),"pending"===a.state()||g(i[n]&&i[n].then)))return a.then();while(n--)$(i[n],s(n),a.reject);return a.promise()}});var B=/^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;w.Deferred.exceptionHook=function(t,n){e.console&&e.console.warn&&t&&B.test(t.name)&&e.console.warn("jQuery.Deferred exception: "+t.message,t.stack,n)},w.readyException=function(t){e.setTimeout(function(){throw t})};var F=w.Deferred();w.fn.ready=function(e){return F.then(e)["catch"](function(e){w.readyException(e)}),this},w.extend({isReady:!1,readyWait:1,ready:function(e){(!0===e?--w.readyWait:w.isReady)||(w.isReady=!0,!0!==e&&--w.readyWait>0||F.resolveWith(r,[w]))}}),w.ready.then=F.then;function _(){r.removeEventListener("DOMContentLoaded",_),e.removeEventListener("load",_),w.ready()}"complete"===r.readyState||"loading"!==r.readyState&&!r.documentElement.doScroll?e.setTimeout(w.ready):(r.addEventListener("DOMContentLoaded",_),e.addEventListener("load",_));var z=function(e,t,n,r,i,o,a){var s=0,u=e.length,l=null==n;if("object"===x(n)){i=!0;for(s in n)z(e,t,s,n[s],!0,o,a)}else if(void 0!==r&&(i=!0,g(r)||(a=!0),l&&(a?(t.call(e,r),t=null):(l=t,t=function(e,t,n){return l.call(w(e),n)})),t))for(;s1,null,!0)},removeData:function(e){return this.each(function(){K.remove(this,e)})}}),w.extend({queue:function(e,t,n){var r;if(e)return t=(t||"fx")+"queue",r=J.get(e,t),n&&(!r||Array.isArray(n)?r=J.access(e,t,w.makeArray(n)):r.push(n)),r||[]},dequeue:function(e,t){t=t||"fx";var n=w.queue(e,t),r=n.length,i=n.shift(),o=w._queueHooks(e,t),a=function(){w.dequeue(e,t)};"inprogress"===i&&(i=n.shift(),r--),i&&("fx"===t&&n.unshift("inprogress"),delete o.stop,i.call(e,a,o)),!r&&o&&o.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return J.get(e,n)||J.access(e,n,{empty:w.Callbacks("once memory").add(function(){J.remove(e,[t+"queue",n])})})}}),w.fn.extend({queue:function(e,t){var n=2;return"string"!=typeof e&&(t=e,e="fx",n--),arguments.length\x20\t\r\n\f]+)/i,he=/^$|^module$|\/(?:java|ecma)script/i,ge={option:[1,""],thead:[1,"","
"],col:[2,"","
"],tr:[2,"","
"],td:[3,"","
"],_default:[0,"",""]};ge.optgroup=ge.option,ge.tbody=ge.tfoot=ge.colgroup=ge.caption=ge.thead,ge.th=ge.td;function ye(e,t){var n;return n="undefined"!=typeof e.getElementsByTagName?e.getElementsByTagName(t||"*"):"undefined"!=typeof e.querySelectorAll?e.querySelectorAll(t||"*"):[],void 0===t||t&&N(e,t)?w.merge([e],n):n}function ve(e,t){for(var n=0,r=e.length;n-1)i&&i.push(o);else if(l=w.contains(o.ownerDocument,o),a=ye(f.appendChild(o),"script"),l&&ve(a),n){c=0;while(o=a[c++])he.test(o.type||"")&&n.push(o)}return f}!function(){var e=r.createDocumentFragment().appendChild(r.createElement("div")),t=r.createElement("input");t.setAttribute("type","radio"),t.setAttribute("checked","checked"),t.setAttribute("name","t"),e.appendChild(t),h.checkClone=e.cloneNode(!0).cloneNode(!0).lastChild.checked,e.innerHTML="",h.noCloneChecked=!!e.cloneNode(!0).lastChild.defaultValue}();var be=r.documentElement,we=/^key/,Te=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,Ce=/^([^.]*)(?:\.(.+)|)/;function Ee(){return!0}function ke(){return!1}function Se(){try{return r.activeElement}catch(e){}}function De(e,t,n,r,i,o){var a,s;if("object"==typeof t){"string"!=typeof n&&(r=r||n,n=void 0);for(s in t)De(e,s,n,r,t[s],o);return e}if(null==r&&null==i?(i=n,r=n=void 0):null==i&&("string"==typeof n?(i=r,r=void 0):(i=r,r=n,n=void 0)),!1===i)i=ke;else if(!i)return e;return 1===o&&(a=i,(i=function(e){return w().off(e),a.apply(this,arguments)}).guid=a.guid||(a.guid=w.guid++)),e.each(function(){w.event.add(this,t,i,r,n)})}w.event={global:{},add:function(e,t,n,r,i){var o,a,s,u,l,c,f,p,d,h,g,y=J.get(e);if(y){n.handler&&(n=(o=n).handler,i=o.selector),i&&w.find.matchesSelector(be,i),n.guid||(n.guid=w.guid++),(u=y.events)||(u=y.events={}),(a=y.handle)||(a=y.handle=function(t){return"undefined"!=typeof w&&w.event.triggered!==t.type?w.event.dispatch.apply(e,arguments):void 0}),l=(t=(t||"").match(M)||[""]).length;while(l--)d=g=(s=Ce.exec(t[l])||[])[1],h=(s[2]||"").split(".").sort(),d&&(f=w.event.special[d]||{},d=(i?f.delegateType:f.bindType)||d,f=w.event.special[d]||{},c=w.extend({type:d,origType:g,data:r,handler:n,guid:n.guid,selector:i,needsContext:i&&w.expr.match.needsContext.test(i),namespace:h.join(".")},o),(p=u[d])||((p=u[d]=[]).delegateCount=0,f.setup&&!1!==f.setup.call(e,r,h,a)||e.addEventListener&&e.addEventListener(d,a)),f.add&&(f.add.call(e,c),c.handler.guid||(c.handler.guid=n.guid)),i?p.splice(p.delegateCount++,0,c):p.push(c),w.event.global[d]=!0)}},remove:function(e,t,n,r,i){var o,a,s,u,l,c,f,p,d,h,g,y=J.hasData(e)&&J.get(e);if(y&&(u=y.events)){l=(t=(t||"").match(M)||[""]).length;while(l--)if(s=Ce.exec(t[l])||[],d=g=s[1],h=(s[2]||"").split(".").sort(),d){f=w.event.special[d]||{},p=u[d=(r?f.delegateType:f.bindType)||d]||[],s=s[2]&&new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"),a=o=p.length;while(o--)c=p[o],!i&&g!==c.origType||n&&n.guid!==c.guid||s&&!s.test(c.namespace)||r&&r!==c.selector&&("**"!==r||!c.selector)||(p.splice(o,1),c.selector&&p.delegateCount--,f.remove&&f.remove.call(e,c));a&&!p.length&&(f.teardown&&!1!==f.teardown.call(e,h,y.handle)||w.removeEvent(e,d,y.handle),delete u[d])}else for(d in u)w.event.remove(e,d+t[l],n,r,!0);w.isEmptyObject(u)&&J.remove(e,"handle events")}},dispatch:function(e){var t=w.event.fix(e),n,r,i,o,a,s,u=new Array(arguments.length),l=(J.get(this,"events")||{})[t.type]||[],c=w.event.special[t.type]||{};for(u[0]=t,n=1;n=1))for(;l!==this;l=l.parentNode||this)if(1===l.nodeType&&("click"!==e.type||!0!==l.disabled)){for(o=[],a={},n=0;n-1:w.find(i,this,null,[l]).length),a[i]&&o.push(r);o.length&&s.push({elem:l,handlers:o})}return l=this,u\x20\t\r\n\f]*)[^>]*)\/>/gi,Ae=/\s*$/g;function Le(e,t){return N(e,"table")&&N(11!==t.nodeType?t:t.firstChild,"tr")?w(e).children("tbody")[0]||e:e}function He(e){return e.type=(null!==e.getAttribute("type"))+"/"+e.type,e}function Oe(e){return"true/"===(e.type||"").slice(0,5)?e.type=e.type.slice(5):e.removeAttribute("type"),e}function Pe(e,t){var n,r,i,o,a,s,u,l;if(1===t.nodeType){if(J.hasData(e)&&(o=J.access(e),a=J.set(t,o),l=o.events)){delete a.handle,a.events={};for(i in l)for(n=0,r=l[i].length;n1&&"string"==typeof y&&!h.checkClone&&je.test(y))return e.each(function(i){var o=e.eq(i);v&&(t[0]=y.call(this,i,o.html())),Re(o,t,n,r)});if(p&&(i=xe(t,e[0].ownerDocument,!1,e,r),o=i.firstChild,1===i.childNodes.length&&(i=o),o||r)){for(u=(s=w.map(ye(i,"script"),He)).length;f")},clone:function(e,t,n){var r,i,o,a,s=e.cloneNode(!0),u=w.contains(e.ownerDocument,e);if(!(h.noCloneChecked||1!==e.nodeType&&11!==e.nodeType||w.isXMLDoc(e)))for(a=ye(s),r=0,i=(o=ye(e)).length;r0&&ve(a,!u&&ye(e,"script")),s},cleanData:function(e){for(var t,n,r,i=w.event.special,o=0;void 0!==(n=e[o]);o++)if(Y(n)){if(t=n[J.expando]){if(t.events)for(r in t.events)i[r]?w.event.remove(n,r):w.removeEvent(n,r,t.handle);n[J.expando]=void 0}n[K.expando]&&(n[K.expando]=void 0)}}}),w.fn.extend({detach:function(e){return Ie(this,e,!0)},remove:function(e){return Ie(this,e)},text:function(e){return z(this,function(e){return void 0===e?w.text(this):this.empty().each(function(){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||(this.textContent=e)})},null,e,arguments.length)},append:function(){return Re(this,arguments,function(e){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||Le(this,e).appendChild(e)})},prepend:function(){return Re(this,arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=Le(this,e);t.insertBefore(e,t.firstChild)}})},before:function(){return Re(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this)})},after:function(){return Re(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this.nextSibling)})},empty:function(){for(var e,t=0;null!=(e=this[t]);t++)1===e.nodeType&&(w.cleanData(ye(e,!1)),e.textContent="");return this},clone:function(e,t){return e=null!=e&&e,t=null==t?e:t,this.map(function(){return w.clone(this,e,t)})},html:function(e){return z(this,function(e){var t=this[0]||{},n=0,r=this.length;if(void 0===e&&1===t.nodeType)return t.innerHTML;if("string"==typeof e&&!Ae.test(e)&&!ge[(de.exec(e)||["",""])[1].toLowerCase()]){e=w.htmlPrefilter(e);try{for(;n=0&&(u+=Math.max(0,Math.ceil(e["offset"+t[0].toUpperCase()+t.slice(1)]-o-u-s-.5))),u}function et(e,t,n){var r=$e(e),i=Fe(e,t,r),o="border-box"===w.css(e,"boxSizing",!1,r),a=o;if(We.test(i)){if(!n)return i;i="auto"}return a=a&&(h.boxSizingReliable()||i===e.style[t]),("auto"===i||!parseFloat(i)&&"inline"===w.css(e,"display",!1,r))&&(i=e["offset"+t[0].toUpperCase()+t.slice(1)],a=!0),(i=parseFloat(i)||0)+Ze(e,t,n||(o?"border":"content"),a,r,i)+"px"}w.extend({cssHooks:{opacity:{get:function(e,t){if(t){var n=Fe(e,"opacity");return""===n?"1":n}}}},cssNumber:{animationIterationCount:!0,columnCount:!0,fillOpacity:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{},style:function(e,t,n,r){if(e&&3!==e.nodeType&&8!==e.nodeType&&e.style){var i,o,a,s=G(t),u=Xe.test(t),l=e.style;if(u||(t=Je(s)),a=w.cssHooks[t]||w.cssHooks[s],void 0===n)return a&&"get"in a&&void 0!==(i=a.get(e,!1,r))?i:l[t];"string"==(o=typeof n)&&(i=ie.exec(n))&&i[1]&&(n=ue(e,t,i),o="number"),null!=n&&n===n&&("number"===o&&(n+=i&&i[3]||(w.cssNumber[s]?"":"px")),h.clearCloneStyle||""!==n||0!==t.indexOf("background")||(l[t]="inherit"),a&&"set"in a&&void 0===(n=a.set(e,n,r))||(u?l.setProperty(t,n):l[t]=n))}},css:function(e,t,n,r){var i,o,a,s=G(t);return Xe.test(t)||(t=Je(s)),(a=w.cssHooks[t]||w.cssHooks[s])&&"get"in a&&(i=a.get(e,!0,n)),void 0===i&&(i=Fe(e,t,r)),"normal"===i&&t in Ve&&(i=Ve[t]),""===n||n?(o=parseFloat(i),!0===n||isFinite(o)?o||0:i):i}}),w.each(["height","width"],function(e,t){w.cssHooks[t]={get:function(e,n,r){if(n)return!ze.test(w.css(e,"display"))||e.getClientRects().length&&e.getBoundingClientRect().width?et(e,t,r):se(e,Ue,function(){return et(e,t,r)})},set:function(e,n,r){var i,o=$e(e),a="border-box"===w.css(e,"boxSizing",!1,o),s=r&&Ze(e,t,r,a,o);return a&&h.scrollboxSize()===o.position&&(s-=Math.ceil(e["offset"+t[0].toUpperCase()+t.slice(1)]-parseFloat(o[t])-Ze(e,t,"border",!1,o)-.5)),s&&(i=ie.exec(n))&&"px"!==(i[3]||"px")&&(e.style[t]=n,n=w.css(e,t)),Ke(e,n,s)}}}),w.cssHooks.marginLeft=_e(h.reliableMarginLeft,function(e,t){if(t)return(parseFloat(Fe(e,"marginLeft"))||e.getBoundingClientRect().left-se(e,{marginLeft:0},function(){return e.getBoundingClientRect().left}))+"px"}),w.each({margin:"",padding:"",border:"Width"},function(e,t){w.cssHooks[e+t]={expand:function(n){for(var r=0,i={},o="string"==typeof n?n.split(" "):[n];r<4;r++)i[e+oe[r]+t]=o[r]||o[r-2]||o[0];return i}},"margin"!==e&&(w.cssHooks[e+t].set=Ke)}),w.fn.extend({css:function(e,t){return z(this,function(e,t,n){var r,i,o={},a=0;if(Array.isArray(t)){for(r=$e(e),i=t.length;a1)}});function tt(e,t,n,r,i){return new tt.prototype.init(e,t,n,r,i)}w.Tween=tt,tt.prototype={constructor:tt,init:function(e,t,n,r,i,o){this.elem=e,this.prop=n,this.easing=i||w.easing._default,this.options=t,this.start=this.now=this.cur(),this.end=r,this.unit=o||(w.cssNumber[n]?"":"px")},cur:function(){var e=tt.propHooks[this.prop];return e&&e.get?e.get(this):tt.propHooks._default.get(this)},run:function(e){var t,n=tt.propHooks[this.prop];return this.options.duration?this.pos=t=w.easing[this.easing](e,this.options.duration*e,0,1,this.options.duration):this.pos=t=e,this.now=(this.end-this.start)*t+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),n&&n.set?n.set(this):tt.propHooks._default.set(this),this}},tt.prototype.init.prototype=tt.prototype,tt.propHooks={_default:{get:function(e){var t;return 1!==e.elem.nodeType||null!=e.elem[e.prop]&&null==e.elem.style[e.prop]?e.elem[e.prop]:(t=w.css(e.elem,e.prop,""))&&"auto"!==t?t:0},set:function(e){w.fx.step[e.prop]?w.fx.step[e.prop](e):1!==e.elem.nodeType||null==e.elem.style[w.cssProps[e.prop]]&&!w.cssHooks[e.prop]?e.elem[e.prop]=e.now:w.style(e.elem,e.prop,e.now+e.unit)}}},tt.propHooks.scrollTop=tt.propHooks.scrollLeft={set:function(e){e.elem.nodeType&&e.elem.parentNode&&(e.elem[e.prop]=e.now)}},w.easing={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},_default:"swing"},w.fx=tt.prototype.init,w.fx.step={};var nt,rt,it=/^(?:toggle|show|hide)$/,ot=/queueHooks$/;function at(){rt&&(!1===r.hidden&&e.requestAnimationFrame?e.requestAnimationFrame(at):e.setTimeout(at,w.fx.interval),w.fx.tick())}function st(){return e.setTimeout(function(){nt=void 0}),nt=Date.now()}function ut(e,t){var n,r=0,i={height:e};for(t=t?1:0;r<4;r+=2-t)i["margin"+(n=oe[r])]=i["padding"+n]=e;return t&&(i.opacity=i.width=e),i}function lt(e,t,n){for(var r,i=(pt.tweeners[t]||[]).concat(pt.tweeners["*"]),o=0,a=i.length;o1)},removeAttr:function(e){return this.each(function(){w.removeAttr(this,e)})}}),w.extend({attr:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return"undefined"==typeof e.getAttribute?w.prop(e,t,n):(1===o&&w.isXMLDoc(e)||(i=w.attrHooks[t.toLowerCase()]||(w.expr.match.bool.test(t)?dt:void 0)),void 0!==n?null===n?void w.removeAttr(e,t):i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:(e.setAttribute(t,n+""),n):i&&"get"in i&&null!==(r=i.get(e,t))?r:null==(r=w.find.attr(e,t))?void 0:r)},attrHooks:{type:{set:function(e,t){if(!h.radioValue&&"radio"===t&&N(e,"input")){var n=e.value;return e.setAttribute("type",t),n&&(e.value=n),t}}}},removeAttr:function(e,t){var n,r=0,i=t&&t.match(M);if(i&&1===e.nodeType)while(n=i[r++])e.removeAttribute(n)}}),dt={set:function(e,t,n){return!1===t?w.removeAttr(e,n):e.setAttribute(n,n),n}},w.each(w.expr.match.bool.source.match(/\w+/g),function(e,t){var n=ht[t]||w.find.attr;ht[t]=function(e,t,r){var i,o,a=t.toLowerCase();return r||(o=ht[a],ht[a]=i,i=null!=n(e,t,r)?a:null,ht[a]=o),i}});var gt=/^(?:input|select|textarea|button)$/i,yt=/^(?:a|area)$/i;w.fn.extend({prop:function(e,t){return z(this,w.prop,e,t,arguments.length>1)},removeProp:function(e){return this.each(function(){delete this[w.propFix[e]||e]})}}),w.extend({prop:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return 1===o&&w.isXMLDoc(e)||(t=w.propFix[t]||t,i=w.propHooks[t]),void 0!==n?i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:e[t]=n:i&&"get"in i&&null!==(r=i.get(e,t))?r:e[t]},propHooks:{tabIndex:{get:function(e){var t=w.find.attr(e,"tabindex");return t?parseInt(t,10):gt.test(e.nodeName)||yt.test(e.nodeName)&&e.href?0:-1}}},propFix:{"for":"htmlFor","class":"className"}}),h.optSelected||(w.propHooks.selected={get:function(e){var t=e.parentNode;return t&&t.parentNode&&t.parentNode.selectedIndex,null},set:function(e){var t=e.parentNode;t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex)}}),w.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){w.propFix[this.toLowerCase()]=this});function vt(e){return(e.match(M)||[]).join(" ")}function mt(e){return e.getAttribute&&e.getAttribute("class")||""}function xt(e){return Array.isArray(e)?e:"string"==typeof e?e.match(M)||[]:[]}w.fn.extend({addClass:function(e){var t,n,r,i,o,a,s,u=0;if(g(e))return this.each(function(t){w(this).addClass(e.call(this,t,mt(this)))});if((t=xt(e)).length)while(n=this[u++])if(i=mt(n),r=1===n.nodeType&&" "+vt(i)+" "){a=0;while(o=t[a++])r.indexOf(" "+o+" ")<0&&(r+=o+" ");i!==(s=vt(r))&&n.setAttribute("class",s)}return this},removeClass:function(e){var t,n,r,i,o,a,s,u=0;if(g(e))return this.each(function(t){w(this).removeClass(e.call(this,t,mt(this)))});if(!arguments.length)return this.attr("class","");if((t=xt(e)).length)while(n=this[u++])if(i=mt(n),r=1===n.nodeType&&" "+vt(i)+" "){a=0;while(o=t[a++])while(r.indexOf(" "+o+" ")>-1)r=r.replace(" "+o+" "," ");i!==(s=vt(r))&&n.setAttribute("class",s)}return this},toggleClass:function(e,t){var n=typeof e,r="string"===n||Array.isArray(e);return"boolean"==typeof t&&r?t?this.addClass(e):this.removeClass(e):g(e)?this.each(function(n){w(this).toggleClass(e.call(this,n,mt(this),t),t)}):this.each(function(){var t,i,o,a;if(r){i=0,o=w(this),a=xt(e);while(t=a[i++])o.hasClass(t)?o.removeClass(t):o.addClass(t)}else void 0!==e&&"boolean"!==n||((t=mt(this))&&J.set(this,"__className__",t),this.setAttribute&&this.setAttribute("class",t||!1===e?"":J.get(this,"__className__")||""))})},hasClass:function(e){var t,n,r=0;t=" "+e+" ";while(n=this[r++])if(1===n.nodeType&&(" "+vt(mt(n))+" ").indexOf(t)>-1)return!0;return!1}});var bt=/\r/g;w.fn.extend({val:function(e){var t,n,r,i=this[0];{if(arguments.length)return r=g(e),this.each(function(n){var i;1===this.nodeType&&(null==(i=r?e.call(this,n,w(this).val()):e)?i="":"number"==typeof i?i+="":Array.isArray(i)&&(i=w.map(i,function(e){return null==e?"":e+""})),(t=w.valHooks[this.type]||w.valHooks[this.nodeName.toLowerCase()])&&"set"in t&&void 0!==t.set(this,i,"value")||(this.value=i))});if(i)return(t=w.valHooks[i.type]||w.valHooks[i.nodeName.toLowerCase()])&&"get"in t&&void 0!==(n=t.get(i,"value"))?n:"string"==typeof(n=i.value)?n.replace(bt,""):null==n?"":n}}}),w.extend({valHooks:{option:{get:function(e){var t=w.find.attr(e,"value");return null!=t?t:vt(w.text(e))}},select:{get:function(e){var t,n,r,i=e.options,o=e.selectedIndex,a="select-one"===e.type,s=a?null:[],u=a?o+1:i.length;for(r=o<0?u:a?o:0;r-1)&&(n=!0);return n||(e.selectedIndex=-1),o}}}}),w.each(["radio","checkbox"],function(){w.valHooks[this]={set:function(e,t){if(Array.isArray(t))return e.checked=w.inArray(w(e).val(),t)>-1}},h.checkOn||(w.valHooks[this].get=function(e){return null===e.getAttribute("value")?"on":e.value})}),h.focusin="onfocusin"in e;var wt=/^(?:focusinfocus|focusoutblur)$/,Tt=function(e){e.stopPropagation()};w.extend(w.event,{trigger:function(t,n,i,o){var a,s,u,l,c,p,d,h,v=[i||r],m=f.call(t,"type")?t.type:t,x=f.call(t,"namespace")?t.namespace.split("."):[];if(s=h=u=i=i||r,3!==i.nodeType&&8!==i.nodeType&&!wt.test(m+w.event.triggered)&&(m.indexOf(".")>-1&&(m=(x=m.split(".")).shift(),x.sort()),c=m.indexOf(":")<0&&"on"+m,t=t[w.expando]?t:new w.Event(m,"object"==typeof t&&t),t.isTrigger=o?2:3,t.namespace=x.join("."),t.rnamespace=t.namespace?new RegExp("(^|\\.)"+x.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,t.result=void 0,t.target||(t.target=i),n=null==n?[t]:w.makeArray(n,[t]),d=w.event.special[m]||{},o||!d.trigger||!1!==d.trigger.apply(i,n))){if(!o&&!d.noBubble&&!y(i)){for(l=d.delegateType||m,wt.test(l+m)||(s=s.parentNode);s;s=s.parentNode)v.push(s),u=s;u===(i.ownerDocument||r)&&v.push(u.defaultView||u.parentWindow||e)}a=0;while((s=v[a++])&&!t.isPropagationStopped())h=s,t.type=a>1?l:d.bindType||m,(p=(J.get(s,"events")||{})[t.type]&&J.get(s,"handle"))&&p.apply(s,n),(p=c&&s[c])&&p.apply&&Y(s)&&(t.result=p.apply(s,n),!1===t.result&&t.preventDefault());return t.type=m,o||t.isDefaultPrevented()||d._default&&!1!==d._default.apply(v.pop(),n)||!Y(i)||c&&g(i[m])&&!y(i)&&((u=i[c])&&(i[c]=null),w.event.triggered=m,t.isPropagationStopped()&&h.addEventListener(m,Tt),i[m](),t.isPropagationStopped()&&h.removeEventListener(m,Tt),w.event.triggered=void 0,u&&(i[c]=u)),t.result}},simulate:function(e,t,n){var r=w.extend(new w.Event,n,{type:e,isSimulated:!0});w.event.trigger(r,null,t)}}),w.fn.extend({trigger:function(e,t){return this.each(function(){w.event.trigger(e,t,this)})},triggerHandler:function(e,t){var n=this[0];if(n)return w.event.trigger(e,t,n,!0)}}),h.focusin||w.each({focus:"focusin",blur:"focusout"},function(e,t){var n=function(e){w.event.simulate(t,e.target,w.event.fix(e))};w.event.special[t]={setup:function(){var r=this.ownerDocument||this,i=J.access(r,t);i||r.addEventListener(e,n,!0),J.access(r,t,(i||0)+1)},teardown:function(){var r=this.ownerDocument||this,i=J.access(r,t)-1;i?J.access(r,t,i):(r.removeEventListener(e,n,!0),J.remove(r,t))}}});var Ct=e.location,Et=Date.now(),kt=/\?/;w.parseXML=function(t){var n;if(!t||"string"!=typeof t)return null;try{n=(new e.DOMParser).parseFromString(t,"text/xml")}catch(e){n=void 0}return n&&!n.getElementsByTagName("parsererror").length||w.error("Invalid XML: "+t),n};var St=/\[\]$/,Dt=/\r?\n/g,Nt=/^(?:submit|button|image|reset|file)$/i,At=/^(?:input|select|textarea|keygen)/i;function jt(e,t,n,r){var i;if(Array.isArray(t))w.each(t,function(t,i){n||St.test(e)?r(e,i):jt(e+"["+("object"==typeof i&&null!=i?t:"")+"]",i,n,r)});else if(n||"object"!==x(t))r(e,t);else for(i in t)jt(e+"["+i+"]",t[i],n,r)}w.param=function(e,t){var n,r=[],i=function(e,t){var n=g(t)?t():t;r[r.length]=encodeURIComponent(e)+"="+encodeURIComponent(null==n?"":n)};if(Array.isArray(e)||e.jquery&&!w.isPlainObject(e))w.each(e,function(){i(this.name,this.value)});else for(n in e)jt(n,e[n],t,i);return r.join("&")},w.fn.extend({serialize:function(){return w.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var e=w.prop(this,"elements");return e?w.makeArray(e):this}).filter(function(){var e=this.type;return this.name&&!w(this).is(":disabled")&&At.test(this.nodeName)&&!Nt.test(e)&&(this.checked||!pe.test(e))}).map(function(e,t){var n=w(this).val();return null==n?null:Array.isArray(n)?w.map(n,function(e){return{name:t.name,value:e.replace(Dt,"\r\n")}}):{name:t.name,value:n.replace(Dt,"\r\n")}}).get()}});var qt=/%20/g,Lt=/#.*$/,Ht=/([?&])_=[^&]*/,Ot=/^(.*?):[ \t]*([^\r\n]*)$/gm,Pt=/^(?:about|app|app-storage|.+-extension|file|res|widget):$/,Mt=/^(?:GET|HEAD)$/,Rt=/^\/\//,It={},Wt={},$t="*/".concat("*"),Bt=r.createElement("a");Bt.href=Ct.href;function Ft(e){return function(t,n){"string"!=typeof t&&(n=t,t="*");var r,i=0,o=t.toLowerCase().match(M)||[];if(g(n))while(r=o[i++])"+"===r[0]?(r=r.slice(1)||"*",(e[r]=e[r]||[]).unshift(n)):(e[r]=e[r]||[]).push(n)}}function _t(e,t,n,r){var i={},o=e===Wt;function a(s){var u;return i[s]=!0,w.each(e[s]||[],function(e,s){var l=s(t,n,r);return"string"!=typeof l||o||i[l]?o?!(u=l):void 0:(t.dataTypes.unshift(l),a(l),!1)}),u}return a(t.dataTypes[0])||!i["*"]&&a("*")}function zt(e,t){var n,r,i=w.ajaxSettings.flatOptions||{};for(n in t)void 0!==t[n]&&((i[n]?e:r||(r={}))[n]=t[n]);return r&&w.extend(!0,e,r),e}function Xt(e,t,n){var r,i,o,a,s=e.contents,u=e.dataTypes;while("*"===u[0])u.shift(),void 0===r&&(r=e.mimeType||t.getResponseHeader("Content-Type"));if(r)for(i in s)if(s[i]&&s[i].test(r)){u.unshift(i);break}if(u[0]in n)o=u[0];else{for(i in n){if(!u[0]||e.converters[i+" "+u[0]]){o=i;break}a||(a=i)}o=o||a}if(o)return o!==u[0]&&u.unshift(o),n[o]}function Ut(e,t,n,r){var i,o,a,s,u,l={},c=e.dataTypes.slice();if(c[1])for(a in e.converters)l[a.toLowerCase()]=e.converters[a];o=c.shift();while(o)if(e.responseFields[o]&&(n[e.responseFields[o]]=t),!u&&r&&e.dataFilter&&(t=e.dataFilter(t,e.dataType)),u=o,o=c.shift())if("*"===o)o=u;else if("*"!==u&&u!==o){if(!(a=l[u+" "+o]||l["* "+o]))for(i in l)if((s=i.split(" "))[1]===o&&(a=l[u+" "+s[0]]||l["* "+s[0]])){!0===a?a=l[i]:!0!==l[i]&&(o=s[0],c.unshift(s[1]));break}if(!0!==a)if(a&&e["throws"])t=a(t);else try{t=a(t)}catch(e){return{state:"parsererror",error:a?e:"No conversion from "+u+" to "+o}}}return{state:"success",data:t}}w.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:Ct.href,type:"GET",isLocal:Pt.test(Ct.protocol),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":$t,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":JSON.parse,"text xml":w.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(e,t){return t?zt(zt(e,w.ajaxSettings),t):zt(w.ajaxSettings,e)},ajaxPrefilter:Ft(It),ajaxTransport:Ft(Wt),ajax:function(t,n){"object"==typeof t&&(n=t,t=void 0),n=n||{};var i,o,a,s,u,l,c,f,p,d,h=w.ajaxSetup({},n),g=h.context||h,y=h.context&&(g.nodeType||g.jquery)?w(g):w.event,v=w.Deferred(),m=w.Callbacks("once memory"),x=h.statusCode||{},b={},T={},C="canceled",E={readyState:0,getResponseHeader:function(e){var t;if(c){if(!s){s={};while(t=Ot.exec(a))s[t[1].toLowerCase()]=t[2]}t=s[e.toLowerCase()]}return null==t?null:t},getAllResponseHeaders:function(){return c?a:null},setRequestHeader:function(e,t){return null==c&&(e=T[e.toLowerCase()]=T[e.toLowerCase()]||e,b[e]=t),this},overrideMimeType:function(e){return null==c&&(h.mimeType=e),this},statusCode:function(e){var t;if(e)if(c)E.always(e[E.status]);else for(t in e)x[t]=[x[t],e[t]];return this},abort:function(e){var t=e||C;return i&&i.abort(t),k(0,t),this}};if(v.promise(E),h.url=((t||h.url||Ct.href)+"").replace(Rt,Ct.protocol+"//"),h.type=n.method||n.type||h.method||h.type,h.dataTypes=(h.dataType||"*").toLowerCase().match(M)||[""],null==h.crossDomain){l=r.createElement("a");try{l.href=h.url,l.href=l.href,h.crossDomain=Bt.protocol+"//"+Bt.host!=l.protocol+"//"+l.host}catch(e){h.crossDomain=!0}}if(h.data&&h.processData&&"string"!=typeof h.data&&(h.data=w.param(h.data,h.traditional)),_t(It,h,n,E),c)return E;(f=w.event&&h.global)&&0==w.active++&&w.event.trigger("ajaxStart"),h.type=h.type.toUpperCase(),h.hasContent=!Mt.test(h.type),o=h.url.replace(Lt,""),h.hasContent?h.data&&h.processData&&0===(h.contentType||"").indexOf("application/x-www-form-urlencoded")&&(h.data=h.data.replace(qt,"+")):(d=h.url.slice(o.length),h.data&&(h.processData||"string"==typeof h.data)&&(o+=(kt.test(o)?"&":"?")+h.data,delete h.data),!1===h.cache&&(o=o.replace(Ht,"$1"),d=(kt.test(o)?"&":"?")+"_="+Et+++d),h.url=o+d),h.ifModified&&(w.lastModified[o]&&E.setRequestHeader("If-Modified-Since",w.lastModified[o]),w.etag[o]&&E.setRequestHeader("If-None-Match",w.etag[o])),(h.data&&h.hasContent&&!1!==h.contentType||n.contentType)&&E.setRequestHeader("Content-Type",h.contentType),E.setRequestHeader("Accept",h.dataTypes[0]&&h.accepts[h.dataTypes[0]]?h.accepts[h.dataTypes[0]]+("*"!==h.dataTypes[0]?", "+$t+"; q=0.01":""):h.accepts["*"]);for(p in h.headers)E.setRequestHeader(p,h.headers[p]);if(h.beforeSend&&(!1===h.beforeSend.call(g,E,h)||c))return E.abort();if(C="abort",m.add(h.complete),E.done(h.success),E.fail(h.error),i=_t(Wt,h,n,E)){if(E.readyState=1,f&&y.trigger("ajaxSend",[E,h]),c)return E;h.async&&h.timeout>0&&(u=e.setTimeout(function(){E.abort("timeout")},h.timeout));try{c=!1,i.send(b,k)}catch(e){if(c)throw e;k(-1,e)}}else k(-1,"No Transport");function k(t,n,r,s){var l,p,d,b,T,C=n;c||(c=!0,u&&e.clearTimeout(u),i=void 0,a=s||"",E.readyState=t>0?4:0,l=t>=200&&t<300||304===t,r&&(b=Xt(h,E,r)),b=Ut(h,b,E,l),l?(h.ifModified&&((T=E.getResponseHeader("Last-Modified"))&&(w.lastModified[o]=T),(T=E.getResponseHeader("etag"))&&(w.etag[o]=T)),204===t||"HEAD"===h.type?C="nocontent":304===t?C="notmodified":(C=b.state,p=b.data,l=!(d=b.error))):(d=C,!t&&C||(C="error",t<0&&(t=0))),E.status=t,E.statusText=(n||C)+"",l?v.resolveWith(g,[p,C,E]):v.rejectWith(g,[E,C,d]),E.statusCode(x),x=void 0,f&&y.trigger(l?"ajaxSuccess":"ajaxError",[E,h,l?p:d]),m.fireWith(g,[E,C]),f&&(y.trigger("ajaxComplete",[E,h]),--w.active||w.event.trigger("ajaxStop")))}return E},getJSON:function(e,t,n){return w.get(e,t,n,"json")},getScript:function(e,t){return w.get(e,void 0,t,"script")}}),w.each(["get","post"],function(e,t){w[t]=function(e,n,r,i){return g(n)&&(i=i||r,r=n,n=void 0),w.ajax(w.extend({url:e,type:t,dataType:i,data:n,success:r},w.isPlainObject(e)&&e))}}),w._evalUrl=function(e){return w.ajax({url:e,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,"throws":!0})},w.fn.extend({wrapAll:function(e){var t;return this[0]&&(g(e)&&(e=e.call(this[0])),t=w(e,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&t.insertBefore(this[0]),t.map(function(){var e=this;while(e.firstElementChild)e=e.firstElementChild;return e}).append(this)),this},wrapInner:function(e){return g(e)?this.each(function(t){w(this).wrapInner(e.call(this,t))}):this.each(function(){var t=w(this),n=t.contents();n.length?n.wrapAll(e):t.append(e)})},wrap:function(e){var t=g(e);return this.each(function(n){w(this).wrapAll(t?e.call(this,n):e)})},unwrap:function(e){return this.parent(e).not("body").each(function(){w(this).replaceWith(this.childNodes)}),this}}),w.expr.pseudos.hidden=function(e){return!w.expr.pseudos.visible(e)},w.expr.pseudos.visible=function(e){return!!(e.offsetWidth||e.offsetHeight||e.getClientRects().length)},w.ajaxSettings.xhr=function(){try{return new e.XMLHttpRequest}catch(e){}};var Vt={0:200,1223:204},Gt=w.ajaxSettings.xhr();h.cors=!!Gt&&"withCredentials"in Gt,h.ajax=Gt=!!Gt,w.ajaxTransport(function(t){var n,r;if(h.cors||Gt&&!t.crossDomain)return{send:function(i,o){var a,s=t.xhr();if(s.open(t.type,t.url,t.async,t.username,t.password),t.xhrFields)for(a in t.xhrFields)s[a]=t.xhrFields[a];t.mimeType&&s.overrideMimeType&&s.overrideMimeType(t.mimeType),t.crossDomain||i["X-Requested-With"]||(i["X-Requested-With"]="XMLHttpRequest");for(a in i)s.setRequestHeader(a,i[a]);n=function(e){return function(){n&&(n=r=s.onload=s.onerror=s.onabort=s.ontimeout=s.onreadystatechange=null,"abort"===e?s.abort():"error"===e?"number"!=typeof s.status?o(0,"error"):o(s.status,s.statusText):o(Vt[s.status]||s.status,s.statusText,"text"!==(s.responseType||"text")||"string"!=typeof s.responseText?{binary:s.response}:{text:s.responseText},s.getAllResponseHeaders()))}},s.onload=n(),r=s.onerror=s.ontimeout=n("error"),void 0!==s.onabort?s.onabort=r:s.onreadystatechange=function(){4===s.readyState&&e.setTimeout(function(){n&&r()})},n=n("abort");try{s.send(t.hasContent&&t.data||null)}catch(e){if(n)throw e}},abort:function(){n&&n()}}}),w.ajaxPrefilter(function(e){e.crossDomain&&(e.contents.script=!1)}),w.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(e){return w.globalEval(e),e}}}),w.ajaxPrefilter("script",function(e){void 0===e.cache&&(e.cache=!1),e.crossDomain&&(e.type="GET")}),w.ajaxTransport("script",function(e){if(e.crossDomain){var t,n;return{send:function(i,o){t=w("